/** * Lightcase - jQuery Plugin * The smart and flexible Lightbox Plugin. * * @author Cornel Boppart * @copyright Author * * @version 2.5.0 (11/03/2018) */ /** * Lightcase settings * * Note: Override default settings for your project without touching this source code by simply * defining those variables within a SASS map called '$lightcase-custom'. * * // Example usage * $lightcase-custom: ( * 'breakpoint': 768px * ); */ @font-face { font-family: 'lightcase'; src: url(/wp-content/themes/methodist/dist/vendor/_/_/node_modules/lightcase/src/fonts/lightcase.eot); src: url(/wp-content/themes/methodist/dist/vendor/_/_/node_modules/lightcase/src/fonts/lightcase.eot#iefix) format("embedded-opentype"), url(data:font/woff;base64,d09GRgABAAAAAAxYAA4AAAAAFiQAAQAAAAAAAAAAAAAAAAAAAAAAAAAAAABPUy8yAAABRAAAAEQAAABWPihJfGNtYXAAAAGIAAAAOgAAAUrQFhm3Y3Z0IAAAAcQAAAAKAAAACgAAAABmcGdtAAAB0AAABZQAAAtwiJCQWWdhc3AAAAdkAAAACAAAAAgAAAAQZ2x5ZgAAB2wAAAIlAAADvPBL4i9oZWFkAAAJlAAAADQAAAA2BUgyI2hoZWEAAAnIAAAAHQAAACQHlgNaaG10eAAACegAAAAPAAAAHBtYAABsb2NhAAAJ+AAAABAAAAAQA0gEDm1heHAAAAoIAAAAIAAAACAAnQu3bmFtZQAACigAAAGBAAAC2Yr/NNNwb3N0AAALrAAAAEEAAABS/NgGm3ByZXAAAAvwAAAAZQAAAHvdawOFeJxjYGR+wTiBgZWBg6mKaQ8DA0MPhGZ8wGDIyMTAwMTAysyAFQSkuaYwOLxgeMHKHPQ/iyGKOYhhGlCYESQHAA00DCJ4nGNgYGBmgGAZBkYGEHAB8hjBfBYGDSDNBqQZGZgYGF6w/v8PUvCCAURLMELVAwEjG8OIBwBpWAazAAAAAAAAAAAAAAAAAAB4nK1WaXMTRxCd1WHLNj6CDxI2gVnGcox2VpjLCBDG7EoW4BzylexCjl1Ldu6LT/wG/ZpekVSRb/y0vB4d2GAnVVQoSv2m9+1M9+ueXpPQksReWI+k3HwpprY2aWTnSUg3bFqO4kPZ2QspU0z+LoiCaLXUvu04JCISgap1hSWC2PfI0iTjQ48yWrYlvWpSbulJd9kaD+qt+vbT0FGO3QklNZuhQ+uRLanCqBJFMu2RkjYtw9VfSVrh5yvMfNUMJYLoJJLGm2EMj+Rn44xWGa3GdhxFkU2WG0WKRDM8iCKPslpin1wxQUD5oBlSXvk0onyEH5EVe5TTCnHJdprf9yU/6R3OvyTieouyJQf+QHZkB3unK/ki0toK46adbEehivB0fSfEI5uT6p/sUV7TaOB2RaYnzQiWyleQWPkJZfYPyWrhfMqXPBrVkoOcCFovc2Jf8g60HkdMiWsmyILujk6IoO6XnKHYY/q4+OO9XSwXIQTIOJb1jkq4EEYpYbOaJG0EOYiSskWV1HpHTJzyOi3iLWG/Tu3oS2e0Sag7MZ6th46tnKjkeDSp00ymTu2k5tGUBlFKOhM85tcBlB/RJK+2sZrEyqNpbDNjJJFQoIVzaSqIZSeWNAXRPJrRm7thmmvXokWaPFDPPXpPb26Fmzs9p+3AP2v8Z3UqpoO9MJ2eDshKfJp2uUnRun56hn8m8UPWAiqRLTbDlMVDtn4H5eVjS47CawNs957zK+h99kTIpIH4G/AeL9UpBUyFmFVQC9201rUsy9RqVotUZOq7IU0rX9ZpAk05Dn1jX8Y4/q+ZGUtMCd/vxOnZEZeeufYlyDSH3GZdj+Z1arFdgM5sz+k0y/Z9nebYfqDTPNvzOh1ha+t0lO2HOi2w/UinY2wvaEGT7jsEchGBXMAGEoGwdRAI20sIhK1CIGwXEQjbIgJhu4RA2H6MQNguIxC2l7Wsmn4qaRw7E8sARYgDoznuyGVuKldTyaUSrotGpzbkKXKrpKJ4Vv0rA/3ikTesgbVAukTW/IpJrnxUleOPrmh508S5Ao5Vf3tzXJ8TD2W/WPhT8L/amqqkV6x5ZHIVeSPQk+NE1yYVj67p8rmqR9f/i4oOa4F+A6UQC0VZlg2+mZDwUafTUA1c5RAzGzMP1/W6Zc3P4fybGCEL6H78NxQaC9yDTllJWe1gr9XXj2W5twflsCdYkmK+zOtb4YuMzEr7RWYpez7yecAVMCqVYasNXK3gzXsS85DpTfJMELcVZYOkjceZILGBYx4wb76TICRMXbWB2imcsIG8YMwp2O+EQ1RvlOVwe6F9Ho2Uf2tX7MgZFU0Q+G32Rtjrs1DyW6yBhCe/1NdAVSFNxbipgEsj5YZq8GFcrdtGMk6gr6jYDcuyig8fR9x3So5lIPlIEatHRz+tvUKd1Ln9yihu3zv9CIJBaWL+9r6Z4qCUd7WSZVZtA1O3GpVT15rDxasO3c2j7nvH2Sdy1jTddE/c9L6mVbeDg7lZEO3bHJSlTC6o68MOG6jLzaXQ6mVckt52DzAsMKDfoRUb/1f3cfg8V6oKo+NIvZ2oH6PPYgzyDzh/R/UF6OcxTLmGlOd7lxOfbtzD2TJdxV2sn+LfwKy15mbpGnBD0w2Yh6xaHbrKDXynBjo90tyO9BDwse4K8QBgE8Bi8InuWsbzKYDxfMYcH+Bz5jBoMofBFnMYbDNnDWCHOQx2mcNgjzkMvmDOOsCXzGEQModBxBwGT5gTADxlDoOvmMPga+Yw+IY59wG+ZQ6DmDkMEuYw2Nd0ayhzixd0F6htUBXowPQTFvewONRUGbK/44Vhf28Qs38wiKk/aro9pP7EC0P92SCm/mIQU3/VdGdI/Y0Xhvq7QUz9wyCmPtMvxnKZwV9GvkuFA8ouNp/z98T7B8IaQLYAAQAB//8AD3ichZI/b9NQEMDv8nLv1c92mpDIFomqQJLaQ1Ugf5ogMQQGVqT2CzAiwUdAFWuyMMGQTmVwvwBCrCzJ1AllZ0BtGRgZiFQM9xI7NRIqkRzds+7e/X7ngzzA7+fimzgAG3xoQw/ch7rbCW/ecCTkd3dQgvLA78MgABFAyAEfJcfNew3VlKpU8T2/43fvY7szxH4vVHs+/pjH50RYnc+xRhSfzafxTz5vTGeo+Lz4TgpzeQtRqBw/FBEdH4oDkzmPzzizZiovh5mS2Sxe5F4Rkh1/yAspkCLp0mhxCPC3w23YNQ472/Xq/xxKshGWev2OxxayGaxiA79GWMJzZz6rWULyGG+hLugvWhXR2tT/xF4nL7GfxafFIvaU1io+3bBwFYNg7hfiQuxDDULogv7YZuoyCUZWvleRjbuoZCPoDTEMGK2OA+arEOukFiZI7XJvRiOyCnI0poKm8Zi0K8cj6Wp8QvF5hrC6xWDT1GqKCi8427VNje1SJn599R2rZC7JWJliyDiY2Yfs0NoyYxfXjD11C3hf2Ce7LUmXKzTT7eVkYlwiy4pkwRL7K5t1yeUjzl2vyZTn/fRowtoUOc4JS1zHSEu61QjLS7rVaMuDMBj06+hVNpGXJGDGhC1tnLClY2RGy3IcXuSICqTfZnW4RHxK2Chh/fXuaOI4tm2W+ITIAf6h+VvusQL5ngB5hk3G2fP4bcvc9BXv4ANzbUvGn/8AB6z3lgAAAHicY2BkYGAA4ksvig/E89t8ZeBmfgEUYbio0BMJoZM0GRj+ZzG/YA4CcjkYmECiAF+8C4p4nGNgZGBgDvqfxRDF/IIBCIAkIwMqYAcAZnkD+AAAAHicY37BwMCMAwMAYJQGbgAAAAAAAGIAvgEgAXIBxgHeAAEAAAAHADUABAAAAAAAAgAAABAAcwAAAB4LcAAAAAB4nHWRv07DMBDGP0MpgkoMVGL2AgIhpW0QSweEVBU2BoYyh+D8KUkcOW6lTLwF78ADsfIsfElNhPiT6JzffXfnOzsADvEBgc1zSduwwB69DW9hF1eOt6nPHffId453MMCD4z71R8f7OMez4wGGeOUOordHb4k3xwKHYuh4Cwfi2PE29QvHPfLc8Q6OxIPjPvXc8T4W4sXxACfifabL2qRxYuXp7Ez648mlfKylppQWQSaDlU20qeS1jHRhVZZpL9R51hSEQaXuVbzKAtP5HSyUqVJdyIk37rRbVSgTWPXUdKjWsW9tJCOjc3nj9pal0UsVWi+xtpyORt97YgaNEjUMUsRIYCFxSvWMXx9jTPgzJC+15qpdVooCATIqAVasSNpIRf+aFtErqCpmZGQPIdec/NUhZF3F+D0t5g4ZffNH/LeyoDWd0raH5HQeZ/ydd0sr2tygneSpO0OFNXN9qpaTNtOadjqJmx9zS95LE1tSCal7bQdLdYoR33/O+Ql1xYc7AAAAeJxjYGKAAC4G7ICdgYGRiZGZkYWRlZGNkZ2lICexkrUgsbQ4lTU5J784laWgKLWMJS+1ooSluCAzj4EBANRsC28AAAB4nGPw3sFwIihiIyNjX+QGxp0cDBwMyQUbGVidNjIwaEFoDhR6JwMDAycyi5nBZaMKY0dgxAaHjoiNzCkuG9VAvF0cDQyMLA4dySERICWRQLCRgUdrB+P/1g0svRuZGFwAB9MiuAAAAA==) format("woff"), url(/wp-content/themes/methodist/dist/vendor/_/_/node_modules/lightcase/src/fonts/lightcase.ttf) format("truetype"), url(data:image/svg+xml;base64,PD94bWwgdmVyc2lvbj0iMS4wIiBzdGFuZGFsb25lPSJubyI/Pgo8IURPQ1RZUEUgc3ZnIFBVQkxJQyAiLS8vVzNDLy9EVEQgU1ZHIDEuMS8vRU4iICJodHRwOi8vd3d3LnczLm9yZy9HcmFwaGljcy9TVkcvMS4xL0RURC9zdmcxMS5kdGQiPgo8c3ZnIHhtbG5zPSJodHRwOi8vd3d3LnczLm9yZy8yMDAwL3N2ZyI+CjxtZXRhZGF0YT5Db3B5cmlnaHQgKEMpIDIwMTUgYnkgb3JpZ2luYWwgYXV0aG9ycyBAIGZvbnRlbGxvLmNvbTwvbWV0YWRhdGE+CjxkZWZzPgo8Zm9udCBpZD0ibGlnaHRjYXNlIiBob3Jpei1hZHYteD0iMTAwMCIgPgo8Zm9udC1mYWNlIGZvbnQtZmFtaWx5PSJsaWdodGNhc2UiIGZvbnQtd2VpZ2h0PSI0MDAiIGZvbnQtc3RyZXRjaD0ibm9ybWFsIiB1bml0cy1wZXItZW09IjEwMDAiIGFzY2VudD0iODUwIiBkZXNjZW50PSItMTUwIiAvPgo8bWlzc2luZy1nbHlwaCBob3Jpei1hZHYteD0iMTAwMCIgLz4KPGdseXBoIGdseXBoLW5hbWU9InBsYXkiIHVuaWNvZGU9IiYjeGU4MDA7IiBkPSJtNTAwIDg1MGMtMjc1IDAtNDk5LTIyNC00OTktNTAwIDAtMjc1IDIyNC01MDAgNDk5LTUwMHM1MDAgMjI1IDUwMCA1MDBjMCAyNzYtMjI0IDUwMC01MDAgNTAweiBtMC05NjZjLTI1NiAwLTQ2NiAyMTAtNDY2IDQ2NiAwIDI1NyAyMTAgNDY2IDQ2NiA0NjYgMjU3IDAgNDY2LTIwOSA0NjYtNDY2IDAtMjU3LTIwOS00NjYtNDY2LTQ2NnogbS0zOCA2NDRjLTMgMy04IDUtMTIgNSAwIDAgMCAwIDAgMC0xIDAtMiAwLTMtMS0xIDAtMiAwLTQgMC02LTMtMTAtOS0xMC0xNnYtMzMxIDBjMC0zIDAtNSAxLTcgMi00IDUtNyAxMC05IDEgMCAyIDAgMy0xIDEgMCAyIDAgMyAwIDAgMCAwIDAgMCAwIDAgMCAwIDAgMCAwIDQgMCA5IDEgMTIgNWwxNjUgMTY1YzcgNyA3IDE4IDAgMjRsLTE2NSAxNjZ6IG01LTMwMnYyNDlsMTI1LTEyNS0xMjUtMTI0eiIgaG9yaXotYWR2LXg9IjEwMDAiIC8+CjxnbHlwaCBnbHlwaC1uYW1lPSJwYXVzZSIgdW5pY29kZT0iJiN4ZTgwMTsiIGQ9Im01MDAgODUwYy0yNzUgMC01MDAtMjI1LTUwMC01MDAgMC0yNzYgMjI1LTUwMCA1MDAtNTAwczUwMCAyMjQgNTAwIDUwMGMwIDI3NS0yMjQgNTAwLTUwMCA1MDB6IG0wLTk2NmMtMjU3IDAtNDY2IDIwOS00NjYgNDY2IDAgMjU3IDIwOSA0NjYgNDY2IDQ2NiAyNTcgMCA0NjYtMjA5IDQ2Ni00NjYgMC0yNTctMjA5LTQ2Ni00NjYtNDY2eiBtMTI5IDYyMHYtMzA4YzAtMTAtNy0xNy0xNy0xN3MtMTcgNy0xNyAxN3YzMDhjMCA5IDggMTcgMTcgMTdzMTctOCAxNy0xN3ogbS0yMjMgMHYtMzA4YzAtMTAtOC0xNy0xNy0xNy0xMCAwLTE3IDctMTcgMTd2MzA4YzAgOSA3IDE3IDE3IDE3IDkgMCAxNy04IDE3LTE3eiIgaG9yaXotYWR2LXg9IjEwMDAiIC8+CjxnbHlwaCBnbHlwaC1uYW1lPSJjbG9zZSIgdW5pY29kZT0iJiN4ZTgwMjsiIGQ9Im02NjAgNDg3bC0xMzYtMTM3IDEzNi0xMzdjNy02IDctMTcgMC0yNC0zLTMtNy01LTEyLTUtNCAwLTggMi0xMiA1bC0xMzYgMTM3LTEzNy0xMzdjLTMtMy04LTUtMTItNS00IDAtOSAyLTEyIDUtNyA3LTcgMTggMCAyNGwxMzcgMTM3LTEzNyAxMzdjLTcgNi03IDE3IDAgMjQgNiA2IDE3IDYgMjQgMGwxMzctMTM3IDEzNiAxMzdjNyA2IDE4IDYgMjQgMCA3LTcgNy0xOCAwLTI0eiBtMzM5LTEzN2MwLTI3NS0yMjQtNDk5LTQ5OS00OTktMjc2IDAtNTAwIDIyNC01MDAgNDk5IDAgMjc1IDIyNCA0OTkgNTAwIDQ5OSAyNzUgMCA0OTktMjI0IDQ5OS00OTl6IG0tMzQgMGMwIDI1Ny0yMDkgNDY2LTQ2NSA0NjYtMjU3IDAtNDY2LTIwOS00NjYtNDY2IDAtMjU3IDIwOS00NjYgNDY2LTQ2NiAyNTYgMCA0NjUgMjA5IDQ2NSA0NjZ6IiBob3Jpei1hZHYteD0iMTAwMCIgLz4KPGdseXBoIGdseXBoLW5hbWU9InByZXYiIHVuaWNvZGU9IiYjeGU4MDM7IiBkPSJtNTAwIDg0OWMtMjc1IDAtNDk5LTIyMy00OTktNDk5IDAtMjc1IDIyNC00OTkgNDk5LTQ5OSAyNzUgMCA0OTkgMjI0IDQ5OSA0OTkgMCAyNzYtMjI0IDQ5OS00OTkgNDk5eiBtMC05NjRjLTI1NyAwLTQ2NiAyMDktNDY2IDQ2NSAwIDI1NyAyMDkgNDY2IDQ2NiA0NjYgMjU2IDAgNDY1LTIwOSA0NjUtNDY2IDAtMjU2LTIwOS00NjUtNDY1LTQ2NXogbTc0IDYxMmwtMTUzLTE1NCAxNTMtMTUzYzctNyA3LTE4IDAtMjQtNi03LTE3LTctMjQgMGwtMTY1IDE2NWMtNiA3LTYgMTcgMCAyNGwxNjUgMTY2YzQgMyA4IDUgMTIgNSA1IDAgOS0yIDEyLTUgNy03IDctMTggMC0yNHoiIGhvcml6LWFkdi14PSIxMDAwIiAvPgo8Z2x5cGggZ2x5cGgtbmFtZT0ibmV4dCIgdW5pY29kZT0iJiN4ZTgwNDsiIGQ9Im01MDAtMTQ5YzI3NSAwIDQ5OSAyMjQgNDk5IDQ5OSAwIDI3Ni0yMjQgNDk5LTQ5OSA0OTktMjc1IDAtNDk5LTIyMy00OTktNDk5IDAtMjc1IDIyNC00OTkgNDk5LTQ5OXogbTAgOTY1YzI1NiAwIDQ2NS0yMDkgNDY1LTQ2NiAwLTI1Ni0yMDktNDY1LTQ2NS00NjUtMjU3IDAtNDY2IDIwOS00NjYgNDY1IDAgMjU3IDIwOSA0NjYgNDY2IDQ2NnogbS03NS02MTJsMTUzIDE1NC0xNTMgMTUzYy02IDctNiAxNyAwIDI0IDcgNyAxNyA3IDI0IDBsMTY1LTE2NWM3LTcgNy0xOCAwLTI0bC0xNjUtMTY2Yy0zLTMtOC01LTEyLTUtNCAwLTkgMi0xMiA1LTcgNy03IDE3IDAgMjR6IiBob3Jpei1hZHYteD0iMTAwMCIgLz4KPGdseXBoIGdseXBoLW5hbWU9InNwaW4iIHVuaWNvZGU9IiYjeGU4MDU7IiBkPSJtMTAwMCAzMTVoLTM2YzAgMjc1LTIyNCA0OTktNDk5IDQ5OXYzNmMyOTUgMCA1MzUtMjQwIDUzNS01MzV6IiBob3Jpei1hZHYteD0iMTAwMCIgLz4KPC9mb250Pgo8L2RlZnM+Cjwvc3ZnPg==#lightcase) format("svg"); font-weight: normal; font-style: normal; } /* line 12, ../scss/components/fonts/_font-lightcase.scss */ [class*='lightcase-icon-']:before { font-family: 'lightcase', sans-serif; font-style: normal; font-weight: normal; speak: none; display: inline-block; text-decoration: inherit; width: 1em; text-align: center; /* For safety - reset parent styles, that can break glyph codes*/ font-variant: normal; text-transform: none; /* fix buttons height, for twitter bootstrap */ line-height: 1em; /* Uncomment for 3D effect */ /* text-shadow: 1px 1px 1px rgba(127, 127, 127, 0.3); */ } /* Codes */ /* line 35, ../scss/components/fonts/_font-lightcase.scss */ .lightcase-icon-play:before { content: '\e800'; } /* line 36, ../scss/components/fonts/_font-lightcase.scss */ .lightcase-icon-pause:before { content: '\e801'; } /* line 37, ../scss/components/fonts/_font-lightcase.scss */ .lightcase-icon-close:before { content: '\e802'; } /* line 38, ../scss/components/fonts/_font-lightcase.scss */ .lightcase-icon-prev:before { content: '\e803'; } /* line 39, ../scss/components/fonts/_font-lightcase.scss */ .lightcase-icon-next:before { content: '\e804'; } /* line 40, ../scss/components/fonts/_font-lightcase.scss */ .lightcase-icon-spin:before { content: '\e805'; } /** * Mixin providing icon defaults to be used on top of font-lightcase. * * Example usage: * @include icon(#e9e9e9) */ /** * Mixin providing icon defaults including a hover status to be used * on top of font-lightcase. * * Example usage: * @include icon-hover(#e9e9e9, #fff) */ /** * Provides natural content overflow behavior and scrolling support * even so for touch devices. * * Example usage: * @include overflow() */ /** * Neutralizes/resets dimensions including width, height, position as well as margins, * paddings and styles. Used to enforce a neutral and unstyled look and behavoir! * * Example usage: * @include clear(true) * * @param boolean $important */ @-webkit-keyframes lightcase-spin { 0% { -webkit-transform: rotate(0deg); -moz-transform: rotate(0deg); -o-transform: rotate(0deg); transform: rotate(0deg); } 100% { -webkit-transform: rotate(359deg); -moz-transform: rotate(359deg); -o-transform: rotate(359deg); transform: rotate(359deg); } } @-moz-keyframes lightcase-spin { 0% { -webkit-transform: rotate(0deg); -moz-transform: rotate(0deg); -o-transform: rotate(0deg); transform: rotate(0deg); } 100% { -webkit-transform: rotate(359deg); -moz-transform: rotate(359deg); -o-transform: rotate(359deg); transform: rotate(359deg); } } @-o-keyframes lightcase-spin { 0% { -webkit-transform: rotate(0deg); -moz-transform: rotate(0deg); -o-transform: rotate(0deg); transform: rotate(0deg); } 100% { -webkit-transform: rotate(359deg); -moz-transform: rotate(359deg); -o-transform: rotate(359deg); transform: rotate(359deg); } } @-ms-keyframes lightcase-spin { 0% { -webkit-transform: rotate(0deg); -moz-transform: rotate(0deg); -o-transform: rotate(0deg); transform: rotate(0deg); } 100% { -webkit-transform: rotate(359deg); -moz-transform: rotate(359deg); -o-transform: rotate(359deg); transform: rotate(359deg); } } @keyframes lightcase-spin { 0% { -webkit-transform: rotate(0deg); -moz-transform: rotate(0deg); -o-transform: rotate(0deg); transform: rotate(0deg); } 100% { -webkit-transform: rotate(359deg); -moz-transform: rotate(359deg); -o-transform: rotate(359deg); transform: rotate(359deg); } } /* line 1, ../scss/components/modules/_case.scss */ #lightcase-case { display: none; position: fixed; z-index: 2002; top: 50%; left: 50%; font-family: arial, sans-serif; font-size: 13px; line-height: 1.5; text-align: left; text-shadow: 0 0 10px rgba(0, 0, 0, 0.5); } @media screen and (max-width: 640px) { /* line 16, ../scss/components/modules/_case.scss */ html[data-lc-type=inline] #lightcase-case, html[data-lc-type=ajax] #lightcase-case { position: fixed !important; top: 0 !important; left: 0 !important; right: 0 !important; bottom: 0 !important; margin: 0 !important; padding: 55px 0 70px 0; width: 100% !important; height: 100% !important; overflow: auto !important; } } @media screen and (min-width: 641px) { /* line 4, ../scss/components/modules/_content.scss */ html:not([data-lc-type=error]) #lightcase-content { position: relative; z-index: 1; text-shadow: none; background-color: #fff; -webkit-box-shadow: 0 0 30px rgba(0, 0, 0, 0.5); -moz-box-shadow: 0 0 30px rgba(0, 0, 0, 0.5); -o-box-shadow: 0 0 30px rgba(0, 0, 0, 0.5); box-shadow: 0 0 30px rgba(0, 0, 0, 0.5); -webkit-backface-visibility: hidden; } } @media screen and (min-width: 641px) { /* line 23, ../scss/components/modules/_content.scss */ html[data-lc-type=image] #lightcase-content, html[data-lc-type=video] #lightcase-content { background-color: #333; } } /* line 31, ../scss/components/modules/_content.scss */ html[data-lc-type=inline] #lightcase-content, html[data-lc-type=ajax] #lightcase-content, html[data-lc-type=error] #lightcase-content { -webkit-box-shadow: none; -moz-box-shadow: none; -o-box-shadow: none; box-shadow: none; } @media screen and (max-width: 640px) { /* line 31, ../scss/components/modules/_content.scss */ html[data-lc-type=inline] #lightcase-content, html[data-lc-type=ajax] #lightcase-content, html[data-lc-type=error] #lightcase-content { position: relative !important; top: auto !important; left: auto !important; width: auto !important; height: auto !important; margin: 0 !important; padding: 0 !important; border: none !important; background: none !important; } } /* line 43, ../scss/components/modules/_content.scss */ html[data-lc-type=inline] #lightcase-content .lightcase-contentInner, html[data-lc-type=ajax] #lightcase-content .lightcase-contentInner, html[data-lc-type=error] #lightcase-content .lightcase-contentInner { -webkit-box-sizing: border-box; -moz-box-sizing: border-box; -o-box-sizing: border-box; box-sizing: border-box; } @media screen and (max-width: 640px) { /* line 43, ../scss/components/modules/_content.scss */ html[data-lc-type=inline] #lightcase-content .lightcase-contentInner, html[data-lc-type=ajax] #lightcase-content .lightcase-contentInner, html[data-lc-type=error] #lightcase-content .lightcase-contentInner { padding: 15px; } /* line 52, ../scss/components/modules/_content.scss */ html[data-lc-type=inline] #lightcase-content .lightcase-contentInner, html[data-lc-type=inline] #lightcase-content .lightcase-contentInner > *, html[data-lc-type=ajax] #lightcase-content .lightcase-contentInner, html[data-lc-type=ajax] #lightcase-content .lightcase-contentInner > *, html[data-lc-type=error] #lightcase-content .lightcase-contentInner, html[data-lc-type=error] #lightcase-content .lightcase-contentInner > * { width: 100% !important; max-width: none !important; } /* line 59, ../scss/components/modules/_content.scss */ html[data-lc-type=inline] #lightcase-content .lightcase-contentInner > *:not(iframe), html[data-lc-type=ajax] #lightcase-content .lightcase-contentInner > *:not(iframe), html[data-lc-type=error] #lightcase-content .lightcase-contentInner > *:not(iframe) { height: auto !important; max-height: none !important; } } @media screen and (max-width: 640px) { /* line 70, ../scss/components/modules/_content.scss */ html.lightcase-isMobileDevice[data-lc-type=iframe] #lightcase-content .lightcase-contentInner iframe { overflow: auto; -webkit-overflow-scrolling: touch; } } @media screen and (max-width: 640px) and (min-width: 641px) { /* line 74, ../scss/components/modules/_content.scss */ html[data-lc-type=image] #lightcase-content .lightcase-contentInner, html[data-lc-type=video] #lightcase-content .lightcase-contentInner { line-height: 0.75; } } /* line 82, ../scss/components/modules/_content.scss */ html[data-lc-type=image] #lightcase-content .lightcase-contentInner { position: relative; overflow: hidden !important; } @media screen and (max-width: 640px) { /* line 91, ../scss/components/modules/_content.scss */ html[data-lc-type=inline] #lightcase-content .lightcase-contentInner .lightcase-inlineWrap, html[data-lc-type=ajax] #lightcase-content .lightcase-contentInner .lightcase-inlineWrap, html[data-lc-type=error] #lightcase-content .lightcase-contentInner .lightcase-inlineWrap { position: relative !important; top: auto !important; left: auto !important; width: auto !important; height: auto !important; margin: 0 !important; padding: 0 !important; border: none !important; background: none !important; } } @media screen and (min-width: 641px) { /* line 100, ../scss/components/modules/_content.scss */ html:not([data-lc-type=error]) #lightcase-content .lightcase-contentInner .lightcase-inlineWrap { padding: 30px; overflow: auto; -webkit-box-sizing: border-box; -moz-box-sizing: border-box; -o-box-sizing: border-box; box-sizing: border-box; } } @media screen and (max-width: 640px) { /* line 117, ../scss/components/modules/_content.scss */ #lightcase-content h1, #lightcase-content h2, #lightcase-content h3, #lightcase-content h4, #lightcase-content h5, #lightcase-content h6, #lightcase-content p { color: #aaa; } } @media screen and (min-width: 641px) { /* line 117, ../scss/components/modules/_content.scss */ #lightcase-content h1, #lightcase-content h2, #lightcase-content h3, #lightcase-content h4, #lightcase-content h5, #lightcase-content h6, #lightcase-content p { color: #333; } } /* line 3, ../scss/components/modules/_error.scss */ #lightcase-case p.lightcase-error { margin: 0; font-size: 17px; text-align: center; white-space: nowrap; overflow: hidden; text-overflow: ellipsis; color: #aaa; } @media screen and (max-width: 640px) { /* line 3, ../scss/components/modules/_error.scss */ #lightcase-case p.lightcase-error { padding: 30px 0; } } @media screen and (min-width: 641px) { /* line 3, ../scss/components/modules/_error.scss */ #lightcase-case p.lightcase-error { padding: 0; } } /* line 4, ../scss/components/modules/_global.scss */ .lightcase-open body { overflow: hidden; } /* line 8, ../scss/components/modules/_global.scss */ .lightcase-isMobileDevice .lightcase-open body { max-width: 100%; max-height: 100%; } /* line 1, ../scss/components/modules/_info.scss */ #lightcase-info { position: absolute; padding-top: 15px; } /* line 9, ../scss/components/modules/_info.scss */ #lightcase-info #lightcase-title, #lightcase-info #lightcase-caption { margin: 0; padding: 0; line-height: 1.5; font-weight: normal; text-overflow: ellipsis; } /* line 19, ../scss/components/modules/_info.scss */ #lightcase-info #lightcase-title { font-size: 17px; color: #aaa; } @media screen and (max-width: 640px) { /* line 19, ../scss/components/modules/_info.scss */ #lightcase-info #lightcase-title { position: fixed; top: 10px; left: 0; max-width: 87.5%; padding: 5px 15px; background: #333; } } /* line 33, ../scss/components/modules/_info.scss */ #lightcase-info #lightcase-caption { clear: both; font-size: 13px; color: #aaa; } /* line 39, ../scss/components/modules/_info.scss */ #lightcase-info #lightcase-sequenceInfo { font-size: 11px; color: #aaa; } @media screen and (max-width: 640px) { /* line 45, ../scss/components/modules/_info.scss */ .lightcase-fullScreenMode #lightcase-info { padding-left: 15px; padding-right: 15px; } /* line 51, ../scss/components/modules/_info.scss */ html:not([data-lc-type=image]):not([data-lc-type=video]):not([data-lc-type=flash]):not([data-lc-type=error]) #lightcase-info { position: static; } } /* line 1, ../scss/components/modules/_loading.scss */ #lightcase-loading { position: fixed; z-index: 9999; width: 1.123em; height: auto; font-size: 38px; line-height: 1; text-align: center; text-shadow: none; position: fixed; z-index: 2001; top: 50%; left: 50%; margin-top: -0.5em; margin-left: -0.5em; opacity: 1; font-size: 32px; text-shadow: 0 0 15px #fff; -moz-transform-origin: 50% 53%; -webkit-animation: lightcase-spin 0.5s infinite linear; -moz-animation: lightcase-spin 0.5s infinite linear; -o-animation: lightcase-spin 0.5s infinite linear; animation: lightcase-spin 0.5s infinite linear; } /* line 20, ../scss/components/mixins/_presets.scss */ #lightcase-loading, #lightcase-loading:focus { text-decoration: none; color: #fff; -webkit-tap-highlight-color: transparent; -webkit-transition: color, opacity, ease-in-out 0.25s; -moz-transition: color, opacity, ease-in-out 0.25s; -o-transition: color, opacity, ease-in-out 0.25s; transition: color, opacity, ease-in-out 0.25s; } /* line 32, ../scss/components/mixins/_presets.scss */ #lightcase-loading > span { display: inline-block; text-indent: -9999px; } /* line 2, ../scss/components/modules/_navigation.scss */ a[class*='lightcase-icon-'] { position: fixed; z-index: 9999; width: 1.123em; height: auto; font-size: 38px; line-height: 1; text-align: center; text-shadow: none; outline: none; cursor: pointer; } /* line 20, ../scss/components/mixins/_presets.scss */ a[class*='lightcase-icon-'], a[class*='lightcase-icon-']:focus { text-decoration: none; color: rgba(255, 255, 255, 0.6); -webkit-tap-highlight-color: transparent; -webkit-transition: color, opacity, ease-in-out 0.25s; -moz-transition: color, opacity, ease-in-out 0.25s; -o-transition: color, opacity, ease-in-out 0.25s; transition: color, opacity, ease-in-out 0.25s; } /* line 32, ../scss/components/mixins/_presets.scss */ a[class*='lightcase-icon-'] > span { display: inline-block; text-indent: -9999px; } /* line 49, ../scss/components/mixins/_presets.scss */ a[class*='lightcase-icon-']:hover { color: white; text-shadow: 0 0 15px white; } /* line 10, ../scss/components/modules/_navigation.scss */ .lightcase-isMobileDevice a[class*='lightcase-icon-']:hover { color: #aaa; text-shadow: none; } /* line 17, ../scss/components/modules/_navigation.scss */ a[class*='lightcase-icon-'].lightcase-icon-close { position: fixed; top: 15px; right: 15px; bottom: auto; margin: 0; opacity: 0; outline: none; } /* line 28, ../scss/components/modules/_navigation.scss */ a[class*='lightcase-icon-'].lightcase-icon-prev { left: 15px; } /* line 33, ../scss/components/modules/_navigation.scss */ a[class*='lightcase-icon-'].lightcase-icon-next { right: 15px; } /* line 38, ../scss/components/modules/_navigation.scss */ a[class*='lightcase-icon-'].lightcase-icon-pause, a[class*='lightcase-icon-'].lightcase-icon-play { left: 50%; margin-left: -0.5em; } @media screen and (min-width: 641px) { /* line 38, ../scss/components/modules/_navigation.scss */ a[class*='lightcase-icon-'].lightcase-icon-pause, a[class*='lightcase-icon-'].lightcase-icon-play { opacity: 0; } } @media screen and (max-width: 640px) { /* line 2, ../scss/components/modules/_navigation.scss */ a[class*='lightcase-icon-'] { bottom: 15px; font-size: 24px; } } @media screen and (min-width: 641px) { /* line 2, ../scss/components/modules/_navigation.scss */ a[class*='lightcase-icon-'] { bottom: 50%; margin-bottom: -0.5em; } /* line 57, ../scss/components/modules/_navigation.scss */ a[class*='lightcase-icon-']:hover, #lightcase-case:hover ~ a[class*='lightcase-icon-'] { opacity: 1; } } /* line 1, ../scss/components/modules/_overlay.scss */ #lightcase-overlay { display: none; width: 100%; min-height: 100%; position: fixed; z-index: 2000; top: -9999px; bottom: -9999px; left: 0; background: #333; } @media screen and (max-width: 640px) { /* line 1, ../scss/components/modules/_overlay.scss */ #lightcase-overlay { opacity: 1 !important; } } .shk{--color-primary:#0d6efd;--color-opac:#b9b9b94d;--color-theme:#fff;--color-secondary:#767676;--color-text:#333;--color-shadow:#b9b6b680;--color-handle-shadow-mobile:#b9b6b6;--background-body:var(--color-theme);--color-title:var(--color-text);--color-artist:var(--color-secondary);--color-button:var(--color-primary);--color-button-disabled:var(--color-opac);--color-button-active-background:var(--color-opac);--color-handle:var(--color-primary);--color-handle-disabled:#b9b9b9;--color-bar-loaded:var(--color-opac);--color-bar-played:var(--color-primary);--color-time:var(--color-secondary);--color-spinner:var(--color-primary);--color-live-symbol:var(--color-primary);--color-live-text:var(--color-primary);--shadow-body:2px 2px 8px -2px var(--color-shadow);--shadow-body-mobile:0 -2px 6px -2px var(--color-shadow);--shadow-handle:0px 2px 10px 2px var(--color-shadow);--shadow-handle-mobile:2px 2px 8px -2px var(--color-handle-shadow-mobile)}.shk[data-theme=dark]{--color-theme:#333;--color-secondary:#b9b6b6;--color-text:#f8f9fa;--color-handle-shadow-mobile:#141414;--color-shadow:#14141480}@media (prefers-color-scheme:dark){.shk[data-theme=auto]{--color-theme:#333;--color-secondary:#b9b6b6;--color-text:#fff;--color-handle-shadow-mobile:#141414;--color-shadow:#14141480}}@-webkit-keyframes rotate{to{-webkit-transform:rotate(1turn);transform:rotate(1turn)}}@keyframes rotate{to{-webkit-transform:rotate(1turn);transform:rotate(1turn)}}@-webkit-keyframes marquee{0%{-webkit-transform:translate(0);transform:translate(0)}to{-webkit-transform:translateX(-100%);transform:translate(-100%)}}@keyframes marquee{0%{-webkit-transform:translate(0);transform:translate(0)}to{-webkit-transform:translateX(-100%);transform:translate(-100%)}}.shk{border:none;color:var(--color-text);cursor:auto;font-family:inherit;font-size:16px;font-weight:400;line-height:1.42;position:relative}.js-focus-visible :focus:not(.focus-visible),.js-focus-visible:focus:not(.focus-visible){outline:none}.shk[data-fixed-type=fixed]{bottom:0;left:0;margin:0;position:fixed;width:100%}.shk[data-fixed-type=fixed][data-fixed-pos=top]{bottom:auto;top:0}.shk[data-seeking] .shk-player{cursor:-webkit-grabbing;cursor:grabbing}.shk button{font-family:inherit}.shk-player{background:var(--background-body);border-radius:2px;box-sizing:border-box;height:120px;position:relative;z-index:10}.shk-body{align-items:stretch;display:flex;flex-flow:row nowrap;position:relative;-webkit-user-select:none;-ms-user-select:none;user-select:none;width:100%}.shk-cover{background-repeat:no-repeat;background-size:cover;flex:0 0 auto;height:80px;margin-right:16px;width:80px}.shk-main{display:flex;flex-grow:1;flex-wrap:nowrap;justify-content:flex-start;position:relative}.shk-text{overflow:hidden}.shk-artist,.shk-title{margin:auto;white-space:nowrap}.shk-artist{color:var(--color-artist);font-weight:500;text-overflow:clip}.shk-title_wrap[data-overflow]{-webkit-mask-image:linear-gradient(90deg,transparent,#202124 5%,#202124 95%,transparent);mask-image:linear-gradient(90deg,transparent,#202124 5%,#202124 95%,transparent)}.shk-title_inner{display:inline-flex;overflow:visible}.shk-title_wrap[data-overflow] .shk-title_inner{-webkit-animation-duration:inherit;animation-duration:inherit;box-sizing:border-box;padding:0 3%;white-space:nowrap}.shk-title_wrap[data-overflow] .shk-title_inner:after{content:attr(data-title);display:inline-block}.shk-title,.shk-title_wrap[data-overflow] .shk-title_inner:after{color:var(--color-title);font-size:1.33em;font-weight:300}.shk-title_wrap[data-overflow] .shk-title,.shk-title_wrap[data-overflow] .shk-title_inner:after{-webkit-animation:marquee linear infinite;animation:marquee linear infinite;-webkit-animation-duration:inherit;animation-duration:inherit;padding-right:60px}.shk-btn{fill:currentColor;-webkit-appearance:none;appearance:none;background:transparent;border:none;box-sizing:content-box;color:var(--color-button);cursor:pointer;font-size:1em;line-height:normal;padding:10px;position:relative}.shk-btn:disabled{color:var(--color-button-disabled);cursor:not-allowed}.shk-btn:after{background:var(--color-button-active-background);border-radius:50%;content:"";height:100%;left:50%;opacity:0;pointer-events:none;position:absolute;top:50%;-webkit-transform:translate(-50%,-50%);transform:translate(-50%,-50%);transition:opacity 1s cubic-bezier(0,0,.2,1),visibility 1s linear;visibility:hidden;width:100%;z-index:-1}.shk-btn:not(:disabled):active:after{opacity:1;visibility:visible}a.shk-btn:visited{color:var(--color-button)}.shk-btn svg{height:24px;vertical-align:middle;width:24px}.shk-controls{flex:0 0 auto;margin:0 auto;position:relative;width:280px}.shk-controls .shk-btn{border-radius:100%}.shk-controls>div{align-items:center;display:flex;flex-flow:row nowrap}.shk-controls_basic{justify-content:space-between}.shk-controls_extra{background:var(--background-body);bottom:0;height:100%;justify-content:flex-end;margin-right:44px;opacity:0;overflow:hidden;padding-right:0 8px;position:absolute;right:0;transition:width .2s ease-in-out,opacity .1s linear .1s,visibility .2s;visibility:hidden;white-space:nowrap;width:0;z-index:10}.shk[data-extra] .shk-controls_extra{opacity:1;transition:width .2s ease-in-out,opacity .1s linear;visibility:visible;width:calc(100% - 44px)}.shk[data-extra] .shk-controls_extra .shk-btn{display:inline-block}.shk-btn_toggle svg{height:32px;width:32px}.shk[data-play=paused] .shk-btn_play,.shk[data-play=playing] .shk-btn_pause{display:inline}.shk[data-play=paused] .shk-btn_pause,.shk[data-play=playing] .shk-btn_play{display:none}.shk-btn_speed{font-size:.86em;font-weight:400;height:44px;padding:0;width:44px}.shk-btn_more{position:relative;-webkit-transform:none;transform:none;transition:-webkit-transform .2s .1s;transition:transform .2s .1s;transition:transform .2s .1s,-webkit-transform .2s .1s;z-index:11}.shk[data-extra] .shk-btn_more{-webkit-transform:rotate(90deg);transform:rotate(90deg)}.shk[data-mute] svg.shk-btn_mute,svg.shk-btn_unmute{display:inline-block}.shk[data-mute] svg.shk-btn_unmute,svg.shk-btn_mute{display:none}.shk-bar_wrap{cursor:pointer;position:relative;z-index:1}.shk-bar{background:var(--background-body);box-sizing:border-box;height:4px;position:relative;width:100%}.shk-bar_loaded,.shk-bar_played{bottom:0;left:0;position:absolute;top:0;transition:width .1s ease-in;width:0}.shk-bar_loaded{background:var(--color-bar-loaded)}.shk-bar_played{background:var(--color-bar-played)}.shk[data-seeking] .shk-bar_played{transition:none}.shk-bar-handle{background:var(--color-handle);border:0;border-radius:20px;box-sizing:content-box;cursor:-webkit-grab;cursor:grab;height:20px;padding:0;position:absolute;right:-10px;width:20px}.shk-bar-handle:disabled{background-color:var(--color-handle-disabled);box-shadow:none;cursor:not-allowed}.shk-bar-handle:active{cursor:-webkit-grabbing;cursor:grabbing}.shk-display{position:absolute}.shk-loader{color:var(--color-spinner);display:none;vertical-align:middle}.shk[data-loading] .shk-loader{display:inline-block}.shk-loader svg{-webkit-animation:rotate 1.4s linear infinite;animation:rotate 1.4s linear infinite;height:12px;position:relative;width:12px}.shk-visuallyhidden:not(:focus):not(:active){clip:rect(0 0 0 0);border:0;-webkit-clip-path:inset(100%);clip-path:inset(100%);height:1px;margin:-1px;overflow:hidden;padding:0;position:absolute;white-space:nowrap;width:1px}.shk-time{color:var(--color-time);display:inline-block;font-size:.8em;font-weight:300;vertical-align:middle}.shk .shk-live{align-items:center;color:var(--color-live-text);display:none;font-family:sans-serif;font-size:.8em;text-transform:uppercase}.shk .shk-live:before{background:var(--color-live-symbol);border-radius:50%;content:"";height:.5em;margin-right:2px;width:.5em}.shk-icons,.shk[data-live] .shk-bar,.shk[data-live] .shk-time{display:none}.shk[data-live] .shk-live{display:inline-flex}@media (min-width:641px){.shk-player{box-shadow:var(--shadow-body);margin-top:4px;padding:20px 16px}.shk-main{align-items:flex-end;flex-direction:row;max-width:calc(100% - 96px);padding:10px 0}.shk-text{flex:2 1 auto}.shk-bar_wrap{left:0;padding:4px 0 16px;position:absolute;right:0;top:-4px}.shk-bar{transition:height .15s ease-in}.shk-bar_wrap:hover .shk-bar{height:10px}.shk-bar-handle{border:4px solid transparent;box-shadow:var(--shadow-handle);top:-9.5px;-webkit-transform:scale(.0001);transform:scale(.0001);transition:all .1s ease-in}.shk-bar-handle.focus-visible,.shk-bar_wrap:hover .shk-bar-handle:not(:disabled){border-color:#fff;-webkit-transform:scale(.8);transform:scale(.8)}.shk-display{right:8px;top:-6px}.shk-loader{margin-right:4px}.shk-time_duration:before{content:"/";margin:0 4px}}@media (max-width:640px){.shk-player{box-shadow:var(--shadow-body-mobile);padding:5px 16px}.shk[data-fixed-type=auto]{bottom:0;left:0;position:fixed;width:100%}.shk[data-fixed-type=auto][data-fixed-pos=top]{bottom:auto;top:0}.shk[data-live] .shk-bar_wrap{height:4px}.shk-cover{display:none}.shk-main{align-items:center;flex-direction:column;max-width:none;padding:0;width:100%}.shk-text{flex:0 0 auto;text-align:center;width:100%}.shk-artist_wrap{font-size:.8em;line-height:1.1}.shk-artist{display:inline-block}.shk-title,.shk-title_wrap[data-overflow] .shk-title_inner:after{font-size:1em;line-height:1}.shk-bar_wrap{margin:0 60px;padding:8px 0}.shk-bar-handle{box-shadow:var(--shadow-handle-mobile);display:inline-block;top:-8px}.shk-bar{background:var(--color-opac);border-radius:2px}.shk-display{left:0;right:0;top:-16px}.shk-loader{left:-10px;position:absolute;top:-5px}.shk-time{display:flex;flex-flow:row nowrap;font-size:.7em;justify-content:space-between;line-height:1;margin:0 5px}.shk-time_now{text-align:right;width:40px}.shk-time_duration{text-align:left;width:40px}.shk-live{position:absolute;right:0;top:0}}@-webkit-keyframes stretch{0%,to{box-shadow:0 0}50%{box-shadow:0 -5px}}@keyframes stretch{0%,to{box-shadow:0 0}50%{box-shadow:0 -5px}}.shk .shk-controls_extra .shk-btn.shk-btn_chapter{display:none}.shk[data-has-chapter] .shk-controls_extra .shk-btn.shk-btn_chapter{display:inline-block}.shk-chapter{background:var(--color-theme);border:1px solid rgba(0,41,37,.05);border-radius:2px;bottom:0;box-shadow:0 0 10px #00292512;box-sizing:border-box;height:0;left:20px;margin:0 auto;opacity:0;overflow:hidden;position:absolute;right:20px;transition:height .2s ease-in-out,bottom .1s ease-in-out,opacity .1s linear,visibility .1s .2s;visibility:hidden;z-index:0}.shk[data-show-chapter] .shk-chapter{bottom:120px;height:340px;opacity:1;transition:height .2s ease-in-out,bottom .1s ease-in-out,opacity .1s linear;visibility:visible}.shk-btn_close{fill:var(--color-primary);font-size:0;position:absolute;right:4px;top:4px}.shk-btn .shk-icon_close{height:16px;width:16px}.shk-chapter_main{box-sizing:border-box;height:calc(100% - 60px);margin:40px 0 20px;-webkit-mask-image:linear-gradient(180deg,transparent,#202124 5%,#202124 95%,transparent);mask-image:linear-gradient(180deg,transparent,#202124 5%,#202124 95%,transparent);overflow-x:hidden;overflow-y:scroll;padding:0 40px;scroll-behavior:smooth}.shk-chapter_list{box-sizing:border-box;list-style:none;margin:10px 0 0;padding:0}.shk-chapter_item{margin:5px 0}.shk-chapter .shk-chapter_btn{align-items:center;box-sizing:border-box;color:var(--color-text);display:flex;flex-flow:row nowrap;justify-content:flex-start;overflow:hidden;width:100%}.shk-chapter .shk-chapter_btn:after{border-radius:2px}.shk-chapter_btn div{fill:currentColor;color:currentColor}.shk-chapter_item[data-active] .shk-chapter_btn div{color:var(--color-primary);font-weight:600}.shk-icon_chapter{flex-shrink:0;height:12px;width:12px}.shk[data-play=playing] .shk-chapter_item[data-active] .shk-icon_playing,.shk[data-play=playing] .shk-chapter_item[data-active] .shk-icon_playing:after,.shk[data-play=playing] .shk-chapter_item[data-active] .shk-icon_playing:before{display:block}.shk-icon_playing,.shk-icon_playing:after,.shk-icon_playing:before{-webkit-animation:stretch 1s ease-in-out infinite;animation:stretch 1s ease-in-out infinite;background:currentColor;color:currentColor;display:none;height:5px;left:4px;top:6px;width:3px}.shk-icon_playing{-webkit-animation-delay:.16s;animation-delay:.16s;position:relative}.shk-icon_playing:after,.shk-icon_playing:before{content:"";position:absolute;top:0}.shk-icon_playing:before{-webkit-animation-delay:-.16s;animation-delay:-.16s;left:-4px}.shk-icon_playing:after{left:4px}.shk-icon_triangle{align-items:flex-start;display:flex;flex-shrink:0}.shk[data-play=playing] .shk-chapter_item[data-active] .shk-icon_triangle{display:none}.shk-icon_triangle svg{fill:currentColor;height:12px;width:12px}.shk-chapter_duration{color:var(--color-secondary);flex-shrink:0;font-weight:200;margin:0 5%;min-width:60px;text-align:left}.shk-chapter_title_wrap{flex-grow:1;overflow:hidden;white-space:nowrap}.shk-chapter_item[data-active] .shk-chapter_title_wrap[data-overflow]{-webkit-mask-image:linear-gradient(90deg,transparent,#202124 2%,#202124 98%,transparent);mask-image:linear-gradient(90deg,transparent,#202124 2%,#202124 98%,transparent)}.shk-chapter_title_inner{-webkit-animation-duration:inherit;animation-duration:inherit;display:flex}.shk-chapter_item[data-active] .shk-chapter_title_wrap[data-overflow] .shk-chapter_title_inner{box-sizing:border-box;padding:0 3%}.shk-chapter_item[data-active] .shk-chapter_title_wrap[data-overflow] .shk-chapter_title_inner:after{content:attr(data-chapter);display:block}.shk-chapter_title{color:var(--color-text);overflow:hidden;text-align:left;text-overflow:ellipsis}.shk-chapter_item[data-active] .shk-chapter_title{overflow:visible}.shk-chapter_item[data-active] .shk-chapter_title_wrap[data-overflow] .shk-chapter_title,.shk-chapter_item[data-active] .shk-chapter_title_wrap[data-overflow] .shk-chapter_title_inner:after{-webkit-animation:marquee linear infinite;animation:marquee linear infinite;-webkit-animation-duration:inherit;animation-duration:inherit;color:currentColor;padding-right:60px}@media (max-width:640px){.shk-chapter{left:10px;right:10px}.shk-chapter_main{padding:0 10px}} @charset "UTF-8"; /** Import Bootstrap functions */ /** Bootstrap navbar fix (https://git.io/fADqW) */ /** Import everything from autoload */ /*! * Bootstrap v4.6.0 (https://getbootstrap.com/) * Copyright 2011-2021 The Bootstrap Authors * Copyright 2011-2021 Twitter, Inc. * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) */ :root { --blue: #007bff; --indigo: #6610f2; --purple: #6f42c1; --pink: #e83e8c; --red: #dc3545; --orange: #fd7e14; --yellow: #ffc107; --green: #28a745; --teal: #20c997; --cyan: #17a2b8; --white: #fff; --gray: #6c757d; --gray-dark: #343a40; --primary: #023605; --secondary: #faf8f6; --success: #28a745; --info: #17a2b8; --warning: #ffc107; --danger: #dc3545; --light: #a49f9f; --dark: #343a40; --breakpoint-xs: 0; --breakpoint-sm: 576px; --breakpoint-md: 768px; --breakpoint-lg: 992px; --breakpoint-xl: 1200px; --breakpoint-xxl: 1400px; --font-family-sans-serif: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", "Liberation Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; --font-family-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace; } *, *::before, *::after { -webkit-box-sizing: border-box; box-sizing: border-box; } html { font-family: sans-serif; line-height: 1.15; -webkit-text-size-adjust: 100%; -webkit-tap-highlight-color: rgba(0, 0, 0, 0); } article, aside, figcaption, figure, footer, header, hgroup, main, nav, section { display: block; } body { margin: 0; font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", "Liberation Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; font-size: 1rem; font-weight: 400; line-height: 1.5; color: #212529; text-align: left; background-color: #fff; } [tabindex="-1"]:focus:not(:focus-visible) { outline: 0 !important; } hr { -webkit-box-sizing: content-box; box-sizing: content-box; height: 0; overflow: visible; } h1, h2, h3, h4, .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item span, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_duration, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_now, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .shk-title, h5, h6 { margin-top: 0; margin-bottom: 0.5rem; } p { margin-top: 0; margin-bottom: 1rem; } abbr[title], abbr[data-original-title] { text-decoration: underline; -webkit-text-decoration: underline dotted; text-decoration: underline dotted; cursor: help; border-bottom: 0; -webkit-text-decoration-skip-ink: none; text-decoration-skip-ink: none; } address { margin-bottom: 1rem; font-style: normal; line-height: inherit; } ol, ul, dl { margin-top: 0; margin-bottom: 1rem; } ol ol, ul ul, ol ul, ul ol { margin-bottom: 0; } dt { font-weight: 700; } dd { margin-bottom: 0.5rem; margin-left: 0; } blockquote { margin: 0 0 1rem; } b, strong { font-weight: bolder; } small { font-size: 80%; } sub, sup { position: relative; font-size: 75%; line-height: 0; vertical-align: baseline; } sub { bottom: -0.25em; } sup { top: -0.5em; } a { color: #023605; text-decoration: none; background-color: transparent; } a:hover { color: black; text-decoration: underline; } a:not([href]):not([class]) { color: inherit; text-decoration: none; } a:not([href]):not([class]):hover { color: inherit; text-decoration: none; } pre, code, kbd, samp { font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace; font-size: 1em; } pre { margin-top: 0; margin-bottom: 1rem; overflow: auto; -ms-overflow-style: scrollbar; } figure { margin: 0 0 1rem; } img { vertical-align: middle; border-style: none; } svg { overflow: hidden; vertical-align: middle; } table { border-collapse: collapse; } caption { padding-top: 0.75rem; padding-bottom: 0.75rem; color: #6c757d; text-align: left; caption-side: bottom; } th { text-align: inherit; text-align: -webkit-match-parent; } label { display: inline-block; margin-bottom: 0.5rem; } button { border-radius: 0; } button:focus:not(:focus-visible) { outline: 0; } input, button, select, optgroup, textarea { margin: 0; font-family: inherit; font-size: inherit; line-height: inherit; } button, input { overflow: visible; } button, select { text-transform: none; } [role=button] { cursor: pointer; } select { word-wrap: normal; } button, [type=button], [type=reset], [type=submit] { -webkit-appearance: button; } button:not(:disabled), [type=button]:not(:disabled), [type=reset]:not(:disabled), [type=submit]:not(:disabled) { cursor: pointer; } button::-moz-focus-inner, [type=button]::-moz-focus-inner, [type=reset]::-moz-focus-inner, [type=submit]::-moz-focus-inner { padding: 0; border-style: none; } input[type=radio], input[type=checkbox] { -webkit-box-sizing: border-box; box-sizing: border-box; padding: 0; } textarea { overflow: auto; resize: vertical; } fieldset { min-width: 0; padding: 0; margin: 0; border: 0; } legend { display: block; width: 100%; max-width: 100%; padding: 0; margin-bottom: 0.5rem; font-size: 1.5rem; line-height: inherit; color: inherit; white-space: normal; } progress { vertical-align: baseline; } [type=number]::-webkit-inner-spin-button, [type=number]::-webkit-outer-spin-button { height: auto; } [type=search] { outline-offset: -2px; -webkit-appearance: none; } [type=search]::-webkit-search-decoration { -webkit-appearance: none; } ::-webkit-file-upload-button { font: inherit; -webkit-appearance: button; } output { display: inline-block; } summary { display: list-item; cursor: pointer; } template { display: none; } [hidden] { display: none !important; } h1, h2, h3, h4, .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item span, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_duration, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_now, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .shk-title, h5, h6, .h1, .h2, .h3, .h4, .h5, .h6 { margin-bottom: 0.5rem; font-weight: 500; line-height: 1.2; } h1, .h1 { font-size: 2.5rem; } h2, .h2 { font-size: 2rem; } h3, .h3 { font-size: 1.75rem; } h4, .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item span, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_duration, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_now, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .shk-title, .h4 { font-size: 1.5rem; } h5, .h5 { font-size: 1.25rem; } h6, .h6 { font-size: 1rem; } .lead { font-size: 1.25rem; font-weight: 300; } .display-1 { font-size: 6rem; font-weight: 300; line-height: 1.2; } .display-2 { font-size: 5.5rem; font-weight: 300; line-height: 1.2; } .display-3 { font-size: 4.5rem; font-weight: 300; line-height: 1.2; } .display-4 { font-size: 3.5rem; font-weight: 300; line-height: 1.2; } hr { margin-top: 1rem; margin-bottom: 1rem; border: 0; border-top: 1px solid rgba(0, 0, 0, 0.1); } small, .small { font-size: 80%; font-weight: 400; } mark, .mark { padding: 0.2em; background-color: #fcf8e3; } .list-unstyled, .comment-list { padding-left: 0; list-style: none; } .list-inline { padding-left: 0; list-style: none; } .list-inline-item { display: inline-block; } .list-inline-item:not(:last-child) { margin-right: 0.5rem; } .initialism { font-size: 90%; text-transform: uppercase; } .blockquote { margin-bottom: 1rem; font-size: 1.25rem; } .blockquote-footer { display: block; font-size: 80%; color: #6c757d; } .blockquote-footer::before { content: "— "; } .img-fluid, .wp-caption img { max-width: 100%; height: auto; } .img-thumbnail { padding: 0.25rem; background-color: #fff; border: 1px solid #dee2e6; border-radius: 0.25rem; max-width: 100%; height: auto; } .figure, .wp-caption { display: inline-block; } .figure-img, .wp-caption img { margin-bottom: 0.5rem; line-height: 1; } .figure-caption, .wp-caption-text { font-size: 90%; color: #6c757d; } code { font-size: 87.5%; color: #e83e8c; word-wrap: break-word; } a > code { color: inherit; } kbd { padding: 0.2rem 0.4rem; font-size: 87.5%; color: #fff; background-color: #212529; border-radius: 0.2rem; } kbd kbd { padding: 0; font-size: 100%; font-weight: 700; } pre { display: block; font-size: 87.5%; color: #212529; } pre code { font-size: inherit; color: inherit; word-break: normal; } .pre-scrollable { max-height: 340px; overflow-y: scroll; } .container, .container-fluid, .container-xxl, .container-xl, .container-lg, .container-md, .container-sm { width: 100%; padding-right: 36px; padding-left: 36px; margin-right: auto; margin-left: auto; } @media (min-width: 576px) { .container-sm, .container { max-width: 540px; } } @media (min-width: 768px) { .container-md, .container-sm, .container { max-width: 720px; } } @media (min-width: 992px) { .container-lg, .container-md, .container-sm, .container { max-width: 960px; } } @media (min-width: 1200px) { .container-xl, .container-lg, .container-md, .container-sm, .container { max-width: 1140px; } } @media (min-width: 1400px) { .container-xxl, .container-xl, .container-lg, .container-md, .container-sm, .container { max-width: 1712px; } } .row { display: -webkit-box; display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; margin-right: -36px; margin-left: -36px; } .no-gutters { margin-right: 0; margin-left: 0; } .no-gutters > .col, .no-gutters > [class*=col-] { padding-right: 0; padding-left: 0; } .col-xxl, .col-xxl-auto, .col-xxl-12, .col-xxl-11, .col-xxl-10, .col-xxl-9, .col-xxl-8, .col-xxl-7, .col-xxl-6, .col-xxl-5, .col-xxl-4, .col-xxl-3, .col-xxl-2, .col-xxl-1, .col-xl, .col-xl-auto, .col-xl-12, .col-xl-11, .col-xl-10, .col-xl-9, .col-xl-8, .col-xl-7, .col-xl-6, .col-xl-5, .col-xl-4, .col-xl-3, .col-xl-2, .col-xl-1, .col-lg, .col-lg-auto, .col-lg-12, .col-lg-11, .col-lg-10, .col-lg-9, .col-lg-8, .col-lg-7, .col-lg-6, .col-lg-5, .col-lg-4, .col-lg-3, .col-lg-2, .col-lg-1, .col-md, .col-md-auto, .col-md-12, .col-md-11, .col-md-10, .col-md-9, .col-md-8, .col-md-7, .col-md-6, .col-md-5, .col-md-4, .col-md-3, .col-md-2, .col-md-1, .col-sm, .col-sm-auto, .col-sm-12, .col-sm-11, .col-sm-10, .col-sm-9, .col-sm-8, .col-sm-7, .col-sm-6, .col-sm-5, .col-sm-4, .col-sm-3, .col-sm-2, .col-sm-1, .col, .col-auto, .col-12, .col-11, .col-10, .col-9, .col-8, .col-7, .col-6, .col-5, .col-4, .col-3, .col-2, .col-1 { position: relative; width: 100%; padding-right: 36px; padding-left: 36px; } .col { -ms-flex-preferred-size: 0; flex-basis: 0; -webkit-box-flex: 1; -ms-flex-positive: 1; flex-grow: 1; max-width: 100%; } .row-cols-1 > * { -webkit-box-flex: 0; -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .row-cols-2 > * { -webkit-box-flex: 0; -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .row-cols-3 > * { -webkit-box-flex: 0; -ms-flex: 0 0 33.3333333333%; flex: 0 0 33.3333333333%; max-width: 33.3333333333%; } .row-cols-4 > * { -webkit-box-flex: 0; -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .row-cols-5 > * { -webkit-box-flex: 0; -ms-flex: 0 0 20%; flex: 0 0 20%; max-width: 20%; } .row-cols-6 > * { -webkit-box-flex: 0; -ms-flex: 0 0 16.6666666667%; flex: 0 0 16.6666666667%; max-width: 16.6666666667%; } .col-auto { -webkit-box-flex: 0; -ms-flex: 0 0 auto; flex: 0 0 auto; width: auto; max-width: 100%; } .col-1 { -webkit-box-flex: 0; -ms-flex: 0 0 8.3333333333%; flex: 0 0 8.3333333333%; max-width: 8.3333333333%; } .col-2 { -webkit-box-flex: 0; -ms-flex: 0 0 16.6666666667%; flex: 0 0 16.6666666667%; max-width: 16.6666666667%; } .col-3 { -webkit-box-flex: 0; -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .col-4 { -webkit-box-flex: 0; -ms-flex: 0 0 33.3333333333%; flex: 0 0 33.3333333333%; max-width: 33.3333333333%; } .col-5 { -webkit-box-flex: 0; -ms-flex: 0 0 41.6666666667%; flex: 0 0 41.6666666667%; max-width: 41.6666666667%; } .col-6 { -webkit-box-flex: 0; -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .col-7 { -webkit-box-flex: 0; -ms-flex: 0 0 58.3333333333%; flex: 0 0 58.3333333333%; max-width: 58.3333333333%; } .col-8 { -webkit-box-flex: 0; -ms-flex: 0 0 66.6666666667%; flex: 0 0 66.6666666667%; max-width: 66.6666666667%; } .col-9 { -webkit-box-flex: 0; -ms-flex: 0 0 75%; flex: 0 0 75%; max-width: 75%; } .col-10 { -webkit-box-flex: 0; -ms-flex: 0 0 83.3333333333%; flex: 0 0 83.3333333333%; max-width: 83.3333333333%; } .col-11 { -webkit-box-flex: 0; -ms-flex: 0 0 91.6666666667%; flex: 0 0 91.6666666667%; max-width: 91.6666666667%; } .col-12 { -webkit-box-flex: 0; -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .order-first { -webkit-box-ordinal-group: 0; -ms-flex-order: -1; order: -1; } .order-last { -webkit-box-ordinal-group: 14; -ms-flex-order: 13; order: 13; } .order-0 { -webkit-box-ordinal-group: 1; -ms-flex-order: 0; order: 0; } .order-1 { -webkit-box-ordinal-group: 2; -ms-flex-order: 1; order: 1; } .order-2 { -webkit-box-ordinal-group: 3; -ms-flex-order: 2; order: 2; } .order-3 { -webkit-box-ordinal-group: 4; -ms-flex-order: 3; order: 3; } .order-4 { -webkit-box-ordinal-group: 5; -ms-flex-order: 4; order: 4; } .order-5 { -webkit-box-ordinal-group: 6; -ms-flex-order: 5; order: 5; } .order-6 { -webkit-box-ordinal-group: 7; -ms-flex-order: 6; order: 6; } .order-7 { -webkit-box-ordinal-group: 8; -ms-flex-order: 7; order: 7; } .order-8 { -webkit-box-ordinal-group: 9; -ms-flex-order: 8; order: 8; } .order-9 { -webkit-box-ordinal-group: 10; -ms-flex-order: 9; order: 9; } .order-10 { -webkit-box-ordinal-group: 11; -ms-flex-order: 10; order: 10; } .order-11 { -webkit-box-ordinal-group: 12; -ms-flex-order: 11; order: 11; } .order-12 { -webkit-box-ordinal-group: 13; -ms-flex-order: 12; order: 12; } .offset-1 { margin-left: 8.3333333333%; } .offset-2 { margin-left: 16.6666666667%; } .offset-3 { margin-left: 25%; } .offset-4 { margin-left: 33.3333333333%; } .offset-5 { margin-left: 41.6666666667%; } .offset-6 { margin-left: 50%; } .offset-7 { margin-left: 58.3333333333%; } .offset-8 { margin-left: 66.6666666667%; } .offset-9 { margin-left: 75%; } .offset-10 { margin-left: 83.3333333333%; } .offset-11 { margin-left: 91.6666666667%; } @media (min-width: 576px) { .col-sm { -ms-flex-preferred-size: 0; flex-basis: 0; -webkit-box-flex: 1; -ms-flex-positive: 1; flex-grow: 1; max-width: 100%; } .row-cols-sm-1 > * { -webkit-box-flex: 0; -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .row-cols-sm-2 > * { -webkit-box-flex: 0; -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .row-cols-sm-3 > * { -webkit-box-flex: 0; -ms-flex: 0 0 33.3333333333%; flex: 0 0 33.3333333333%; max-width: 33.3333333333%; } .row-cols-sm-4 > * { -webkit-box-flex: 0; -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .row-cols-sm-5 > * { -webkit-box-flex: 0; -ms-flex: 0 0 20%; flex: 0 0 20%; max-width: 20%; } .row-cols-sm-6 > * { -webkit-box-flex: 0; -ms-flex: 0 0 16.6666666667%; flex: 0 0 16.6666666667%; max-width: 16.6666666667%; } .col-sm-auto { -webkit-box-flex: 0; -ms-flex: 0 0 auto; flex: 0 0 auto; width: auto; max-width: 100%; } .col-sm-1 { -webkit-box-flex: 0; -ms-flex: 0 0 8.3333333333%; flex: 0 0 8.3333333333%; max-width: 8.3333333333%; } .col-sm-2 { -webkit-box-flex: 0; -ms-flex: 0 0 16.6666666667%; flex: 0 0 16.6666666667%; max-width: 16.6666666667%; } .col-sm-3 { -webkit-box-flex: 0; -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .col-sm-4 { -webkit-box-flex: 0; -ms-flex: 0 0 33.3333333333%; flex: 0 0 33.3333333333%; max-width: 33.3333333333%; } .col-sm-5 { -webkit-box-flex: 0; -ms-flex: 0 0 41.6666666667%; flex: 0 0 41.6666666667%; max-width: 41.6666666667%; } .col-sm-6 { -webkit-box-flex: 0; -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .col-sm-7 { -webkit-box-flex: 0; -ms-flex: 0 0 58.3333333333%; flex: 0 0 58.3333333333%; max-width: 58.3333333333%; } .col-sm-8 { -webkit-box-flex: 0; -ms-flex: 0 0 66.6666666667%; flex: 0 0 66.6666666667%; max-width: 66.6666666667%; } .col-sm-9 { -webkit-box-flex: 0; -ms-flex: 0 0 75%; flex: 0 0 75%; max-width: 75%; } .col-sm-10 { -webkit-box-flex: 0; -ms-flex: 0 0 83.3333333333%; flex: 0 0 83.3333333333%; max-width: 83.3333333333%; } .col-sm-11 { -webkit-box-flex: 0; -ms-flex: 0 0 91.6666666667%; flex: 0 0 91.6666666667%; max-width: 91.6666666667%; } .col-sm-12 { -webkit-box-flex: 0; -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .order-sm-first { -webkit-box-ordinal-group: 0; -ms-flex-order: -1; order: -1; } .order-sm-last { -webkit-box-ordinal-group: 14; -ms-flex-order: 13; order: 13; } .order-sm-0 { -webkit-box-ordinal-group: 1; -ms-flex-order: 0; order: 0; } .order-sm-1 { -webkit-box-ordinal-group: 2; -ms-flex-order: 1; order: 1; } .order-sm-2 { -webkit-box-ordinal-group: 3; -ms-flex-order: 2; order: 2; } .order-sm-3 { -webkit-box-ordinal-group: 4; -ms-flex-order: 3; order: 3; } .order-sm-4 { -webkit-box-ordinal-group: 5; -ms-flex-order: 4; order: 4; } .order-sm-5 { -webkit-box-ordinal-group: 6; -ms-flex-order: 5; order: 5; } .order-sm-6 { -webkit-box-ordinal-group: 7; -ms-flex-order: 6; order: 6; } .order-sm-7 { -webkit-box-ordinal-group: 8; -ms-flex-order: 7; order: 7; } .order-sm-8 { -webkit-box-ordinal-group: 9; -ms-flex-order: 8; order: 8; } .order-sm-9 { -webkit-box-ordinal-group: 10; -ms-flex-order: 9; order: 9; } .order-sm-10 { -webkit-box-ordinal-group: 11; -ms-flex-order: 10; order: 10; } .order-sm-11 { -webkit-box-ordinal-group: 12; -ms-flex-order: 11; order: 11; } .order-sm-12 { -webkit-box-ordinal-group: 13; -ms-flex-order: 12; order: 12; } .offset-sm-0 { margin-left: 0; } .offset-sm-1 { margin-left: 8.3333333333%; } .offset-sm-2 { margin-left: 16.6666666667%; } .offset-sm-3 { margin-left: 25%; } .offset-sm-4 { margin-left: 33.3333333333%; } .offset-sm-5 { margin-left: 41.6666666667%; } .offset-sm-6 { margin-left: 50%; } .offset-sm-7 { margin-left: 58.3333333333%; } .offset-sm-8 { margin-left: 66.6666666667%; } .offset-sm-9 { margin-left: 75%; } .offset-sm-10 { margin-left: 83.3333333333%; } .offset-sm-11 { margin-left: 91.6666666667%; } } @media (min-width: 768px) { .col-md { -ms-flex-preferred-size: 0; flex-basis: 0; -webkit-box-flex: 1; -ms-flex-positive: 1; flex-grow: 1; max-width: 100%; } .row-cols-md-1 > * { -webkit-box-flex: 0; -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .row-cols-md-2 > * { -webkit-box-flex: 0; -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .row-cols-md-3 > * { -webkit-box-flex: 0; -ms-flex: 0 0 33.3333333333%; flex: 0 0 33.3333333333%; max-width: 33.3333333333%; } .row-cols-md-4 > * { -webkit-box-flex: 0; -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .row-cols-md-5 > * { -webkit-box-flex: 0; -ms-flex: 0 0 20%; flex: 0 0 20%; max-width: 20%; } .row-cols-md-6 > * { -webkit-box-flex: 0; -ms-flex: 0 0 16.6666666667%; flex: 0 0 16.6666666667%; max-width: 16.6666666667%; } .col-md-auto { -webkit-box-flex: 0; -ms-flex: 0 0 auto; flex: 0 0 auto; width: auto; max-width: 100%; } .col-md-1 { -webkit-box-flex: 0; -ms-flex: 0 0 8.3333333333%; flex: 0 0 8.3333333333%; max-width: 8.3333333333%; } .col-md-2 { -webkit-box-flex: 0; -ms-flex: 0 0 16.6666666667%; flex: 0 0 16.6666666667%; max-width: 16.6666666667%; } .col-md-3 { -webkit-box-flex: 0; -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .col-md-4 { -webkit-box-flex: 0; -ms-flex: 0 0 33.3333333333%; flex: 0 0 33.3333333333%; max-width: 33.3333333333%; } .col-md-5 { -webkit-box-flex: 0; -ms-flex: 0 0 41.6666666667%; flex: 0 0 41.6666666667%; max-width: 41.6666666667%; } .col-md-6 { -webkit-box-flex: 0; -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .col-md-7 { -webkit-box-flex: 0; -ms-flex: 0 0 58.3333333333%; flex: 0 0 58.3333333333%; max-width: 58.3333333333%; } .col-md-8 { -webkit-box-flex: 0; -ms-flex: 0 0 66.6666666667%; flex: 0 0 66.6666666667%; max-width: 66.6666666667%; } .col-md-9 { -webkit-box-flex: 0; -ms-flex: 0 0 75%; flex: 0 0 75%; max-width: 75%; } .col-md-10 { -webkit-box-flex: 0; -ms-flex: 0 0 83.3333333333%; flex: 0 0 83.3333333333%; max-width: 83.3333333333%; } .col-md-11 { -webkit-box-flex: 0; -ms-flex: 0 0 91.6666666667%; flex: 0 0 91.6666666667%; max-width: 91.6666666667%; } .col-md-12 { -webkit-box-flex: 0; -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .order-md-first { -webkit-box-ordinal-group: 0; -ms-flex-order: -1; order: -1; } .order-md-last { -webkit-box-ordinal-group: 14; -ms-flex-order: 13; order: 13; } .order-md-0 { -webkit-box-ordinal-group: 1; -ms-flex-order: 0; order: 0; } .order-md-1 { -webkit-box-ordinal-group: 2; -ms-flex-order: 1; order: 1; } .order-md-2 { -webkit-box-ordinal-group: 3; -ms-flex-order: 2; order: 2; } .order-md-3 { -webkit-box-ordinal-group: 4; -ms-flex-order: 3; order: 3; } .order-md-4 { -webkit-box-ordinal-group: 5; -ms-flex-order: 4; order: 4; } .order-md-5 { -webkit-box-ordinal-group: 6; -ms-flex-order: 5; order: 5; } .order-md-6 { -webkit-box-ordinal-group: 7; -ms-flex-order: 6; order: 6; } .order-md-7 { -webkit-box-ordinal-group: 8; -ms-flex-order: 7; order: 7; } .order-md-8 { -webkit-box-ordinal-group: 9; -ms-flex-order: 8; order: 8; } .order-md-9 { -webkit-box-ordinal-group: 10; -ms-flex-order: 9; order: 9; } .order-md-10 { -webkit-box-ordinal-group: 11; -ms-flex-order: 10; order: 10; } .order-md-11 { -webkit-box-ordinal-group: 12; -ms-flex-order: 11; order: 11; } .order-md-12 { -webkit-box-ordinal-group: 13; -ms-flex-order: 12; order: 12; } .offset-md-0 { margin-left: 0; } .offset-md-1 { margin-left: 8.3333333333%; } .offset-md-2 { margin-left: 16.6666666667%; } .offset-md-3 { margin-left: 25%; } .offset-md-4 { margin-left: 33.3333333333%; } .offset-md-5 { margin-left: 41.6666666667%; } .offset-md-6 { margin-left: 50%; } .offset-md-7 { margin-left: 58.3333333333%; } .offset-md-8 { margin-left: 66.6666666667%; } .offset-md-9 { margin-left: 75%; } .offset-md-10 { margin-left: 83.3333333333%; } .offset-md-11 { margin-left: 91.6666666667%; } } @media (min-width: 992px) { .col-lg { -ms-flex-preferred-size: 0; flex-basis: 0; -webkit-box-flex: 1; -ms-flex-positive: 1; flex-grow: 1; max-width: 100%; } .row-cols-lg-1 > * { -webkit-box-flex: 0; -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .row-cols-lg-2 > * { -webkit-box-flex: 0; -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .row-cols-lg-3 > * { -webkit-box-flex: 0; -ms-flex: 0 0 33.3333333333%; flex: 0 0 33.3333333333%; max-width: 33.3333333333%; } .row-cols-lg-4 > * { -webkit-box-flex: 0; -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .row-cols-lg-5 > * { -webkit-box-flex: 0; -ms-flex: 0 0 20%; flex: 0 0 20%; max-width: 20%; } .row-cols-lg-6 > * { -webkit-box-flex: 0; -ms-flex: 0 0 16.6666666667%; flex: 0 0 16.6666666667%; max-width: 16.6666666667%; } .col-lg-auto { -webkit-box-flex: 0; -ms-flex: 0 0 auto; flex: 0 0 auto; width: auto; max-width: 100%; } .col-lg-1 { -webkit-box-flex: 0; -ms-flex: 0 0 8.3333333333%; flex: 0 0 8.3333333333%; max-width: 8.3333333333%; } .col-lg-2 { -webkit-box-flex: 0; -ms-flex: 0 0 16.6666666667%; flex: 0 0 16.6666666667%; max-width: 16.6666666667%; } .col-lg-3 { -webkit-box-flex: 0; -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .col-lg-4 { -webkit-box-flex: 0; -ms-flex: 0 0 33.3333333333%; flex: 0 0 33.3333333333%; max-width: 33.3333333333%; } .col-lg-5 { -webkit-box-flex: 0; -ms-flex: 0 0 41.6666666667%; flex: 0 0 41.6666666667%; max-width: 41.6666666667%; } .col-lg-6 { -webkit-box-flex: 0; -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .col-lg-7 { -webkit-box-flex: 0; -ms-flex: 0 0 58.3333333333%; flex: 0 0 58.3333333333%; max-width: 58.3333333333%; } .col-lg-8 { -webkit-box-flex: 0; -ms-flex: 0 0 66.6666666667%; flex: 0 0 66.6666666667%; max-width: 66.6666666667%; } .col-lg-9 { -webkit-box-flex: 0; -ms-flex: 0 0 75%; flex: 0 0 75%; max-width: 75%; } .col-lg-10 { -webkit-box-flex: 0; -ms-flex: 0 0 83.3333333333%; flex: 0 0 83.3333333333%; max-width: 83.3333333333%; } .col-lg-11 { -webkit-box-flex: 0; -ms-flex: 0 0 91.6666666667%; flex: 0 0 91.6666666667%; max-width: 91.6666666667%; } .col-lg-12 { -webkit-box-flex: 0; -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .order-lg-first { -webkit-box-ordinal-group: 0; -ms-flex-order: -1; order: -1; } .order-lg-last { -webkit-box-ordinal-group: 14; -ms-flex-order: 13; order: 13; } .order-lg-0 { -webkit-box-ordinal-group: 1; -ms-flex-order: 0; order: 0; } .order-lg-1 { -webkit-box-ordinal-group: 2; -ms-flex-order: 1; order: 1; } .order-lg-2 { -webkit-box-ordinal-group: 3; -ms-flex-order: 2; order: 2; } .order-lg-3 { -webkit-box-ordinal-group: 4; -ms-flex-order: 3; order: 3; } .order-lg-4 { -webkit-box-ordinal-group: 5; -ms-flex-order: 4; order: 4; } .order-lg-5 { -webkit-box-ordinal-group: 6; -ms-flex-order: 5; order: 5; } .order-lg-6 { -webkit-box-ordinal-group: 7; -ms-flex-order: 6; order: 6; } .order-lg-7 { -webkit-box-ordinal-group: 8; -ms-flex-order: 7; order: 7; } .order-lg-8 { -webkit-box-ordinal-group: 9; -ms-flex-order: 8; order: 8; } .order-lg-9 { -webkit-box-ordinal-group: 10; -ms-flex-order: 9; order: 9; } .order-lg-10 { -webkit-box-ordinal-group: 11; -ms-flex-order: 10; order: 10; } .order-lg-11 { -webkit-box-ordinal-group: 12; -ms-flex-order: 11; order: 11; } .order-lg-12 { -webkit-box-ordinal-group: 13; -ms-flex-order: 12; order: 12; } .offset-lg-0 { margin-left: 0; } .offset-lg-1 { margin-left: 8.3333333333%; } .offset-lg-2 { margin-left: 16.6666666667%; } .offset-lg-3 { margin-left: 25%; } .offset-lg-4 { margin-left: 33.3333333333%; } .offset-lg-5 { margin-left: 41.6666666667%; } .offset-lg-6 { margin-left: 50%; } .offset-lg-7 { margin-left: 58.3333333333%; } .offset-lg-8 { margin-left: 66.6666666667%; } .offset-lg-9 { margin-left: 75%; } .offset-lg-10 { margin-left: 83.3333333333%; } .offset-lg-11 { margin-left: 91.6666666667%; } } @media (min-width: 1200px) { .col-xl { -ms-flex-preferred-size: 0; flex-basis: 0; -webkit-box-flex: 1; -ms-flex-positive: 1; flex-grow: 1; max-width: 100%; } .row-cols-xl-1 > * { -webkit-box-flex: 0; -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .row-cols-xl-2 > * { -webkit-box-flex: 0; -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .row-cols-xl-3 > * { -webkit-box-flex: 0; -ms-flex: 0 0 33.3333333333%; flex: 0 0 33.3333333333%; max-width: 33.3333333333%; } .row-cols-xl-4 > * { -webkit-box-flex: 0; -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .row-cols-xl-5 > * { -webkit-box-flex: 0; -ms-flex: 0 0 20%; flex: 0 0 20%; max-width: 20%; } .row-cols-xl-6 > * { -webkit-box-flex: 0; -ms-flex: 0 0 16.6666666667%; flex: 0 0 16.6666666667%; max-width: 16.6666666667%; } .col-xl-auto { -webkit-box-flex: 0; -ms-flex: 0 0 auto; flex: 0 0 auto; width: auto; max-width: 100%; } .col-xl-1 { -webkit-box-flex: 0; -ms-flex: 0 0 8.3333333333%; flex: 0 0 8.3333333333%; max-width: 8.3333333333%; } .col-xl-2 { -webkit-box-flex: 0; -ms-flex: 0 0 16.6666666667%; flex: 0 0 16.6666666667%; max-width: 16.6666666667%; } .col-xl-3 { -webkit-box-flex: 0; -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .col-xl-4 { -webkit-box-flex: 0; -ms-flex: 0 0 33.3333333333%; flex: 0 0 33.3333333333%; max-width: 33.3333333333%; } .col-xl-5 { -webkit-box-flex: 0; -ms-flex: 0 0 41.6666666667%; flex: 0 0 41.6666666667%; max-width: 41.6666666667%; } .col-xl-6 { -webkit-box-flex: 0; -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .col-xl-7 { -webkit-box-flex: 0; -ms-flex: 0 0 58.3333333333%; flex: 0 0 58.3333333333%; max-width: 58.3333333333%; } .col-xl-8 { -webkit-box-flex: 0; -ms-flex: 0 0 66.6666666667%; flex: 0 0 66.6666666667%; max-width: 66.6666666667%; } .col-xl-9 { -webkit-box-flex: 0; -ms-flex: 0 0 75%; flex: 0 0 75%; max-width: 75%; } .col-xl-10 { -webkit-box-flex: 0; -ms-flex: 0 0 83.3333333333%; flex: 0 0 83.3333333333%; max-width: 83.3333333333%; } .col-xl-11 { -webkit-box-flex: 0; -ms-flex: 0 0 91.6666666667%; flex: 0 0 91.6666666667%; max-width: 91.6666666667%; } .col-xl-12 { -webkit-box-flex: 0; -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .order-xl-first { -webkit-box-ordinal-group: 0; -ms-flex-order: -1; order: -1; } .order-xl-last { -webkit-box-ordinal-group: 14; -ms-flex-order: 13; order: 13; } .order-xl-0 { -webkit-box-ordinal-group: 1; -ms-flex-order: 0; order: 0; } .order-xl-1 { -webkit-box-ordinal-group: 2; -ms-flex-order: 1; order: 1; } .order-xl-2 { -webkit-box-ordinal-group: 3; -ms-flex-order: 2; order: 2; } .order-xl-3 { -webkit-box-ordinal-group: 4; -ms-flex-order: 3; order: 3; } .order-xl-4 { -webkit-box-ordinal-group: 5; -ms-flex-order: 4; order: 4; } .order-xl-5 { -webkit-box-ordinal-group: 6; -ms-flex-order: 5; order: 5; } .order-xl-6 { -webkit-box-ordinal-group: 7; -ms-flex-order: 6; order: 6; } .order-xl-7 { -webkit-box-ordinal-group: 8; -ms-flex-order: 7; order: 7; } .order-xl-8 { -webkit-box-ordinal-group: 9; -ms-flex-order: 8; order: 8; } .order-xl-9 { -webkit-box-ordinal-group: 10; -ms-flex-order: 9; order: 9; } .order-xl-10 { -webkit-box-ordinal-group: 11; -ms-flex-order: 10; order: 10; } .order-xl-11 { -webkit-box-ordinal-group: 12; -ms-flex-order: 11; order: 11; } .order-xl-12 { -webkit-box-ordinal-group: 13; -ms-flex-order: 12; order: 12; } .offset-xl-0 { margin-left: 0; } .offset-xl-1 { margin-left: 8.3333333333%; } .offset-xl-2 { margin-left: 16.6666666667%; } .offset-xl-3 { margin-left: 25%; } .offset-xl-4 { margin-left: 33.3333333333%; } .offset-xl-5 { margin-left: 41.6666666667%; } .offset-xl-6 { margin-left: 50%; } .offset-xl-7 { margin-left: 58.3333333333%; } .offset-xl-8 { margin-left: 66.6666666667%; } .offset-xl-9 { margin-left: 75%; } .offset-xl-10 { margin-left: 83.3333333333%; } .offset-xl-11 { margin-left: 91.6666666667%; } } @media (min-width: 1400px) { .col-xxl { -ms-flex-preferred-size: 0; flex-basis: 0; -webkit-box-flex: 1; -ms-flex-positive: 1; flex-grow: 1; max-width: 100%; } .row-cols-xxl-1 > * { -webkit-box-flex: 0; -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .row-cols-xxl-2 > * { -webkit-box-flex: 0; -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .row-cols-xxl-3 > * { -webkit-box-flex: 0; -ms-flex: 0 0 33.3333333333%; flex: 0 0 33.3333333333%; max-width: 33.3333333333%; } .row-cols-xxl-4 > * { -webkit-box-flex: 0; -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .row-cols-xxl-5 > * { -webkit-box-flex: 0; -ms-flex: 0 0 20%; flex: 0 0 20%; max-width: 20%; } .row-cols-xxl-6 > * { -webkit-box-flex: 0; -ms-flex: 0 0 16.6666666667%; flex: 0 0 16.6666666667%; max-width: 16.6666666667%; } .col-xxl-auto { -webkit-box-flex: 0; -ms-flex: 0 0 auto; flex: 0 0 auto; width: auto; max-width: 100%; } .col-xxl-1 { -webkit-box-flex: 0; -ms-flex: 0 0 8.3333333333%; flex: 0 0 8.3333333333%; max-width: 8.3333333333%; } .col-xxl-2 { -webkit-box-flex: 0; -ms-flex: 0 0 16.6666666667%; flex: 0 0 16.6666666667%; max-width: 16.6666666667%; } .col-xxl-3 { -webkit-box-flex: 0; -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .col-xxl-4 { -webkit-box-flex: 0; -ms-flex: 0 0 33.3333333333%; flex: 0 0 33.3333333333%; max-width: 33.3333333333%; } .col-xxl-5 { -webkit-box-flex: 0; -ms-flex: 0 0 41.6666666667%; flex: 0 0 41.6666666667%; max-width: 41.6666666667%; } .col-xxl-6 { -webkit-box-flex: 0; -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .col-xxl-7 { -webkit-box-flex: 0; -ms-flex: 0 0 58.3333333333%; flex: 0 0 58.3333333333%; max-width: 58.3333333333%; } .col-xxl-8 { -webkit-box-flex: 0; -ms-flex: 0 0 66.6666666667%; flex: 0 0 66.6666666667%; max-width: 66.6666666667%; } .col-xxl-9 { -webkit-box-flex: 0; -ms-flex: 0 0 75%; flex: 0 0 75%; max-width: 75%; } .col-xxl-10 { -webkit-box-flex: 0; -ms-flex: 0 0 83.3333333333%; flex: 0 0 83.3333333333%; max-width: 83.3333333333%; } .col-xxl-11 { -webkit-box-flex: 0; -ms-flex: 0 0 91.6666666667%; flex: 0 0 91.6666666667%; max-width: 91.6666666667%; } .col-xxl-12 { -webkit-box-flex: 0; -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .order-xxl-first { -webkit-box-ordinal-group: 0; -ms-flex-order: -1; order: -1; } .order-xxl-last { -webkit-box-ordinal-group: 14; -ms-flex-order: 13; order: 13; } .order-xxl-0 { -webkit-box-ordinal-group: 1; -ms-flex-order: 0; order: 0; } .order-xxl-1 { -webkit-box-ordinal-group: 2; -ms-flex-order: 1; order: 1; } .order-xxl-2 { -webkit-box-ordinal-group: 3; -ms-flex-order: 2; order: 2; } .order-xxl-3 { -webkit-box-ordinal-group: 4; -ms-flex-order: 3; order: 3; } .order-xxl-4 { -webkit-box-ordinal-group: 5; -ms-flex-order: 4; order: 4; } .order-xxl-5 { -webkit-box-ordinal-group: 6; -ms-flex-order: 5; order: 5; } .order-xxl-6 { -webkit-box-ordinal-group: 7; -ms-flex-order: 6; order: 6; } .order-xxl-7 { -webkit-box-ordinal-group: 8; -ms-flex-order: 7; order: 7; } .order-xxl-8 { -webkit-box-ordinal-group: 9; -ms-flex-order: 8; order: 8; } .order-xxl-9 { -webkit-box-ordinal-group: 10; -ms-flex-order: 9; order: 9; } .order-xxl-10 { -webkit-box-ordinal-group: 11; -ms-flex-order: 10; order: 10; } .order-xxl-11 { -webkit-box-ordinal-group: 12; -ms-flex-order: 11; order: 11; } .order-xxl-12 { -webkit-box-ordinal-group: 13; -ms-flex-order: 12; order: 12; } .offset-xxl-0 { margin-left: 0; } .offset-xxl-1 { margin-left: 8.3333333333%; } .offset-xxl-2 { margin-left: 16.6666666667%; } .offset-xxl-3 { margin-left: 25%; } .offset-xxl-4 { margin-left: 33.3333333333%; } .offset-xxl-5 { margin-left: 41.6666666667%; } .offset-xxl-6 { margin-left: 50%; } .offset-xxl-7 { margin-left: 58.3333333333%; } .offset-xxl-8 { margin-left: 66.6666666667%; } .offset-xxl-9 { margin-left: 75%; } .offset-xxl-10 { margin-left: 83.3333333333%; } .offset-xxl-11 { margin-left: 91.6666666667%; } } .table { width: 100%; margin-bottom: 1rem; color: #212529; } .table th, .table td { padding: 0.75rem; vertical-align: top; border-top: 1px solid #dee2e6; } .table thead th { vertical-align: bottom; border-bottom: 2px solid #dee2e6; } .table tbody + tbody { border-top: 2px solid #dee2e6; } .table-sm th, .table-sm td { padding: 0.3rem; } .table-bordered { border: 1px solid #dee2e6; } .table-bordered th, .table-bordered td { border: 1px solid #dee2e6; } .table-bordered thead th, .table-bordered thead td { border-bottom-width: 2px; } .table-borderless th, .table-borderless td, .table-borderless thead th, .table-borderless tbody + tbody { border: 0; } .table-striped tbody tr:nth-of-type(odd) { background-color: rgba(0, 0, 0, 0.05); } .table-hover tbody tr:hover { color: #212529; background-color: rgba(0, 0, 0, 0.075); } .table-primary, .table-primary > th, .table-primary > td { background-color: #b8c7b9; } .table-primary th, .table-primary td, .table-primary thead th, .table-primary tbody + tbody { border-color: #7b967d; } .table-hover .table-primary:hover { background-color: #aabcab; } .table-hover .table-primary:hover > td, .table-hover .table-primary:hover > th { background-color: #aabcab; } .table-secondary, .table-secondary > th, .table-secondary > td { background-color: #fefdfc; } .table-secondary th, .table-secondary td, .table-secondary thead th, .table-secondary tbody + tbody { border-color: #fcfbfa; } .table-hover .table-secondary:hover { background-color: #f8f0e9; } .table-hover .table-secondary:hover > td, .table-hover .table-secondary:hover > th { background-color: #f8f0e9; } .table-success, .table-success > th, .table-success > td { background-color: #c3e6cb; } .table-success th, .table-success td, .table-success thead th, .table-success tbody + tbody { border-color: #8fd19e; } .table-hover .table-success:hover { background-color: #b1dfbb; } .table-hover .table-success:hover > td, .table-hover .table-success:hover > th { background-color: #b1dfbb; } .table-info, .table-info > th, .table-info > td { background-color: #bee5eb; } .table-info th, .table-info td, .table-info thead th, .table-info tbody + tbody { border-color: #86cfda; } .table-hover .table-info:hover { background-color: #abdde5; } .table-hover .table-info:hover > td, .table-hover .table-info:hover > th { background-color: #abdde5; } .table-warning, .table-warning > th, .table-warning > td { background-color: #ffeeba; } .table-warning th, .table-warning td, .table-warning thead th, .table-warning tbody + tbody { border-color: #ffdf7e; } .table-hover .table-warning:hover { background-color: #ffe8a1; } .table-hover .table-warning:hover > td, .table-hover .table-warning:hover > th { background-color: #ffe8a1; } .table-danger, .table-danger > th, .table-danger > td { background-color: #f5c6cb; } .table-danger th, .table-danger td, .table-danger thead th, .table-danger tbody + tbody { border-color: #ed969e; } .table-hover .table-danger:hover { background-color: #f1b0b7; } .table-hover .table-danger:hover > td, .table-hover .table-danger:hover > th { background-color: #f1b0b7; } .table-light, .table-light > th, .table-light > td { background-color: #e6e4e4; } .table-light th, .table-light td, .table-light thead th, .table-light tbody + tbody { border-color: #d0cdcd; } .table-hover .table-light:hover { background-color: #dad7d7; } .table-hover .table-light:hover > td, .table-hover .table-light:hover > th { background-color: #dad7d7; } .table-dark, .table-dark > th, .table-dark > td { background-color: #c6c8ca; } .table-dark th, .table-dark td, .table-dark thead th, .table-dark tbody + tbody { border-color: #95999c; } .table-hover .table-dark:hover { background-color: #b9bbbe; } .table-hover .table-dark:hover > td, .table-hover .table-dark:hover > th { background-color: #b9bbbe; } .table-active, .table-active > th, .table-active > td { background-color: rgba(0, 0, 0, 0.075); } .table-hover .table-active:hover { background-color: rgba(0, 0, 0, 0.075); } .table-hover .table-active:hover > td, .table-hover .table-active:hover > th { background-color: rgba(0, 0, 0, 0.075); } .table .thead-dark th { color: #fff; background-color: #343a40; border-color: #454d55; } .table .thead-light th { color: #495057; background-color: #9ca0a2; border-color: #dee2e6; } .table-dark { color: #fff; background-color: #343a40; } .table-dark th, .table-dark td, .table-dark thead th { border-color: #454d55; } .table-dark.table-bordered { border: 0; } .table-dark.table-striped tbody tr:nth-of-type(odd) { background-color: rgba(255, 255, 255, 0.05); } .table-dark.table-hover tbody tr:hover { color: #fff; background-color: rgba(255, 255, 255, 0.075); } @media (max-width: 575.98px) { .table-responsive-sm { display: block; width: 100%; overflow-x: auto; -webkit-overflow-scrolling: touch; } .table-responsive-sm > .table-bordered { border: 0; } } @media (max-width: 767.98px) { .table-responsive-md { display: block; width: 100%; overflow-x: auto; -webkit-overflow-scrolling: touch; } .table-responsive-md > .table-bordered { border: 0; } } @media (max-width: 991.98px) { .table-responsive-lg { display: block; width: 100%; overflow-x: auto; -webkit-overflow-scrolling: touch; } .table-responsive-lg > .table-bordered { border: 0; } } @media (max-width: 1199.98px) { .table-responsive-xl { display: block; width: 100%; overflow-x: auto; -webkit-overflow-scrolling: touch; } .table-responsive-xl > .table-bordered { border: 0; } } @media (max-width: 1399.98px) { .table-responsive-xxl { display: block; width: 100%; overflow-x: auto; -webkit-overflow-scrolling: touch; } .table-responsive-xxl > .table-bordered { border: 0; } } .table-responsive { display: block; width: 100%; overflow-x: auto; -webkit-overflow-scrolling: touch; } .table-responsive > .table-bordered { border: 0; } .form-control, .comment-form input[type=text], .comment-form input[type=email], .comment-form input[type=url], .comment-form textarea { display: block; width: 100%; height: calc(1.5em + 0.75rem + 2px); padding: 0.375rem 0.75rem; font-size: 1rem; font-weight: 400; line-height: 1.5; color: #495057; background-color: #fff; background-clip: padding-box; border: 1px solid #ced4da; border-radius: 0.25rem; -webkit-transition: border-color 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; transition: border-color 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; -o-transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; } @media (prefers-reduced-motion: reduce) { .form-control, .comment-form input[type=text], .comment-form input[type=email], .comment-form input[type=url], .comment-form textarea { -webkit-transition: none; -o-transition: none; transition: none; } } .form-control::-ms-expand, .comment-form input[type=text]::-ms-expand, .comment-form input[type=email]::-ms-expand, .comment-form input[type=url]::-ms-expand, .comment-form textarea::-ms-expand { background-color: transparent; border: 0; } .form-control:-moz-focusring, .comment-form input[type=text]:-moz-focusring, .comment-form input[type=email]:-moz-focusring, .comment-form input[type=url]:-moz-focusring, .comment-form textarea:-moz-focusring { color: transparent; text-shadow: 0 0 0 #495057; } .form-control:focus, .comment-form input[type=text]:focus, .comment-form input[type=email]:focus, .comment-form input[type=url]:focus, .comment-form textarea:focus { color: #495057; background-color: #fff; border-color: #07b110; outline: 0; -webkit-box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.25); box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.25); } .form-control::-webkit-input-placeholder, .comment-form input[type=text]::-webkit-input-placeholder, .comment-form input[type=email]::-webkit-input-placeholder, .comment-form input[type=url]::-webkit-input-placeholder, .comment-form textarea::-webkit-input-placeholder { color: #6c757d; opacity: 1; } .form-control::-moz-placeholder, .comment-form input[type=text]::-moz-placeholder, .comment-form input[type=email]::-moz-placeholder, .comment-form input[type=url]::-moz-placeholder, .comment-form textarea::-moz-placeholder { color: #6c757d; opacity: 1; } .form-control:-ms-input-placeholder, .comment-form input[type=text]:-ms-input-placeholder, .comment-form input[type=email]:-ms-input-placeholder, .comment-form input[type=url]:-ms-input-placeholder, .comment-form textarea:-ms-input-placeholder { color: #6c757d; opacity: 1; } .form-control::-ms-input-placeholder, .comment-form input[type=text]::-ms-input-placeholder, .comment-form input[type=email]::-ms-input-placeholder, .comment-form input[type=url]::-ms-input-placeholder, .comment-form textarea::-ms-input-placeholder { color: #6c757d; opacity: 1; } .form-control::placeholder, .comment-form input[type=text]::placeholder, .comment-form input[type=email]::placeholder, .comment-form input[type=url]::placeholder, .comment-form textarea::placeholder { color: #6c757d; opacity: 1; } .form-control:disabled, .comment-form input[type=text]:disabled, .comment-form input[type=email]:disabled, .comment-form input[type=url]:disabled, .comment-form textarea:disabled, .form-control[readonly], .comment-form input[readonly][type=text], .comment-form input[readonly][type=email], .comment-form input[readonly][type=url], .comment-form textarea[readonly] { background-color: #9ca0a2; opacity: 1; } input[type=date].form-control, .comment-form input[type=date][type=text], .comment-form input[type=date][type=email], .comment-form input[type=date][type=url], input[type=time].form-control, .comment-form input[type=time][type=text], .comment-form input[type=time][type=email], .comment-form input[type=time][type=url], input[type=datetime-local].form-control, .comment-form input[type=datetime-local][type=text], .comment-form input[type=datetime-local][type=email], .comment-form input[type=datetime-local][type=url], input[type=month].form-control, .comment-form input[type=month][type=text], .comment-form input[type=month][type=email], .comment-form input[type=month][type=url] { -webkit-appearance: none; -moz-appearance: none; appearance: none; } select.form-control:focus::-ms-value { color: #495057; background-color: #fff; } .form-control-file, .form-control-range { display: block; width: 100%; } .col-form-label { padding-top: calc(0.375rem + 1px); padding-bottom: calc(0.375rem + 1px); margin-bottom: 0; font-size: inherit; line-height: 1.5; } .col-form-label-lg { padding-top: calc(0.5rem + 1px); padding-bottom: calc(0.5rem + 1px); font-size: 1.25rem; line-height: 1.5; } .col-form-label-sm { padding-top: calc(0.25rem + 1px); padding-bottom: calc(0.25rem + 1px); font-size: 0.875rem; line-height: 1.5; } .form-control-plaintext { display: block; width: 100%; padding: 0.375rem 0; margin-bottom: 0; font-size: 1rem; line-height: 1.5; color: #212529; background-color: transparent; border: solid transparent; border-width: 1px 0; } .form-control-plaintext.form-control-sm, .form-control-plaintext.form-control-lg { padding-right: 0; padding-left: 0; } .form-control-sm { height: calc(1.5em + 0.5rem + 2px); padding: 0.25rem 0.5rem; font-size: 0.875rem; line-height: 1.5; border-radius: 0.2rem; } .form-control-lg { height: calc(1.5em + 1rem + 2px); padding: 0.5rem 1rem; font-size: 1.25rem; line-height: 1.5; border-radius: 0.3rem; } select.form-control[size], select.form-control[multiple] { height: auto; } textarea.form-control, .comment-form textarea { height: auto; } .form-group, .comment-form p { margin-bottom: 1rem; } .form-text { display: block; margin-top: 0.25rem; } .form-row { display: -webkit-box; display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; margin-right: -5px; margin-left: -5px; } .form-row > .col, .form-row > [class*=col-] { padding-right: 5px; padding-left: 5px; } .form-check { position: relative; display: block; padding-left: 1.25rem; } .form-check-input { position: absolute; margin-top: 0.3rem; margin-left: -1.25rem; } .form-check-input[disabled] ~ .form-check-label, .form-check-input:disabled ~ .form-check-label { color: #6c757d; } .form-check-label { margin-bottom: 0; } .form-check-inline { display: -webkit-inline-box; display: -ms-inline-flexbox; display: inline-flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; padding-left: 0; margin-right: 0.75rem; } .form-check-inline .form-check-input { position: static; margin-top: 0; margin-right: 0.3125rem; margin-left: 0; } .valid-feedback { display: none; width: 100%; margin-top: 0.25rem; font-size: 80%; color: #28a745; } .valid-tooltip { position: absolute; top: 100%; left: 0; z-index: 5; display: none; max-width: 100%; padding: 0.25rem 0.5rem; margin-top: 0.1rem; font-size: 0.875rem; line-height: 1.5; color: #fff; background-color: rgba(40, 167, 69, 0.9); border-radius: 0.25rem; } .form-row > .col > .valid-tooltip, .form-row > [class*=col-] > .valid-tooltip { left: 5px; } .was-validated :valid ~ .valid-feedback, .was-validated :valid ~ .valid-tooltip, .is-valid ~ .valid-feedback, .is-valid ~ .valid-tooltip { display: block; } .was-validated .form-control:valid, .was-validated .comment-form input[type=text]:valid, .comment-form .was-validated input[type=text]:valid, .was-validated .comment-form input[type=email]:valid, .comment-form .was-validated input[type=email]:valid, .was-validated .comment-form input[type=url]:valid, .comment-form .was-validated input[type=url]:valid, .was-validated .comment-form textarea:valid, .comment-form .was-validated textarea:valid, .form-control.is-valid, .comment-form input.is-valid[type=text], .comment-form input.is-valid[type=email], .comment-form input.is-valid[type=url], .comment-form textarea.is-valid { border-color: #28a745; padding-right: calc(1.5em + 0.75rem); background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath fill='%2328a745' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e"); background-repeat: no-repeat; background-position: right calc(0.375em + 0.1875rem) center; background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); } .was-validated .form-control:valid:focus, .was-validated .comment-form input[type=text]:valid:focus, .comment-form .was-validated input[type=text]:valid:focus, .was-validated .comment-form input[type=email]:valid:focus, .comment-form .was-validated input[type=email]:valid:focus, .was-validated .comment-form input[type=url]:valid:focus, .comment-form .was-validated input[type=url]:valid:focus, .was-validated .comment-form textarea:valid:focus, .comment-form .was-validated textarea:valid:focus, .form-control.is-valid:focus, .comment-form input.is-valid[type=text]:focus, .comment-form input.is-valid[type=email]:focus, .comment-form input.is-valid[type=url]:focus, .comment-form textarea.is-valid:focus { border-color: #28a745; -webkit-box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25); box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25); } .was-validated textarea.form-control:valid, .was-validated .comment-form textarea:valid, .comment-form .was-validated textarea:valid, textarea.form-control.is-valid, .comment-form textarea.is-valid { padding-right: calc(1.5em + 0.75rem); background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem); } .was-validated .custom-select:valid, .custom-select.is-valid { border-color: #28a745; padding-right: calc(0.75em + 2.3125rem); background: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='5' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") right 0.75rem center/8px 10px no-repeat, #fff url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath fill='%2328a745' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e") center right 1.75rem/calc(0.75em + 0.375rem) calc(0.75em + 0.375rem) no-repeat; } .was-validated .custom-select:valid:focus, .custom-select.is-valid:focus { border-color: #28a745; -webkit-box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25); box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25); } .was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label { color: #28a745; } .was-validated .form-check-input:valid ~ .valid-feedback, .was-validated .form-check-input:valid ~ .valid-tooltip, .form-check-input.is-valid ~ .valid-feedback, .form-check-input.is-valid ~ .valid-tooltip { display: block; } .was-validated .custom-control-input:valid ~ .custom-control-label, .custom-control-input.is-valid ~ .custom-control-label { color: #28a745; } .was-validated .custom-control-input:valid ~ .custom-control-label::before, .custom-control-input.is-valid ~ .custom-control-label::before { border-color: #28a745; } .was-validated .custom-control-input:valid:checked ~ .custom-control-label::before, .custom-control-input.is-valid:checked ~ .custom-control-label::before { border-color: #34ce57; background-color: #34ce57; } .was-validated .custom-control-input:valid:focus ~ .custom-control-label::before, .custom-control-input.is-valid:focus ~ .custom-control-label::before { -webkit-box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25); box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25); } .was-validated .custom-control-input:valid:focus:not(:checked) ~ .custom-control-label::before, .custom-control-input.is-valid:focus:not(:checked) ~ .custom-control-label::before { border-color: #28a745; } .was-validated .custom-file-input:valid ~ .custom-file-label, .custom-file-input.is-valid ~ .custom-file-label { border-color: #28a745; } .was-validated .custom-file-input:valid:focus ~ .custom-file-label, .custom-file-input.is-valid:focus ~ .custom-file-label { border-color: #28a745; -webkit-box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25); box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25); } .invalid-feedback { display: none; width: 100%; margin-top: 0.25rem; font-size: 80%; color: #dc3545; } .invalid-tooltip { position: absolute; top: 100%; left: 0; z-index: 5; display: none; max-width: 100%; padding: 0.25rem 0.5rem; margin-top: 0.1rem; font-size: 0.875rem; line-height: 1.5; color: #fff; background-color: rgba(220, 53, 69, 0.9); border-radius: 0.25rem; } .form-row > .col > .invalid-tooltip, .form-row > [class*=col-] > .invalid-tooltip { left: 5px; } .was-validated :invalid ~ .invalid-feedback, .was-validated :invalid ~ .invalid-tooltip, .is-invalid ~ .invalid-feedback, .is-invalid ~ .invalid-tooltip { display: block; } .was-validated .form-control:invalid, .was-validated .comment-form input[type=text]:invalid, .comment-form .was-validated input[type=text]:invalid, .was-validated .comment-form input[type=email]:invalid, .comment-form .was-validated input[type=email]:invalid, .was-validated .comment-form input[type=url]:invalid, .comment-form .was-validated input[type=url]:invalid, .was-validated .comment-form textarea:invalid, .comment-form .was-validated textarea:invalid, .form-control.is-invalid, .comment-form input.is-invalid[type=text], .comment-form input.is-invalid[type=email], .comment-form input.is-invalid[type=url], .comment-form textarea.is-invalid { border-color: #dc3545; padding-right: calc(1.5em + 0.75rem); background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' fill='none' stroke='%23dc3545' viewBox='0 0 12 12'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e"); background-repeat: no-repeat; background-position: right calc(0.375em + 0.1875rem) center; background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); } .was-validated .form-control:invalid:focus, .was-validated .comment-form input[type=text]:invalid:focus, .comment-form .was-validated input[type=text]:invalid:focus, .was-validated .comment-form input[type=email]:invalid:focus, .comment-form .was-validated input[type=email]:invalid:focus, .was-validated .comment-form input[type=url]:invalid:focus, .comment-form .was-validated input[type=url]:invalid:focus, .was-validated .comment-form textarea:invalid:focus, .comment-form .was-validated textarea:invalid:focus, .form-control.is-invalid:focus, .comment-form input.is-invalid[type=text]:focus, .comment-form input.is-invalid[type=email]:focus, .comment-form input.is-invalid[type=url]:focus, .comment-form textarea.is-invalid:focus { border-color: #dc3545; -webkit-box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25); box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25); } .was-validated textarea.form-control:invalid, .was-validated .comment-form textarea:invalid, .comment-form .was-validated textarea:invalid, textarea.form-control.is-invalid, .comment-form textarea.is-invalid { padding-right: calc(1.5em + 0.75rem); background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem); } .was-validated .custom-select:invalid, .custom-select.is-invalid { border-color: #dc3545; padding-right: calc(0.75em + 2.3125rem); background: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='5' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") right 0.75rem center/8px 10px no-repeat, #fff url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' fill='none' stroke='%23dc3545' viewBox='0 0 12 12'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e") center right 1.75rem/calc(0.75em + 0.375rem) calc(0.75em + 0.375rem) no-repeat; } .was-validated .custom-select:invalid:focus, .custom-select.is-invalid:focus { border-color: #dc3545; -webkit-box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25); box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25); } .was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label { color: #dc3545; } .was-validated .form-check-input:invalid ~ .invalid-feedback, .was-validated .form-check-input:invalid ~ .invalid-tooltip, .form-check-input.is-invalid ~ .invalid-feedback, .form-check-input.is-invalid ~ .invalid-tooltip { display: block; } .was-validated .custom-control-input:invalid ~ .custom-control-label, .custom-control-input.is-invalid ~ .custom-control-label { color: #dc3545; } .was-validated .custom-control-input:invalid ~ .custom-control-label::before, .custom-control-input.is-invalid ~ .custom-control-label::before { border-color: #dc3545; } .was-validated .custom-control-input:invalid:checked ~ .custom-control-label::before, .custom-control-input.is-invalid:checked ~ .custom-control-label::before { border-color: #e4606d; background-color: #e4606d; } .was-validated .custom-control-input:invalid:focus ~ .custom-control-label::before, .custom-control-input.is-invalid:focus ~ .custom-control-label::before { -webkit-box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25); box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25); } .was-validated .custom-control-input:invalid:focus:not(:checked) ~ .custom-control-label::before, .custom-control-input.is-invalid:focus:not(:checked) ~ .custom-control-label::before { border-color: #dc3545; } .was-validated .custom-file-input:invalid ~ .custom-file-label, .custom-file-input.is-invalid ~ .custom-file-label { border-color: #dc3545; } .was-validated .custom-file-input:invalid:focus ~ .custom-file-label, .custom-file-input.is-invalid:focus ~ .custom-file-label { border-color: #dc3545; -webkit-box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25); box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25); } .form-inline { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-flow: row wrap; flex-flow: row wrap; -webkit-box-align: center; -ms-flex-align: center; align-items: center; } .form-inline .form-check { width: 100%; } @media (min-width: 576px) { .form-inline label { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; margin-bottom: 0; } .form-inline .form-group, .form-inline .comment-form p, .comment-form .form-inline p { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-flex: 0; -ms-flex: 0 0 auto; flex: 0 0 auto; -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-flow: row wrap; flex-flow: row wrap; -webkit-box-align: center; -ms-flex-align: center; align-items: center; margin-bottom: 0; } .form-inline .form-control, .form-inline .comment-form input[type=text], .comment-form .form-inline input[type=text], .form-inline .comment-form input[type=email], .comment-form .form-inline input[type=email], .form-inline .comment-form input[type=url], .comment-form .form-inline input[type=url], .form-inline .comment-form textarea, .comment-form .form-inline textarea { display: inline-block; width: auto; vertical-align: middle; } .form-inline .form-control-plaintext { display: inline-block; } .form-inline .input-group, .form-inline .custom-select { width: auto; } .form-inline .form-check { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; width: auto; padding-left: 0; } .form-inline .form-check-input { position: relative; -ms-flex-negative: 0; flex-shrink: 0; margin-top: 0; margin-right: 0.25rem; margin-left: 0; } .form-inline .custom-control { -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; } .form-inline .custom-control-label { margin-bottom: 0; } } .btn, .comment-form input[type=submit] { display: inline-block; font-weight: 400; color: #212529; text-align: center; vertical-align: middle; -webkit-user-select: none; -moz-user-select: none; -ms-user-select: none; user-select: none; background-color: transparent; border: 1px solid transparent; padding: 0.375rem 0.75rem; font-size: 1rem; line-height: 1.5; border-radius: 0.25rem; -webkit-transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; -o-transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; } @media (prefers-reduced-motion: reduce) { .btn, .comment-form input[type=submit] { -webkit-transition: none; -o-transition: none; transition: none; } } .btn:hover, .comment-form input[type=submit]:hover { color: #212529; text-decoration: none; } .btn:focus, .comment-form input[type=submit]:focus, .btn.focus, .comment-form input.focus[type=submit] { outline: 0; -webkit-box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.25); box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.25); } .btn.disabled, .comment-form input.disabled[type=submit], .btn:disabled, .comment-form input[type=submit]:disabled { opacity: 0.65; } .btn:not(:disabled):not(.disabled), .comment-form input[type=submit]:not(:disabled):not(.disabled) { cursor: pointer; } a.btn.disabled, fieldset:disabled a.btn { pointer-events: none; } .btn-primary { color: #fff; background-color: #023605; border-color: #023605; } .btn-primary:hover { color: #fff; background-color: #011102; border-color: #000500; } .btn-primary:focus, .btn-primary.focus { color: #fff; background-color: #011102; border-color: #000500; -webkit-box-shadow: 0 0 0 0.2rem rgba(40, 84, 43, 0.5); box-shadow: 0 0 0 0.2rem rgba(40, 84, 43, 0.5); } .btn-primary.disabled, .btn-primary:disabled { color: #fff; background-color: #023605; border-color: #023605; } .btn-primary:not(:disabled):not(.disabled):active, .btn-primary:not(:disabled):not(.disabled).active, .show > .btn-primary.dropdown-toggle { color: #fff; background-color: #000500; border-color: black; } .btn-primary:not(:disabled):not(.disabled):active:focus, .btn-primary:not(:disabled):not(.disabled).active:focus, .show > .btn-primary.dropdown-toggle:focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(40, 84, 43, 0.5); box-shadow: 0 0 0 0.2rem rgba(40, 84, 43, 0.5); } .btn-secondary, .comment-form input[type=submit] { color: #212529; background-color: #faf8f6; border-color: #faf8f6; } .btn-secondary:hover, .comment-form input[type=submit]:hover { color: #212529; background-color: #ece5dd; border-color: #e8dfd5; } .btn-secondary:focus, .comment-form input[type=submit]:focus, .btn-secondary.focus, .comment-form input.focus[type=submit] { color: #212529; background-color: #ece5dd; border-color: #e8dfd5; -webkit-box-shadow: 0 0 0 0.2rem rgba(217, 216, 215, 0.5); box-shadow: 0 0 0 0.2rem rgba(217, 216, 215, 0.5); } .btn-secondary.disabled, .comment-form input.disabled[type=submit], .btn-secondary:disabled, .comment-form input[type=submit]:disabled { color: #212529; background-color: #faf8f6; border-color: #faf8f6; } .btn-secondary:not(:disabled):not(.disabled):active, .comment-form input[type=submit]:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active, .comment-form input[type=submit]:not(:disabled):not(.disabled).active, .show > .btn-secondary.dropdown-toggle, .comment-form .show > input.dropdown-toggle[type=submit] { color: #212529; background-color: #e8dfd5; border-color: #e3d8cd; } .btn-secondary:not(:disabled):not(.disabled):active:focus, .comment-form input[type=submit]:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus, .comment-form input[type=submit]:not(:disabled):not(.disabled).active:focus, .show > .btn-secondary.dropdown-toggle:focus, .comment-form .show > input.dropdown-toggle[type=submit]:focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(217, 216, 215, 0.5); box-shadow: 0 0 0 0.2rem rgba(217, 216, 215, 0.5); } .btn-success { color: #fff; background-color: #28a745; border-color: #28a745; } .btn-success:hover { color: #fff; background-color: #218838; border-color: #1e7e34; } .btn-success:focus, .btn-success.focus { color: #fff; background-color: #218838; border-color: #1e7e34; -webkit-box-shadow: 0 0 0 0.2rem rgba(72, 180, 97, 0.5); box-shadow: 0 0 0 0.2rem rgba(72, 180, 97, 0.5); } .btn-success.disabled, .btn-success:disabled { color: #fff; background-color: #28a745; border-color: #28a745; } .btn-success:not(:disabled):not(.disabled):active, .btn-success:not(:disabled):not(.disabled).active, .show > .btn-success.dropdown-toggle { color: #fff; background-color: #1e7e34; border-color: #1c7430; } .btn-success:not(:disabled):not(.disabled):active:focus, .btn-success:not(:disabled):not(.disabled).active:focus, .show > .btn-success.dropdown-toggle:focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(72, 180, 97, 0.5); box-shadow: 0 0 0 0.2rem rgba(72, 180, 97, 0.5); } .btn-info { color: #fff; background-color: #17a2b8; border-color: #17a2b8; } .btn-info:hover { color: #fff; background-color: #138496; border-color: #117a8b; } .btn-info:focus, .btn-info.focus { color: #fff; background-color: #138496; border-color: #117a8b; -webkit-box-shadow: 0 0 0 0.2rem rgba(58, 176, 195, 0.5); box-shadow: 0 0 0 0.2rem rgba(58, 176, 195, 0.5); } .btn-info.disabled, .btn-info:disabled { color: #fff; background-color: #17a2b8; border-color: #17a2b8; } .btn-info:not(:disabled):not(.disabled):active, .btn-info:not(:disabled):not(.disabled).active, .show > .btn-info.dropdown-toggle { color: #fff; background-color: #117a8b; border-color: #10707f; } .btn-info:not(:disabled):not(.disabled):active:focus, .btn-info:not(:disabled):not(.disabled).active:focus, .show > .btn-info.dropdown-toggle:focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(58, 176, 195, 0.5); box-shadow: 0 0 0 0.2rem rgba(58, 176, 195, 0.5); } .btn-warning { color: #212529; background-color: #ffc107; border-color: #ffc107; } .btn-warning:hover { color: #212529; background-color: #e0a800; border-color: #d39e00; } .btn-warning:focus, .btn-warning.focus { color: #212529; background-color: #e0a800; border-color: #d39e00; -webkit-box-shadow: 0 0 0 0.2rem rgba(222, 170, 12, 0.5); box-shadow: 0 0 0 0.2rem rgba(222, 170, 12, 0.5); } .btn-warning.disabled, .btn-warning:disabled { color: #212529; background-color: #ffc107; border-color: #ffc107; } .btn-warning:not(:disabled):not(.disabled):active, .btn-warning:not(:disabled):not(.disabled).active, .show > .btn-warning.dropdown-toggle { color: #212529; background-color: #d39e00; border-color: #c69500; } .btn-warning:not(:disabled):not(.disabled):active:focus, .btn-warning:not(:disabled):not(.disabled).active:focus, .show > .btn-warning.dropdown-toggle:focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(222, 170, 12, 0.5); box-shadow: 0 0 0 0.2rem rgba(222, 170, 12, 0.5); } .btn-danger { color: #fff; background-color: #dc3545; border-color: #dc3545; } .btn-danger:hover { color: #fff; background-color: #c82333; border-color: #bd2130; } .btn-danger:focus, .btn-danger.focus { color: #fff; background-color: #c82333; border-color: #bd2130; -webkit-box-shadow: 0 0 0 0.2rem rgba(225, 83, 97, 0.5); box-shadow: 0 0 0 0.2rem rgba(225, 83, 97, 0.5); } .btn-danger.disabled, .btn-danger:disabled { color: #fff; background-color: #dc3545; border-color: #dc3545; } .btn-danger:not(:disabled):not(.disabled):active, .btn-danger:not(:disabled):not(.disabled).active, .show > .btn-danger.dropdown-toggle { color: #fff; background-color: #bd2130; border-color: #b21f2d; } .btn-danger:not(:disabled):not(.disabled):active:focus, .btn-danger:not(:disabled):not(.disabled).active:focus, .show > .btn-danger.dropdown-toggle:focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(225, 83, 97, 0.5); box-shadow: 0 0 0 0.2rem rgba(225, 83, 97, 0.5); } .btn-light { color: #212529; background-color: #a49f9f; border-color: #a49f9f; } .btn-light:hover { color: #fff; background-color: #918b8b; border-color: #8b8585; } .btn-light:focus, .btn-light.focus { color: #fff; background-color: #918b8b; border-color: #8b8585; -webkit-box-shadow: 0 0 0 0.2rem rgba(144, 141, 141, 0.5); box-shadow: 0 0 0 0.2rem rgba(144, 141, 141, 0.5); } .btn-light.disabled, .btn-light:disabled { color: #212529; background-color: #a49f9f; border-color: #a49f9f; } .btn-light:not(:disabled):not(.disabled):active, .btn-light:not(:disabled):not(.disabled).active, .show > .btn-light.dropdown-toggle { color: #fff; background-color: #8b8585; border-color: #857e7e; } .btn-light:not(:disabled):not(.disabled):active:focus, .btn-light:not(:disabled):not(.disabled).active:focus, .show > .btn-light.dropdown-toggle:focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(144, 141, 141, 0.5); box-shadow: 0 0 0 0.2rem rgba(144, 141, 141, 0.5); } .btn-dark { color: #fff; background-color: #343a40; border-color: #343a40; } .btn-dark:hover { color: #fff; background-color: #23272b; border-color: #1d2124; } .btn-dark:focus, .btn-dark.focus { color: #fff; background-color: #23272b; border-color: #1d2124; -webkit-box-shadow: 0 0 0 0.2rem rgba(82, 88, 93, 0.5); box-shadow: 0 0 0 0.2rem rgba(82, 88, 93, 0.5); } .btn-dark.disabled, .btn-dark:disabled { color: #fff; background-color: #343a40; border-color: #343a40; } .btn-dark:not(:disabled):not(.disabled):active, .btn-dark:not(:disabled):not(.disabled).active, .show > .btn-dark.dropdown-toggle { color: #fff; background-color: #1d2124; border-color: #171a1d; } .btn-dark:not(:disabled):not(.disabled):active:focus, .btn-dark:not(:disabled):not(.disabled).active:focus, .show > .btn-dark.dropdown-toggle:focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(82, 88, 93, 0.5); box-shadow: 0 0 0 0.2rem rgba(82, 88, 93, 0.5); } .btn-outline-primary { color: #023605; border-color: #023605; } .btn-outline-primary:hover { color: #fff; background-color: #023605; border-color: #023605; } .btn-outline-primary:focus, .btn-outline-primary.focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.5); box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.5); } .btn-outline-primary.disabled, .btn-outline-primary:disabled { color: #023605; background-color: transparent; } .btn-outline-primary:not(:disabled):not(.disabled):active, .btn-outline-primary:not(:disabled):not(.disabled).active, .show > .btn-outline-primary.dropdown-toggle { color: #fff; background-color: #023605; border-color: #023605; } .btn-outline-primary:not(:disabled):not(.disabled):active:focus, .btn-outline-primary:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-primary.dropdown-toggle:focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.5); box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.5); } .btn-outline-secondary { color: #faf8f6; border-color: #faf8f6; } .btn-outline-secondary:hover { color: #212529; background-color: #faf8f6; border-color: #faf8f6; } .btn-outline-secondary:focus, .btn-outline-secondary.focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(250, 248, 246, 0.5); box-shadow: 0 0 0 0.2rem rgba(250, 248, 246, 0.5); } .btn-outline-secondary.disabled, .btn-outline-secondary:disabled { color: #faf8f6; background-color: transparent; } .btn-outline-secondary:not(:disabled):not(.disabled):active, .btn-outline-secondary:not(:disabled):not(.disabled).active, .show > .btn-outline-secondary.dropdown-toggle { color: #212529; background-color: #faf8f6; border-color: #faf8f6; } .btn-outline-secondary:not(:disabled):not(.disabled):active:focus, .btn-outline-secondary:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-secondary.dropdown-toggle:focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(250, 248, 246, 0.5); box-shadow: 0 0 0 0.2rem rgba(250, 248, 246, 0.5); } .btn-outline-success { color: #28a745; border-color: #28a745; } .btn-outline-success:hover { color: #fff; background-color: #28a745; border-color: #28a745; } .btn-outline-success:focus, .btn-outline-success.focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5); box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5); } .btn-outline-success.disabled, .btn-outline-success:disabled { color: #28a745; background-color: transparent; } .btn-outline-success:not(:disabled):not(.disabled):active, .btn-outline-success:not(:disabled):not(.disabled).active, .show > .btn-outline-success.dropdown-toggle { color: #fff; background-color: #28a745; border-color: #28a745; } .btn-outline-success:not(:disabled):not(.disabled):active:focus, .btn-outline-success:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-success.dropdown-toggle:focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5); box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5); } .btn-outline-info { color: #17a2b8; border-color: #17a2b8; } .btn-outline-info:hover { color: #fff; background-color: #17a2b8; border-color: #17a2b8; } .btn-outline-info:focus, .btn-outline-info.focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5); box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5); } .btn-outline-info.disabled, .btn-outline-info:disabled { color: #17a2b8; background-color: transparent; } .btn-outline-info:not(:disabled):not(.disabled):active, .btn-outline-info:not(:disabled):not(.disabled).active, .show > .btn-outline-info.dropdown-toggle { color: #fff; background-color: #17a2b8; border-color: #17a2b8; } .btn-outline-info:not(:disabled):not(.disabled):active:focus, .btn-outline-info:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-info.dropdown-toggle:focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5); box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5); } .btn-outline-warning { color: #ffc107; border-color: #ffc107; } .btn-outline-warning:hover { color: #212529; background-color: #ffc107; border-color: #ffc107; } .btn-outline-warning:focus, .btn-outline-warning.focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5); box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5); } .btn-outline-warning.disabled, .btn-outline-warning:disabled { color: #ffc107; background-color: transparent; } .btn-outline-warning:not(:disabled):not(.disabled):active, .btn-outline-warning:not(:disabled):not(.disabled).active, .show > .btn-outline-warning.dropdown-toggle { color: #212529; background-color: #ffc107; border-color: #ffc107; } .btn-outline-warning:not(:disabled):not(.disabled):active:focus, .btn-outline-warning:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-warning.dropdown-toggle:focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5); box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5); } .btn-outline-danger { color: #dc3545; border-color: #dc3545; } .btn-outline-danger:hover { color: #fff; background-color: #dc3545; border-color: #dc3545; } .btn-outline-danger:focus, .btn-outline-danger.focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5); box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5); } .btn-outline-danger.disabled, .btn-outline-danger:disabled { color: #dc3545; background-color: transparent; } .btn-outline-danger:not(:disabled):not(.disabled):active, .btn-outline-danger:not(:disabled):not(.disabled).active, .show > .btn-outline-danger.dropdown-toggle { color: #fff; background-color: #dc3545; border-color: #dc3545; } .btn-outline-danger:not(:disabled):not(.disabled):active:focus, .btn-outline-danger:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-danger.dropdown-toggle:focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5); box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5); } .btn-outline-light { color: #a49f9f; border-color: #a49f9f; } .btn-outline-light:hover { color: #212529; background-color: #a49f9f; border-color: #a49f9f; } .btn-outline-light:focus, .btn-outline-light.focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(164, 159, 159, 0.5); box-shadow: 0 0 0 0.2rem rgba(164, 159, 159, 0.5); } .btn-outline-light.disabled, .btn-outline-light:disabled { color: #a49f9f; background-color: transparent; } .btn-outline-light:not(:disabled):not(.disabled):active, .btn-outline-light:not(:disabled):not(.disabled).active, .show > .btn-outline-light.dropdown-toggle { color: #212529; background-color: #a49f9f; border-color: #a49f9f; } .btn-outline-light:not(:disabled):not(.disabled):active:focus, .btn-outline-light:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-light.dropdown-toggle:focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(164, 159, 159, 0.5); box-shadow: 0 0 0 0.2rem rgba(164, 159, 159, 0.5); } .btn-outline-dark { color: #343a40; border-color: #343a40; } .btn-outline-dark:hover { color: #fff; background-color: #343a40; border-color: #343a40; } .btn-outline-dark:focus, .btn-outline-dark.focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5); box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5); } .btn-outline-dark.disabled, .btn-outline-dark:disabled { color: #343a40; background-color: transparent; } .btn-outline-dark:not(:disabled):not(.disabled):active, .btn-outline-dark:not(:disabled):not(.disabled).active, .show > .btn-outline-dark.dropdown-toggle { color: #fff; background-color: #343a40; border-color: #343a40; } .btn-outline-dark:not(:disabled):not(.disabled):active:focus, .btn-outline-dark:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-dark.dropdown-toggle:focus { -webkit-box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5); box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5); } .btn-link { font-weight: 400; color: #023605; text-decoration: none; } .btn-link:hover { color: black; text-decoration: underline; } .btn-link:focus, .btn-link.focus { text-decoration: underline; } .btn-link:disabled, .btn-link.disabled { color: #6c757d; pointer-events: none; } .btn-lg, .btn-group-lg > .btn, .comment-form .btn-group-lg > input[type=submit] { padding: 0.5rem 1rem; font-size: 1.25rem; line-height: 1.5; border-radius: 0.3rem; } .btn-sm, .btn-group-sm > .btn, .comment-form .btn-group-sm > input[type=submit] { padding: 0.25rem 0.5rem; font-size: 0.875rem; line-height: 1.5; border-radius: 0.2rem; } .btn-block { display: block; width: 100%; } .btn-block + .btn-block { margin-top: 0.5rem; } input[type=submit].btn-block, input[type=reset].btn-block, input[type=button].btn-block { width: 100%; } .fade { -webkit-transition: opacity 0.15s linear; -o-transition: opacity 0.15s linear; transition: opacity 0.15s linear; } @media (prefers-reduced-motion: reduce) { .fade { -webkit-transition: none; -o-transition: none; transition: none; } } .fade:not(.show) { opacity: 0; } .collapse:not(.show) { display: none; } .collapsing { position: relative; height: 0; overflow: hidden; -webkit-transition: height 0.35s ease; -o-transition: height 0.35s ease; transition: height 0.35s ease; } @media (prefers-reduced-motion: reduce) { .collapsing { -webkit-transition: none; -o-transition: none; transition: none; } } .dropup, .dropright, .dropdown, .dropleft { position: relative; } .dropdown-toggle { white-space: nowrap; } .dropdown-toggle::after { display: inline-block; margin-left: 0.255em; vertical-align: 0.255em; content: ""; border-top: 0.3em solid; border-right: 0.3em solid transparent; border-bottom: 0; border-left: 0.3em solid transparent; } .dropdown-toggle:empty::after { margin-left: 0; } .dropdown-menu { position: absolute; top: 100%; left: 0; z-index: 1000; display: none; float: left; min-width: 10rem; padding: 0.5rem 0; margin: 0.125rem 0 0; font-size: 1rem; color: #212529; text-align: left; list-style: none; background-color: #fff; background-clip: padding-box; border: 1px solid rgba(0, 0, 0, 0.15); border-radius: 0.25rem; } .dropdown-menu-left { right: auto; left: 0; } .dropdown-menu-right { right: 0; left: auto; } @media (min-width: 576px) { .dropdown-menu-sm-left { right: auto; left: 0; } .dropdown-menu-sm-right { right: 0; left: auto; } } @media (min-width: 768px) { .dropdown-menu-md-left { right: auto; left: 0; } .dropdown-menu-md-right { right: 0; left: auto; } } @media (min-width: 992px) { .dropdown-menu-lg-left { right: auto; left: 0; } .dropdown-menu-lg-right { right: 0; left: auto; } } @media (min-width: 1200px) { .dropdown-menu-xl-left { right: auto; left: 0; } .dropdown-menu-xl-right { right: 0; left: auto; } } @media (min-width: 1400px) { .dropdown-menu-xxl-left { right: auto; left: 0; } .dropdown-menu-xxl-right { right: 0; left: auto; } } .dropup .dropdown-menu { top: auto; bottom: 100%; margin-top: 0; margin-bottom: 0.125rem; } .dropup .dropdown-toggle::after { display: inline-block; margin-left: 0.255em; vertical-align: 0.255em; content: ""; border-top: 0; border-right: 0.3em solid transparent; border-bottom: 0.3em solid; border-left: 0.3em solid transparent; } .dropup .dropdown-toggle:empty::after { margin-left: 0; } .dropright .dropdown-menu { top: 0; right: auto; left: 100%; margin-top: 0; margin-left: 0.125rem; } .dropright .dropdown-toggle::after { display: inline-block; margin-left: 0.255em; vertical-align: 0.255em; content: ""; border-top: 0.3em solid transparent; border-right: 0; border-bottom: 0.3em solid transparent; border-left: 0.3em solid; } .dropright .dropdown-toggle:empty::after { margin-left: 0; } .dropright .dropdown-toggle::after { vertical-align: 0; } .dropleft .dropdown-menu { top: 0; right: 100%; left: auto; margin-top: 0; margin-right: 0.125rem; } .dropleft .dropdown-toggle::after { display: inline-block; margin-left: 0.255em; vertical-align: 0.255em; content: ""; } .dropleft .dropdown-toggle::after { display: none; } .dropleft .dropdown-toggle::before { display: inline-block; margin-right: 0.255em; vertical-align: 0.255em; content: ""; border-top: 0.3em solid transparent; border-right: 0.3em solid; border-bottom: 0.3em solid transparent; } .dropleft .dropdown-toggle:empty::after { margin-left: 0; } .dropleft .dropdown-toggle::before { vertical-align: 0; } .dropdown-menu[x-placement^=top], .dropdown-menu[x-placement^=right], .dropdown-menu[x-placement^=bottom], .dropdown-menu[x-placement^=left] { right: auto; bottom: auto; } .dropdown-divider { height: 0; margin: 0.5rem 0; overflow: hidden; border-top: 1px solid #9ca0a2; } .dropdown-item { display: block; width: 100%; padding: 0.25rem 1.5rem; clear: both; font-weight: 400; color: #212529; text-align: inherit; white-space: nowrap; background-color: transparent; border: 0; } .dropdown-item:hover, .dropdown-item:focus { color: #16181b; text-decoration: none; background-color: #9ca0a2; } .dropdown-item.active, .dropdown-item:active { color: #fff; text-decoration: none; background-color: #023605; } .dropdown-item.disabled, .dropdown-item:disabled { color: #adb5bd; pointer-events: none; background-color: transparent; } .dropdown-menu.show { display: block; } .dropdown-header { display: block; padding: 0.5rem 1.5rem; margin-bottom: 0; font-size: 0.875rem; color: #6c757d; white-space: nowrap; } .dropdown-item-text { display: block; padding: 0.25rem 1.5rem; color: #212529; } .btn-group, .btn-group-vertical { position: relative; display: -webkit-inline-box; display: -ms-inline-flexbox; display: inline-flex; vertical-align: middle; } .btn-group > .btn, .comment-form .btn-group > input[type=submit], .btn-group-vertical > .btn, .comment-form .btn-group-vertical > input[type=submit] { position: relative; -webkit-box-flex: 1; -ms-flex: 1 1 auto; flex: 1 1 auto; } .btn-group > .btn:hover, .comment-form .btn-group > input[type=submit]:hover, .btn-group-vertical > .btn:hover, .comment-form .btn-group-vertical > input[type=submit]:hover { z-index: 1; } .btn-group > .btn:focus, .comment-form .btn-group > input[type=submit]:focus, .btn-group > .btn:active, .comment-form .btn-group > input[type=submit]:active, .btn-group > .btn.active, .comment-form .btn-group > input.active[type=submit], .btn-group-vertical > .btn:focus, .comment-form .btn-group-vertical > input[type=submit]:focus, .btn-group-vertical > .btn:active, .comment-form .btn-group-vertical > input[type=submit]:active, .btn-group-vertical > .btn.active, .comment-form .btn-group-vertical > input.active[type=submit] { z-index: 1; } .btn-toolbar { display: -webkit-box; display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; -webkit-box-pack: start; -ms-flex-pack: start; justify-content: flex-start; } .btn-toolbar .input-group { width: auto; } .btn-group > .btn:not(:first-child), .comment-form .btn-group > input[type=submit]:not(:first-child), .btn-group > .btn-group:not(:first-child) { margin-left: -1px; } .btn-group > .btn:not(:last-child):not(.dropdown-toggle), .comment-form .btn-group > input[type=submit]:not(:last-child):not(.dropdown-toggle), .btn-group > .btn-group:not(:last-child) > .btn, .comment-form .btn-group > .btn-group:not(:last-child) > input[type=submit] { border-top-right-radius: 0; border-bottom-right-radius: 0; } .btn-group > .btn:not(:first-child), .comment-form .btn-group > input[type=submit]:not(:first-child), .btn-group > .btn-group:not(:first-child) > .btn, .comment-form .btn-group > .btn-group:not(:first-child) > input[type=submit] { border-top-left-radius: 0; border-bottom-left-radius: 0; } .dropdown-toggle-split { padding-right: 0.5625rem; padding-left: 0.5625rem; } .dropdown-toggle-split::after, .dropup .dropdown-toggle-split::after, .dropright .dropdown-toggle-split::after { margin-left: 0; } .dropleft .dropdown-toggle-split::before { margin-right: 0; } .btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split, .comment-form .btn-group-sm > input[type=submit] + .dropdown-toggle-split { padding-right: 0.375rem; padding-left: 0.375rem; } .btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split, .comment-form .btn-group-lg > input[type=submit] + .dropdown-toggle-split { padding-right: 0.75rem; padding-left: 0.75rem; } .btn-group-vertical { -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; -webkit-box-align: start; -ms-flex-align: start; align-items: flex-start; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; } .btn-group-vertical > .btn, .comment-form .btn-group-vertical > input[type=submit], .btn-group-vertical > .btn-group { width: 100%; } .btn-group-vertical > .btn:not(:first-child), .comment-form .btn-group-vertical > input[type=submit]:not(:first-child), .btn-group-vertical > .btn-group:not(:first-child) { margin-top: -1px; } .btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle), .comment-form .btn-group-vertical > input[type=submit]:not(:last-child):not(.dropdown-toggle), .btn-group-vertical > .btn-group:not(:last-child) > .btn, .comment-form .btn-group-vertical > .btn-group:not(:last-child) > input[type=submit] { border-bottom-right-radius: 0; border-bottom-left-radius: 0; } .btn-group-vertical > .btn:not(:first-child), .comment-form .btn-group-vertical > input[type=submit]:not(:first-child), .btn-group-vertical > .btn-group:not(:first-child) > .btn, .comment-form .btn-group-vertical > .btn-group:not(:first-child) > input[type=submit] { border-top-left-radius: 0; border-top-right-radius: 0; } .btn-group-toggle > .btn, .comment-form .btn-group-toggle > input[type=submit], .btn-group-toggle > .btn-group > .btn, .comment-form .btn-group-toggle > .btn-group > input[type=submit] { margin-bottom: 0; } .btn-group-toggle > .btn input[type=radio], .comment-form .btn-group-toggle > input[type=submit] input[type=radio], .btn-group-toggle > .btn input[type=checkbox], .comment-form .btn-group-toggle > input[type=submit] input[type=checkbox], .btn-group-toggle > .btn-group > .btn input[type=radio], .btn-group-toggle > .btn-group > .btn input[type=checkbox] { position: absolute; clip: rect(0, 0, 0, 0); pointer-events: none; } .input-group { position: relative; display: -webkit-box; display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; -webkit-box-align: stretch; -ms-flex-align: stretch; align-items: stretch; width: 100%; } .input-group > .form-control, .comment-form .input-group > input[type=text], .comment-form .input-group > input[type=email], .comment-form .input-group > input[type=url], .comment-form .input-group > textarea, .input-group > .form-control-plaintext, .input-group > .custom-select, .input-group > .custom-file { position: relative; -webkit-box-flex: 1; -ms-flex: 1 1 auto; flex: 1 1 auto; width: 1%; min-width: 0; margin-bottom: 0; } .input-group > .form-control + .form-control, .comment-form .input-group > input[type=text] + .form-control, .comment-form .input-group > input[type=email] + .form-control, .comment-form .input-group > input[type=url] + .form-control, .comment-form .input-group > textarea + .form-control, .comment-form .input-group > .form-control + input[type=text], .comment-form .input-group > input[type=text] + input[type=text], .comment-form .input-group > input[type=email] + input[type=text], .comment-form .input-group > input[type=url] + input[type=text], .comment-form .input-group > textarea + input[type=text], .comment-form .input-group > .form-control + input[type=email], .comment-form .input-group > input[type=text] + input[type=email], .comment-form .input-group > input[type=email] + input[type=email], .comment-form .input-group > input[type=url] + input[type=email], .comment-form .input-group > textarea + input[type=email], .comment-form .input-group > .form-control + input[type=url], .comment-form .input-group > input[type=text] + input[type=url], .comment-form .input-group > input[type=email] + input[type=url], .comment-form .input-group > input[type=url] + input[type=url], .comment-form .input-group > textarea + input[type=url], .comment-form .input-group > .form-control + textarea, .comment-form .input-group > input[type=text] + textarea, .comment-form .input-group > input[type=email] + textarea, .comment-form .input-group > input[type=url] + textarea, .comment-form .input-group > textarea + textarea, .input-group > .form-control + .custom-select, .comment-form .input-group > input[type=text] + .custom-select, .comment-form .input-group > input[type=email] + .custom-select, .comment-form .input-group > input[type=url] + .custom-select, .comment-form .input-group > textarea + .custom-select, .input-group > .form-control + .custom-file, .comment-form .input-group > input[type=text] + .custom-file, .comment-form .input-group > input[type=email] + .custom-file, .comment-form .input-group > input[type=url] + .custom-file, .comment-form .input-group > textarea + .custom-file, .input-group > .form-control-plaintext + .form-control, .comment-form .input-group > .form-control-plaintext + input[type=text], .comment-form .input-group > .form-control-plaintext + input[type=email], .comment-form .input-group > .form-control-plaintext + input[type=url], .comment-form .input-group > .form-control-plaintext + textarea, .input-group > .form-control-plaintext + .custom-select, .input-group > .form-control-plaintext + .custom-file, .input-group > .custom-select + .form-control, .comment-form .input-group > .custom-select + input[type=text], .comment-form .input-group > .custom-select + input[type=email], .comment-form .input-group > .custom-select + input[type=url], .comment-form .input-group > .custom-select + textarea, .input-group > .custom-select + .custom-select, .input-group > .custom-select + .custom-file, .input-group > .custom-file + .form-control, .comment-form .input-group > .custom-file + input[type=text], .comment-form .input-group > .custom-file + input[type=email], .comment-form .input-group > .custom-file + input[type=url], .comment-form .input-group > .custom-file + textarea, .input-group > .custom-file + .custom-select, .input-group > .custom-file + .custom-file { margin-left: -1px; } .input-group > .form-control:focus, .comment-form .input-group > input[type=text]:focus, .comment-form .input-group > input[type=email]:focus, .comment-form .input-group > input[type=url]:focus, .comment-form .input-group > textarea:focus, .input-group > .custom-select:focus, .input-group > .custom-file .custom-file-input:focus ~ .custom-file-label { z-index: 3; } .input-group > .custom-file .custom-file-input:focus { z-index: 4; } .input-group > .form-control:not(:first-child), .comment-form .input-group > input[type=text]:not(:first-child), .comment-form .input-group > input[type=email]:not(:first-child), .comment-form .input-group > input[type=url]:not(:first-child), .comment-form .input-group > textarea:not(:first-child), .input-group > .custom-select:not(:first-child) { border-top-left-radius: 0; border-bottom-left-radius: 0; } .input-group > .custom-file { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; } .input-group > .custom-file:not(:last-child) .custom-file-label, .input-group > .custom-file:not(:first-child) .custom-file-label { border-top-left-radius: 0; border-bottom-left-radius: 0; } .input-group:not(.has-validation) > .form-control:not(:last-child), .comment-form .input-group:not(.has-validation) > input[type=text]:not(:last-child), .comment-form .input-group:not(.has-validation) > input[type=email]:not(:last-child), .comment-form .input-group:not(.has-validation) > input[type=url]:not(:last-child), .comment-form .input-group:not(.has-validation) > textarea:not(:last-child), .input-group:not(.has-validation) > .custom-select:not(:last-child), .input-group:not(.has-validation) > .custom-file:not(:last-child) .custom-file-label::after { border-top-right-radius: 0; border-bottom-right-radius: 0; } .input-group.has-validation > .form-control:nth-last-child(n+3), .comment-form .input-group.has-validation > input[type=text]:nth-last-child(n+3), .comment-form .input-group.has-validation > input[type=email]:nth-last-child(n+3), .comment-form .input-group.has-validation > input[type=url]:nth-last-child(n+3), .comment-form .input-group.has-validation > textarea:nth-last-child(n+3), .input-group.has-validation > .custom-select:nth-last-child(n+3), .input-group.has-validation > .custom-file:nth-last-child(n+3) .custom-file-label::after { border-top-right-radius: 0; border-bottom-right-radius: 0; } .input-group-prepend, .input-group-append { display: -webkit-box; display: -ms-flexbox; display: flex; } .input-group-prepend .btn, .input-group-prepend .comment-form input[type=submit], .comment-form .input-group-prepend input[type=submit], .input-group-append .btn, .input-group-append .comment-form input[type=submit], .comment-form .input-group-append input[type=submit] { position: relative; z-index: 2; } .input-group-prepend .btn:focus, .input-group-prepend .comment-form input[type=submit]:focus, .comment-form .input-group-prepend input[type=submit]:focus, .input-group-append .btn:focus, .input-group-append .comment-form input[type=submit]:focus, .comment-form .input-group-append input[type=submit]:focus { z-index: 3; } .input-group-prepend .btn + .btn, .input-group-prepend .comment-form input[type=submit] + .btn, .comment-form .input-group-prepend input[type=submit] + .btn, .input-group-prepend .comment-form .btn + input[type=submit], .comment-form .input-group-prepend .btn + input[type=submit], .input-group-prepend .comment-form input[type=submit] + input[type=submit], .comment-form .input-group-prepend input[type=submit] + input[type=submit], .input-group-prepend .btn + .input-group-text, .input-group-prepend .comment-form input[type=submit] + .input-group-text, .comment-form .input-group-prepend input[type=submit] + .input-group-text, .input-group-prepend .input-group-text + .input-group-text, .input-group-prepend .input-group-text + .btn, .input-group-prepend .comment-form .input-group-text + input[type=submit], .comment-form .input-group-prepend .input-group-text + input[type=submit], .input-group-append .btn + .btn, .input-group-append .comment-form input[type=submit] + .btn, .comment-form .input-group-append input[type=submit] + .btn, .input-group-append .comment-form .btn + input[type=submit], .comment-form .input-group-append .btn + input[type=submit], .input-group-append .comment-form input[type=submit] + input[type=submit], .comment-form .input-group-append input[type=submit] + input[type=submit], .input-group-append .btn + .input-group-text, .input-group-append .comment-form input[type=submit] + .input-group-text, .comment-form .input-group-append input[type=submit] + .input-group-text, .input-group-append .input-group-text + .input-group-text, .input-group-append .input-group-text + .btn, .input-group-append .comment-form .input-group-text + input[type=submit], .comment-form .input-group-append .input-group-text + input[type=submit] { margin-left: -1px; } .input-group-prepend { margin-right: -1px; } .input-group-append { margin-left: -1px; } .input-group-text { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; padding: 0.375rem 0.75rem; margin-bottom: 0; font-size: 1rem; font-weight: 400; line-height: 1.5; color: #495057; text-align: center; white-space: nowrap; background-color: #9ca0a2; border: 1px solid #ced4da; border-radius: 0.25rem; } .input-group-text input[type=radio], .input-group-text input[type=checkbox] { margin-top: 0; } .input-group-lg > .form-control:not(textarea), .comment-form .input-group-lg > input[type=text]:not(textarea), .comment-form .input-group-lg > input[type=email]:not(textarea), .comment-form .input-group-lg > input[type=url]:not(textarea), .comment-form .input-group-lg > textarea:not(textarea), .input-group-lg > .custom-select { height: calc(1.5em + 1rem + 2px); } .input-group-lg > .form-control, .comment-form .input-group-lg > input[type=text], .comment-form .input-group-lg > input[type=email], .comment-form .input-group-lg > input[type=url], .comment-form .input-group-lg > textarea, .input-group-lg > .custom-select, .input-group-lg > .input-group-prepend > .input-group-text, .input-group-lg > .input-group-append > .input-group-text, .input-group-lg > .input-group-prepend > .btn, .comment-form .input-group-lg > .input-group-prepend > input[type=submit], .input-group-lg > .input-group-append > .btn, .comment-form .input-group-lg > .input-group-append > input[type=submit] { padding: 0.5rem 1rem; font-size: 1.25rem; line-height: 1.5; border-radius: 0.3rem; } .input-group-sm > .form-control:not(textarea), .comment-form .input-group-sm > input[type=text]:not(textarea), .comment-form .input-group-sm > input[type=email]:not(textarea), .comment-form .input-group-sm > input[type=url]:not(textarea), .comment-form .input-group-sm > textarea:not(textarea), .input-group-sm > .custom-select { height: calc(1.5em + 0.5rem + 2px); } .input-group-sm > .form-control, .comment-form .input-group-sm > input[type=text], .comment-form .input-group-sm > input[type=email], .comment-form .input-group-sm > input[type=url], .comment-form .input-group-sm > textarea, .input-group-sm > .custom-select, .input-group-sm > .input-group-prepend > .input-group-text, .input-group-sm > .input-group-append > .input-group-text, .input-group-sm > .input-group-prepend > .btn, .comment-form .input-group-sm > .input-group-prepend > input[type=submit], .input-group-sm > .input-group-append > .btn, .comment-form .input-group-sm > .input-group-append > input[type=submit] { padding: 0.25rem 0.5rem; font-size: 0.875rem; line-height: 1.5; border-radius: 0.2rem; } .input-group-lg > .custom-select, .input-group-sm > .custom-select { padding-right: 1.75rem; } .input-group > .input-group-prepend > .btn, .comment-form .input-group > .input-group-prepend > input[type=submit], .input-group > .input-group-prepend > .input-group-text, .input-group:not(.has-validation) > .input-group-append:not(:last-child) > .btn, .comment-form .input-group:not(.has-validation) > .input-group-append:not(:last-child) > input[type=submit], .input-group:not(.has-validation) > .input-group-append:not(:last-child) > .input-group-text, .input-group.has-validation > .input-group-append:nth-last-child(n+3) > .btn, .comment-form .input-group.has-validation > .input-group-append:nth-last-child(n+3) > input[type=submit], .input-group.has-validation > .input-group-append:nth-last-child(n+3) > .input-group-text, .input-group > .input-group-append:last-child > .btn:not(:last-child):not(.dropdown-toggle), .comment-form .input-group > .input-group-append:last-child > input[type=submit]:not(:last-child):not(.dropdown-toggle), .input-group > .input-group-append:last-child > .input-group-text:not(:last-child) { border-top-right-radius: 0; border-bottom-right-radius: 0; } .input-group > .input-group-append > .btn, .comment-form .input-group > .input-group-append > input[type=submit], .input-group > .input-group-append > .input-group-text, .input-group > .input-group-prepend:not(:first-child) > .btn, .comment-form .input-group > .input-group-prepend:not(:first-child) > input[type=submit], .input-group > .input-group-prepend:not(:first-child) > .input-group-text, .input-group > .input-group-prepend:first-child > .btn:not(:first-child), .comment-form .input-group > .input-group-prepend:first-child > input[type=submit]:not(:first-child), .input-group > .input-group-prepend:first-child > .input-group-text:not(:first-child) { border-top-left-radius: 0; border-bottom-left-radius: 0; } .custom-control { position: relative; z-index: 1; display: block; min-height: 1.5rem; padding-left: 1.5rem; -webkit-print-color-adjust: exact; color-adjust: exact; } .custom-control-inline { display: -webkit-inline-box; display: -ms-inline-flexbox; display: inline-flex; margin-right: 1rem; } .custom-control-input { position: absolute; left: 0; z-index: -1; width: 1rem; height: 1.25rem; opacity: 0; } .custom-control-input:checked ~ .custom-control-label::before { color: #fff; border-color: #023605; background-color: #023605; } .custom-control-input:focus ~ .custom-control-label::before { -webkit-box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.25); box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.25); } .custom-control-input:focus:not(:checked) ~ .custom-control-label::before { border-color: #07b110; } .custom-control-input:not(:disabled):active ~ .custom-control-label::before { color: #fff; background-color: #08e215; border-color: #08e215; } .custom-control-input[disabled] ~ .custom-control-label, .custom-control-input:disabled ~ .custom-control-label { color: #6c757d; } .custom-control-input[disabled] ~ .custom-control-label::before, .custom-control-input:disabled ~ .custom-control-label::before { background-color: #9ca0a2; } .custom-control-label { position: relative; margin-bottom: 0; vertical-align: top; } .custom-control-label::before { position: absolute; top: 0.25rem; left: -1.5rem; display: block; width: 1rem; height: 1rem; pointer-events: none; content: ""; background-color: #fff; border: #adb5bd solid 1px; } .custom-control-label::after { position: absolute; top: 0.25rem; left: -1.5rem; display: block; width: 1rem; height: 1rem; content: ""; background: 50%/50% 50% no-repeat; } .custom-checkbox .custom-control-label::before { border-radius: 0.25rem; } .custom-checkbox .custom-control-input:checked ~ .custom-control-label::after { background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26l2.974 2.99L8 2.193z'/%3e%3c/svg%3e"); } .custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::before { border-color: #023605; background-color: #023605; } .custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::after { background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='4' viewBox='0 0 4 4'%3e%3cpath stroke='%23fff' d='M0 2h4'/%3e%3c/svg%3e"); } .custom-checkbox .custom-control-input:disabled:checked ~ .custom-control-label::before { background-color: rgba(2, 54, 5, 0.5); } .custom-checkbox .custom-control-input:disabled:indeterminate ~ .custom-control-label::before { background-color: rgba(2, 54, 5, 0.5); } .custom-radio .custom-control-label::before { border-radius: 50%; } .custom-radio .custom-control-input:checked ~ .custom-control-label::after { background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e"); } .custom-radio .custom-control-input:disabled:checked ~ .custom-control-label::before { background-color: rgba(2, 54, 5, 0.5); } .custom-switch { padding-left: 2.25rem; } .custom-switch .custom-control-label::before { left: -2.25rem; width: 1.75rem; pointer-events: all; border-radius: 0.5rem; } .custom-switch .custom-control-label::after { top: calc(0.25rem + 2px); left: calc(-2.25rem + 2px); width: calc(1rem - 4px); height: calc(1rem - 4px); background-color: #adb5bd; border-radius: 0.5rem; -webkit-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, -webkit-transform 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, -webkit-transform 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; -o-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, -o-transform 0.15s ease-in-out; transition: transform 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; transition: transform 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, -webkit-transform 0.15s ease-in-out, -o-transform 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; } @media (prefers-reduced-motion: reduce) { .custom-switch .custom-control-label::after { -webkit-transition: none; -o-transition: none; transition: none; } } .custom-switch .custom-control-input:checked ~ .custom-control-label::after { background-color: #fff; -webkit-transform: translateX(0.75rem); -o-transform: translateX(0.75rem); transform: translateX(0.75rem); } .custom-switch .custom-control-input:disabled:checked ~ .custom-control-label::before { background-color: rgba(2, 54, 5, 0.5); } .custom-select { display: inline-block; width: 100%; height: calc(1.5em + 0.75rem + 2px); padding: 0.375rem 1.75rem 0.375rem 0.75rem; font-size: 1rem; font-weight: 400; line-height: 1.5; color: #495057; vertical-align: middle; background: #fff url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='5' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") right 0.75rem center/8px 10px no-repeat; border: 1px solid #ced4da; border-radius: 0.25rem; -webkit-appearance: none; -moz-appearance: none; appearance: none; } .custom-select:focus { border-color: #07b110; outline: 0; -webkit-box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.25); box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.25); } .custom-select:focus::-ms-value { color: #495057; background-color: #fff; } .custom-select[multiple], .custom-select[size]:not([size="1"]) { height: auto; padding-right: 0.75rem; background-image: none; } .custom-select:disabled { color: #6c757d; background-color: #9ca0a2; } .custom-select::-ms-expand { display: none; } .custom-select:-moz-focusring { color: transparent; text-shadow: 0 0 0 #495057; } .custom-select-sm { height: calc(1.5em + 0.5rem + 2px); padding-top: 0.25rem; padding-bottom: 0.25rem; padding-left: 0.5rem; font-size: 0.875rem; } .custom-select-lg { height: calc(1.5em + 1rem + 2px); padding-top: 0.5rem; padding-bottom: 0.5rem; padding-left: 1rem; font-size: 1.25rem; } .custom-file { position: relative; display: inline-block; width: 100%; height: calc(1.5em + 0.75rem + 2px); margin-bottom: 0; } .custom-file-input { position: relative; z-index: 2; width: 100%; height: calc(1.5em + 0.75rem + 2px); margin: 0; overflow: hidden; opacity: 0; } .custom-file-input:focus ~ .custom-file-label { border-color: #07b110; -webkit-box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.25); box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.25); } .custom-file-input[disabled] ~ .custom-file-label, .custom-file-input:disabled ~ .custom-file-label { background-color: #9ca0a2; } .custom-file-input:lang(en) ~ .custom-file-label::after { content: "Browse"; } .custom-file-input ~ .custom-file-label[data-browse]::after { content: attr(data-browse); } .custom-file-label { position: absolute; top: 0; right: 0; left: 0; z-index: 1; height: calc(1.5em + 0.75rem + 2px); padding: 0.375rem 0.75rem; overflow: hidden; font-weight: 400; line-height: 1.5; color: #495057; background-color: #fff; border: 1px solid #ced4da; border-radius: 0.25rem; } .custom-file-label::after { position: absolute; top: 0; right: 0; bottom: 0; z-index: 3; display: block; height: calc(1.5em + 0.75rem); padding: 0.375rem 0.75rem; line-height: 1.5; color: #495057; content: "Browse"; background-color: #9ca0a2; border-left: inherit; border-radius: 0 0.25rem 0.25rem 0; } .custom-range { width: 100%; height: 1.4rem; padding: 0; background-color: transparent; -webkit-appearance: none; -moz-appearance: none; appearance: none; } .custom-range:focus { outline: 0; } .custom-range:focus::-webkit-slider-thumb { -webkit-box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(2, 54, 5, 0.25); box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(2, 54, 5, 0.25); } .custom-range:focus::-moz-range-thumb { box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(2, 54, 5, 0.25); } .custom-range:focus::-ms-thumb { box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(2, 54, 5, 0.25); } .custom-range::-moz-focus-outer { border: 0; } .custom-range::-webkit-slider-thumb { width: 1rem; height: 1rem; margin-top: -0.25rem; background-color: #023605; border: 0; border-radius: 1rem; -webkit-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; -webkit-appearance: none; appearance: none; } @media (prefers-reduced-motion: reduce) { .custom-range::-webkit-slider-thumb { -webkit-transition: none; transition: none; } } .custom-range::-webkit-slider-thumb:active { background-color: #08e215; } .custom-range::-webkit-slider-runnable-track { width: 100%; height: 0.5rem; color: transparent; cursor: pointer; background-color: #dee2e6; border-color: transparent; border-radius: 1rem; } .custom-range::-moz-range-thumb { width: 1rem; height: 1rem; background-color: #023605; border: 0; border-radius: 1rem; -moz-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; -moz-appearance: none; appearance: none; } @media (prefers-reduced-motion: reduce) { .custom-range::-moz-range-thumb { -moz-transition: none; transition: none; } } .custom-range::-moz-range-thumb:active { background-color: #08e215; } .custom-range::-moz-range-track { width: 100%; height: 0.5rem; color: transparent; cursor: pointer; background-color: #dee2e6; border-color: transparent; border-radius: 1rem; } .custom-range::-ms-thumb { width: 1rem; height: 1rem; margin-top: 0; margin-right: 0.2rem; margin-left: 0.2rem; background-color: #023605; border: 0; border-radius: 1rem; -ms-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; appearance: none; } @media (prefers-reduced-motion: reduce) { .custom-range::-ms-thumb { -ms-transition: none; transition: none; } } .custom-range::-ms-thumb:active { background-color: #08e215; } .custom-range::-ms-track { width: 100%; height: 0.5rem; color: transparent; cursor: pointer; background-color: transparent; border-color: transparent; border-width: 0.5rem; } .custom-range::-ms-fill-lower { background-color: #dee2e6; border-radius: 1rem; } .custom-range::-ms-fill-upper { margin-right: 15px; background-color: #dee2e6; border-radius: 1rem; } .custom-range:disabled::-webkit-slider-thumb { background-color: #adb5bd; } .custom-range:disabled::-webkit-slider-runnable-track { cursor: default; } .custom-range:disabled::-moz-range-thumb { background-color: #adb5bd; } .custom-range:disabled::-moz-range-track { cursor: default; } .custom-range:disabled::-ms-thumb { background-color: #adb5bd; } .custom-control-label::before, .custom-file-label, .custom-select { -webkit-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; -o-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; } @media (prefers-reduced-motion: reduce) { .custom-control-label::before, .custom-file-label, .custom-select { -webkit-transition: none; -o-transition: none; transition: none; } } .nav { display: -webkit-box; display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; padding-left: 0; margin-bottom: 0; list-style: none; } .nav-link, .banner .nav a { display: block; padding: 0.5rem 1rem; } .nav-link:hover, .banner .nav a:hover, .nav-link:focus, .banner .nav a:focus { text-decoration: none; } .nav-link.disabled, .banner .nav a.disabled { color: #6c757d; pointer-events: none; cursor: default; } .nav-tabs { border-bottom: 1px solid #dee2e6; } .nav-tabs .nav-link, .nav-tabs .banner .nav a, .banner .nav .nav-tabs a { margin-bottom: -1px; border: 1px solid transparent; border-top-left-radius: 0.25rem; border-top-right-radius: 0.25rem; } .nav-tabs .nav-link:hover, .nav-tabs .banner .nav a:hover, .banner .nav .nav-tabs a:hover, .nav-tabs .nav-link:focus, .nav-tabs .banner .nav a:focus, .banner .nav .nav-tabs a:focus { border-color: #9ca0a2 #9ca0a2 #dee2e6; } .nav-tabs .nav-link.disabled, .nav-tabs .banner .nav a.disabled, .banner .nav .nav-tabs a.disabled { color: #6c757d; background-color: transparent; border-color: transparent; } .nav-tabs .nav-link.active, .nav-tabs .banner .nav a.active, .banner .nav .nav-tabs a.active, .nav-tabs .nav-item.show .nav-link, .nav-tabs .nav-item.show .banner .nav a, .banner .nav .nav-tabs .nav-item.show a, .nav-tabs .banner .nav li.show .nav-link, .nav-tabs .banner .nav li.show a, .banner .nav .nav-tabs li.show .nav-link, .banner .nav .nav-tabs li.show a { color: #495057; background-color: #fff; border-color: #dee2e6 #dee2e6 #fff; } .nav-tabs .dropdown-menu { margin-top: -1px; border-top-left-radius: 0; border-top-right-radius: 0; } .nav-pills .nav-link, .nav-pills .banner .nav a, .banner .nav .nav-pills a { border-radius: 0.25rem; } .nav-pills .nav-link.active, .nav-pills .banner .nav a.active, .banner .nav .nav-pills a.active, .nav-pills .show > .nav-link, .nav-pills .banner .nav .show > a, .banner .nav .nav-pills .show > a { color: #fff; background-color: #023605; } .nav-fill > .nav-link, .banner .nav .nav-fill > a, .nav-fill .nav-item, .nav-fill .banner .nav li, .banner .nav .nav-fill li { -webkit-box-flex: 1; -ms-flex: 1 1 auto; flex: 1 1 auto; text-align: center; } .nav-justified > .nav-link, .banner .nav .nav-justified > a, .nav-justified .nav-item, .nav-justified .banner .nav li, .banner .nav .nav-justified li { -ms-flex-preferred-size: 0; flex-basis: 0; -webkit-box-flex: 1; -ms-flex-positive: 1; flex-grow: 1; text-align: center; } .tab-content > .tab-pane { display: none; } .tab-content > .active { display: block; } .navbar { position: relative; display: -webkit-box; display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-pack: justify; -ms-flex-pack: justify; justify-content: space-between; padding: 0.5rem 1rem; } .navbar .container, .navbar .container-fluid, .navbar .container-sm, .navbar .container-md, .navbar .container-lg, .navbar .container-xl, .navbar .container-xxl { display: -webkit-box; display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-pack: justify; -ms-flex-pack: justify; justify-content: space-between; } .navbar-brand { display: inline-block; padding-top: 0.3125rem; padding-bottom: 0.3125rem; margin-right: 1rem; font-size: 1.25rem; line-height: inherit; white-space: nowrap; } .navbar-brand:hover, .navbar-brand:focus { text-decoration: none; } .navbar-nav { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; padding-left: 0; margin-bottom: 0; list-style: none; } .navbar-nav .nav-link, .navbar-nav .banner .nav a, .banner .nav .navbar-nav a { padding-right: 0; padding-left: 0; } .navbar-nav .dropdown-menu { position: static; float: none; } .navbar-text { display: inline-block; padding-top: 0.5rem; padding-bottom: 0.5rem; } .navbar-collapse { -ms-flex-preferred-size: 100%; flex-basis: 100%; -webkit-box-flex: 1; -ms-flex-positive: 1; flex-grow: 1; -webkit-box-align: center; -ms-flex-align: center; align-items: center; } .navbar-toggler { padding: 0.25rem 0.75rem; font-size: 1.25rem; line-height: 1; background-color: transparent; border: 1px solid transparent; border-radius: 0.25rem; } .navbar-toggler:hover, .navbar-toggler:focus { text-decoration: none; } .navbar-toggler-icon { display: inline-block; width: 1.5em; height: 1.5em; vertical-align: middle; content: ""; background: 50%/100% 100% no-repeat; } .navbar-nav-scroll { max-height: 75vh; overflow-y: auto; } @media (max-width: 575.98px) { .navbar-expand-sm > .container, .navbar-expand-sm > .container-fluid, .navbar-expand-sm > .container-sm, .navbar-expand-sm > .container-md, .navbar-expand-sm > .container-lg, .navbar-expand-sm > .container-xl, .navbar-expand-sm > .container-xxl { padding-right: 0; padding-left: 0; } } @media (min-width: 576px) { .navbar-expand-sm { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-flow: row nowrap; flex-flow: row nowrap; -webkit-box-pack: start; -ms-flex-pack: start; justify-content: flex-start; } .navbar-expand-sm .navbar-nav { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; } .navbar-expand-sm .navbar-nav .dropdown-menu { position: absolute; } .navbar-expand-sm .navbar-nav .nav-link, .navbar-expand-sm .navbar-nav .banner .nav a, .banner .nav .navbar-expand-sm .navbar-nav a { padding-right: 0.5rem; padding-left: 0.5rem; } .navbar-expand-sm > .container, .navbar-expand-sm > .container-fluid, .navbar-expand-sm > .container-sm, .navbar-expand-sm > .container-md, .navbar-expand-sm > .container-lg, .navbar-expand-sm > .container-xl, .navbar-expand-sm > .container-xxl { -ms-flex-wrap: nowrap; flex-wrap: nowrap; } .navbar-expand-sm .navbar-nav-scroll { overflow: visible; } .navbar-expand-sm .navbar-collapse { display: -webkit-box !important; display: -ms-flexbox !important; display: flex !important; -ms-flex-preferred-size: auto; flex-basis: auto; } .navbar-expand-sm .navbar-toggler { display: none; } } @media (max-width: 767.98px) { .navbar-expand-md > .container, .navbar-expand-md > .container-fluid, .navbar-expand-md > .container-sm, .navbar-expand-md > .container-md, .navbar-expand-md > .container-lg, .navbar-expand-md > .container-xl, .navbar-expand-md > .container-xxl { padding-right: 0; padding-left: 0; } } @media (min-width: 768px) { .navbar-expand-md { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-flow: row nowrap; flex-flow: row nowrap; -webkit-box-pack: start; -ms-flex-pack: start; justify-content: flex-start; } .navbar-expand-md .navbar-nav { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; } .navbar-expand-md .navbar-nav .dropdown-menu { position: absolute; } .navbar-expand-md .navbar-nav .nav-link, .navbar-expand-md .navbar-nav .banner .nav a, .banner .nav .navbar-expand-md .navbar-nav a { padding-right: 0.5rem; padding-left: 0.5rem; } .navbar-expand-md > .container, .navbar-expand-md > .container-fluid, .navbar-expand-md > .container-sm, .navbar-expand-md > .container-md, .navbar-expand-md > .container-lg, .navbar-expand-md > .container-xl, .navbar-expand-md > .container-xxl { -ms-flex-wrap: nowrap; flex-wrap: nowrap; } .navbar-expand-md .navbar-nav-scroll { overflow: visible; } .navbar-expand-md .navbar-collapse { display: -webkit-box !important; display: -ms-flexbox !important; display: flex !important; -ms-flex-preferred-size: auto; flex-basis: auto; } .navbar-expand-md .navbar-toggler { display: none; } } @media (max-width: 991.98px) { .navbar-expand-lg > .container, .navbar-expand-lg > .container-fluid, .navbar-expand-lg > .container-sm, .navbar-expand-lg > .container-md, .navbar-expand-lg > .container-lg, .navbar-expand-lg > .container-xl, .navbar-expand-lg > .container-xxl { padding-right: 0; padding-left: 0; } } @media (min-width: 992px) { .navbar-expand-lg { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-flow: row nowrap; flex-flow: row nowrap; -webkit-box-pack: start; -ms-flex-pack: start; justify-content: flex-start; } .navbar-expand-lg .navbar-nav { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; } .navbar-expand-lg .navbar-nav .dropdown-menu { position: absolute; } .navbar-expand-lg .navbar-nav .nav-link, .navbar-expand-lg .navbar-nav .banner .nav a, .banner .nav .navbar-expand-lg .navbar-nav a { padding-right: 0.5rem; padding-left: 0.5rem; } .navbar-expand-lg > .container, .navbar-expand-lg > .container-fluid, .navbar-expand-lg > .container-sm, .navbar-expand-lg > .container-md, .navbar-expand-lg > .container-lg, .navbar-expand-lg > .container-xl, .navbar-expand-lg > .container-xxl { -ms-flex-wrap: nowrap; flex-wrap: nowrap; } .navbar-expand-lg .navbar-nav-scroll { overflow: visible; } .navbar-expand-lg .navbar-collapse { display: -webkit-box !important; display: -ms-flexbox !important; display: flex !important; -ms-flex-preferred-size: auto; flex-basis: auto; } .navbar-expand-lg .navbar-toggler { display: none; } } @media (max-width: 1199.98px) { .navbar-expand-xl > .container, .navbar-expand-xl > .container-fluid, .navbar-expand-xl > .container-sm, .navbar-expand-xl > .container-md, .navbar-expand-xl > .container-lg, .navbar-expand-xl > .container-xl, .navbar-expand-xl > .container-xxl { padding-right: 0; padding-left: 0; } } @media (min-width: 1200px) { .navbar-expand-xl { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-flow: row nowrap; flex-flow: row nowrap; -webkit-box-pack: start; -ms-flex-pack: start; justify-content: flex-start; } .navbar-expand-xl .navbar-nav { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; } .navbar-expand-xl .navbar-nav .dropdown-menu { position: absolute; } .navbar-expand-xl .navbar-nav .nav-link, .navbar-expand-xl .navbar-nav .banner .nav a, .banner .nav .navbar-expand-xl .navbar-nav a { padding-right: 0.5rem; padding-left: 0.5rem; } .navbar-expand-xl > .container, .navbar-expand-xl > .container-fluid, .navbar-expand-xl > .container-sm, .navbar-expand-xl > .container-md, .navbar-expand-xl > .container-lg, .navbar-expand-xl > .container-xl, .navbar-expand-xl > .container-xxl { -ms-flex-wrap: nowrap; flex-wrap: nowrap; } .navbar-expand-xl .navbar-nav-scroll { overflow: visible; } .navbar-expand-xl .navbar-collapse { display: -webkit-box !important; display: -ms-flexbox !important; display: flex !important; -ms-flex-preferred-size: auto; flex-basis: auto; } .navbar-expand-xl .navbar-toggler { display: none; } } @media (max-width: 1399.98px) { .navbar-expand-xxl > .container, .navbar-expand-xxl > .container-fluid, .navbar-expand-xxl > .container-sm, .navbar-expand-xxl > .container-md, .navbar-expand-xxl > .container-lg, .navbar-expand-xxl > .container-xl, .navbar-expand-xxl > .container-xxl { padding-right: 0; padding-left: 0; } } @media (min-width: 1400px) { .navbar-expand-xxl { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-flow: row nowrap; flex-flow: row nowrap; -webkit-box-pack: start; -ms-flex-pack: start; justify-content: flex-start; } .navbar-expand-xxl .navbar-nav { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; } .navbar-expand-xxl .navbar-nav .dropdown-menu { position: absolute; } .navbar-expand-xxl .navbar-nav .nav-link, .navbar-expand-xxl .navbar-nav .banner .nav a, .banner .nav .navbar-expand-xxl .navbar-nav a { padding-right: 0.5rem; padding-left: 0.5rem; } .navbar-expand-xxl > .container, .navbar-expand-xxl > .container-fluid, .navbar-expand-xxl > .container-sm, .navbar-expand-xxl > .container-md, .navbar-expand-xxl > .container-lg, .navbar-expand-xxl > .container-xl, .navbar-expand-xxl > .container-xxl { -ms-flex-wrap: nowrap; flex-wrap: nowrap; } .navbar-expand-xxl .navbar-nav-scroll { overflow: visible; } .navbar-expand-xxl .navbar-collapse { display: -webkit-box !important; display: -ms-flexbox !important; display: flex !important; -ms-flex-preferred-size: auto; flex-basis: auto; } .navbar-expand-xxl .navbar-toggler { display: none; } } .navbar-expand { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-flow: row nowrap; flex-flow: row nowrap; -webkit-box-pack: start; -ms-flex-pack: start; justify-content: flex-start; } .navbar-expand > .container, .navbar-expand > .container-fluid, .navbar-expand > .container-sm, .navbar-expand > .container-md, .navbar-expand > .container-lg, .navbar-expand > .container-xl, .navbar-expand > .container-xxl { padding-right: 0; padding-left: 0; } .navbar-expand .navbar-nav { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; } .navbar-expand .navbar-nav .dropdown-menu { position: absolute; } .navbar-expand .navbar-nav .nav-link, .navbar-expand .navbar-nav .banner .nav a, .banner .nav .navbar-expand .navbar-nav a { padding-right: 0.5rem; padding-left: 0.5rem; } .navbar-expand > .container, .navbar-expand > .container-fluid, .navbar-expand > .container-sm, .navbar-expand > .container-md, .navbar-expand > .container-lg, .navbar-expand > .container-xl, .navbar-expand > .container-xxl { -ms-flex-wrap: nowrap; flex-wrap: nowrap; } .navbar-expand .navbar-nav-scroll { overflow: visible; } .navbar-expand .navbar-collapse { display: -webkit-box !important; display: -ms-flexbox !important; display: flex !important; -ms-flex-preferred-size: auto; flex-basis: auto; } .navbar-expand .navbar-toggler { display: none; } .navbar-light .navbar-brand { color: rgba(0, 0, 0, 0.9); } .navbar-light .navbar-brand:hover, .navbar-light .navbar-brand:focus { color: rgba(0, 0, 0, 0.9); } .navbar-light .navbar-nav .nav-link, .navbar-light .navbar-nav .banner .nav a, .banner .nav .navbar-light .navbar-nav a { color: rgba(0, 0, 0, 0.5); } .navbar-light .navbar-nav .nav-link:hover, .navbar-light .navbar-nav .banner .nav a:hover, .banner .nav .navbar-light .navbar-nav a:hover, .navbar-light .navbar-nav .nav-link:focus, .navbar-light .navbar-nav .banner .nav a:focus, .banner .nav .navbar-light .navbar-nav a:focus { color: rgba(0, 0, 0, 0.7); } .navbar-light .navbar-nav .nav-link.disabled, .navbar-light .navbar-nav .banner .nav a.disabled, .banner .nav .navbar-light .navbar-nav a.disabled { color: rgba(0, 0, 0, 0.3); } .navbar-light .navbar-nav .show > .nav-link, .navbar-light .navbar-nav .banner .nav .show > a, .banner .nav .navbar-light .navbar-nav .show > a, .navbar-light .navbar-nav .active > .nav-link, .navbar-light .navbar-nav .banner .nav .active > a, .banner .nav .navbar-light .navbar-nav .active > a, .navbar-light .navbar-nav .nav-link.show, .navbar-light .navbar-nav .banner .nav a.show, .banner .nav .navbar-light .navbar-nav a.show, .navbar-light .navbar-nav .nav-link.active, .navbar-light .navbar-nav .banner .nav a.active, .banner .nav .navbar-light .navbar-nav a.active { color: rgba(0, 0, 0, 0.9); } .navbar-light .navbar-toggler { color: rgba(0, 0, 0, 0.5); border-color: rgba(0, 0, 0, 0.1); } .navbar-light .navbar-toggler-icon { background-image: none; } .navbar-light .navbar-text { color: rgba(0, 0, 0, 0.5); } .navbar-light .navbar-text a { color: rgba(0, 0, 0, 0.9); } .navbar-light .navbar-text a:hover, .navbar-light .navbar-text a:focus { color: rgba(0, 0, 0, 0.9); } .navbar-dark .navbar-brand { color: #fff; } .navbar-dark .navbar-brand:hover, .navbar-dark .navbar-brand:focus { color: #fff; } .navbar-dark .navbar-nav .nav-link, .navbar-dark .navbar-nav .banner .nav a, .banner .nav .navbar-dark .navbar-nav a { color: rgba(255, 255, 255, 0.5); } .navbar-dark .navbar-nav .nav-link:hover, .navbar-dark .navbar-nav .banner .nav a:hover, .banner .nav .navbar-dark .navbar-nav a:hover, .navbar-dark .navbar-nav .nav-link:focus, .navbar-dark .navbar-nav .banner .nav a:focus, .banner .nav .navbar-dark .navbar-nav a:focus { color: rgba(255, 255, 255, 0.75); } .navbar-dark .navbar-nav .nav-link.disabled, .navbar-dark .navbar-nav .banner .nav a.disabled, .banner .nav .navbar-dark .navbar-nav a.disabled { color: rgba(255, 255, 255, 0.25); } .navbar-dark .navbar-nav .show > .nav-link, .navbar-dark .navbar-nav .banner .nav .show > a, .banner .nav .navbar-dark .navbar-nav .show > a, .navbar-dark .navbar-nav .active > .nav-link, .navbar-dark .navbar-nav .banner .nav .active > a, .banner .nav .navbar-dark .navbar-nav .active > a, .navbar-dark .navbar-nav .nav-link.show, .navbar-dark .navbar-nav .banner .nav a.show, .banner .nav .navbar-dark .navbar-nav a.show, .navbar-dark .navbar-nav .nav-link.active, .navbar-dark .navbar-nav .banner .nav a.active, .banner .nav .navbar-dark .navbar-nav a.active { color: #fff; } .navbar-dark .navbar-toggler { color: rgba(255, 255, 255, 0.5); border-color: rgba(255, 255, 255, 0.1); } .navbar-dark .navbar-toggler-icon { background-image: none; } .navbar-dark .navbar-text { color: rgba(255, 255, 255, 0.5); } .navbar-dark .navbar-text a { color: #fff; } .navbar-dark .navbar-text a:hover, .navbar-dark .navbar-text a:focus { color: #fff; } .card { position: relative; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; min-width: 0; word-wrap: break-word; background-color: #fff; background-clip: border-box; border: 1px solid rgba(0, 0, 0, 0.125); border-radius: 0.25rem; } .card > hr { margin-right: 0; margin-left: 0; } .card > .list-group { border-top: inherit; border-bottom: inherit; } .card > .list-group:first-child { border-top-width: 0; border-top-left-radius: calc(0.25rem - 1px); border-top-right-radius: calc(0.25rem - 1px); } .card > .list-group:last-child { border-bottom-width: 0; border-bottom-right-radius: calc(0.25rem - 1px); border-bottom-left-radius: calc(0.25rem - 1px); } .card > .card-header + .list-group, .card > .list-group + .card-footer { border-top: 0; } .card-body { -webkit-box-flex: 1; -ms-flex: 1 1 auto; flex: 1 1 auto; min-height: 1px; padding: 1.25rem; } .card-title { margin-bottom: 0.75rem; } .card-subtitle { margin-top: -0.375rem; margin-bottom: 0; } .card-text:last-child { margin-bottom: 0; } .card-link:hover { text-decoration: none; } .card-link + .card-link { margin-left: 1.25rem; } .card-header { padding: 0.75rem 1.25rem; margin-bottom: 0; background-color: rgba(0, 0, 0, 0.03); border-bottom: 1px solid rgba(0, 0, 0, 0.125); } .card-header:first-child { border-radius: calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0; } .card-footer { padding: 0.75rem 1.25rem; background-color: rgba(0, 0, 0, 0.03); border-top: 1px solid rgba(0, 0, 0, 0.125); } .card-footer:last-child { border-radius: 0 0 calc(0.25rem - 1px) calc(0.25rem - 1px); } .card-header-tabs { margin-right: -0.625rem; margin-bottom: -0.75rem; margin-left: -0.625rem; border-bottom: 0; } .card-header-pills { margin-right: -0.625rem; margin-left: -0.625rem; } .card-img-overlay { position: absolute; top: 0; right: 0; bottom: 0; left: 0; padding: 1.25rem; border-radius: calc(0.25rem - 1px); } .card-img, .card-img-top, .card-img-bottom { -ms-flex-negative: 0; flex-shrink: 0; width: 100%; } .card-img, .card-img-top { border-top-left-radius: calc(0.25rem - 1px); border-top-right-radius: calc(0.25rem - 1px); } .card-img, .card-img-bottom { border-bottom-right-radius: calc(0.25rem - 1px); border-bottom-left-radius: calc(0.25rem - 1px); } .card-deck .card { margin-bottom: 36px; } @media (min-width: 576px) { .card-deck { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-flow: row wrap; flex-flow: row wrap; margin-right: -36px; margin-left: -36px; } .card-deck .card { -webkit-box-flex: 1; -ms-flex: 1 0 0%; flex: 1 0 0%; margin-right: 36px; margin-bottom: 0; margin-left: 36px; } } .card-group > .card { margin-bottom: 36px; } @media (min-width: 576px) { .card-group { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-flow: row wrap; flex-flow: row wrap; } .card-group > .card { -webkit-box-flex: 1; -ms-flex: 1 0 0%; flex: 1 0 0%; margin-bottom: 0; } .card-group > .card + .card { margin-left: 0; border-left: 0; } .card-group > .card:not(:last-child) { border-top-right-radius: 0; border-bottom-right-radius: 0; } .card-group > .card:not(:last-child) .card-img-top, .card-group > .card:not(:last-child) .card-header { border-top-right-radius: 0; } .card-group > .card:not(:last-child) .card-img-bottom, .card-group > .card:not(:last-child) .card-footer { border-bottom-right-radius: 0; } .card-group > .card:not(:first-child) { border-top-left-radius: 0; border-bottom-left-radius: 0; } .card-group > .card:not(:first-child) .card-img-top, .card-group > .card:not(:first-child) .card-header { border-top-left-radius: 0; } .card-group > .card:not(:first-child) .card-img-bottom, .card-group > .card:not(:first-child) .card-footer { border-bottom-left-radius: 0; } } .card-columns .card { margin-bottom: 0.75rem; } @media (min-width: 576px) { .card-columns { -webkit-column-count: 3; -moz-column-count: 3; column-count: 3; -webkit-column-gap: 1.25rem; -moz-column-gap: 1.25rem; column-gap: 1.25rem; orphans: 1; widows: 1; } .card-columns .card { display: inline-block; width: 100%; } } .accordion { overflow-anchor: none; } .accordion > .card { overflow: hidden; } .accordion > .card:not(:last-of-type) { border-bottom: 0; border-bottom-right-radius: 0; border-bottom-left-radius: 0; } .accordion > .card:not(:first-of-type) { border-top-left-radius: 0; border-top-right-radius: 0; } .accordion > .card > .card-header { border-radius: 0; margin-bottom: -1px; } .breadcrumb { display: -webkit-box; display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; padding: 0.75rem 1rem; margin-bottom: 1rem; list-style: none; background-color: #9ca0a2; border-radius: 0.25rem; } .breadcrumb-item + .breadcrumb-item { padding-left: 0.5rem; } .breadcrumb-item + .breadcrumb-item::before { float: left; padding-right: 0.5rem; color: #6c757d; content: "/"; } .breadcrumb-item + .breadcrumb-item:hover::before { text-decoration: underline; } .breadcrumb-item + .breadcrumb-item:hover::before { text-decoration: none; } .breadcrumb-item.active { color: #6c757d; } .pagination { display: -webkit-box; display: -ms-flexbox; display: flex; padding-left: 0; list-style: none; border-radius: 0.25rem; } .page-link { position: relative; display: block; padding: 0.5rem 0.75rem; margin-left: -1px; line-height: 1.25; color: #023605; background-color: #fff; border: 1px solid #dee2e6; } .page-link:hover { z-index: 2; color: black; text-decoration: none; background-color: #9ca0a2; border-color: #dee2e6; } .page-link:focus { z-index: 3; outline: 0; -webkit-box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.25); box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.25); } .page-item:first-child .page-link { margin-left: 0; border-top-left-radius: 0.25rem; border-bottom-left-radius: 0.25rem; } .page-item:last-child .page-link { border-top-right-radius: 0.25rem; border-bottom-right-radius: 0.25rem; } .page-item.active .page-link { z-index: 3; color: #fff; background-color: #023605; border-color: #023605; } .page-item.disabled .page-link { color: #6c757d; pointer-events: none; cursor: auto; background-color: #fff; border-color: #dee2e6; } .pagination-lg .page-link { padding: 0.75rem 1.5rem; font-size: 1.25rem; line-height: 1.5; } .pagination-lg .page-item:first-child .page-link { border-top-left-radius: 0.3rem; border-bottom-left-radius: 0.3rem; } .pagination-lg .page-item:last-child .page-link { border-top-right-radius: 0.3rem; border-bottom-right-radius: 0.3rem; } .pagination-sm .page-link { padding: 0.25rem 0.5rem; font-size: 0.875rem; line-height: 1.5; } .pagination-sm .page-item:first-child .page-link { border-top-left-radius: 0.2rem; border-bottom-left-radius: 0.2rem; } .pagination-sm .page-item:last-child .page-link { border-top-right-radius: 0.2rem; border-bottom-right-radius: 0.2rem; } .badge { display: inline-block; padding: 0.25em 0.4em; font-size: 75%; font-weight: 700; line-height: 1; text-align: center; white-space: nowrap; vertical-align: baseline; border-radius: 0.25rem; -webkit-transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; -o-transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; } @media (prefers-reduced-motion: reduce) { .badge { -webkit-transition: none; -o-transition: none; transition: none; } } a.badge:hover, a.badge:focus { text-decoration: none; } .badge:empty { display: none; } .btn .badge, .comment-form input[type=submit] .badge { position: relative; top: -1px; } .badge-pill { padding-right: 0.6em; padding-left: 0.6em; border-radius: 10rem; } .badge-primary { color: #fff; background-color: #023605; } a.badge-primary:hover, a.badge-primary:focus { color: #fff; background-color: #000500; } a.badge-primary:focus, a.badge-primary.focus { outline: 0; -webkit-box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.5); box-shadow: 0 0 0 0.2rem rgba(2, 54, 5, 0.5); } .badge-secondary { color: #212529; background-color: #faf8f6; } a.badge-secondary:hover, a.badge-secondary:focus { color: #212529; background-color: #e8dfd5; } a.badge-secondary:focus, a.badge-secondary.focus { outline: 0; -webkit-box-shadow: 0 0 0 0.2rem rgba(250, 248, 246, 0.5); box-shadow: 0 0 0 0.2rem rgba(250, 248, 246, 0.5); } .badge-success { color: #fff; background-color: #28a745; } a.badge-success:hover, a.badge-success:focus { color: #fff; background-color: #1e7e34; } a.badge-success:focus, a.badge-success.focus { outline: 0; -webkit-box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5); box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5); } .badge-info { color: #fff; background-color: #17a2b8; } a.badge-info:hover, a.badge-info:focus { color: #fff; background-color: #117a8b; } a.badge-info:focus, a.badge-info.focus { outline: 0; -webkit-box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5); box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5); } .badge-warning { color: #212529; background-color: #ffc107; } a.badge-warning:hover, a.badge-warning:focus { color: #212529; background-color: #d39e00; } a.badge-warning:focus, a.badge-warning.focus { outline: 0; -webkit-box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5); box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5); } .badge-danger { color: #fff; background-color: #dc3545; } a.badge-danger:hover, a.badge-danger:focus { color: #fff; background-color: #bd2130; } a.badge-danger:focus, a.badge-danger.focus { outline: 0; -webkit-box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5); box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5); } .badge-light { color: #212529; background-color: #a49f9f; } a.badge-light:hover, a.badge-light:focus { color: #212529; background-color: #8b8585; } a.badge-light:focus, a.badge-light.focus { outline: 0; -webkit-box-shadow: 0 0 0 0.2rem rgba(164, 159, 159, 0.5); box-shadow: 0 0 0 0.2rem rgba(164, 159, 159, 0.5); } .badge-dark { color: #fff; background-color: #343a40; } a.badge-dark:hover, a.badge-dark:focus { color: #fff; background-color: #1d2124; } a.badge-dark:focus, a.badge-dark.focus { outline: 0; -webkit-box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5); box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5); } .jumbotron { padding: 2rem 1rem; margin-bottom: 2rem; background-color: #9ca0a2; border-radius: 0.3rem; } @media (min-width: 576px) { .jumbotron { padding: 4rem 2rem; } } .jumbotron-fluid { padding-right: 0; padding-left: 0; border-radius: 0; } .alert { position: relative; padding: 0.75rem 1.25rem; margin-bottom: 1rem; border: 1px solid transparent; border-radius: 0.25rem; } .alert-heading { color: inherit; } .alert-link { font-weight: 700; } .alert-dismissible { padding-right: 4rem; } .alert-dismissible .close { position: absolute; top: 0; right: 0; z-index: 2; padding: 0.75rem 1.25rem; color: inherit; } .alert-primary { color: #011c03; background-color: #ccd7cd; border-color: #b8c7b9; } .alert-primary hr { border-top-color: #aabcab; } .alert-primary .alert-link { color: black; } .alert-secondary { color: #828180; background-color: #fefefd; border-color: #fefdfc; } .alert-secondary hr { border-top-color: #f8f0e9; } .alert-secondary .alert-link { color: #686867; } .alert-success { color: #155724; background-color: #d4edda; border-color: #c3e6cb; } .alert-success hr { border-top-color: #b1dfbb; } .alert-success .alert-link { color: #0b2e13; } .alert-info { color: #0c5460; background-color: #d1ecf1; border-color: #bee5eb; } .alert-info hr { border-top-color: #abdde5; } .alert-info .alert-link { color: #062c33; } .alert-warning { color: #856404; background-color: #fff3cd; border-color: #ffeeba; } .alert-warning hr { border-top-color: #ffe8a1; } .alert-warning .alert-link { color: #533f03; } .alert-danger { color: #721c24; background-color: #f8d7da; border-color: #f5c6cb; } .alert-danger hr { border-top-color: #f1b0b7; } .alert-danger .alert-link { color: #491217; } .alert-light { color: #555353; background-color: #edecec; border-color: #e6e4e4; } .alert-light hr { border-top-color: #dad7d7; } .alert-light .alert-link { color: #3b3a3a; } .alert-dark { color: #1b1e21; background-color: #d6d8d9; border-color: #c6c8ca; } .alert-dark hr { border-top-color: #b9bbbe; } .alert-dark .alert-link { color: #040505; } @-webkit-keyframes progress-bar-stripes { from { background-position: 1rem 0; } to { background-position: 0 0; } } @-o-keyframes progress-bar-stripes { from { background-position: 1rem 0; } to { background-position: 0 0; } } @keyframes progress-bar-stripes { from { background-position: 1rem 0; } to { background-position: 0 0; } } .progress { display: -webkit-box; display: -ms-flexbox; display: flex; height: 1rem; overflow: hidden; line-height: 0; font-size: 0.75rem; background-color: #9ca0a2; border-radius: 0.25rem; } .progress-bar { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; overflow: hidden; color: #fff; text-align: center; white-space: nowrap; background-color: #023605; -webkit-transition: width 0.6s ease; -o-transition: width 0.6s ease; transition: width 0.6s ease; } @media (prefers-reduced-motion: reduce) { .progress-bar { -webkit-transition: none; -o-transition: none; transition: none; } } .progress-bar-striped { background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); background-size: 1rem 1rem; } .progress-bar-animated { -webkit-animation: 1s linear infinite progress-bar-stripes; -o-animation: 1s linear infinite progress-bar-stripes; animation: 1s linear infinite progress-bar-stripes; } @media (prefers-reduced-motion: reduce) { .progress-bar-animated { -webkit-animation: none; -o-animation: none; animation: none; } } .media { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: start; -ms-flex-align: start; align-items: flex-start; } .media-body { -webkit-box-flex: 1; -ms-flex: 1; flex: 1; } .list-group { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; padding-left: 0; margin-bottom: 0; border-radius: 0.25rem; } .list-group-item-action { width: 100%; color: #495057; text-align: inherit; } .list-group-item-action:hover, .list-group-item-action:focus { z-index: 1; color: #495057; text-decoration: none; background-color: #a49f9f; } .list-group-item-action:active { color: #212529; background-color: #9ca0a2; } .list-group-item { position: relative; display: block; padding: 0.75rem 1.25rem; background-color: #fff; border: 1px solid rgba(0, 0, 0, 0.125); } .list-group-item:first-child { border-top-left-radius: inherit; border-top-right-radius: inherit; } .list-group-item:last-child { border-bottom-right-radius: inherit; border-bottom-left-radius: inherit; } .list-group-item.disabled, .list-group-item:disabled { color: #6c757d; pointer-events: none; background-color: #fff; } .list-group-item.active { z-index: 2; color: #fff; background-color: #023605; border-color: #023605; } .list-group-item + .list-group-item { border-top-width: 0; } .list-group-item + .list-group-item.active { margin-top: -1px; border-top-width: 1px; } .list-group-horizontal { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; } .list-group-horizontal > .list-group-item:first-child { border-bottom-left-radius: 0.25rem; border-top-right-radius: 0; } .list-group-horizontal > .list-group-item:last-child { border-top-right-radius: 0.25rem; border-bottom-left-radius: 0; } .list-group-horizontal > .list-group-item.active { margin-top: 0; } .list-group-horizontal > .list-group-item + .list-group-item { border-top-width: 1px; border-left-width: 0; } .list-group-horizontal > .list-group-item + .list-group-item.active { margin-left: -1px; border-left-width: 1px; } @media (min-width: 576px) { .list-group-horizontal-sm { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; } .list-group-horizontal-sm > .list-group-item:first-child { border-bottom-left-radius: 0.25rem; border-top-right-radius: 0; } .list-group-horizontal-sm > .list-group-item:last-child { border-top-right-radius: 0.25rem; border-bottom-left-radius: 0; } .list-group-horizontal-sm > .list-group-item.active { margin-top: 0; } .list-group-horizontal-sm > .list-group-item + .list-group-item { border-top-width: 1px; border-left-width: 0; } .list-group-horizontal-sm > .list-group-item + .list-group-item.active { margin-left: -1px; border-left-width: 1px; } } @media (min-width: 768px) { .list-group-horizontal-md { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; } .list-group-horizontal-md > .list-group-item:first-child { border-bottom-left-radius: 0.25rem; border-top-right-radius: 0; } .list-group-horizontal-md > .list-group-item:last-child { border-top-right-radius: 0.25rem; border-bottom-left-radius: 0; } .list-group-horizontal-md > .list-group-item.active { margin-top: 0; } .list-group-horizontal-md > .list-group-item + .list-group-item { border-top-width: 1px; border-left-width: 0; } .list-group-horizontal-md > .list-group-item + .list-group-item.active { margin-left: -1px; border-left-width: 1px; } } @media (min-width: 992px) { .list-group-horizontal-lg { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; } .list-group-horizontal-lg > .list-group-item:first-child { border-bottom-left-radius: 0.25rem; border-top-right-radius: 0; } .list-group-horizontal-lg > .list-group-item:last-child { border-top-right-radius: 0.25rem; border-bottom-left-radius: 0; } .list-group-horizontal-lg > .list-group-item.active { margin-top: 0; } .list-group-horizontal-lg > .list-group-item + .list-group-item { border-top-width: 1px; border-left-width: 0; } .list-group-horizontal-lg > .list-group-item + .list-group-item.active { margin-left: -1px; border-left-width: 1px; } } @media (min-width: 1200px) { .list-group-horizontal-xl { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; } .list-group-horizontal-xl > .list-group-item:first-child { border-bottom-left-radius: 0.25rem; border-top-right-radius: 0; } .list-group-horizontal-xl > .list-group-item:last-child { border-top-right-radius: 0.25rem; border-bottom-left-radius: 0; } .list-group-horizontal-xl > .list-group-item.active { margin-top: 0; } .list-group-horizontal-xl > .list-group-item + .list-group-item { border-top-width: 1px; border-left-width: 0; } .list-group-horizontal-xl > .list-group-item + .list-group-item.active { margin-left: -1px; border-left-width: 1px; } } @media (min-width: 1400px) { .list-group-horizontal-xxl { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; } .list-group-horizontal-xxl > .list-group-item:first-child { border-bottom-left-radius: 0.25rem; border-top-right-radius: 0; } .list-group-horizontal-xxl > .list-group-item:last-child { border-top-right-radius: 0.25rem; border-bottom-left-radius: 0; } .list-group-horizontal-xxl > .list-group-item.active { margin-top: 0; } .list-group-horizontal-xxl > .list-group-item + .list-group-item { border-top-width: 1px; border-left-width: 0; } .list-group-horizontal-xxl > .list-group-item + .list-group-item.active { margin-left: -1px; border-left-width: 1px; } } .list-group-flush { border-radius: 0; } .list-group-flush > .list-group-item { border-width: 0 0 1px; } .list-group-flush > .list-group-item:last-child { border-bottom-width: 0; } .list-group-item-primary { color: #011c03; background-color: #b8c7b9; } .list-group-item-primary.list-group-item-action:hover, .list-group-item-primary.list-group-item-action:focus { color: #011c03; background-color: #aabcab; } .list-group-item-primary.list-group-item-action.active { color: #fff; background-color: #011c03; border-color: #011c03; } .list-group-item-secondary { color: #828180; background-color: #fefdfc; } .list-group-item-secondary.list-group-item-action:hover, .list-group-item-secondary.list-group-item-action:focus { color: #828180; background-color: #f8f0e9; } .list-group-item-secondary.list-group-item-action.active { color: #fff; background-color: #828180; border-color: #828180; } .list-group-item-success { color: #155724; background-color: #c3e6cb; } .list-group-item-success.list-group-item-action:hover, .list-group-item-success.list-group-item-action:focus { color: #155724; background-color: #b1dfbb; } .list-group-item-success.list-group-item-action.active { color: #fff; background-color: #155724; border-color: #155724; } .list-group-item-info { color: #0c5460; background-color: #bee5eb; } .list-group-item-info.list-group-item-action:hover, .list-group-item-info.list-group-item-action:focus { color: #0c5460; background-color: #abdde5; } .list-group-item-info.list-group-item-action.active { color: #fff; background-color: #0c5460; border-color: #0c5460; } .list-group-item-warning { color: #856404; background-color: #ffeeba; } .list-group-item-warning.list-group-item-action:hover, .list-group-item-warning.list-group-item-action:focus { color: #856404; background-color: #ffe8a1; } .list-group-item-warning.list-group-item-action.active { color: #fff; background-color: #856404; border-color: #856404; } .list-group-item-danger { color: #721c24; background-color: #f5c6cb; } .list-group-item-danger.list-group-item-action:hover, .list-group-item-danger.list-group-item-action:focus { color: #721c24; background-color: #f1b0b7; } .list-group-item-danger.list-group-item-action.active { color: #fff; background-color: #721c24; border-color: #721c24; } .list-group-item-light { color: #555353; background-color: #e6e4e4; } .list-group-item-light.list-group-item-action:hover, .list-group-item-light.list-group-item-action:focus { color: #555353; background-color: #dad7d7; } .list-group-item-light.list-group-item-action.active { color: #fff; background-color: #555353; border-color: #555353; } .list-group-item-dark { color: #1b1e21; background-color: #c6c8ca; } .list-group-item-dark.list-group-item-action:hover, .list-group-item-dark.list-group-item-action:focus { color: #1b1e21; background-color: #b9bbbe; } .list-group-item-dark.list-group-item-action.active { color: #fff; background-color: #1b1e21; border-color: #1b1e21; } .close { float: right; font-size: 1.5rem; font-weight: 700; line-height: 1; color: #000; text-shadow: 0 1px 0 #fff; opacity: 0.5; } .close:hover { color: #000; text-decoration: none; } .close:not(:disabled):not(.disabled):hover, .close:not(:disabled):not(.disabled):focus { opacity: 0.75; } button.close { padding: 0; background-color: transparent; border: 0; } a.close.disabled { pointer-events: none; } .toast { -ms-flex-preferred-size: 350px; flex-basis: 350px; max-width: 350px; font-size: 0.875rem; background-color: rgba(255, 255, 255, 0.85); background-clip: padding-box; border: 1px solid rgba(0, 0, 0, 0.1); -webkit-box-shadow: 0 0.25rem 0.75rem rgba(0, 0, 0, 0.1); box-shadow: 0 0.25rem 0.75rem rgba(0, 0, 0, 0.1); opacity: 0; border-radius: 0.25rem; } .toast:not(:last-child) { margin-bottom: 0.75rem; } .toast.showing { opacity: 1; } .toast.show { display: block; opacity: 1; } .toast.hide { display: none; } .toast-header { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; padding: 0.25rem 0.75rem; color: #6c757d; background-color: rgba(255, 255, 255, 0.85); background-clip: padding-box; border-bottom: 1px solid rgba(0, 0, 0, 0.05); border-top-left-radius: calc(0.25rem - 1px); border-top-right-radius: calc(0.25rem - 1px); } .toast-body { padding: 0.75rem; } .modal-open { overflow: hidden; } .modal-open .modal { overflow-x: hidden; overflow-y: auto; } .modal { position: fixed; top: 0; left: 0; z-index: 1050; display: none; width: 100%; height: 100%; overflow: hidden; outline: 0; } .modal-dialog { position: relative; width: auto; margin: 0.5rem; pointer-events: none; } .modal.fade .modal-dialog { -webkit-transition: -webkit-transform 0.3s ease-out; transition: -webkit-transform 0.3s ease-out; -o-transition: -o-transform 0.3s ease-out; transition: transform 0.3s ease-out; transition: transform 0.3s ease-out, -webkit-transform 0.3s ease-out, -o-transform 0.3s ease-out; -webkit-transform: translate(0, -50px); -o-transform: translate(0, -50px); transform: translate(0, -50px); } @media (prefers-reduced-motion: reduce) { .modal.fade .modal-dialog { -webkit-transition: none; -o-transition: none; transition: none; } } .modal.show .modal-dialog { -webkit-transform: none; -o-transform: none; transform: none; } .modal.modal-static .modal-dialog { -webkit-transform: scale(1.02); -o-transform: scale(1.02); transform: scale(1.02); } .modal-dialog-scrollable { display: -webkit-box; display: -ms-flexbox; display: flex; max-height: calc(100% - 1rem); } .modal-dialog-scrollable .modal-content { max-height: calc(100vh - 1rem); overflow: hidden; } .modal-dialog-scrollable .modal-header, .modal-dialog-scrollable .modal-footer { -ms-flex-negative: 0; flex-shrink: 0; } .modal-dialog-scrollable .modal-body { overflow-y: auto; } .modal-dialog-centered { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; min-height: calc(100% - 1rem); } .modal-dialog-centered::before { display: block; height: calc(100vh - 1rem); height: -webkit-min-content; height: -moz-min-content; height: min-content; content: ""; } .modal-dialog-centered.modal-dialog-scrollable { -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; height: 100%; } .modal-dialog-centered.modal-dialog-scrollable .modal-content { max-height: none; } .modal-dialog-centered.modal-dialog-scrollable::before { content: none; } .modal-content { position: relative; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; width: 100%; pointer-events: auto; background-color: #fff; background-clip: padding-box; border: 1px solid rgba(0, 0, 0, 0.2); border-radius: 0.3rem; outline: 0; } .modal-backdrop { position: fixed; top: 0; left: 0; z-index: 1040; width: 100vw; height: 100vh; background-color: #000; } .modal-backdrop.fade { opacity: 0; } .modal-backdrop.show { opacity: 0.5; } .modal-header { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: start; -ms-flex-align: start; align-items: flex-start; -webkit-box-pack: justify; -ms-flex-pack: justify; justify-content: space-between; padding: 1rem 1rem; border-bottom: 1px solid #dee2e6; border-top-left-radius: calc(0.3rem - 1px); border-top-right-radius: calc(0.3rem - 1px); } .modal-header .close { padding: 1rem 1rem; margin: -1rem -1rem -1rem auto; } .modal-title { margin-bottom: 0; line-height: 1.5; } .modal-body { position: relative; -webkit-box-flex: 1; -ms-flex: 1 1 auto; flex: 1 1 auto; padding: 1rem; } .modal-footer { display: -webkit-box; display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-pack: end; -ms-flex-pack: end; justify-content: flex-end; padding: 0.75rem; border-top: 1px solid #dee2e6; border-bottom-right-radius: calc(0.3rem - 1px); border-bottom-left-radius: calc(0.3rem - 1px); } .modal-footer > * { margin: 0.25rem; } .modal-scrollbar-measure { position: absolute; top: -9999px; width: 50px; height: 50px; overflow: scroll; } @media (min-width: 576px) { .modal-dialog { max-width: 500px; margin: 1.75rem auto; } .modal-dialog-scrollable { max-height: calc(100% - 3.5rem); } .modal-dialog-scrollable .modal-content { max-height: calc(100vh - 3.5rem); } .modal-dialog-centered { min-height: calc(100% - 3.5rem); } .modal-dialog-centered::before { height: calc(100vh - 3.5rem); height: -webkit-min-content; height: -moz-min-content; height: min-content; } .modal-sm { max-width: 300px; } } @media (min-width: 992px) { .modal-lg, .modal-xl { max-width: 800px; } } @media (min-width: 1200px) { .modal-xl { max-width: 1140px; } } .tooltip { position: absolute; z-index: 1070; display: block; margin: 0; font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", "Liberation Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; font-style: normal; font-weight: 400; line-height: 1.5; text-align: left; text-align: start; text-decoration: none; text-shadow: none; text-transform: none; letter-spacing: normal; word-break: normal; word-spacing: normal; white-space: normal; line-break: auto; font-size: 0.875rem; word-wrap: break-word; opacity: 0; } .tooltip.show { opacity: 0.9; } .tooltip .arrow { position: absolute; display: block; width: 0.8rem; height: 0.4rem; } .tooltip .arrow::before { position: absolute; content: ""; border-color: transparent; border-style: solid; } .bs-tooltip-top, .bs-tooltip-auto[x-placement^=top] { padding: 0.4rem 0; } .bs-tooltip-top .arrow, .bs-tooltip-auto[x-placement^=top] .arrow { bottom: 0; } .bs-tooltip-top .arrow::before, .bs-tooltip-auto[x-placement^=top] .arrow::before { top: 0; border-width: 0.4rem 0.4rem 0; border-top-color: #000; } .bs-tooltip-right, .bs-tooltip-auto[x-placement^=right] { padding: 0 0.4rem; } .bs-tooltip-right .arrow, .bs-tooltip-auto[x-placement^=right] .arrow { left: 0; width: 0.4rem; height: 0.8rem; } .bs-tooltip-right .arrow::before, .bs-tooltip-auto[x-placement^=right] .arrow::before { right: 0; border-width: 0.4rem 0.4rem 0.4rem 0; border-right-color: #000; } .bs-tooltip-bottom, .bs-tooltip-auto[x-placement^=bottom] { padding: 0.4rem 0; } .bs-tooltip-bottom .arrow, .bs-tooltip-auto[x-placement^=bottom] .arrow { top: 0; } .bs-tooltip-bottom .arrow::before, .bs-tooltip-auto[x-placement^=bottom] .arrow::before { bottom: 0; border-width: 0 0.4rem 0.4rem; border-bottom-color: #000; } .bs-tooltip-left, .bs-tooltip-auto[x-placement^=left] { padding: 0 0.4rem; } .bs-tooltip-left .arrow, .bs-tooltip-auto[x-placement^=left] .arrow { right: 0; width: 0.4rem; height: 0.8rem; } .bs-tooltip-left .arrow::before, .bs-tooltip-auto[x-placement^=left] .arrow::before { left: 0; border-width: 0.4rem 0 0.4rem 0.4rem; border-left-color: #000; } .tooltip-inner { max-width: 200px; padding: 0.25rem 0.5rem; color: #fff; text-align: center; background-color: #000; border-radius: 0.25rem; } .popover { position: absolute; top: 0; left: 0; z-index: 1060; display: block; max-width: 276px; font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", "Liberation Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; font-style: normal; font-weight: 400; line-height: 1.5; text-align: left; text-align: start; text-decoration: none; text-shadow: none; text-transform: none; letter-spacing: normal; word-break: normal; word-spacing: normal; white-space: normal; line-break: auto; font-size: 0.875rem; word-wrap: break-word; background-color: #fff; background-clip: padding-box; border: 1px solid rgba(0, 0, 0, 0.2); border-radius: 0.3rem; } .popover .arrow { position: absolute; display: block; width: 1rem; height: 0.5rem; margin: 0 0.3rem; } .popover .arrow::before, .popover .arrow::after { position: absolute; display: block; content: ""; border-color: transparent; border-style: solid; } .bs-popover-top, .bs-popover-auto[x-placement^=top] { margin-bottom: 0.5rem; } .bs-popover-top > .arrow, .bs-popover-auto[x-placement^=top] > .arrow { bottom: calc(-0.5rem - 1px); } .bs-popover-top > .arrow::before, .bs-popover-auto[x-placement^=top] > .arrow::before { bottom: 0; border-width: 0.5rem 0.5rem 0; border-top-color: rgba(0, 0, 0, 0.25); } .bs-popover-top > .arrow::after, .bs-popover-auto[x-placement^=top] > .arrow::after { bottom: 1px; border-width: 0.5rem 0.5rem 0; border-top-color: #fff; } .bs-popover-right, .bs-popover-auto[x-placement^=right] { margin-left: 0.5rem; } .bs-popover-right > .arrow, .bs-popover-auto[x-placement^=right] > .arrow { left: calc(-0.5rem - 1px); width: 0.5rem; height: 1rem; margin: 0.3rem 0; } .bs-popover-right > .arrow::before, .bs-popover-auto[x-placement^=right] > .arrow::before { left: 0; border-width: 0.5rem 0.5rem 0.5rem 0; border-right-color: rgba(0, 0, 0, 0.25); } .bs-popover-right > .arrow::after, .bs-popover-auto[x-placement^=right] > .arrow::after { left: 1px; border-width: 0.5rem 0.5rem 0.5rem 0; border-right-color: #fff; } .bs-popover-bottom, .bs-popover-auto[x-placement^=bottom] { margin-top: 0.5rem; } .bs-popover-bottom > .arrow, .bs-popover-auto[x-placement^=bottom] > .arrow { top: calc(-0.5rem - 1px); } .bs-popover-bottom > .arrow::before, .bs-popover-auto[x-placement^=bottom] > .arrow::before { top: 0; border-width: 0 0.5rem 0.5rem 0.5rem; border-bottom-color: rgba(0, 0, 0, 0.25); } .bs-popover-bottom > .arrow::after, .bs-popover-auto[x-placement^=bottom] > .arrow::after { top: 1px; border-width: 0 0.5rem 0.5rem 0.5rem; border-bottom-color: #fff; } .bs-popover-bottom .popover-header::before, .bs-popover-auto[x-placement^=bottom] .popover-header::before { position: absolute; top: 0; left: 50%; display: block; width: 1rem; margin-left: -0.5rem; content: ""; border-bottom: 1px solid #f7f7f7; } .bs-popover-left, .bs-popover-auto[x-placement^=left] { margin-right: 0.5rem; } .bs-popover-left > .arrow, .bs-popover-auto[x-placement^=left] > .arrow { right: calc(-0.5rem - 1px); width: 0.5rem; height: 1rem; margin: 0.3rem 0; } .bs-popover-left > .arrow::before, .bs-popover-auto[x-placement^=left] > .arrow::before { right: 0; border-width: 0.5rem 0 0.5rem 0.5rem; border-left-color: rgba(0, 0, 0, 0.25); } .bs-popover-left > .arrow::after, .bs-popover-auto[x-placement^=left] > .arrow::after { right: 1px; border-width: 0.5rem 0 0.5rem 0.5rem; border-left-color: #fff; } .popover-header { padding: 0.5rem 0.75rem; margin-bottom: 0; font-size: 1rem; background-color: #f7f7f7; border-bottom: 1px solid #ebebeb; border-top-left-radius: calc(0.3rem - 1px); border-top-right-radius: calc(0.3rem - 1px); } .popover-header:empty { display: none; } .popover-body { padding: 0.5rem 0.75rem; color: #212529; } .carousel { position: relative; } .carousel.pointer-event { -ms-touch-action: pan-y; touch-action: pan-y; } .carousel-inner { position: relative; width: 100%; overflow: hidden; } .carousel-inner::after { display: block; clear: both; content: ""; } .carousel-item { position: relative; display: none; float: left; width: 100%; margin-right: -100%; -webkit-backface-visibility: hidden; backface-visibility: hidden; -webkit-transition: -webkit-transform 0.6s ease-in-out; transition: -webkit-transform 0.6s ease-in-out; -o-transition: -o-transform 0.6s ease-in-out; transition: transform 0.6s ease-in-out; transition: transform 0.6s ease-in-out, -webkit-transform 0.6s ease-in-out, -o-transform 0.6s ease-in-out; } @media (prefers-reduced-motion: reduce) { .carousel-item { -webkit-transition: none; -o-transition: none; transition: none; } } .carousel-item.active, .carousel-item-next, .carousel-item-prev { display: block; } .carousel-item-next:not(.carousel-item-left), .active.carousel-item-right { -webkit-transform: translateX(100%); -o-transform: translateX(100%); transform: translateX(100%); } .carousel-item-prev:not(.carousel-item-right), .active.carousel-item-left { -webkit-transform: translateX(-100%); -o-transform: translateX(-100%); transform: translateX(-100%); } .carousel-fade .carousel-item { opacity: 0; -webkit-transition-property: opacity; -o-transition-property: opacity; transition-property: opacity; -webkit-transform: none; -o-transform: none; transform: none; } .carousel-fade .carousel-item.active, .carousel-fade .carousel-item-next.carousel-item-left, .carousel-fade .carousel-item-prev.carousel-item-right { z-index: 1; opacity: 1; } .carousel-fade .active.carousel-item-left, .carousel-fade .active.carousel-item-right { z-index: 0; opacity: 0; -webkit-transition: opacity 0s 0.6s; -o-transition: opacity 0s 0.6s; transition: opacity 0s 0.6s; } @media (prefers-reduced-motion: reduce) { .carousel-fade .active.carousel-item-left, .carousel-fade .active.carousel-item-right { -webkit-transition: none; -o-transition: none; transition: none; } } .carousel-control-prev, .carousel-control-next { position: absolute; top: 0; bottom: 0; z-index: 1; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; width: 15%; color: #fff; text-align: center; opacity: 0.5; -webkit-transition: opacity 0.15s ease; -o-transition: opacity 0.15s ease; transition: opacity 0.15s ease; } @media (prefers-reduced-motion: reduce) { .carousel-control-prev, .carousel-control-next { -webkit-transition: none; -o-transition: none; transition: none; } } .carousel-control-prev:hover, .carousel-control-prev:focus, .carousel-control-next:hover, .carousel-control-next:focus { color: #fff; text-decoration: none; outline: 0; opacity: 0.9; } .carousel-control-prev { left: 0; } .carousel-control-next { right: 0; } .carousel-control-prev-icon, .carousel-control-next-icon { display: inline-block; width: 20px; height: 20px; background: 50%/100% 100% no-repeat; } .carousel-control-prev-icon { background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath d='M5.25 0l-4 4 4 4 1.5-1.5L4.25 4l2.5-2.5L5.25 0z'/%3e%3c/svg%3e"); } .carousel-control-next-icon { background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath d='M2.75 0l-1.5 1.5L3.75 4l-2.5 2.5L2.75 8l4-4-4-4z'/%3e%3c/svg%3e"); } .carousel-indicators { position: absolute; right: 0; bottom: 0; left: 0; z-index: 15; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; padding-left: 0; margin-right: 15%; margin-left: 15%; list-style: none; } .carousel-indicators li { -webkit-box-sizing: content-box; box-sizing: content-box; -webkit-box-flex: 0; -ms-flex: 0 1 auto; flex: 0 1 auto; width: 30px; height: 3px; margin-right: 3px; margin-left: 3px; text-indent: -999px; cursor: pointer; background-color: #fff; background-clip: padding-box; border-top: 10px solid transparent; border-bottom: 10px solid transparent; opacity: 0.5; -webkit-transition: opacity 0.6s ease; -o-transition: opacity 0.6s ease; transition: opacity 0.6s ease; } @media (prefers-reduced-motion: reduce) { .carousel-indicators li { -webkit-transition: none; -o-transition: none; transition: none; } } .carousel-indicators .active { opacity: 1; } .carousel-caption { position: absolute; right: 15%; bottom: 20px; left: 15%; z-index: 10; padding-top: 20px; padding-bottom: 20px; color: #fff; text-align: center; } @-webkit-keyframes spinner-border { to { -webkit-transform: rotate(360deg); transform: rotate(360deg); } } @-o-keyframes spinner-border { to { -o-transform: rotate(360deg); transform: rotate(360deg); } } @keyframes spinner-border { to { -webkit-transform: rotate(360deg); -o-transform: rotate(360deg); transform: rotate(360deg); } } .spinner-border { display: inline-block; width: 2rem; height: 2rem; vertical-align: text-bottom; border: 0.25em solid currentColor; border-right-color: transparent; border-radius: 50%; -webkit-animation: 0.75s linear infinite spinner-border; -o-animation: 0.75s linear infinite spinner-border; animation: 0.75s linear infinite spinner-border; } .spinner-border-sm { width: 1rem; height: 1rem; border-width: 0.2em; } @-webkit-keyframes spinner-grow { 0% { -webkit-transform: scale(0); transform: scale(0); } 50% { opacity: 1; -webkit-transform: none; transform: none; } } @-o-keyframes spinner-grow { 0% { -o-transform: scale(0); transform: scale(0); } 50% { opacity: 1; -o-transform: none; transform: none; } } @keyframes spinner-grow { 0% { -webkit-transform: scale(0); -o-transform: scale(0); transform: scale(0); } 50% { opacity: 1; -webkit-transform: none; -o-transform: none; transform: none; } } .spinner-grow { display: inline-block; width: 2rem; height: 2rem; vertical-align: text-bottom; background-color: currentColor; border-radius: 50%; opacity: 0; -webkit-animation: 0.75s linear infinite spinner-grow; -o-animation: 0.75s linear infinite spinner-grow; animation: 0.75s linear infinite spinner-grow; } .spinner-grow-sm { width: 1rem; height: 1rem; } @media (prefers-reduced-motion: reduce) { .spinner-border, .spinner-grow { -webkit-animation-duration: 1.5s; -o-animation-duration: 1.5s; animation-duration: 1.5s; } } .align-baseline { vertical-align: baseline !important; } .align-top { vertical-align: top !important; } .align-middle { vertical-align: middle !important; } .align-bottom { vertical-align: bottom !important; } .align-text-bottom { vertical-align: text-bottom !important; } .align-text-top { vertical-align: text-top !important; } .bg-primary { background-color: #023605 !important; } a.bg-primary:hover, a.bg-primary:focus, button.bg-primary:hover, button.bg-primary:focus { background-color: #000500 !important; } .bg-secondary { background-color: #faf8f6 !important; } a.bg-secondary:hover, a.bg-secondary:focus, button.bg-secondary:hover, button.bg-secondary:focus { background-color: #e8dfd5 !important; } .bg-success { background-color: #28a745 !important; } a.bg-success:hover, a.bg-success:focus, button.bg-success:hover, button.bg-success:focus { background-color: #1e7e34 !important; } .bg-info { background-color: #17a2b8 !important; } a.bg-info:hover, a.bg-info:focus, button.bg-info:hover, button.bg-info:focus { background-color: #117a8b !important; } .bg-warning { background-color: #ffc107 !important; } a.bg-warning:hover, a.bg-warning:focus, button.bg-warning:hover, button.bg-warning:focus { background-color: #d39e00 !important; } .bg-danger { background-color: #dc3545 !important; } a.bg-danger:hover, a.bg-danger:focus, button.bg-danger:hover, button.bg-danger:focus { background-color: #bd2130 !important; } .bg-light { background-color: #a49f9f !important; } a.bg-light:hover, a.bg-light:focus, button.bg-light:hover, button.bg-light:focus { background-color: #8b8585 !important; } .bg-dark { background-color: #343a40 !important; } a.bg-dark:hover, a.bg-dark:focus, button.bg-dark:hover, button.bg-dark:focus { background-color: #1d2124 !important; } .bg-white { background-color: #fff !important; } .bg-transparent { background-color: transparent !important; } .border { border: 1px solid #dee2e6 !important; } .border-top { border-top: 1px solid #dee2e6 !important; } .border-right { border-right: 1px solid #dee2e6 !important; } .border-bottom { border-bottom: 1px solid #dee2e6 !important; } .border-left { border-left: 1px solid #dee2e6 !important; } .border-0 { border: 0 !important; } .border-top-0 { border-top: 0 !important; } .border-right-0 { border-right: 0 !important; } .border-bottom-0 { border-bottom: 0 !important; } .border-left-0 { border-left: 0 !important; } .border-primary { border-color: #023605 !important; } .border-secondary { border-color: #faf8f6 !important; } .border-success { border-color: #28a745 !important; } .border-info { border-color: #17a2b8 !important; } .border-warning { border-color: #ffc107 !important; } .border-danger { border-color: #dc3545 !important; } .border-light { border-color: #a49f9f !important; } .border-dark { border-color: #343a40 !important; } .border-white { border-color: #fff !important; } .rounded-sm { border-radius: 0.2rem !important; } .rounded { border-radius: 0.25rem !important; } .rounded-top { border-top-left-radius: 0.25rem !important; border-top-right-radius: 0.25rem !important; } .rounded-right { border-top-right-radius: 0.25rem !important; border-bottom-right-radius: 0.25rem !important; } .rounded-bottom { border-bottom-right-radius: 0.25rem !important; border-bottom-left-radius: 0.25rem !important; } .rounded-left { border-top-left-radius: 0.25rem !important; border-bottom-left-radius: 0.25rem !important; } .rounded-lg { border-radius: 0.3rem !important; } .rounded-circle { border-radius: 50% !important; } .rounded-pill { border-radius: 50rem !important; } .rounded-0 { border-radius: 0 !important; } .clearfix::after { display: block; clear: both; content: ""; } .d-none { display: none !important; } .d-inline { display: inline !important; } .d-inline-block { display: inline-block !important; } .d-block { display: block !important; } .d-table { display: table !important; } .d-table-row { display: table-row !important; } .d-table-cell { display: table-cell !important; } .d-flex { display: -webkit-box !important; display: -ms-flexbox !important; display: flex !important; } .d-inline-flex { display: -webkit-inline-box !important; display: -ms-inline-flexbox !important; display: inline-flex !important; } @media (min-width: 576px) { .d-sm-none { display: none !important; } .d-sm-inline { display: inline !important; } .d-sm-inline-block { display: inline-block !important; } .d-sm-block { display: block !important; } .d-sm-table { display: table !important; } .d-sm-table-row { display: table-row !important; } .d-sm-table-cell { display: table-cell !important; } .d-sm-flex { display: -webkit-box !important; display: -ms-flexbox !important; display: flex !important; } .d-sm-inline-flex { display: -webkit-inline-box !important; display: -ms-inline-flexbox !important; display: inline-flex !important; } } @media (min-width: 768px) { .d-md-none { display: none !important; } .d-md-inline { display: inline !important; } .d-md-inline-block { display: inline-block !important; } .d-md-block { display: block !important; } .d-md-table { display: table !important; } .d-md-table-row { display: table-row !important; } .d-md-table-cell { display: table-cell !important; } .d-md-flex { display: -webkit-box !important; display: -ms-flexbox !important; display: flex !important; } .d-md-inline-flex { display: -webkit-inline-box !important; display: -ms-inline-flexbox !important; display: inline-flex !important; } } @media (min-width: 992px) { .d-lg-none { display: none !important; } .d-lg-inline { display: inline !important; } .d-lg-inline-block { display: inline-block !important; } .d-lg-block { display: block !important; } .d-lg-table { display: table !important; } .d-lg-table-row { display: table-row !important; } .d-lg-table-cell { display: table-cell !important; } .d-lg-flex { display: -webkit-box !important; display: -ms-flexbox !important; display: flex !important; } .d-lg-inline-flex { display: -webkit-inline-box !important; display: -ms-inline-flexbox !important; display: inline-flex !important; } } @media (min-width: 1200px) { .d-xl-none { display: none !important; } .d-xl-inline { display: inline !important; } .d-xl-inline-block { display: inline-block !important; } .d-xl-block { display: block !important; } .d-xl-table { display: table !important; } .d-xl-table-row { display: table-row !important; } .d-xl-table-cell { display: table-cell !important; } .d-xl-flex { display: -webkit-box !important; display: -ms-flexbox !important; display: flex !important; } .d-xl-inline-flex { display: -webkit-inline-box !important; display: -ms-inline-flexbox !important; display: inline-flex !important; } } @media (min-width: 1400px) { .d-xxl-none { display: none !important; } .d-xxl-inline { display: inline !important; } .d-xxl-inline-block { display: inline-block !important; } .d-xxl-block { display: block !important; } .d-xxl-table { display: table !important; } .d-xxl-table-row { display: table-row !important; } .d-xxl-table-cell { display: table-cell !important; } .d-xxl-flex { display: -webkit-box !important; display: -ms-flexbox !important; display: flex !important; } .d-xxl-inline-flex { display: -webkit-inline-box !important; display: -ms-inline-flexbox !important; display: inline-flex !important; } } @media print { .d-print-none { display: none !important; } .d-print-inline { display: inline !important; } .d-print-inline-block { display: inline-block !important; } .d-print-block { display: block !important; } .d-print-table { display: table !important; } .d-print-table-row { display: table-row !important; } .d-print-table-cell { display: table-cell !important; } .d-print-flex { display: -webkit-box !important; display: -ms-flexbox !important; display: flex !important; } .d-print-inline-flex { display: -webkit-inline-box !important; display: -ms-inline-flexbox !important; display: inline-flex !important; } } .embed-responsive { position: relative; display: block; width: 100%; padding: 0; overflow: hidden; } .embed-responsive::before { display: block; content: ""; } .embed-responsive .embed-responsive-item, .embed-responsive iframe, .embed-responsive embed, .embed-responsive object, .embed-responsive video { position: absolute; top: 0; bottom: 0; left: 0; width: 100%; height: 100%; border: 0; } .embed-responsive-21by9::before { padding-top: 42.8571428571%; } .embed-responsive-16by9::before { padding-top: 56.25%; } .embed-responsive-4by3::before { padding-top: 75%; } .embed-responsive-1by1::before { padding-top: 100%; } .flex-row { -webkit-box-orient: horizontal !important; -webkit-box-direction: normal !important; -ms-flex-direction: row !important; flex-direction: row !important; } .flex-column { -webkit-box-orient: vertical !important; -webkit-box-direction: normal !important; -ms-flex-direction: column !important; flex-direction: column !important; } .flex-row-reverse { -webkit-box-orient: horizontal !important; -webkit-box-direction: reverse !important; -ms-flex-direction: row-reverse !important; flex-direction: row-reverse !important; } .flex-column-reverse { -webkit-box-orient: vertical !important; -webkit-box-direction: reverse !important; -ms-flex-direction: column-reverse !important; flex-direction: column-reverse !important; } .flex-wrap { -ms-flex-wrap: wrap !important; flex-wrap: wrap !important; } .flex-nowrap { -ms-flex-wrap: nowrap !important; flex-wrap: nowrap !important; } .flex-wrap-reverse { -ms-flex-wrap: wrap-reverse !important; flex-wrap: wrap-reverse !important; } .flex-fill { -webkit-box-flex: 1 !important; -ms-flex: 1 1 auto !important; flex: 1 1 auto !important; } .flex-grow-0 { -webkit-box-flex: 0 !important; -ms-flex-positive: 0 !important; flex-grow: 0 !important; } .flex-grow-1 { -webkit-box-flex: 1 !important; -ms-flex-positive: 1 !important; flex-grow: 1 !important; } .flex-shrink-0 { -ms-flex-negative: 0 !important; flex-shrink: 0 !important; } .flex-shrink-1 { -ms-flex-negative: 1 !important; flex-shrink: 1 !important; } .justify-content-start { -webkit-box-pack: start !important; -ms-flex-pack: start !important; justify-content: flex-start !important; } .justify-content-end { -webkit-box-pack: end !important; -ms-flex-pack: end !important; justify-content: flex-end !important; } .justify-content-center { -webkit-box-pack: center !important; -ms-flex-pack: center !important; justify-content: center !important; } .justify-content-between { -webkit-box-pack: justify !important; -ms-flex-pack: justify !important; justify-content: space-between !important; } .justify-content-around { -ms-flex-pack: distribute !important; justify-content: space-around !important; } .align-items-start { -webkit-box-align: start !important; -ms-flex-align: start !important; align-items: flex-start !important; } .align-items-end { -webkit-box-align: end !important; -ms-flex-align: end !important; align-items: flex-end !important; } .align-items-center { -webkit-box-align: center !important; -ms-flex-align: center !important; align-items: center !important; } .align-items-baseline { -webkit-box-align: baseline !important; -ms-flex-align: baseline !important; align-items: baseline !important; } .align-items-stretch { -webkit-box-align: stretch !important; -ms-flex-align: stretch !important; align-items: stretch !important; } .align-content-start { -ms-flex-line-pack: start !important; align-content: flex-start !important; } .align-content-end { -ms-flex-line-pack: end !important; align-content: flex-end !important; } .align-content-center { -ms-flex-line-pack: center !important; align-content: center !important; } .align-content-between { -ms-flex-line-pack: justify !important; align-content: space-between !important; } .align-content-around { -ms-flex-line-pack: distribute !important; align-content: space-around !important; } .align-content-stretch { -ms-flex-line-pack: stretch !important; align-content: stretch !important; } .align-self-auto { -ms-flex-item-align: auto !important; align-self: auto !important; } .align-self-start { -ms-flex-item-align: start !important; align-self: flex-start !important; } .align-self-end { -ms-flex-item-align: end !important; align-self: flex-end !important; } .align-self-center { -ms-flex-item-align: center !important; align-self: center !important; } .align-self-baseline { -ms-flex-item-align: baseline !important; align-self: baseline !important; } .align-self-stretch { -ms-flex-item-align: stretch !important; align-self: stretch !important; } @media (min-width: 576px) { .flex-sm-row { -webkit-box-orient: horizontal !important; -webkit-box-direction: normal !important; -ms-flex-direction: row !important; flex-direction: row !important; } .flex-sm-column { -webkit-box-orient: vertical !important; -webkit-box-direction: normal !important; -ms-flex-direction: column !important; flex-direction: column !important; } .flex-sm-row-reverse { -webkit-box-orient: horizontal !important; -webkit-box-direction: reverse !important; -ms-flex-direction: row-reverse !important; flex-direction: row-reverse !important; } .flex-sm-column-reverse { -webkit-box-orient: vertical !important; -webkit-box-direction: reverse !important; -ms-flex-direction: column-reverse !important; flex-direction: column-reverse !important; } .flex-sm-wrap { -ms-flex-wrap: wrap !important; flex-wrap: wrap !important; } .flex-sm-nowrap { -ms-flex-wrap: nowrap !important; flex-wrap: nowrap !important; } .flex-sm-wrap-reverse { -ms-flex-wrap: wrap-reverse !important; flex-wrap: wrap-reverse !important; } .flex-sm-fill { -webkit-box-flex: 1 !important; -ms-flex: 1 1 auto !important; flex: 1 1 auto !important; } .flex-sm-grow-0 { -webkit-box-flex: 0 !important; -ms-flex-positive: 0 !important; flex-grow: 0 !important; } .flex-sm-grow-1 { -webkit-box-flex: 1 !important; -ms-flex-positive: 1 !important; flex-grow: 1 !important; } .flex-sm-shrink-0 { -ms-flex-negative: 0 !important; flex-shrink: 0 !important; } .flex-sm-shrink-1 { -ms-flex-negative: 1 !important; flex-shrink: 1 !important; } .justify-content-sm-start { -webkit-box-pack: start !important; -ms-flex-pack: start !important; justify-content: flex-start !important; } .justify-content-sm-end { -webkit-box-pack: end !important; -ms-flex-pack: end !important; justify-content: flex-end !important; } .justify-content-sm-center { -webkit-box-pack: center !important; -ms-flex-pack: center !important; justify-content: center !important; } .justify-content-sm-between { -webkit-box-pack: justify !important; -ms-flex-pack: justify !important; justify-content: space-between !important; } .justify-content-sm-around { -ms-flex-pack: distribute !important; justify-content: space-around !important; } .align-items-sm-start { -webkit-box-align: start !important; -ms-flex-align: start !important; align-items: flex-start !important; } .align-items-sm-end { -webkit-box-align: end !important; -ms-flex-align: end !important; align-items: flex-end !important; } .align-items-sm-center { -webkit-box-align: center !important; -ms-flex-align: center !important; align-items: center !important; } .align-items-sm-baseline { -webkit-box-align: baseline !important; -ms-flex-align: baseline !important; align-items: baseline !important; } .align-items-sm-stretch { -webkit-box-align: stretch !important; -ms-flex-align: stretch !important; align-items: stretch !important; } .align-content-sm-start { -ms-flex-line-pack: start !important; align-content: flex-start !important; } .align-content-sm-end { -ms-flex-line-pack: end !important; align-content: flex-end !important; } .align-content-sm-center { -ms-flex-line-pack: center !important; align-content: center !important; } .align-content-sm-between { -ms-flex-line-pack: justify !important; align-content: space-between !important; } .align-content-sm-around { -ms-flex-line-pack: distribute !important; align-content: space-around !important; } .align-content-sm-stretch { -ms-flex-line-pack: stretch !important; align-content: stretch !important; } .align-self-sm-auto { -ms-flex-item-align: auto !important; align-self: auto !important; } .align-self-sm-start { -ms-flex-item-align: start !important; align-self: flex-start !important; } .align-self-sm-end { -ms-flex-item-align: end !important; align-self: flex-end !important; } .align-self-sm-center { -ms-flex-item-align: center !important; align-self: center !important; } .align-self-sm-baseline { -ms-flex-item-align: baseline !important; align-self: baseline !important; } .align-self-sm-stretch { -ms-flex-item-align: stretch !important; align-self: stretch !important; } } @media (min-width: 768px) { .flex-md-row { -webkit-box-orient: horizontal !important; -webkit-box-direction: normal !important; -ms-flex-direction: row !important; flex-direction: row !important; } .flex-md-column { -webkit-box-orient: vertical !important; -webkit-box-direction: normal !important; -ms-flex-direction: column !important; flex-direction: column !important; } .flex-md-row-reverse { -webkit-box-orient: horizontal !important; -webkit-box-direction: reverse !important; -ms-flex-direction: row-reverse !important; flex-direction: row-reverse !important; } .flex-md-column-reverse { -webkit-box-orient: vertical !important; -webkit-box-direction: reverse !important; -ms-flex-direction: column-reverse !important; flex-direction: column-reverse !important; } .flex-md-wrap { -ms-flex-wrap: wrap !important; flex-wrap: wrap !important; } .flex-md-nowrap { -ms-flex-wrap: nowrap !important; flex-wrap: nowrap !important; } .flex-md-wrap-reverse { -ms-flex-wrap: wrap-reverse !important; flex-wrap: wrap-reverse !important; } .flex-md-fill { -webkit-box-flex: 1 !important; -ms-flex: 1 1 auto !important; flex: 1 1 auto !important; } .flex-md-grow-0 { -webkit-box-flex: 0 !important; -ms-flex-positive: 0 !important; flex-grow: 0 !important; } .flex-md-grow-1 { -webkit-box-flex: 1 !important; -ms-flex-positive: 1 !important; flex-grow: 1 !important; } .flex-md-shrink-0 { -ms-flex-negative: 0 !important; flex-shrink: 0 !important; } .flex-md-shrink-1 { -ms-flex-negative: 1 !important; flex-shrink: 1 !important; } .justify-content-md-start { -webkit-box-pack: start !important; -ms-flex-pack: start !important; justify-content: flex-start !important; } .justify-content-md-end { -webkit-box-pack: end !important; -ms-flex-pack: end !important; justify-content: flex-end !important; } .justify-content-md-center { -webkit-box-pack: center !important; -ms-flex-pack: center !important; justify-content: center !important; } .justify-content-md-between { -webkit-box-pack: justify !important; -ms-flex-pack: justify !important; justify-content: space-between !important; } .justify-content-md-around { -ms-flex-pack: distribute !important; justify-content: space-around !important; } .align-items-md-start { -webkit-box-align: start !important; -ms-flex-align: start !important; align-items: flex-start !important; } .align-items-md-end { -webkit-box-align: end !important; -ms-flex-align: end !important; align-items: flex-end !important; } .align-items-md-center { -webkit-box-align: center !important; -ms-flex-align: center !important; align-items: center !important; } .align-items-md-baseline { -webkit-box-align: baseline !important; -ms-flex-align: baseline !important; align-items: baseline !important; } .align-items-md-stretch { -webkit-box-align: stretch !important; -ms-flex-align: stretch !important; align-items: stretch !important; } .align-content-md-start { -ms-flex-line-pack: start !important; align-content: flex-start !important; } .align-content-md-end { -ms-flex-line-pack: end !important; align-content: flex-end !important; } .align-content-md-center { -ms-flex-line-pack: center !important; align-content: center !important; } .align-content-md-between { -ms-flex-line-pack: justify !important; align-content: space-between !important; } .align-content-md-around { -ms-flex-line-pack: distribute !important; align-content: space-around !important; } .align-content-md-stretch { -ms-flex-line-pack: stretch !important; align-content: stretch !important; } .align-self-md-auto { -ms-flex-item-align: auto !important; align-self: auto !important; } .align-self-md-start { -ms-flex-item-align: start !important; align-self: flex-start !important; } .align-self-md-end { -ms-flex-item-align: end !important; align-self: flex-end !important; } .align-self-md-center { -ms-flex-item-align: center !important; align-self: center !important; } .align-self-md-baseline { -ms-flex-item-align: baseline !important; align-self: baseline !important; } .align-self-md-stretch { -ms-flex-item-align: stretch !important; align-self: stretch !important; } } @media (min-width: 992px) { .flex-lg-row { -webkit-box-orient: horizontal !important; -webkit-box-direction: normal !important; -ms-flex-direction: row !important; flex-direction: row !important; } .flex-lg-column { -webkit-box-orient: vertical !important; -webkit-box-direction: normal !important; -ms-flex-direction: column !important; flex-direction: column !important; } .flex-lg-row-reverse { -webkit-box-orient: horizontal !important; -webkit-box-direction: reverse !important; -ms-flex-direction: row-reverse !important; flex-direction: row-reverse !important; } .flex-lg-column-reverse { -webkit-box-orient: vertical !important; -webkit-box-direction: reverse !important; -ms-flex-direction: column-reverse !important; flex-direction: column-reverse !important; } .flex-lg-wrap { -ms-flex-wrap: wrap !important; flex-wrap: wrap !important; } .flex-lg-nowrap { -ms-flex-wrap: nowrap !important; flex-wrap: nowrap !important; } .flex-lg-wrap-reverse { -ms-flex-wrap: wrap-reverse !important; flex-wrap: wrap-reverse !important; } .flex-lg-fill { -webkit-box-flex: 1 !important; -ms-flex: 1 1 auto !important; flex: 1 1 auto !important; } .flex-lg-grow-0 { -webkit-box-flex: 0 !important; -ms-flex-positive: 0 !important; flex-grow: 0 !important; } .flex-lg-grow-1 { -webkit-box-flex: 1 !important; -ms-flex-positive: 1 !important; flex-grow: 1 !important; } .flex-lg-shrink-0 { -ms-flex-negative: 0 !important; flex-shrink: 0 !important; } .flex-lg-shrink-1 { -ms-flex-negative: 1 !important; flex-shrink: 1 !important; } .justify-content-lg-start { -webkit-box-pack: start !important; -ms-flex-pack: start !important; justify-content: flex-start !important; } .justify-content-lg-end { -webkit-box-pack: end !important; -ms-flex-pack: end !important; justify-content: flex-end !important; } .justify-content-lg-center { -webkit-box-pack: center !important; -ms-flex-pack: center !important; justify-content: center !important; } .justify-content-lg-between { -webkit-box-pack: justify !important; -ms-flex-pack: justify !important; justify-content: space-between !important; } .justify-content-lg-around { -ms-flex-pack: distribute !important; justify-content: space-around !important; } .align-items-lg-start { -webkit-box-align: start !important; -ms-flex-align: start !important; align-items: flex-start !important; } .align-items-lg-end { -webkit-box-align: end !important; -ms-flex-align: end !important; align-items: flex-end !important; } .align-items-lg-center { -webkit-box-align: center !important; -ms-flex-align: center !important; align-items: center !important; } .align-items-lg-baseline { -webkit-box-align: baseline !important; -ms-flex-align: baseline !important; align-items: baseline !important; } .align-items-lg-stretch { -webkit-box-align: stretch !important; -ms-flex-align: stretch !important; align-items: stretch !important; } .align-content-lg-start { -ms-flex-line-pack: start !important; align-content: flex-start !important; } .align-content-lg-end { -ms-flex-line-pack: end !important; align-content: flex-end !important; } .align-content-lg-center { -ms-flex-line-pack: center !important; align-content: center !important; } .align-content-lg-between { -ms-flex-line-pack: justify !important; align-content: space-between !important; } .align-content-lg-around { -ms-flex-line-pack: distribute !important; align-content: space-around !important; } .align-content-lg-stretch { -ms-flex-line-pack: stretch !important; align-content: stretch !important; } .align-self-lg-auto { -ms-flex-item-align: auto !important; align-self: auto !important; } .align-self-lg-start { -ms-flex-item-align: start !important; align-self: flex-start !important; } .align-self-lg-end { -ms-flex-item-align: end !important; align-self: flex-end !important; } .align-self-lg-center { -ms-flex-item-align: center !important; align-self: center !important; } .align-self-lg-baseline { -ms-flex-item-align: baseline !important; align-self: baseline !important; } .align-self-lg-stretch { -ms-flex-item-align: stretch !important; align-self: stretch !important; } } @media (min-width: 1200px) { .flex-xl-row { -webkit-box-orient: horizontal !important; -webkit-box-direction: normal !important; -ms-flex-direction: row !important; flex-direction: row !important; } .flex-xl-column { -webkit-box-orient: vertical !important; -webkit-box-direction: normal !important; -ms-flex-direction: column !important; flex-direction: column !important; } .flex-xl-row-reverse { -webkit-box-orient: horizontal !important; -webkit-box-direction: reverse !important; -ms-flex-direction: row-reverse !important; flex-direction: row-reverse !important; } .flex-xl-column-reverse { -webkit-box-orient: vertical !important; -webkit-box-direction: reverse !important; -ms-flex-direction: column-reverse !important; flex-direction: column-reverse !important; } .flex-xl-wrap { -ms-flex-wrap: wrap !important; flex-wrap: wrap !important; } .flex-xl-nowrap { -ms-flex-wrap: nowrap !important; flex-wrap: nowrap !important; } .flex-xl-wrap-reverse { -ms-flex-wrap: wrap-reverse !important; flex-wrap: wrap-reverse !important; } .flex-xl-fill { -webkit-box-flex: 1 !important; -ms-flex: 1 1 auto !important; flex: 1 1 auto !important; } .flex-xl-grow-0 { -webkit-box-flex: 0 !important; -ms-flex-positive: 0 !important; flex-grow: 0 !important; } .flex-xl-grow-1 { -webkit-box-flex: 1 !important; -ms-flex-positive: 1 !important; flex-grow: 1 !important; } .flex-xl-shrink-0 { -ms-flex-negative: 0 !important; flex-shrink: 0 !important; } .flex-xl-shrink-1 { -ms-flex-negative: 1 !important; flex-shrink: 1 !important; } .justify-content-xl-start { -webkit-box-pack: start !important; -ms-flex-pack: start !important; justify-content: flex-start !important; } .justify-content-xl-end { -webkit-box-pack: end !important; -ms-flex-pack: end !important; justify-content: flex-end !important; } .justify-content-xl-center { -webkit-box-pack: center !important; -ms-flex-pack: center !important; justify-content: center !important; } .justify-content-xl-between { -webkit-box-pack: justify !important; -ms-flex-pack: justify !important; justify-content: space-between !important; } .justify-content-xl-around { -ms-flex-pack: distribute !important; justify-content: space-around !important; } .align-items-xl-start { -webkit-box-align: start !important; -ms-flex-align: start !important; align-items: flex-start !important; } .align-items-xl-end { -webkit-box-align: end !important; -ms-flex-align: end !important; align-items: flex-end !important; } .align-items-xl-center { -webkit-box-align: center !important; -ms-flex-align: center !important; align-items: center !important; } .align-items-xl-baseline { -webkit-box-align: baseline !important; -ms-flex-align: baseline !important; align-items: baseline !important; } .align-items-xl-stretch { -webkit-box-align: stretch !important; -ms-flex-align: stretch !important; align-items: stretch !important; } .align-content-xl-start { -ms-flex-line-pack: start !important; align-content: flex-start !important; } .align-content-xl-end { -ms-flex-line-pack: end !important; align-content: flex-end !important; } .align-content-xl-center { -ms-flex-line-pack: center !important; align-content: center !important; } .align-content-xl-between { -ms-flex-line-pack: justify !important; align-content: space-between !important; } .align-content-xl-around { -ms-flex-line-pack: distribute !important; align-content: space-around !important; } .align-content-xl-stretch { -ms-flex-line-pack: stretch !important; align-content: stretch !important; } .align-self-xl-auto { -ms-flex-item-align: auto !important; align-self: auto !important; } .align-self-xl-start { -ms-flex-item-align: start !important; align-self: flex-start !important; } .align-self-xl-end { -ms-flex-item-align: end !important; align-self: flex-end !important; } .align-self-xl-center { -ms-flex-item-align: center !important; align-self: center !important; } .align-self-xl-baseline { -ms-flex-item-align: baseline !important; align-self: baseline !important; } .align-self-xl-stretch { -ms-flex-item-align: stretch !important; align-self: stretch !important; } } @media (min-width: 1400px) { .flex-xxl-row { -webkit-box-orient: horizontal !important; -webkit-box-direction: normal !important; -ms-flex-direction: row !important; flex-direction: row !important; } .flex-xxl-column { -webkit-box-orient: vertical !important; -webkit-box-direction: normal !important; -ms-flex-direction: column !important; flex-direction: column !important; } .flex-xxl-row-reverse { -webkit-box-orient: horizontal !important; -webkit-box-direction: reverse !important; -ms-flex-direction: row-reverse !important; flex-direction: row-reverse !important; } .flex-xxl-column-reverse { -webkit-box-orient: vertical !important; -webkit-box-direction: reverse !important; -ms-flex-direction: column-reverse !important; flex-direction: column-reverse !important; } .flex-xxl-wrap { -ms-flex-wrap: wrap !important; flex-wrap: wrap !important; } .flex-xxl-nowrap { -ms-flex-wrap: nowrap !important; flex-wrap: nowrap !important; } .flex-xxl-wrap-reverse { -ms-flex-wrap: wrap-reverse !important; flex-wrap: wrap-reverse !important; } .flex-xxl-fill { -webkit-box-flex: 1 !important; -ms-flex: 1 1 auto !important; flex: 1 1 auto !important; } .flex-xxl-grow-0 { -webkit-box-flex: 0 !important; -ms-flex-positive: 0 !important; flex-grow: 0 !important; } .flex-xxl-grow-1 { -webkit-box-flex: 1 !important; -ms-flex-positive: 1 !important; flex-grow: 1 !important; } .flex-xxl-shrink-0 { -ms-flex-negative: 0 !important; flex-shrink: 0 !important; } .flex-xxl-shrink-1 { -ms-flex-negative: 1 !important; flex-shrink: 1 !important; } .justify-content-xxl-start { -webkit-box-pack: start !important; -ms-flex-pack: start !important; justify-content: flex-start !important; } .justify-content-xxl-end { -webkit-box-pack: end !important; -ms-flex-pack: end !important; justify-content: flex-end !important; } .justify-content-xxl-center { -webkit-box-pack: center !important; -ms-flex-pack: center !important; justify-content: center !important; } .justify-content-xxl-between { -webkit-box-pack: justify !important; -ms-flex-pack: justify !important; justify-content: space-between !important; } .justify-content-xxl-around { -ms-flex-pack: distribute !important; justify-content: space-around !important; } .align-items-xxl-start { -webkit-box-align: start !important; -ms-flex-align: start !important; align-items: flex-start !important; } .align-items-xxl-end { -webkit-box-align: end !important; -ms-flex-align: end !important; align-items: flex-end !important; } .align-items-xxl-center { -webkit-box-align: center !important; -ms-flex-align: center !important; align-items: center !important; } .align-items-xxl-baseline { -webkit-box-align: baseline !important; -ms-flex-align: baseline !important; align-items: baseline !important; } .align-items-xxl-stretch { -webkit-box-align: stretch !important; -ms-flex-align: stretch !important; align-items: stretch !important; } .align-content-xxl-start { -ms-flex-line-pack: start !important; align-content: flex-start !important; } .align-content-xxl-end { -ms-flex-line-pack: end !important; align-content: flex-end !important; } .align-content-xxl-center { -ms-flex-line-pack: center !important; align-content: center !important; } .align-content-xxl-between { -ms-flex-line-pack: justify !important; align-content: space-between !important; } .align-content-xxl-around { -ms-flex-line-pack: distribute !important; align-content: space-around !important; } .align-content-xxl-stretch { -ms-flex-line-pack: stretch !important; align-content: stretch !important; } .align-self-xxl-auto { -ms-flex-item-align: auto !important; align-self: auto !important; } .align-self-xxl-start { -ms-flex-item-align: start !important; align-self: flex-start !important; } .align-self-xxl-end { -ms-flex-item-align: end !important; align-self: flex-end !important; } .align-self-xxl-center { -ms-flex-item-align: center !important; align-self: center !important; } .align-self-xxl-baseline { -ms-flex-item-align: baseline !important; align-self: baseline !important; } .align-self-xxl-stretch { -ms-flex-item-align: stretch !important; align-self: stretch !important; } } .float-left { float: left !important; } .float-right { float: right !important; } .float-none { float: none !important; } @media (min-width: 576px) { .float-sm-left { float: left !important; } .float-sm-right { float: right !important; } .float-sm-none { float: none !important; } } @media (min-width: 768px) { .float-md-left { float: left !important; } .float-md-right { float: right !important; } .float-md-none { float: none !important; } } @media (min-width: 992px) { .float-lg-left { float: left !important; } .float-lg-right { float: right !important; } .float-lg-none { float: none !important; } } @media (min-width: 1200px) { .float-xl-left { float: left !important; } .float-xl-right { float: right !important; } .float-xl-none { float: none !important; } } @media (min-width: 1400px) { .float-xxl-left { float: left !important; } .float-xxl-right { float: right !important; } .float-xxl-none { float: none !important; } } .user-select-all { -webkit-user-select: all !important; -moz-user-select: all !important; user-select: all !important; } .user-select-auto { -webkit-user-select: auto !important; -moz-user-select: auto !important; -ms-user-select: auto !important; user-select: auto !important; } .user-select-none { -webkit-user-select: none !important; -moz-user-select: none !important; -ms-user-select: none !important; user-select: none !important; } .overflow-auto { overflow: auto !important; } .overflow-hidden { overflow: hidden !important; } .position-static { position: static !important; } .position-relative { position: relative !important; } .position-absolute { position: absolute !important; } .position-fixed { position: fixed !important; } .position-sticky { position: sticky !important; } .fixed-top { position: fixed; top: 0; right: 0; left: 0; z-index: 1030; } .fixed-bottom { position: fixed; right: 0; bottom: 0; left: 0; z-index: 1030; } @supports (position: sticky) { .sticky-top { position: sticky; top: 0; z-index: 1020; } } .sr-only, .screen-reader-text { position: absolute; width: 1px; height: 1px; padding: 0; margin: -1px; overflow: hidden; clip: rect(0, 0, 0, 0); white-space: nowrap; border: 0; } .sr-only-focusable:active, .screen-reader-text:active, .sr-only-focusable:focus, .screen-reader-text:focus { position: static; width: auto; height: auto; overflow: visible; clip: auto; white-space: normal; } .shadow-sm { -webkit-box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075) !important; box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075) !important; } .shadow { -webkit-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15) !important; box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15) !important; } .shadow-lg { -webkit-box-shadow: 0 1rem 3rem rgba(0, 0, 0, 0.175) !important; box-shadow: 0 1rem 3rem rgba(0, 0, 0, 0.175) !important; } .shadow-none { -webkit-box-shadow: none !important; box-shadow: none !important; } .w-25 { width: 25% !important; } .w-50 { width: 50% !important; } .w-75 { width: 75% !important; } .w-100 { width: 100% !important; } .w-auto { width: auto !important; } .h-25 { height: 25% !important; } .h-50 { height: 50% !important; } .h-75 { height: 75% !important; } .h-100 { height: 100% !important; } .h-auto { height: auto !important; } .mw-100 { max-width: 100% !important; } .mh-100 { max-height: 100% !important; } .min-vw-100 { min-width: 100vw !important; } .min-vh-100 { min-height: 100vh !important; } .vw-100 { width: 100vw !important; } .vh-100 { height: 100vh !important; } .m-0 { margin: 0 !important; } .mt-0, .my-0 { margin-top: 0 !important; } .mr-0, .mx-0 { margin-right: 0 !important; } .mb-0, .my-0 { margin-bottom: 0 !important; } .ml-0, .mx-0 { margin-left: 0 !important; } .m-1 { margin: 0.25rem !important; } .mt-1, .my-1 { margin-top: 0.25rem !important; } .mr-1, .mx-1 { margin-right: 0.25rem !important; } .mb-1, .my-1 { margin-bottom: 0.25rem !important; } .ml-1, .mx-1 { margin-left: 0.25rem !important; } .m-2 { margin: 0.5rem !important; } .mt-2, .my-2 { margin-top: 0.5rem !important; } .mr-2, .mx-2 { margin-right: 0.5rem !important; } .mb-2, .my-2 { margin-bottom: 0.5rem !important; } .ml-2, .mx-2 { margin-left: 0.5rem !important; } .m-3 { margin: 1rem !important; } .mt-3, .my-3 { margin-top: 1rem !important; } .mr-3, .mx-3 { margin-right: 1rem !important; } .mb-3, .my-3 { margin-bottom: 1rem !important; } .ml-3, .mx-3 { margin-left: 1rem !important; } .m-4 { margin: 1.5rem !important; } .mt-4, .my-4 { margin-top: 1.5rem !important; } .mr-4, .mx-4 { margin-right: 1.5rem !important; } .mb-4, .my-4 { margin-bottom: 1.5rem !important; } .ml-4, .mx-4 { margin-left: 1.5rem !important; } .m-5 { margin: 3rem !important; } .mt-5, .my-5 { margin-top: 3rem !important; } .mr-5, .mx-5 { margin-right: 3rem !important; } .mb-5, .my-5 { margin-bottom: 3rem !important; } .ml-5, .mx-5 { margin-left: 3rem !important; } .p-0 { padding: 0 !important; } .pt-0, .py-0 { padding-top: 0 !important; } .pr-0, .px-0 { padding-right: 0 !important; } .pb-0, .py-0 { padding-bottom: 0 !important; } .pl-0, .px-0 { padding-left: 0 !important; } .p-1 { padding: 0.25rem !important; } .pt-1, .py-1 { padding-top: 0.25rem !important; } .pr-1, .px-1 { padding-right: 0.25rem !important; } .pb-1, .py-1 { padding-bottom: 0.25rem !important; } .pl-1, .px-1 { padding-left: 0.25rem !important; } .p-2 { padding: 0.5rem !important; } .pt-2, .py-2 { padding-top: 0.5rem !important; } .pr-2, .px-2 { padding-right: 0.5rem !important; } .pb-2, .py-2 { padding-bottom: 0.5rem !important; } .pl-2, .px-2 { padding-left: 0.5rem !important; } .p-3 { padding: 1rem !important; } .pt-3, .py-3 { padding-top: 1rem !important; } .pr-3, .px-3 { padding-right: 1rem !important; } .pb-3, .py-3 { padding-bottom: 1rem !important; } .pl-3, .px-3 { padding-left: 1rem !important; } .p-4 { padding: 1.5rem !important; } .pt-4, .py-4 { padding-top: 1.5rem !important; } .pr-4, .px-4 { padding-right: 1.5rem !important; } .pb-4, .py-4 { padding-bottom: 1.5rem !important; } .pl-4, .px-4 { padding-left: 1.5rem !important; } .p-5 { padding: 3rem !important; } .pt-5, .py-5 { padding-top: 3rem !important; } .pr-5, .px-5 { padding-right: 3rem !important; } .pb-5, .py-5 { padding-bottom: 3rem !important; } .pl-5, .px-5 { padding-left: 3rem !important; } .m-n1 { margin: -0.25rem !important; } .mt-n1, .my-n1 { margin-top: -0.25rem !important; } .mr-n1, .mx-n1 { margin-right: -0.25rem !important; } .mb-n1, .my-n1 { margin-bottom: -0.25rem !important; } .ml-n1, .mx-n1 { margin-left: -0.25rem !important; } .m-n2 { margin: -0.5rem !important; } .mt-n2, .my-n2 { margin-top: -0.5rem !important; } .mr-n2, .mx-n2 { margin-right: -0.5rem !important; } .mb-n2, .my-n2 { margin-bottom: -0.5rem !important; } .ml-n2, .mx-n2 { margin-left: -0.5rem !important; } .m-n3 { margin: -1rem !important; } .mt-n3, .my-n3 { margin-top: -1rem !important; } .mr-n3, .mx-n3 { margin-right: -1rem !important; } .mb-n3, .my-n3 { margin-bottom: -1rem !important; } .ml-n3, .mx-n3 { margin-left: -1rem !important; } .m-n4 { margin: -1.5rem !important; } .mt-n4, .my-n4 { margin-top: -1.5rem !important; } .mr-n4, .mx-n4 { margin-right: -1.5rem !important; } .mb-n4, .my-n4 { margin-bottom: -1.5rem !important; } .ml-n4, .mx-n4 { margin-left: -1.5rem !important; } .m-n5 { margin: -3rem !important; } .mt-n5, .my-n5 { margin-top: -3rem !important; } .mr-n5, .mx-n5 { margin-right: -3rem !important; } .mb-n5, .my-n5 { margin-bottom: -3rem !important; } .ml-n5, .mx-n5 { margin-left: -3rem !important; } .m-auto { margin: auto !important; } .mt-auto, .my-auto { margin-top: auto !important; } .mr-auto, .mx-auto { margin-right: auto !important; } .mb-auto, .my-auto { margin-bottom: auto !important; } .ml-auto, .mx-auto { margin-left: auto !important; } @media (min-width: 576px) { .m-sm-0 { margin: 0 !important; } .mt-sm-0, .my-sm-0 { margin-top: 0 !important; } .mr-sm-0, .mx-sm-0 { margin-right: 0 !important; } .mb-sm-0, .my-sm-0 { margin-bottom: 0 !important; } .ml-sm-0, .mx-sm-0 { margin-left: 0 !important; } .m-sm-1 { margin: 0.25rem !important; } .mt-sm-1, .my-sm-1 { margin-top: 0.25rem !important; } .mr-sm-1, .mx-sm-1 { margin-right: 0.25rem !important; } .mb-sm-1, .my-sm-1 { margin-bottom: 0.25rem !important; } .ml-sm-1, .mx-sm-1 { margin-left: 0.25rem !important; } .m-sm-2 { margin: 0.5rem !important; } .mt-sm-2, .my-sm-2 { margin-top: 0.5rem !important; } .mr-sm-2, .mx-sm-2 { margin-right: 0.5rem !important; } .mb-sm-2, .my-sm-2 { margin-bottom: 0.5rem !important; } .ml-sm-2, .mx-sm-2 { margin-left: 0.5rem !important; } .m-sm-3 { margin: 1rem !important; } .mt-sm-3, .my-sm-3 { margin-top: 1rem !important; } .mr-sm-3, .mx-sm-3 { margin-right: 1rem !important; } .mb-sm-3, .my-sm-3 { margin-bottom: 1rem !important; } .ml-sm-3, .mx-sm-3 { margin-left: 1rem !important; } .m-sm-4 { margin: 1.5rem !important; } .mt-sm-4, .my-sm-4 { margin-top: 1.5rem !important; } .mr-sm-4, .mx-sm-4 { margin-right: 1.5rem !important; } .mb-sm-4, .my-sm-4 { margin-bottom: 1.5rem !important; } .ml-sm-4, .mx-sm-4 { margin-left: 1.5rem !important; } .m-sm-5 { margin: 3rem !important; } .mt-sm-5, .my-sm-5 { margin-top: 3rem !important; } .mr-sm-5, .mx-sm-5 { margin-right: 3rem !important; } .mb-sm-5, .my-sm-5 { margin-bottom: 3rem !important; } .ml-sm-5, .mx-sm-5 { margin-left: 3rem !important; } .p-sm-0 { padding: 0 !important; } .pt-sm-0, .py-sm-0 { padding-top: 0 !important; } .pr-sm-0, .px-sm-0 { padding-right: 0 !important; } .pb-sm-0, .py-sm-0 { padding-bottom: 0 !important; } .pl-sm-0, .px-sm-0 { padding-left: 0 !important; } .p-sm-1 { padding: 0.25rem !important; } .pt-sm-1, .py-sm-1 { padding-top: 0.25rem !important; } .pr-sm-1, .px-sm-1 { padding-right: 0.25rem !important; } .pb-sm-1, .py-sm-1 { padding-bottom: 0.25rem !important; } .pl-sm-1, .px-sm-1 { padding-left: 0.25rem !important; } .p-sm-2 { padding: 0.5rem !important; } .pt-sm-2, .py-sm-2 { padding-top: 0.5rem !important; } .pr-sm-2, .px-sm-2 { padding-right: 0.5rem !important; } .pb-sm-2, .py-sm-2 { padding-bottom: 0.5rem !important; } .pl-sm-2, .px-sm-2 { padding-left: 0.5rem !important; } .p-sm-3 { padding: 1rem !important; } .pt-sm-3, .py-sm-3 { padding-top: 1rem !important; } .pr-sm-3, .px-sm-3 { padding-right: 1rem !important; } .pb-sm-3, .py-sm-3 { padding-bottom: 1rem !important; } .pl-sm-3, .px-sm-3 { padding-left: 1rem !important; } .p-sm-4 { padding: 1.5rem !important; } .pt-sm-4, .py-sm-4 { padding-top: 1.5rem !important; } .pr-sm-4, .px-sm-4 { padding-right: 1.5rem !important; } .pb-sm-4, .py-sm-4 { padding-bottom: 1.5rem !important; } .pl-sm-4, .px-sm-4 { padding-left: 1.5rem !important; } .p-sm-5 { padding: 3rem !important; } .pt-sm-5, .py-sm-5 { padding-top: 3rem !important; } .pr-sm-5, .px-sm-5 { padding-right: 3rem !important; } .pb-sm-5, .py-sm-5 { padding-bottom: 3rem !important; } .pl-sm-5, .px-sm-5 { padding-left: 3rem !important; } .m-sm-n1 { margin: -0.25rem !important; } .mt-sm-n1, .my-sm-n1 { margin-top: -0.25rem !important; } .mr-sm-n1, .mx-sm-n1 { margin-right: -0.25rem !important; } .mb-sm-n1, .my-sm-n1 { margin-bottom: -0.25rem !important; } .ml-sm-n1, .mx-sm-n1 { margin-left: -0.25rem !important; } .m-sm-n2 { margin: -0.5rem !important; } .mt-sm-n2, .my-sm-n2 { margin-top: -0.5rem !important; } .mr-sm-n2, .mx-sm-n2 { margin-right: -0.5rem !important; } .mb-sm-n2, .my-sm-n2 { margin-bottom: -0.5rem !important; } .ml-sm-n2, .mx-sm-n2 { margin-left: -0.5rem !important; } .m-sm-n3 { margin: -1rem !important; } .mt-sm-n3, .my-sm-n3 { margin-top: -1rem !important; } .mr-sm-n3, .mx-sm-n3 { margin-right: -1rem !important; } .mb-sm-n3, .my-sm-n3 { margin-bottom: -1rem !important; } .ml-sm-n3, .mx-sm-n3 { margin-left: -1rem !important; } .m-sm-n4 { margin: -1.5rem !important; } .mt-sm-n4, .my-sm-n4 { margin-top: -1.5rem !important; } .mr-sm-n4, .mx-sm-n4 { margin-right: -1.5rem !important; } .mb-sm-n4, .my-sm-n4 { margin-bottom: -1.5rem !important; } .ml-sm-n4, .mx-sm-n4 { margin-left: -1.5rem !important; } .m-sm-n5 { margin: -3rem !important; } .mt-sm-n5, .my-sm-n5 { margin-top: -3rem !important; } .mr-sm-n5, .mx-sm-n5 { margin-right: -3rem !important; } .mb-sm-n5, .my-sm-n5 { margin-bottom: -3rem !important; } .ml-sm-n5, .mx-sm-n5 { margin-left: -3rem !important; } .m-sm-auto { margin: auto !important; } .mt-sm-auto, .my-sm-auto { margin-top: auto !important; } .mr-sm-auto, .mx-sm-auto { margin-right: auto !important; } .mb-sm-auto, .my-sm-auto { margin-bottom: auto !important; } .ml-sm-auto, .mx-sm-auto { margin-left: auto !important; } } @media (min-width: 768px) { .m-md-0 { margin: 0 !important; } .mt-md-0, .my-md-0 { margin-top: 0 !important; } .mr-md-0, .mx-md-0 { margin-right: 0 !important; } .mb-md-0, .my-md-0 { margin-bottom: 0 !important; } .ml-md-0, .mx-md-0 { margin-left: 0 !important; } .m-md-1 { margin: 0.25rem !important; } .mt-md-1, .my-md-1 { margin-top: 0.25rem !important; } .mr-md-1, .mx-md-1 { margin-right: 0.25rem !important; } .mb-md-1, .my-md-1 { margin-bottom: 0.25rem !important; } .ml-md-1, .mx-md-1 { margin-left: 0.25rem !important; } .m-md-2 { margin: 0.5rem !important; } .mt-md-2, .my-md-2 { margin-top: 0.5rem !important; } .mr-md-2, .mx-md-2 { margin-right: 0.5rem !important; } .mb-md-2, .my-md-2 { margin-bottom: 0.5rem !important; } .ml-md-2, .mx-md-2 { margin-left: 0.5rem !important; } .m-md-3 { margin: 1rem !important; } .mt-md-3, .my-md-3 { margin-top: 1rem !important; } .mr-md-3, .mx-md-3 { margin-right: 1rem !important; } .mb-md-3, .my-md-3 { margin-bottom: 1rem !important; } .ml-md-3, .mx-md-3 { margin-left: 1rem !important; } .m-md-4 { margin: 1.5rem !important; } .mt-md-4, .my-md-4 { margin-top: 1.5rem !important; } .mr-md-4, .mx-md-4 { margin-right: 1.5rem !important; } .mb-md-4, .my-md-4 { margin-bottom: 1.5rem !important; } .ml-md-4, .mx-md-4 { margin-left: 1.5rem !important; } .m-md-5 { margin: 3rem !important; } .mt-md-5, .my-md-5 { margin-top: 3rem !important; } .mr-md-5, .mx-md-5 { margin-right: 3rem !important; } .mb-md-5, .my-md-5 { margin-bottom: 3rem !important; } .ml-md-5, .mx-md-5 { margin-left: 3rem !important; } .p-md-0 { padding: 0 !important; } .pt-md-0, .py-md-0 { padding-top: 0 !important; } .pr-md-0, .px-md-0 { padding-right: 0 !important; } .pb-md-0, .py-md-0 { padding-bottom: 0 !important; } .pl-md-0, .px-md-0 { padding-left: 0 !important; } .p-md-1 { padding: 0.25rem !important; } .pt-md-1, .py-md-1 { padding-top: 0.25rem !important; } .pr-md-1, .px-md-1 { padding-right: 0.25rem !important; } .pb-md-1, .py-md-1 { padding-bottom: 0.25rem !important; } .pl-md-1, .px-md-1 { padding-left: 0.25rem !important; } .p-md-2 { padding: 0.5rem !important; } .pt-md-2, .py-md-2 { padding-top: 0.5rem !important; } .pr-md-2, .px-md-2 { padding-right: 0.5rem !important; } .pb-md-2, .py-md-2 { padding-bottom: 0.5rem !important; } .pl-md-2, .px-md-2 { padding-left: 0.5rem !important; } .p-md-3 { padding: 1rem !important; } .pt-md-3, .py-md-3 { padding-top: 1rem !important; } .pr-md-3, .px-md-3 { padding-right: 1rem !important; } .pb-md-3, .py-md-3 { padding-bottom: 1rem !important; } .pl-md-3, .px-md-3 { padding-left: 1rem !important; } .p-md-4 { padding: 1.5rem !important; } .pt-md-4, .py-md-4 { padding-top: 1.5rem !important; } .pr-md-4, .px-md-4 { padding-right: 1.5rem !important; } .pb-md-4, .py-md-4 { padding-bottom: 1.5rem !important; } .pl-md-4, .px-md-4 { padding-left: 1.5rem !important; } .p-md-5 { padding: 3rem !important; } .pt-md-5, .py-md-5 { padding-top: 3rem !important; } .pr-md-5, .px-md-5 { padding-right: 3rem !important; } .pb-md-5, .py-md-5 { padding-bottom: 3rem !important; } .pl-md-5, .px-md-5 { padding-left: 3rem !important; } .m-md-n1 { margin: -0.25rem !important; } .mt-md-n1, .my-md-n1 { margin-top: -0.25rem !important; } .mr-md-n1, .mx-md-n1 { margin-right: -0.25rem !important; } .mb-md-n1, .my-md-n1 { margin-bottom: -0.25rem !important; } .ml-md-n1, .mx-md-n1 { margin-left: -0.25rem !important; } .m-md-n2 { margin: -0.5rem !important; } .mt-md-n2, .my-md-n2 { margin-top: -0.5rem !important; } .mr-md-n2, .mx-md-n2 { margin-right: -0.5rem !important; } .mb-md-n2, .my-md-n2 { margin-bottom: -0.5rem !important; } .ml-md-n2, .mx-md-n2 { margin-left: -0.5rem !important; } .m-md-n3 { margin: -1rem !important; } .mt-md-n3, .my-md-n3 { margin-top: -1rem !important; } .mr-md-n3, .mx-md-n3 { margin-right: -1rem !important; } .mb-md-n3, .my-md-n3 { margin-bottom: -1rem !important; } .ml-md-n3, .mx-md-n3 { margin-left: -1rem !important; } .m-md-n4 { margin: -1.5rem !important; } .mt-md-n4, .my-md-n4 { margin-top: -1.5rem !important; } .mr-md-n4, .mx-md-n4 { margin-right: -1.5rem !important; } .mb-md-n4, .my-md-n4 { margin-bottom: -1.5rem !important; } .ml-md-n4, .mx-md-n4 { margin-left: -1.5rem !important; } .m-md-n5 { margin: -3rem !important; } .mt-md-n5, .my-md-n5 { margin-top: -3rem !important; } .mr-md-n5, .mx-md-n5 { margin-right: -3rem !important; } .mb-md-n5, .my-md-n5 { margin-bottom: -3rem !important; } .ml-md-n5, .mx-md-n5 { margin-left: -3rem !important; } .m-md-auto { margin: auto !important; } .mt-md-auto, .my-md-auto { margin-top: auto !important; } .mr-md-auto, .mx-md-auto { margin-right: auto !important; } .mb-md-auto, .my-md-auto { margin-bottom: auto !important; } .ml-md-auto, .mx-md-auto { margin-left: auto !important; } } @media (min-width: 992px) { .m-lg-0 { margin: 0 !important; } .mt-lg-0, .my-lg-0 { margin-top: 0 !important; } .mr-lg-0, .mx-lg-0 { margin-right: 0 !important; } .mb-lg-0, .my-lg-0 { margin-bottom: 0 !important; } .ml-lg-0, .mx-lg-0 { margin-left: 0 !important; } .m-lg-1 { margin: 0.25rem !important; } .mt-lg-1, .my-lg-1 { margin-top: 0.25rem !important; } .mr-lg-1, .mx-lg-1 { margin-right: 0.25rem !important; } .mb-lg-1, .my-lg-1 { margin-bottom: 0.25rem !important; } .ml-lg-1, .mx-lg-1 { margin-left: 0.25rem !important; } .m-lg-2 { margin: 0.5rem !important; } .mt-lg-2, .my-lg-2 { margin-top: 0.5rem !important; } .mr-lg-2, .mx-lg-2 { margin-right: 0.5rem !important; } .mb-lg-2, .my-lg-2 { margin-bottom: 0.5rem !important; } .ml-lg-2, .mx-lg-2 { margin-left: 0.5rem !important; } .m-lg-3 { margin: 1rem !important; } .mt-lg-3, .my-lg-3 { margin-top: 1rem !important; } .mr-lg-3, .mx-lg-3 { margin-right: 1rem !important; } .mb-lg-3, .my-lg-3 { margin-bottom: 1rem !important; } .ml-lg-3, .mx-lg-3 { margin-left: 1rem !important; } .m-lg-4 { margin: 1.5rem !important; } .mt-lg-4, .my-lg-4 { margin-top: 1.5rem !important; } .mr-lg-4, .mx-lg-4 { margin-right: 1.5rem !important; } .mb-lg-4, .my-lg-4 { margin-bottom: 1.5rem !important; } .ml-lg-4, .mx-lg-4 { margin-left: 1.5rem !important; } .m-lg-5 { margin: 3rem !important; } .mt-lg-5, .my-lg-5 { margin-top: 3rem !important; } .mr-lg-5, .mx-lg-5 { margin-right: 3rem !important; } .mb-lg-5, .my-lg-5 { margin-bottom: 3rem !important; } .ml-lg-5, .mx-lg-5 { margin-left: 3rem !important; } .p-lg-0 { padding: 0 !important; } .pt-lg-0, .py-lg-0 { padding-top: 0 !important; } .pr-lg-0, .px-lg-0 { padding-right: 0 !important; } .pb-lg-0, .py-lg-0 { padding-bottom: 0 !important; } .pl-lg-0, .px-lg-0 { padding-left: 0 !important; } .p-lg-1 { padding: 0.25rem !important; } .pt-lg-1, .py-lg-1 { padding-top: 0.25rem !important; } .pr-lg-1, .px-lg-1 { padding-right: 0.25rem !important; } .pb-lg-1, .py-lg-1 { padding-bottom: 0.25rem !important; } .pl-lg-1, .px-lg-1 { padding-left: 0.25rem !important; } .p-lg-2 { padding: 0.5rem !important; } .pt-lg-2, .py-lg-2 { padding-top: 0.5rem !important; } .pr-lg-2, .px-lg-2 { padding-right: 0.5rem !important; } .pb-lg-2, .py-lg-2 { padding-bottom: 0.5rem !important; } .pl-lg-2, .px-lg-2 { padding-left: 0.5rem !important; } .p-lg-3 { padding: 1rem !important; } .pt-lg-3, .py-lg-3 { padding-top: 1rem !important; } .pr-lg-3, .px-lg-3 { padding-right: 1rem !important; } .pb-lg-3, .py-lg-3 { padding-bottom: 1rem !important; } .pl-lg-3, .px-lg-3 { padding-left: 1rem !important; } .p-lg-4 { padding: 1.5rem !important; } .pt-lg-4, .py-lg-4 { padding-top: 1.5rem !important; } .pr-lg-4, .px-lg-4 { padding-right: 1.5rem !important; } .pb-lg-4, .py-lg-4 { padding-bottom: 1.5rem !important; } .pl-lg-4, .px-lg-4 { padding-left: 1.5rem !important; } .p-lg-5 { padding: 3rem !important; } .pt-lg-5, .py-lg-5 { padding-top: 3rem !important; } .pr-lg-5, .px-lg-5 { padding-right: 3rem !important; } .pb-lg-5, .py-lg-5 { padding-bottom: 3rem !important; } .pl-lg-5, .px-lg-5 { padding-left: 3rem !important; } .m-lg-n1 { margin: -0.25rem !important; } .mt-lg-n1, .my-lg-n1 { margin-top: -0.25rem !important; } .mr-lg-n1, .mx-lg-n1 { margin-right: -0.25rem !important; } .mb-lg-n1, .my-lg-n1 { margin-bottom: -0.25rem !important; } .ml-lg-n1, .mx-lg-n1 { margin-left: -0.25rem !important; } .m-lg-n2 { margin: -0.5rem !important; } .mt-lg-n2, .my-lg-n2 { margin-top: -0.5rem !important; } .mr-lg-n2, .mx-lg-n2 { margin-right: -0.5rem !important; } .mb-lg-n2, .my-lg-n2 { margin-bottom: -0.5rem !important; } .ml-lg-n2, .mx-lg-n2 { margin-left: -0.5rem !important; } .m-lg-n3 { margin: -1rem !important; } .mt-lg-n3, .my-lg-n3 { margin-top: -1rem !important; } .mr-lg-n3, .mx-lg-n3 { margin-right: -1rem !important; } .mb-lg-n3, .my-lg-n3 { margin-bottom: -1rem !important; } .ml-lg-n3, .mx-lg-n3 { margin-left: -1rem !important; } .m-lg-n4 { margin: -1.5rem !important; } .mt-lg-n4, .my-lg-n4 { margin-top: -1.5rem !important; } .mr-lg-n4, .mx-lg-n4 { margin-right: -1.5rem !important; } .mb-lg-n4, .my-lg-n4 { margin-bottom: -1.5rem !important; } .ml-lg-n4, .mx-lg-n4 { margin-left: -1.5rem !important; } .m-lg-n5 { margin: -3rem !important; } .mt-lg-n5, .my-lg-n5 { margin-top: -3rem !important; } .mr-lg-n5, .mx-lg-n5 { margin-right: -3rem !important; } .mb-lg-n5, .my-lg-n5 { margin-bottom: -3rem !important; } .ml-lg-n5, .mx-lg-n5 { margin-left: -3rem !important; } .m-lg-auto { margin: auto !important; } .mt-lg-auto, .my-lg-auto { margin-top: auto !important; } .mr-lg-auto, .mx-lg-auto { margin-right: auto !important; } .mb-lg-auto, .my-lg-auto { margin-bottom: auto !important; } .ml-lg-auto, .mx-lg-auto { margin-left: auto !important; } } @media (min-width: 1200px) { .m-xl-0 { margin: 0 !important; } .mt-xl-0, .my-xl-0 { margin-top: 0 !important; } .mr-xl-0, .mx-xl-0 { margin-right: 0 !important; } .mb-xl-0, .my-xl-0 { margin-bottom: 0 !important; } .ml-xl-0, .mx-xl-0 { margin-left: 0 !important; } .m-xl-1 { margin: 0.25rem !important; } .mt-xl-1, .my-xl-1 { margin-top: 0.25rem !important; } .mr-xl-1, .mx-xl-1 { margin-right: 0.25rem !important; } .mb-xl-1, .my-xl-1 { margin-bottom: 0.25rem !important; } .ml-xl-1, .mx-xl-1 { margin-left: 0.25rem !important; } .m-xl-2 { margin: 0.5rem !important; } .mt-xl-2, .my-xl-2 { margin-top: 0.5rem !important; } .mr-xl-2, .mx-xl-2 { margin-right: 0.5rem !important; } .mb-xl-2, .my-xl-2 { margin-bottom: 0.5rem !important; } .ml-xl-2, .mx-xl-2 { margin-left: 0.5rem !important; } .m-xl-3 { margin: 1rem !important; } .mt-xl-3, .my-xl-3 { margin-top: 1rem !important; } .mr-xl-3, .mx-xl-3 { margin-right: 1rem !important; } .mb-xl-3, .my-xl-3 { margin-bottom: 1rem !important; } .ml-xl-3, .mx-xl-3 { margin-left: 1rem !important; } .m-xl-4 { margin: 1.5rem !important; } .mt-xl-4, .my-xl-4 { margin-top: 1.5rem !important; } .mr-xl-4, .mx-xl-4 { margin-right: 1.5rem !important; } .mb-xl-4, .my-xl-4 { margin-bottom: 1.5rem !important; } .ml-xl-4, .mx-xl-4 { margin-left: 1.5rem !important; } .m-xl-5 { margin: 3rem !important; } .mt-xl-5, .my-xl-5 { margin-top: 3rem !important; } .mr-xl-5, .mx-xl-5 { margin-right: 3rem !important; } .mb-xl-5, .my-xl-5 { margin-bottom: 3rem !important; } .ml-xl-5, .mx-xl-5 { margin-left: 3rem !important; } .p-xl-0 { padding: 0 !important; } .pt-xl-0, .py-xl-0 { padding-top: 0 !important; } .pr-xl-0, .px-xl-0 { padding-right: 0 !important; } .pb-xl-0, .py-xl-0 { padding-bottom: 0 !important; } .pl-xl-0, .px-xl-0 { padding-left: 0 !important; } .p-xl-1 { padding: 0.25rem !important; } .pt-xl-1, .py-xl-1 { padding-top: 0.25rem !important; } .pr-xl-1, .px-xl-1 { padding-right: 0.25rem !important; } .pb-xl-1, .py-xl-1 { padding-bottom: 0.25rem !important; } .pl-xl-1, .px-xl-1 { padding-left: 0.25rem !important; } .p-xl-2 { padding: 0.5rem !important; } .pt-xl-2, .py-xl-2 { padding-top: 0.5rem !important; } .pr-xl-2, .px-xl-2 { padding-right: 0.5rem !important; } .pb-xl-2, .py-xl-2 { padding-bottom: 0.5rem !important; } .pl-xl-2, .px-xl-2 { padding-left: 0.5rem !important; } .p-xl-3 { padding: 1rem !important; } .pt-xl-3, .py-xl-3 { padding-top: 1rem !important; } .pr-xl-3, .px-xl-3 { padding-right: 1rem !important; } .pb-xl-3, .py-xl-3 { padding-bottom: 1rem !important; } .pl-xl-3, .px-xl-3 { padding-left: 1rem !important; } .p-xl-4 { padding: 1.5rem !important; } .pt-xl-4, .py-xl-4 { padding-top: 1.5rem !important; } .pr-xl-4, .px-xl-4 { padding-right: 1.5rem !important; } .pb-xl-4, .py-xl-4 { padding-bottom: 1.5rem !important; } .pl-xl-4, .px-xl-4 { padding-left: 1.5rem !important; } .p-xl-5 { padding: 3rem !important; } .pt-xl-5, .py-xl-5 { padding-top: 3rem !important; } .pr-xl-5, .px-xl-5 { padding-right: 3rem !important; } .pb-xl-5, .py-xl-5 { padding-bottom: 3rem !important; } .pl-xl-5, .px-xl-5 { padding-left: 3rem !important; } .m-xl-n1 { margin: -0.25rem !important; } .mt-xl-n1, .my-xl-n1 { margin-top: -0.25rem !important; } .mr-xl-n1, .mx-xl-n1 { margin-right: -0.25rem !important; } .mb-xl-n1, .my-xl-n1 { margin-bottom: -0.25rem !important; } .ml-xl-n1, .mx-xl-n1 { margin-left: -0.25rem !important; } .m-xl-n2 { margin: -0.5rem !important; } .mt-xl-n2, .my-xl-n2 { margin-top: -0.5rem !important; } .mr-xl-n2, .mx-xl-n2 { margin-right: -0.5rem !important; } .mb-xl-n2, .my-xl-n2 { margin-bottom: -0.5rem !important; } .ml-xl-n2, .mx-xl-n2 { margin-left: -0.5rem !important; } .m-xl-n3 { margin: -1rem !important; } .mt-xl-n3, .my-xl-n3 { margin-top: -1rem !important; } .mr-xl-n3, .mx-xl-n3 { margin-right: -1rem !important; } .mb-xl-n3, .my-xl-n3 { margin-bottom: -1rem !important; } .ml-xl-n3, .mx-xl-n3 { margin-left: -1rem !important; } .m-xl-n4 { margin: -1.5rem !important; } .mt-xl-n4, .my-xl-n4 { margin-top: -1.5rem !important; } .mr-xl-n4, .mx-xl-n4 { margin-right: -1.5rem !important; } .mb-xl-n4, .my-xl-n4 { margin-bottom: -1.5rem !important; } .ml-xl-n4, .mx-xl-n4 { margin-left: -1.5rem !important; } .m-xl-n5 { margin: -3rem !important; } .mt-xl-n5, .my-xl-n5 { margin-top: -3rem !important; } .mr-xl-n5, .mx-xl-n5 { margin-right: -3rem !important; } .mb-xl-n5, .my-xl-n5 { margin-bottom: -3rem !important; } .ml-xl-n5, .mx-xl-n5 { margin-left: -3rem !important; } .m-xl-auto { margin: auto !important; } .mt-xl-auto, .my-xl-auto { margin-top: auto !important; } .mr-xl-auto, .mx-xl-auto { margin-right: auto !important; } .mb-xl-auto, .my-xl-auto { margin-bottom: auto !important; } .ml-xl-auto, .mx-xl-auto { margin-left: auto !important; } } @media (min-width: 1400px) { .m-xxl-0 { margin: 0 !important; } .mt-xxl-0, .my-xxl-0 { margin-top: 0 !important; } .mr-xxl-0, .mx-xxl-0 { margin-right: 0 !important; } .mb-xxl-0, .my-xxl-0 { margin-bottom: 0 !important; } .ml-xxl-0, .mx-xxl-0 { margin-left: 0 !important; } .m-xxl-1 { margin: 0.25rem !important; } .mt-xxl-1, .my-xxl-1 { margin-top: 0.25rem !important; } .mr-xxl-1, .mx-xxl-1 { margin-right: 0.25rem !important; } .mb-xxl-1, .my-xxl-1 { margin-bottom: 0.25rem !important; } .ml-xxl-1, .mx-xxl-1 { margin-left: 0.25rem !important; } .m-xxl-2 { margin: 0.5rem !important; } .mt-xxl-2, .my-xxl-2 { margin-top: 0.5rem !important; } .mr-xxl-2, .mx-xxl-2 { margin-right: 0.5rem !important; } .mb-xxl-2, .my-xxl-2 { margin-bottom: 0.5rem !important; } .ml-xxl-2, .mx-xxl-2 { margin-left: 0.5rem !important; } .m-xxl-3 { margin: 1rem !important; } .mt-xxl-3, .my-xxl-3 { margin-top: 1rem !important; } .mr-xxl-3, .mx-xxl-3 { margin-right: 1rem !important; } .mb-xxl-3, .my-xxl-3 { margin-bottom: 1rem !important; } .ml-xxl-3, .mx-xxl-3 { margin-left: 1rem !important; } .m-xxl-4 { margin: 1.5rem !important; } .mt-xxl-4, .my-xxl-4 { margin-top: 1.5rem !important; } .mr-xxl-4, .mx-xxl-4 { margin-right: 1.5rem !important; } .mb-xxl-4, .my-xxl-4 { margin-bottom: 1.5rem !important; } .ml-xxl-4, .mx-xxl-4 { margin-left: 1.5rem !important; } .m-xxl-5 { margin: 3rem !important; } .mt-xxl-5, .my-xxl-5 { margin-top: 3rem !important; } .mr-xxl-5, .mx-xxl-5 { margin-right: 3rem !important; } .mb-xxl-5, .my-xxl-5 { margin-bottom: 3rem !important; } .ml-xxl-5, .mx-xxl-5 { margin-left: 3rem !important; } .p-xxl-0 { padding: 0 !important; } .pt-xxl-0, .py-xxl-0 { padding-top: 0 !important; } .pr-xxl-0, .px-xxl-0 { padding-right: 0 !important; } .pb-xxl-0, .py-xxl-0 { padding-bottom: 0 !important; } .pl-xxl-0, .px-xxl-0 { padding-left: 0 !important; } .p-xxl-1 { padding: 0.25rem !important; } .pt-xxl-1, .py-xxl-1 { padding-top: 0.25rem !important; } .pr-xxl-1, .px-xxl-1 { padding-right: 0.25rem !important; } .pb-xxl-1, .py-xxl-1 { padding-bottom: 0.25rem !important; } .pl-xxl-1, .px-xxl-1 { padding-left: 0.25rem !important; } .p-xxl-2 { padding: 0.5rem !important; } .pt-xxl-2, .py-xxl-2 { padding-top: 0.5rem !important; } .pr-xxl-2, .px-xxl-2 { padding-right: 0.5rem !important; } .pb-xxl-2, .py-xxl-2 { padding-bottom: 0.5rem !important; } .pl-xxl-2, .px-xxl-2 { padding-left: 0.5rem !important; } .p-xxl-3 { padding: 1rem !important; } .pt-xxl-3, .py-xxl-3 { padding-top: 1rem !important; } .pr-xxl-3, .px-xxl-3 { padding-right: 1rem !important; } .pb-xxl-3, .py-xxl-3 { padding-bottom: 1rem !important; } .pl-xxl-3, .px-xxl-3 { padding-left: 1rem !important; } .p-xxl-4 { padding: 1.5rem !important; } .pt-xxl-4, .py-xxl-4 { padding-top: 1.5rem !important; } .pr-xxl-4, .px-xxl-4 { padding-right: 1.5rem !important; } .pb-xxl-4, .py-xxl-4 { padding-bottom: 1.5rem !important; } .pl-xxl-4, .px-xxl-4 { padding-left: 1.5rem !important; } .p-xxl-5 { padding: 3rem !important; } .pt-xxl-5, .py-xxl-5 { padding-top: 3rem !important; } .pr-xxl-5, .px-xxl-5 { padding-right: 3rem !important; } .pb-xxl-5, .py-xxl-5 { padding-bottom: 3rem !important; } .pl-xxl-5, .px-xxl-5 { padding-left: 3rem !important; } .m-xxl-n1 { margin: -0.25rem !important; } .mt-xxl-n1, .my-xxl-n1 { margin-top: -0.25rem !important; } .mr-xxl-n1, .mx-xxl-n1 { margin-right: -0.25rem !important; } .mb-xxl-n1, .my-xxl-n1 { margin-bottom: -0.25rem !important; } .ml-xxl-n1, .mx-xxl-n1 { margin-left: -0.25rem !important; } .m-xxl-n2 { margin: -0.5rem !important; } .mt-xxl-n2, .my-xxl-n2 { margin-top: -0.5rem !important; } .mr-xxl-n2, .mx-xxl-n2 { margin-right: -0.5rem !important; } .mb-xxl-n2, .my-xxl-n2 { margin-bottom: -0.5rem !important; } .ml-xxl-n2, .mx-xxl-n2 { margin-left: -0.5rem !important; } .m-xxl-n3 { margin: -1rem !important; } .mt-xxl-n3, .my-xxl-n3 { margin-top: -1rem !important; } .mr-xxl-n3, .mx-xxl-n3 { margin-right: -1rem !important; } .mb-xxl-n3, .my-xxl-n3 { margin-bottom: -1rem !important; } .ml-xxl-n3, .mx-xxl-n3 { margin-left: -1rem !important; } .m-xxl-n4 { margin: -1.5rem !important; } .mt-xxl-n4, .my-xxl-n4 { margin-top: -1.5rem !important; } .mr-xxl-n4, .mx-xxl-n4 { margin-right: -1.5rem !important; } .mb-xxl-n4, .my-xxl-n4 { margin-bottom: -1.5rem !important; } .ml-xxl-n4, .mx-xxl-n4 { margin-left: -1.5rem !important; } .m-xxl-n5 { margin: -3rem !important; } .mt-xxl-n5, .my-xxl-n5 { margin-top: -3rem !important; } .mr-xxl-n5, .mx-xxl-n5 { margin-right: -3rem !important; } .mb-xxl-n5, .my-xxl-n5 { margin-bottom: -3rem !important; } .ml-xxl-n5, .mx-xxl-n5 { margin-left: -3rem !important; } .m-xxl-auto { margin: auto !important; } .mt-xxl-auto, .my-xxl-auto { margin-top: auto !important; } .mr-xxl-auto, .mx-xxl-auto { margin-right: auto !important; } .mb-xxl-auto, .my-xxl-auto { margin-bottom: auto !important; } .ml-xxl-auto, .mx-xxl-auto { margin-left: auto !important; } } .stretched-link::after { position: absolute; top: 0; right: 0; bottom: 0; left: 0; z-index: 1; pointer-events: auto; content: ""; background-color: rgba(0, 0, 0, 0); } .text-monospace { font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace !important; } .text-justify { text-align: justify !important; } .text-wrap { white-space: normal !important; } .text-nowrap { white-space: nowrap !important; } .text-truncate { overflow: hidden; text-overflow: ellipsis; white-space: nowrap; } .text-left { text-align: left !important; } .text-right { text-align: right !important; } .text-center { text-align: center !important; } @media (min-width: 576px) { .text-sm-left { text-align: left !important; } .text-sm-right { text-align: right !important; } .text-sm-center { text-align: center !important; } } @media (min-width: 768px) { .text-md-left { text-align: left !important; } .text-md-right { text-align: right !important; } .text-md-center { text-align: center !important; } } @media (min-width: 992px) { .text-lg-left { text-align: left !important; } .text-lg-right { text-align: right !important; } .text-lg-center { text-align: center !important; } } @media (min-width: 1200px) { .text-xl-left { text-align: left !important; } .text-xl-right { text-align: right !important; } .text-xl-center { text-align: center !important; } } @media (min-width: 1400px) { .text-xxl-left { text-align: left !important; } .text-xxl-right { text-align: right !important; } .text-xxl-center { text-align: center !important; } } .text-lowercase { text-transform: lowercase !important; } .text-uppercase { text-transform: uppercase !important; } .text-capitalize { text-transform: capitalize !important; } .font-weight-light { font-weight: 300 !important; } .font-weight-lighter { font-weight: lighter !important; } .font-weight-normal { font-weight: 400 !important; } .font-weight-bold { font-weight: 700 !important; } .font-weight-bolder { font-weight: bolder !important; } .font-italic { font-style: italic !important; } .text-white { color: #fff !important; } .text-primary { color: #023605 !important; } a.text-primary:hover, a.text-primary:focus { color: black !important; } .text-secondary { color: #faf8f6 !important; } a.text-secondary:hover, a.text-secondary:focus { color: #dfd2c5 !important; } .text-success { color: #28a745 !important; } a.text-success:hover, a.text-success:focus { color: #19692c !important; } .text-info { color: #17a2b8 !important; } a.text-info:hover, a.text-info:focus { color: #0f6674 !important; } .text-warning { color: #ffc107 !important; } a.text-warning:hover, a.text-warning:focus { color: #ba8b00 !important; } .text-danger { color: #dc3545 !important; } a.text-danger:hover, a.text-danger:focus { color: #a71d2a !important; } .text-light { color: #a49f9f !important; } a.text-light:hover, a.text-light:focus { color: #7f7878 !important; } .text-dark { color: #343a40 !important; } a.text-dark:hover, a.text-dark:focus { color: #121416 !important; } .text-body { color: #212529 !important; } .text-muted { color: #6c757d !important; } .text-black-50 { color: rgba(0, 0, 0, 0.5) !important; } .text-white-50 { color: rgba(255, 255, 255, 0.5) !important; } .text-hide { font: 0/0 a; color: transparent; text-shadow: none; background-color: transparent; border: 0; } .text-decoration-none { text-decoration: none !important; } .text-break { word-break: break-word !important; word-wrap: break-word !important; } .text-reset { color: inherit !important; } .visible { visibility: visible !important; } .invisible { visibility: hidden !important; } @media print { *, *::before, *::after { text-shadow: none !important; -webkit-box-shadow: none !important; box-shadow: none !important; } a:not(.btn) { text-decoration: underline; } abbr[title]::after { content: " (" attr(title) ")"; } pre { white-space: pre-wrap !important; } pre, blockquote { border: 1px solid #adb5bd; page-break-inside: avoid; } thead { display: table-header-group; } tr, img { page-break-inside: avoid; } p, h2, h3 { orphans: 3; widows: 3; } h2, h3 { page-break-after: avoid; } @page { size: a3; } body { min-width: 992px !important; } .container { min-width: 992px !important; } .navbar { display: none; } .badge { border: 1px solid #000; } .table { border-collapse: collapse !important; } .table td, .table th { background-color: #fff !important; } .table-bordered th, .table-bordered td { border: 1px solid #dee2e6 !important; } .table-dark { color: inherit; } .table-dark th, .table-dark td, .table-dark thead th, .table-dark tbody + tbody { border-color: #dee2e6; } .table .thead-dark th { color: inherit; border-color: #dee2e6; } } /*! * Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome * License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License) */ /* FONT PATH * -------------------------- */ @font-face { font-family: "FontAwesome"; src: url(/wp-content/themes/methodist/dist/vendor/_/_/node_modules/font-awesome/fonts/fontawesome-webfont.eot); src: url(/wp-content/themes/methodist/dist/vendor/_/_/node_modules/font-awesome/fonts/fontawesome-webfont.eot?#iefix&v=4.7.0) format("embedded-opentype"), url(/wp-content/themes/methodist/dist/vendor/_/_/node_modules/font-awesome/fonts/fontawesome-webfont.woff2) format("woff2"), url(/wp-content/themes/methodist/dist/vendor/_/_/node_modules/font-awesome/fonts/fontawesome-webfont.woff) format("woff"), url(/wp-content/themes/methodist/dist/vendor/_/_/node_modules/font-awesome/fonts/fontawesome-webfont.ttf) format("truetype"), url(/wp-content/themes/methodist/dist/vendor/_/_/node_modules/font-awesome/fonts/fontawesome-webfont.svg#fontawesomeregular) format("svg"); font-weight: normal; font-style: normal; } .fa { display: inline-block; font: normal normal normal 14px/1 FontAwesome; font-size: inherit; text-rendering: auto; -webkit-font-smoothing: antialiased; -moz-osx-font-smoothing: grayscale; } /* makes the font 33% larger relative to the icon container */ .fa-lg { font-size: 1.33333333em; line-height: 0.75em; vertical-align: -15%; } .fa-2x { font-size: 2em; } .fa-3x { font-size: 3em; } .fa-4x { font-size: 4em; } .fa-5x { font-size: 5em; } .fa-fw { width: 1.28571429em; text-align: center; } .fa-ul { padding-left: 0; margin-left: 2.14285714em; list-style-type: none; } .fa-ul > li { position: relative; } .fa-li { position: absolute; left: -2.14285714em; width: 2.14285714em; top: 0.14285714em; text-align: center; } .fa-li.fa-lg { left: -1.85714286em; } .fa-border { padding: 0.2em 0.25em 0.15em; border: solid 0.08em #eeeeee; border-radius: 0.1em; } .fa-pull-left { float: left; } .fa-pull-right { float: right; } .fa.fa-pull-left { margin-right: 0.3em; } .fa.fa-pull-right { margin-left: 0.3em; } /* Deprecated as of 4.4.0 */ .pull-right { float: right; } .pull-left { float: left; } .fa.pull-left { margin-right: 0.3em; } .fa.pull-right { margin-left: 0.3em; } .fa-spin { -webkit-animation: fa-spin 2s infinite linear; -o-animation: fa-spin 2s infinite linear; animation: fa-spin 2s infinite linear; } .fa-pulse { -webkit-animation: fa-spin 1s infinite steps(8); -o-animation: fa-spin 1s infinite steps(8); animation: fa-spin 1s infinite steps(8); } @-webkit-keyframes fa-spin { 0% { -webkit-transform: rotate(0deg); transform: rotate(0deg); } 100% { -webkit-transform: rotate(359deg); transform: rotate(359deg); } } @-o-keyframes fa-spin { 0% { -webkit-transform: rotate(0deg); -o-transform: rotate(0deg); transform: rotate(0deg); } 100% { -webkit-transform: rotate(359deg); -o-transform: rotate(359deg); transform: rotate(359deg); } } @keyframes fa-spin { 0% { -webkit-transform: rotate(0deg); -o-transform: rotate(0deg); transform: rotate(0deg); } 100% { -webkit-transform: rotate(359deg); -o-transform: rotate(359deg); transform: rotate(359deg); } } .fa-rotate-90 { -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=1)"; -webkit-transform: rotate(90deg); -o-transform: rotate(90deg); transform: rotate(90deg); } .fa-rotate-180 { -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2)"; -webkit-transform: rotate(180deg); -o-transform: rotate(180deg); transform: rotate(180deg); } .fa-rotate-270 { -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=3)"; -webkit-transform: rotate(270deg); -o-transform: rotate(270deg); transform: rotate(270deg); } .fa-flip-horizontal { -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)"; -webkit-transform: scale(-1, 1); -o-transform: scale(-1, 1); transform: scale(-1, 1); } .fa-flip-vertical { -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)"; -webkit-transform: scale(1, -1); -o-transform: scale(1, -1); transform: scale(1, -1); } :root .fa-rotate-90, :root .fa-rotate-180, :root .fa-rotate-270, :root .fa-flip-horizontal, :root .fa-flip-vertical { -webkit-filter: none; filter: none; } .fa-stack { position: relative; display: inline-block; width: 2em; height: 2em; line-height: 2em; vertical-align: middle; } .fa-stack-1x, .fa-stack-2x { position: absolute; left: 0; width: 100%; text-align: center; } .fa-stack-1x { line-height: inherit; } .fa-stack-2x { font-size: 2em; } .fa-inverse { color: #ffffff; } /* Font Awesome uses the Unicode Private Use Area (PUA) to ensure screen readers do not read off random characters that represent icons */ .fa-glass:before { content: "\f000"; } .fa-music:before { content: "\f001"; } .fa-search:before { content: "\f002"; } .fa-envelope-o:before { content: "\f003"; } .fa-heart:before { content: "\f004"; } .fa-star:before { content: "\f005"; } .fa-star-o:before { content: "\f006"; } .fa-user:before { content: "\f007"; } .fa-film:before { content: "\f008"; } .fa-th-large:before { content: "\f009"; } .fa-th:before { content: "\f00a"; } .fa-th-list:before { content: "\f00b"; } .fa-check:before { content: "\f00c"; } .fa-remove:before, .fa-close:before, .fa-times:before { content: "\f00d"; } .fa-search-plus:before { content: "\f00e"; } .fa-search-minus:before { content: "\f010"; } .fa-power-off:before { content: "\f011"; } .fa-signal:before { content: "\f012"; } .fa-gear:before, .fa-cog:before { content: "\f013"; } .fa-trash-o:before { content: "\f014"; } .fa-home:before { content: "\f015"; } .fa-file-o:before { content: "\f016"; } .fa-clock-o:before { content: "\f017"; } .fa-road:before { content: "\f018"; } .fa-download:before { content: "\f019"; } .fa-arrow-circle-o-down:before { content: "\f01a"; } .fa-arrow-circle-o-up:before { content: "\f01b"; } .fa-inbox:before { content: "\f01c"; } .fa-play-circle-o:before { content: "\f01d"; } .fa-rotate-right:before, .fa-repeat:before { content: "\f01e"; } .fa-refresh:before { content: "\f021"; } .fa-list-alt:before { content: "\f022"; } .fa-lock:before { content: "\f023"; } .fa-flag:before { content: "\f024"; } .fa-headphones:before { content: "\f025"; } .fa-volume-off:before { content: "\f026"; } .fa-volume-down:before { content: "\f027"; } .fa-volume-up:before { content: "\f028"; } .fa-qrcode:before { content: "\f029"; } .fa-barcode:before { content: "\f02a"; } .fa-tag:before { content: "\f02b"; } .fa-tags:before { content: "\f02c"; } .fa-book:before { content: "\f02d"; } .fa-bookmark:before { content: "\f02e"; } .fa-print:before { content: "\f02f"; } .fa-camera:before { content: "\f030"; } .fa-font:before { content: "\f031"; } .fa-bold:before { content: "\f032"; } .fa-italic:before { content: "\f033"; } .fa-text-height:before { content: "\f034"; } .fa-text-width:before { content: "\f035"; } .fa-align-left:before { content: "\f036"; } .fa-align-center:before { content: "\f037"; } .fa-align-right:before { content: "\f038"; } .fa-align-justify:before { content: "\f039"; } .fa-list:before { content: "\f03a"; } .fa-dedent:before, .fa-outdent:before { content: "\f03b"; } .fa-indent:before { content: "\f03c"; } .fa-video-camera:before { content: "\f03d"; } .fa-photo:before, .fa-image:before, .fa-picture-o:before { content: "\f03e"; } .fa-pencil:before { content: "\f040"; } .fa-map-marker:before { content: "\f041"; } .fa-adjust:before { content: "\f042"; } .fa-tint:before { content: "\f043"; } .fa-edit:before, .fa-pencil-square-o:before { content: "\f044"; } .fa-share-square-o:before { content: "\f045"; } .fa-check-square-o:before { content: "\f046"; } .fa-arrows:before { content: "\f047"; } .fa-step-backward:before { content: "\f048"; } .fa-fast-backward:before { content: "\f049"; } .fa-backward:before { content: "\f04a"; } .fa-play:before { content: "\f04b"; } .fa-pause:before { content: "\f04c"; } .fa-stop:before { content: "\f04d"; } .fa-forward:before { content: "\f04e"; } .fa-fast-forward:before { content: "\f050"; } .fa-step-forward:before { content: "\f051"; } .fa-eject:before { content: "\f052"; } .fa-chevron-left:before { content: "\f053"; } .fa-chevron-right:before { content: "\f054"; } .fa-plus-circle:before { content: "\f055"; } .fa-minus-circle:before { content: "\f056"; } .fa-times-circle:before { content: "\f057"; } .fa-check-circle:before { content: "\f058"; } .fa-question-circle:before { content: "\f059"; } .fa-info-circle:before { content: "\f05a"; } .fa-crosshairs:before { content: "\f05b"; } .fa-times-circle-o:before { content: "\f05c"; } .fa-check-circle-o:before { content: "\f05d"; } .fa-ban:before { content: "\f05e"; } .fa-arrow-left:before { content: "\f060"; } .fa-arrow-right:before { content: "\f061"; } .fa-arrow-up:before { content: "\f062"; } .fa-arrow-down:before { content: "\f063"; } .fa-mail-forward:before, .fa-share:before { content: "\f064"; } .fa-expand:before { content: "\f065"; } .fa-compress:before { content: "\f066"; } .fa-plus:before { content: "\f067"; } .fa-minus:before { content: "\f068"; } .fa-asterisk:before { content: "\f069"; } .fa-exclamation-circle:before { content: "\f06a"; } .fa-gift:before { content: "\f06b"; } .fa-leaf:before { content: "\f06c"; } .fa-fire:before { content: "\f06d"; } .fa-eye:before { content: "\f06e"; } .fa-eye-slash:before { content: "\f070"; } .fa-warning:before, .fa-exclamation-triangle:before { content: "\f071"; } .fa-plane:before { content: "\f072"; } .fa-calendar:before { content: "\f073"; } .fa-random:before { content: "\f074"; } .fa-comment:before { content: "\f075"; } .fa-magnet:before { content: "\f076"; } .fa-chevron-up:before { content: "\f077"; } .fa-chevron-down:before { content: "\f078"; } .fa-retweet:before { content: "\f079"; } .fa-shopping-cart:before { content: "\f07a"; } .fa-folder:before { content: "\f07b"; } .fa-folder-open:before { content: "\f07c"; } .fa-arrows-v:before { content: "\f07d"; } .fa-arrows-h:before { content: "\f07e"; } .fa-bar-chart-o:before, .fa-bar-chart:before { content: "\f080"; } .fa-twitter-square:before { content: "\f081"; } .fa-facebook-square:before { content: "\f082"; } .fa-camera-retro:before { content: "\f083"; } .fa-key:before { content: "\f084"; } .fa-gears:before, .fa-cogs:before { content: "\f085"; } .fa-comments:before { content: "\f086"; } .fa-thumbs-o-up:before { content: "\f087"; } .fa-thumbs-o-down:before { content: "\f088"; } .fa-star-half:before { content: "\f089"; } .fa-heart-o:before { content: "\f08a"; } .fa-sign-out:before { content: "\f08b"; } .fa-linkedin-square:before { content: "\f08c"; } .fa-thumb-tack:before { content: "\f08d"; } .fa-external-link:before { content: "\f08e"; } .fa-sign-in:before { content: "\f090"; } .fa-trophy:before { content: "\f091"; } .fa-github-square:before { content: "\f092"; } .fa-upload:before { content: "\f093"; } .fa-lemon-o:before { content: "\f094"; } .fa-phone:before { content: "\f095"; } .fa-square-o:before { content: "\f096"; } .fa-bookmark-o:before { content: "\f097"; } .fa-phone-square:before { content: "\f098"; } .fa-twitter:before { content: "\f099"; } .fa-facebook-f:before, .fa-facebook:before { content: "\f09a"; } .fa-github:before { content: "\f09b"; } .fa-unlock:before { content: "\f09c"; } .fa-credit-card:before { content: "\f09d"; } .fa-feed:before, .fa-rss:before { content: "\f09e"; } .fa-hdd-o:before { content: "\f0a0"; } .fa-bullhorn:before { content: "\f0a1"; } .fa-bell:before { content: "\f0f3"; } .fa-certificate:before { content: "\f0a3"; } .fa-hand-o-right:before { content: "\f0a4"; } .fa-hand-o-left:before { content: "\f0a5"; } .fa-hand-o-up:before { content: "\f0a6"; } .fa-hand-o-down:before { content: "\f0a7"; } .fa-arrow-circle-left:before { content: "\f0a8"; } .fa-arrow-circle-right:before { content: "\f0a9"; } .fa-arrow-circle-up:before { content: "\f0aa"; } .fa-arrow-circle-down:before { content: "\f0ab"; } .fa-globe:before { content: "\f0ac"; } .fa-wrench:before { content: "\f0ad"; } .fa-tasks:before { content: "\f0ae"; } .fa-filter:before { content: "\f0b0"; } .fa-briefcase:before { content: "\f0b1"; } .fa-arrows-alt:before { content: "\f0b2"; } .fa-group:before, .fa-users:before { content: "\f0c0"; } .fa-chain:before, .fa-link:before { content: "\f0c1"; } .fa-cloud:before { content: "\f0c2"; } .fa-flask:before { content: "\f0c3"; } .fa-cut:before, .fa-scissors:before { content: "\f0c4"; } .fa-copy:before, .fa-files-o:before { content: "\f0c5"; } .fa-paperclip:before { content: "\f0c6"; } .fa-save:before, .fa-floppy-o:before { content: "\f0c7"; } .fa-square:before { content: "\f0c8"; } .fa-navicon:before, .fa-reorder:before, .fa-bars:before { content: "\f0c9"; } .fa-list-ul:before { content: "\f0ca"; } .fa-list-ol:before { content: "\f0cb"; } .fa-strikethrough:before { content: "\f0cc"; } .fa-underline:before { content: "\f0cd"; } .fa-table:before { content: "\f0ce"; } .fa-magic:before { content: "\f0d0"; } .fa-truck:before { content: "\f0d1"; } .fa-pinterest:before { content: "\f0d2"; } .fa-pinterest-square:before { content: "\f0d3"; } .fa-google-plus-square:before { content: "\f0d4"; } .fa-google-plus:before { content: "\f0d5"; } .fa-money:before { content: "\f0d6"; } .fa-caret-down:before { content: "\f0d7"; } .fa-caret-up:before { content: "\f0d8"; } .fa-caret-left:before { content: "\f0d9"; } .fa-caret-right:before { content: "\f0da"; } .fa-columns:before { content: "\f0db"; } .fa-unsorted:before, .fa-sort:before { content: "\f0dc"; } .fa-sort-down:before, .fa-sort-desc:before { content: "\f0dd"; } .fa-sort-up:before, .fa-sort-asc:before { content: "\f0de"; } .fa-envelope:before { content: "\f0e0"; } .fa-linkedin:before { content: "\f0e1"; } .fa-rotate-left:before, .fa-undo:before { content: "\f0e2"; } .fa-legal:before, .fa-gavel:before { content: "\f0e3"; } .fa-dashboard:before, .fa-tachometer:before { content: "\f0e4"; } .fa-comment-o:before { content: "\f0e5"; } .fa-comments-o:before { content: "\f0e6"; } .fa-flash:before, .fa-bolt:before { content: "\f0e7"; } .fa-sitemap:before { content: "\f0e8"; } .fa-umbrella:before { content: "\f0e9"; } .fa-paste:before, .fa-clipboard:before { content: "\f0ea"; } .fa-lightbulb-o:before { content: "\f0eb"; } .fa-exchange:before { content: "\f0ec"; } .fa-cloud-download:before { content: "\f0ed"; } .fa-cloud-upload:before { content: "\f0ee"; } .fa-user-md:before { content: "\f0f0"; } .fa-stethoscope:before { content: "\f0f1"; } .fa-suitcase:before { content: "\f0f2"; } .fa-bell-o:before { content: "\f0a2"; } .fa-coffee:before { content: "\f0f4"; } .fa-cutlery:before { content: "\f0f5"; } .fa-file-text-o:before { content: "\f0f6"; } .fa-building-o:before { content: "\f0f7"; } .fa-hospital-o:before { content: "\f0f8"; } .fa-ambulance:before { content: "\f0f9"; } .fa-medkit:before { content: "\f0fa"; } .fa-fighter-jet:before { content: "\f0fb"; } .fa-beer:before { content: "\f0fc"; } .fa-h-square:before { content: "\f0fd"; } .fa-plus-square:before { content: "\f0fe"; } .fa-angle-double-left:before { content: "\f100"; } .fa-angle-double-right:before { content: "\f101"; } .fa-angle-double-up:before { content: "\f102"; } .fa-angle-double-down:before { content: "\f103"; } .fa-angle-left:before { content: "\f104"; } .fa-angle-right:before { content: "\f105"; } .fa-angle-up:before { content: "\f106"; } .fa-angle-down:before { content: "\f107"; } .fa-desktop:before { content: "\f108"; } .fa-laptop:before { content: "\f109"; } .fa-tablet:before { content: "\f10a"; } .fa-mobile-phone:before, .fa-mobile:before { content: "\f10b"; } .fa-circle-o:before { content: "\f10c"; } .fa-quote-left:before { content: "\f10d"; } .fa-quote-right:before { content: "\f10e"; } .fa-spinner:before { content: "\f110"; } .fa-circle:before { content: "\f111"; } .fa-mail-reply:before, .fa-reply:before { content: "\f112"; } .fa-github-alt:before { content: "\f113"; } .fa-folder-o:before { content: "\f114"; } .fa-folder-open-o:before { content: "\f115"; } .fa-smile-o:before { content: "\f118"; } .fa-frown-o:before { content: "\f119"; } .fa-meh-o:before { content: "\f11a"; } .fa-gamepad:before { content: "\f11b"; } .fa-keyboard-o:before { content: "\f11c"; } .fa-flag-o:before { content: "\f11d"; } .fa-flag-checkered:before { content: "\f11e"; } .fa-terminal:before { content: "\f120"; } .fa-code:before { content: "\f121"; } .fa-mail-reply-all:before, .fa-reply-all:before { content: "\f122"; } .fa-star-half-empty:before, .fa-star-half-full:before, .fa-star-half-o:before { content: "\f123"; } .fa-location-arrow:before { content: "\f124"; } .fa-crop:before { content: "\f125"; } .fa-code-fork:before { content: "\f126"; } .fa-unlink:before, .fa-chain-broken:before { content: "\f127"; } .fa-question:before { content: "\f128"; } .fa-info:before { content: "\f129"; } .fa-exclamation:before { content: "\f12a"; } .fa-superscript:before { content: "\f12b"; } .fa-subscript:before { content: "\f12c"; } .fa-eraser:before { content: "\f12d"; } .fa-puzzle-piece:before { content: "\f12e"; } .fa-microphone:before { content: "\f130"; } .fa-microphone-slash:before { content: "\f131"; } .fa-shield:before { content: "\f132"; } .fa-calendar-o:before { content: "\f133"; } .fa-fire-extinguisher:before { content: "\f134"; } .fa-rocket:before { content: "\f135"; } .fa-maxcdn:before { content: "\f136"; } .fa-chevron-circle-left:before { content: "\f137"; } .fa-chevron-circle-right:before { content: "\f138"; } .fa-chevron-circle-up:before { content: "\f139"; } .fa-chevron-circle-down:before { content: "\f13a"; } .fa-html5:before { content: "\f13b"; } .fa-css3:before { content: "\f13c"; } .fa-anchor:before { content: "\f13d"; } .fa-unlock-alt:before { content: "\f13e"; } .fa-bullseye:before { content: "\f140"; } .fa-ellipsis-h:before { content: "\f141"; } .fa-ellipsis-v:before { content: "\f142"; } .fa-rss-square:before { content: "\f143"; } .fa-play-circle:before { content: "\f144"; } .fa-ticket:before { content: "\f145"; } .fa-minus-square:before { content: "\f146"; } .fa-minus-square-o:before { content: "\f147"; } .fa-level-up:before { content: "\f148"; } .fa-level-down:before { content: "\f149"; } .fa-check-square:before { content: "\f14a"; } .fa-pencil-square:before { content: "\f14b"; } .fa-external-link-square:before { content: "\f14c"; } .fa-share-square:before { content: "\f14d"; } .fa-compass:before { content: "\f14e"; } .fa-toggle-down:before, .fa-caret-square-o-down:before { content: "\f150"; } .fa-toggle-up:before, .fa-caret-square-o-up:before { content: "\f151"; } .fa-toggle-right:before, .fa-caret-square-o-right:before { content: "\f152"; } .fa-euro:before, .fa-eur:before { content: "\f153"; } .fa-gbp:before { content: "\f154"; } .fa-dollar:before, .fa-usd:before { content: "\f155"; } .fa-rupee:before, .fa-inr:before { content: "\f156"; } .fa-cny:before, .fa-rmb:before, .fa-yen:before, .fa-jpy:before { content: "\f157"; } .fa-ruble:before, .fa-rouble:before, .fa-rub:before { content: "\f158"; } .fa-won:before, .fa-krw:before { content: "\f159"; } .fa-bitcoin:before, .fa-btc:before { content: "\f15a"; } .fa-file:before { content: "\f15b"; } .fa-file-text:before { content: "\f15c"; } .fa-sort-alpha-asc:before { content: "\f15d"; } .fa-sort-alpha-desc:before { content: "\f15e"; } .fa-sort-amount-asc:before { content: "\f160"; } .fa-sort-amount-desc:before { content: "\f161"; } .fa-sort-numeric-asc:before { content: "\f162"; } .fa-sort-numeric-desc:before { content: "\f163"; } .fa-thumbs-up:before { content: "\f164"; } .fa-thumbs-down:before { content: "\f165"; } .fa-youtube-square:before { content: "\f166"; } .fa-youtube:before { content: "\f167"; } .fa-xing:before { content: "\f168"; } .fa-xing-square:before { content: "\f169"; } .fa-youtube-play:before { content: "\f16a"; } .fa-dropbox:before { content: "\f16b"; } .fa-stack-overflow:before { content: "\f16c"; } .fa-instagram:before { content: "\f16d"; } .fa-flickr:before { content: "\f16e"; } .fa-adn:before { content: "\f170"; } .fa-bitbucket:before { content: "\f171"; } .fa-bitbucket-square:before { content: "\f172"; } .fa-tumblr:before { content: "\f173"; } .fa-tumblr-square:before { content: "\f174"; } .fa-long-arrow-down:before { content: "\f175"; } .fa-long-arrow-up:before { content: "\f176"; } .fa-long-arrow-left:before { content: "\f177"; } .fa-long-arrow-right:before { content: "\f178"; } .fa-apple:before { content: "\f179"; } .fa-windows:before { content: "\f17a"; } .fa-android:before { content: "\f17b"; } .fa-linux:before { content: "\f17c"; } .fa-dribbble:before { content: "\f17d"; } .fa-skype:before { content: "\f17e"; } .fa-foursquare:before { content: "\f180"; } .fa-trello:before { content: "\f181"; } .fa-female:before { content: "\f182"; } .fa-male:before { content: "\f183"; } .fa-gittip:before, .fa-gratipay:before { content: "\f184"; } .fa-sun-o:before { content: "\f185"; } .fa-moon-o:before { content: "\f186"; } .fa-archive:before { content: "\f187"; } .fa-bug:before { content: "\f188"; } .fa-vk:before { content: "\f189"; } .fa-weibo:before { content: "\f18a"; } .fa-renren:before { content: "\f18b"; } .fa-pagelines:before { content: "\f18c"; } .fa-stack-exchange:before { content: "\f18d"; } .fa-arrow-circle-o-right:before { content: "\f18e"; } .fa-arrow-circle-o-left:before { content: "\f190"; } .fa-toggle-left:before, .fa-caret-square-o-left:before { content: "\f191"; } .fa-dot-circle-o:before { content: "\f192"; } .fa-wheelchair:before { content: "\f193"; } .fa-vimeo-square:before { content: "\f194"; } .fa-turkish-lira:before, .fa-try:before { content: "\f195"; } .fa-plus-square-o:before { content: "\f196"; } .fa-space-shuttle:before { content: "\f197"; } .fa-slack:before { content: "\f198"; } .fa-envelope-square:before { content: "\f199"; } .fa-wordpress:before { content: "\f19a"; } .fa-openid:before { content: "\f19b"; } .fa-institution:before, .fa-bank:before, .fa-university:before { content: "\f19c"; } .fa-mortar-board:before, .fa-graduation-cap:before { content: "\f19d"; } .fa-yahoo:before { content: "\f19e"; } .fa-google:before { content: "\f1a0"; } .fa-reddit:before { content: "\f1a1"; } .fa-reddit-square:before { content: "\f1a2"; } .fa-stumbleupon-circle:before { content: "\f1a3"; } .fa-stumbleupon:before { content: "\f1a4"; } .fa-delicious:before { content: "\f1a5"; } .fa-digg:before { content: "\f1a6"; } .fa-pied-piper-pp:before { content: "\f1a7"; } .fa-pied-piper-alt:before { content: "\f1a8"; } .fa-drupal:before { content: "\f1a9"; } .fa-joomla:before { content: "\f1aa"; } .fa-language:before { content: "\f1ab"; } .fa-fax:before { content: "\f1ac"; } .fa-building:before { content: "\f1ad"; } .fa-child:before { content: "\f1ae"; } .fa-paw:before { content: "\f1b0"; } .fa-spoon:before { content: "\f1b1"; } .fa-cube:before { content: "\f1b2"; } .fa-cubes:before { content: "\f1b3"; } .fa-behance:before { content: "\f1b4"; } .fa-behance-square:before { content: "\f1b5"; } .fa-steam:before { content: "\f1b6"; } .fa-steam-square:before { content: "\f1b7"; } .fa-recycle:before { content: "\f1b8"; } .fa-automobile:before, .fa-car:before { content: "\f1b9"; } .fa-cab:before, .fa-taxi:before { content: "\f1ba"; } .fa-tree:before { content: "\f1bb"; } .fa-spotify:before { content: "\f1bc"; } .fa-deviantart:before { content: "\f1bd"; } .fa-soundcloud:before { content: "\f1be"; } .fa-database:before { content: "\f1c0"; } .fa-file-pdf-o:before { content: "\f1c1"; } .fa-file-word-o:before { content: "\f1c2"; } .fa-file-excel-o:before { content: "\f1c3"; } .fa-file-powerpoint-o:before { content: "\f1c4"; } .fa-file-photo-o:before, .fa-file-picture-o:before, .fa-file-image-o:before { content: "\f1c5"; } .fa-file-zip-o:before, .fa-file-archive-o:before { content: "\f1c6"; } .fa-file-sound-o:before, .fa-file-audio-o:before { content: "\f1c7"; } .fa-file-movie-o:before, .fa-file-video-o:before { content: "\f1c8"; } .fa-file-code-o:before { content: "\f1c9"; } .fa-vine:before { content: "\f1ca"; } .fa-codepen:before { content: "\f1cb"; } .fa-jsfiddle:before { content: "\f1cc"; } .fa-life-bouy:before, .fa-life-buoy:before, .fa-life-saver:before, .fa-support:before, .fa-life-ring:before { content: "\f1cd"; } .fa-circle-o-notch:before { content: "\f1ce"; } .fa-ra:before, .fa-resistance:before, .fa-rebel:before { content: "\f1d0"; } .fa-ge:before, .fa-empire:before { content: "\f1d1"; } .fa-git-square:before { content: "\f1d2"; } .fa-git:before { content: "\f1d3"; } .fa-y-combinator-square:before, .fa-yc-square:before, .fa-hacker-news:before { content: "\f1d4"; } .fa-tencent-weibo:before { content: "\f1d5"; } .fa-qq:before { content: "\f1d6"; } .fa-wechat:before, .fa-weixin:before { content: "\f1d7"; } .fa-send:before, .fa-paper-plane:before { content: "\f1d8"; } .fa-send-o:before, .fa-paper-plane-o:before { content: "\f1d9"; } .fa-history:before { content: "\f1da"; } .fa-circle-thin:before { content: "\f1db"; } .fa-header:before { content: "\f1dc"; } .fa-paragraph:before { content: "\f1dd"; } .fa-sliders:before { content: "\f1de"; } .fa-share-alt:before { content: "\f1e0"; } .fa-share-alt-square:before { content: "\f1e1"; } .fa-bomb:before { content: "\f1e2"; } .fa-soccer-ball-o:before, .fa-futbol-o:before { content: "\f1e3"; } .fa-tty:before { content: "\f1e4"; } .fa-binoculars:before { content: "\f1e5"; } .fa-plug:before { content: "\f1e6"; } .fa-slideshare:before { content: "\f1e7"; } .fa-twitch:before { content: "\f1e8"; } .fa-yelp:before { content: "\f1e9"; } .fa-newspaper-o:before { content: "\f1ea"; } .fa-wifi:before { content: "\f1eb"; } .fa-calculator:before { content: "\f1ec"; } .fa-paypal:before { content: "\f1ed"; } .fa-google-wallet:before { content: "\f1ee"; } .fa-cc-visa:before { content: "\f1f0"; } .fa-cc-mastercard:before { content: "\f1f1"; } .fa-cc-discover:before { content: "\f1f2"; } .fa-cc-amex:before { content: "\f1f3"; } .fa-cc-paypal:before { content: "\f1f4"; } .fa-cc-stripe:before { content: "\f1f5"; } .fa-bell-slash:before { content: "\f1f6"; } .fa-bell-slash-o:before { content: "\f1f7"; } .fa-trash:before { content: "\f1f8"; } .fa-copyright:before { content: "\f1f9"; } .fa-at:before { content: "\f1fa"; } .fa-eyedropper:before { content: "\f1fb"; } .fa-paint-brush:before { content: "\f1fc"; } .fa-birthday-cake:before { content: "\f1fd"; } .fa-area-chart:before { content: "\f1fe"; } .fa-pie-chart:before { content: "\f200"; } .fa-line-chart:before { content: "\f201"; } .fa-lastfm:before { content: "\f202"; } .fa-lastfm-square:before { content: "\f203"; } .fa-toggle-off:before { content: "\f204"; } .fa-toggle-on:before { content: "\f205"; } .fa-bicycle:before { content: "\f206"; } .fa-bus:before { content: "\f207"; } .fa-ioxhost:before { content: "\f208"; } .fa-angellist:before { content: "\f209"; } .fa-cc:before { content: "\f20a"; } .fa-shekel:before, .fa-sheqel:before, .fa-ils:before { content: "\f20b"; } .fa-meanpath:before { content: "\f20c"; } .fa-buysellads:before { content: "\f20d"; } .fa-connectdevelop:before { content: "\f20e"; } .fa-dashcube:before { content: "\f210"; } .fa-forumbee:before { content: "\f211"; } .fa-leanpub:before { content: "\f212"; } .fa-sellsy:before { content: "\f213"; } .fa-shirtsinbulk:before { content: "\f214"; } .fa-simplybuilt:before { content: "\f215"; } .fa-skyatlas:before { content: "\f216"; } .fa-cart-plus:before { content: "\f217"; } .fa-cart-arrow-down:before { content: "\f218"; } .fa-diamond:before { content: "\f219"; } .fa-ship:before { content: "\f21a"; } .fa-user-secret:before { content: "\f21b"; } .fa-motorcycle:before { content: "\f21c"; } .fa-street-view:before { content: "\f21d"; } .fa-heartbeat:before { content: "\f21e"; } .fa-venus:before { content: "\f221"; } .fa-mars:before { content: "\f222"; } .fa-mercury:before { content: "\f223"; } .fa-intersex:before, .fa-transgender:before { content: "\f224"; } .fa-transgender-alt:before { content: "\f225"; } .fa-venus-double:before { content: "\f226"; } .fa-mars-double:before { content: "\f227"; } .fa-venus-mars:before { content: "\f228"; } .fa-mars-stroke:before { content: "\f229"; } .fa-mars-stroke-v:before { content: "\f22a"; } .fa-mars-stroke-h:before { content: "\f22b"; } .fa-neuter:before { content: "\f22c"; } .fa-genderless:before { content: "\f22d"; } .fa-facebook-official:before { content: "\f230"; } .fa-pinterest-p:before { content: "\f231"; } .fa-whatsapp:before { content: "\f232"; } .fa-server:before { content: "\f233"; } .fa-user-plus:before { content: "\f234"; } .fa-user-times:before { content: "\f235"; } .fa-hotel:before, .fa-bed:before { content: "\f236"; } .fa-viacoin:before { content: "\f237"; } .fa-train:before { content: "\f238"; } .fa-subway:before { content: "\f239"; } .fa-medium:before { content: "\f23a"; } .fa-yc:before, .fa-y-combinator:before { content: "\f23b"; } .fa-optin-monster:before { content: "\f23c"; } .fa-opencart:before { content: "\f23d"; } .fa-expeditedssl:before { content: "\f23e"; } .fa-battery-4:before, .fa-battery:before, .fa-battery-full:before { content: "\f240"; } .fa-battery-3:before, .fa-battery-three-quarters:before { content: "\f241"; } .fa-battery-2:before, .fa-battery-half:before { content: "\f242"; } .fa-battery-1:before, .fa-battery-quarter:before { content: "\f243"; } .fa-battery-0:before, .fa-battery-empty:before { content: "\f244"; } .fa-mouse-pointer:before { content: "\f245"; } .fa-i-cursor:before { content: "\f246"; } .fa-object-group:before { content: "\f247"; } .fa-object-ungroup:before { content: "\f248"; } .fa-sticky-note:before { content: "\f249"; } .fa-sticky-note-o:before { content: "\f24a"; } .fa-cc-jcb:before { content: "\f24b"; } .fa-cc-diners-club:before { content: "\f24c"; } .fa-clone:before { content: "\f24d"; } .fa-balance-scale:before { content: "\f24e"; } .fa-hourglass-o:before { content: "\f250"; } .fa-hourglass-1:before, .fa-hourglass-start:before { content: "\f251"; } .fa-hourglass-2:before, .fa-hourglass-half:before { content: "\f252"; } .fa-hourglass-3:before, .fa-hourglass-end:before { content: "\f253"; } .fa-hourglass:before { content: "\f254"; } .fa-hand-grab-o:before, .fa-hand-rock-o:before { content: "\f255"; } .fa-hand-stop-o:before, .fa-hand-paper-o:before { content: "\f256"; } .fa-hand-scissors-o:before { content: "\f257"; } .fa-hand-lizard-o:before { content: "\f258"; } .fa-hand-spock-o:before { content: "\f259"; } .fa-hand-pointer-o:before { content: "\f25a"; } .fa-hand-peace-o:before { content: "\f25b"; } .fa-trademark:before { content: "\f25c"; } .fa-registered:before { content: "\f25d"; } .fa-creative-commons:before { content: "\f25e"; } .fa-gg:before { content: "\f260"; } .fa-gg-circle:before { content: "\f261"; } .fa-tripadvisor:before { content: "\f262"; } .fa-odnoklassniki:before { content: "\f263"; } .fa-odnoklassniki-square:before { content: "\f264"; } .fa-get-pocket:before { content: "\f265"; } .fa-wikipedia-w:before { content: "\f266"; } .fa-safari:before { content: "\f267"; } .fa-chrome:before { content: "\f268"; } .fa-firefox:before { content: "\f269"; } .fa-opera:before { content: "\f26a"; } .fa-internet-explorer:before { content: "\f26b"; } .fa-tv:before, .fa-television:before { content: "\f26c"; } .fa-contao:before { content: "\f26d"; } .fa-500px:before { content: "\f26e"; } .fa-amazon:before { content: "\f270"; } .fa-calendar-plus-o:before { content: "\f271"; } .fa-calendar-minus-o:before { content: "\f272"; } .fa-calendar-times-o:before { content: "\f273"; } .fa-calendar-check-o:before { content: "\f274"; } .fa-industry:before { content: "\f275"; } .fa-map-pin:before { content: "\f276"; } .fa-map-signs:before { content: "\f277"; } .fa-map-o:before { content: "\f278"; } .fa-map:before { content: "\f279"; } .fa-commenting:before { content: "\f27a"; } .fa-commenting-o:before { content: "\f27b"; } .fa-houzz:before { content: "\f27c"; } .fa-vimeo:before { content: "\f27d"; } .fa-black-tie:before { content: "\f27e"; } .fa-fonticons:before { content: "\f280"; } .fa-reddit-alien:before { content: "\f281"; } .fa-edge:before { content: "\f282"; } .fa-credit-card-alt:before { content: "\f283"; } .fa-codiepie:before { content: "\f284"; } .fa-modx:before { content: "\f285"; } .fa-fort-awesome:before { content: "\f286"; } .fa-usb:before { content: "\f287"; } .fa-product-hunt:before { content: "\f288"; } .fa-mixcloud:before { content: "\f289"; } .fa-scribd:before { content: "\f28a"; } .fa-pause-circle:before { content: "\f28b"; } .fa-pause-circle-o:before { content: "\f28c"; } .fa-stop-circle:before { content: "\f28d"; } .fa-stop-circle-o:before { content: "\f28e"; } .fa-shopping-bag:before { content: "\f290"; } .fa-shopping-basket:before { content: "\f291"; } .fa-hashtag:before { content: "\f292"; } .fa-bluetooth:before { content: "\f293"; } .fa-bluetooth-b:before { content: "\f294"; } .fa-percent:before { content: "\f295"; } .fa-gitlab:before { content: "\f296"; } .fa-wpbeginner:before { content: "\f297"; } .fa-wpforms:before { content: "\f298"; } .fa-envira:before { content: "\f299"; } .fa-universal-access:before { content: "\f29a"; } .fa-wheelchair-alt:before { content: "\f29b"; } .fa-question-circle-o:before { content: "\f29c"; } .fa-blind:before { content: "\f29d"; } .fa-audio-description:before { content: "\f29e"; } .fa-volume-control-phone:before { content: "\f2a0"; } .fa-braille:before { content: "\f2a1"; } .fa-assistive-listening-systems:before { content: "\f2a2"; } .fa-asl-interpreting:before, .fa-american-sign-language-interpreting:before { content: "\f2a3"; } .fa-deafness:before, .fa-hard-of-hearing:before, .fa-deaf:before { content: "\f2a4"; } .fa-glide:before { content: "\f2a5"; } .fa-glide-g:before { content: "\f2a6"; } .fa-signing:before, .fa-sign-language:before { content: "\f2a7"; } .fa-low-vision:before { content: "\f2a8"; } .fa-viadeo:before { content: "\f2a9"; } .fa-viadeo-square:before { content: "\f2aa"; } .fa-snapchat:before { content: "\f2ab"; } .fa-snapchat-ghost:before { content: "\f2ac"; } .fa-snapchat-square:before { content: "\f2ad"; } .fa-pied-piper:before { content: "\f2ae"; } .fa-first-order:before { content: "\f2b0"; } .fa-yoast:before { content: "\f2b1"; } .fa-themeisle:before { content: "\f2b2"; } .fa-google-plus-circle:before, .fa-google-plus-official:before { content: "\f2b3"; } .fa-fa:before, .fa-font-awesome:before { content: "\f2b4"; } .fa-handshake-o:before { content: "\f2b5"; } .fa-envelope-open:before { content: "\f2b6"; } .fa-envelope-open-o:before { content: "\f2b7"; } .fa-linode:before { content: "\f2b8"; } .fa-address-book:before { content: "\f2b9"; } .fa-address-book-o:before { content: "\f2ba"; } .fa-vcard:before, .fa-address-card:before { content: "\f2bb"; } .fa-vcard-o:before, .fa-address-card-o:before { content: "\f2bc"; } .fa-user-circle:before { content: "\f2bd"; } .fa-user-circle-o:before { content: "\f2be"; } .fa-user-o:before { content: "\f2c0"; } .fa-id-badge:before { content: "\f2c1"; } .fa-drivers-license:before, .fa-id-card:before { content: "\f2c2"; } .fa-drivers-license-o:before, .fa-id-card-o:before { content: "\f2c3"; } .fa-quora:before { content: "\f2c4"; } .fa-free-code-camp:before { content: "\f2c5"; } .fa-telegram:before { content: "\f2c6"; } .fa-thermometer-4:before, .fa-thermometer:before, .fa-thermometer-full:before { content: "\f2c7"; } .fa-thermometer-3:before, .fa-thermometer-three-quarters:before { content: "\f2c8"; } .fa-thermometer-2:before, .fa-thermometer-half:before { content: "\f2c9"; } .fa-thermometer-1:before, .fa-thermometer-quarter:before { content: "\f2ca"; } .fa-thermometer-0:before, .fa-thermometer-empty:before { content: "\f2cb"; } .fa-shower:before { content: "\f2cc"; } .fa-bathtub:before, .fa-s15:before, .fa-bath:before { content: "\f2cd"; } .fa-podcast:before { content: "\f2ce"; } .fa-window-maximize:before { content: "\f2d0"; } .fa-window-minimize:before { content: "\f2d1"; } .fa-window-restore:before { content: "\f2d2"; } .fa-times-rectangle:before, .fa-window-close:before { content: "\f2d3"; } .fa-times-rectangle-o:before, .fa-window-close-o:before { content: "\f2d4"; } .fa-bandcamp:before { content: "\f2d5"; } .fa-grav:before { content: "\f2d6"; } .fa-etsy:before { content: "\f2d7"; } .fa-imdb:before { content: "\f2d8"; } .fa-ravelry:before { content: "\f2d9"; } .fa-eercast:before { content: "\f2da"; } .fa-microchip:before { content: "\f2db"; } .fa-snowflake-o:before { content: "\f2dc"; } .fa-superpowers:before { content: "\f2dd"; } .fa-wpexplorer:before { content: "\f2de"; } .fa-meetup:before { content: "\f2e0"; } .sr-only, .screen-reader-text { position: absolute; width: 1px; height: 1px; padding: 0; margin: -1px; overflow: hidden; clip: rect(0, 0, 0, 0); border: 0; } .sr-only-focusable:active, .screen-reader-text:active, .sr-only-focusable:focus, .screen-reader-text:focus { position: static; width: auto; height: auto; margin: 0; overflow: visible; clip: auto; } /** Import theme styles */ /* stylelint-disable */ html { -moz-osx-font-smoothing: grayscale; -webkit-font-smoothing: antialiased; text-rendering: optimizeLegibility; scroll-behavior: smooth; } html strong { color: #023605; } body { font-family: "Momo Trust Sans", sans-serif; font-size: 16px; line-height: 28px; font-weight: 400; overflow-x: hidden; color: #a49f9f; background-color: #fffdfc; will-change: color, background-color; -webkit-transition: color, background-color 0.15s ease-in-out; -o-transition: color, background-color 0.15s ease-in-out; transition: color, background-color 0.15s ease-in-out; } @media (min-width: 1400px) { body { font-size: 18px; line-height: 30px; } } body.show-menu { width: 100%; height: 100%; overflow: hidden; } @media (min-width: 1200px) { body.show-menu { overflow: auto; } } body.show-menu .main { -webkit-transform: translate3d(-50%, 0, 0); transform: translate3d(-50%, 0, 0); } @media (min-width: 1200px) { body.show-menu .main { -webkit-transform: translate3d(0, 0, 0); transform: translate3d(0, 0, 0); } } body.page-template-default { background-color: #fff; } body .page-content-main-wrap:not(:has(section)) + .pre-footer { margin-top: 170px; } @media (min-width: 576px) { body .page-content-main-wrap:not(:has(section)) + .pre-footer { margin-top: 140px; } } @media (min-width: 1200px) { body .page-content-main-wrap:not(:has(section)) + .pre-footer { margin-top: 170px; } } body .page-content-main-wrap { position: relative; } body .page-content-main-wrap .main section { padding: 25px 0; } body .page-content-main-wrap .main section:first-child:not(.banner-section) { padding-top: 0; } @media (min-width: 992px) { body .page-content-main-wrap .main section { padding: 37px 0; } } @media (min-width: 1400px) { body .page-content-main-wrap .main section { padding: 50px 0; } } body .page-content-main-wrap .main section.banner-section + .bg-enabled { padding-top: 25px; margin-top: 0; } @media (min-width: 768px) { body .page-content-main-wrap .main section.banner-section + .bg-enabled { padding-top: 37px; } } @media (min-width: 992px) { body .page-content-main-wrap .main section.banner-section + .bg-enabled { padding-top: 50px; } } body .page-content-main-wrap .main section.bg-enabled { padding: 50px 0; margin-top: 25px; } @media (min-width: 768px) { body .page-content-main-wrap .main section.bg-enabled { padding: 75px 0; margin-top: 37px; } } @media (min-width: 992px) { body .page-content-main-wrap .main section.bg-enabled { padding: 100px 0; margin-top: 50px; } } body .page-content-main-wrap .main section.bg-enabled.color-1 { background-color: #878787; } body .page-content-main-wrap .main section.bg-enabled + .bg-enabled { margin-top: -50px; } @media (min-width: 768px) { body .page-content-main-wrap .main section.bg-enabled + .bg-enabled { margin-top: -75px; } } @media (min-width: 992px) { body .page-content-main-wrap .main section.bg-enabled + .bg-enabled { margin-top: -100px; } } body .page-content-main-wrap .main section.bg-enabled + .fcp-section { padding-top: 50px; } @media (min-width: 768px) { body .page-content-main-wrap .main section.bg-enabled + .fcp-section { padding-top: 75px; } } @media (min-width: 992px) { body .page-content-main-wrap .main section.bg-enabled + .fcp-section { padding-top: 100px; } } body .page-content-main-wrap .main section.bg-enabled + .bg-img { margin-top: 0; } body .page-content-main-wrap .main section.banner-section { padding: 83px 0 25px 0; } @media (min-width: 1200px) { body .page-content-main-wrap .main section.banner-section { padding: 160px 0 37px 0; } } @media (min-width: 1400px) { body .page-content-main-wrap .main section.banner-section { padding: 197px 0 50px 0; } } body .page-content-main-wrap .main section.banner-section + .form-section { padding-top: 0; } @media (min-width: 576px) { body .page-content-main-wrap .main section.banner-section + .form-section { padding-top: 25px; } } @media (min-width: 768px) { body .page-content-main-wrap .main section.banner-section + .form-section { padding-top: 37px; } } @media (min-width: 1400px) { body .page-content-main-wrap .main section.banner-section + .form-section { padding-top: 50px; } } body .page-content-main-wrap .main section.bg-img { background-repeat: no-repeat; background-position: center; background-size: cover; margin-top: 25px; } @media (min-width: 768px) { body .page-content-main-wrap .main section.bg-img { margin-top: 37px; } } @media (min-width: 992px) { body .page-content-main-wrap .main section.bg-img { margin-top: 50px; } } body.mobile-menu-active { overflow: hidden; } @media (min-width: 1200px) { body.mobile-menu-active { overflow: visible; } } body img { width: 100%; } .lightcase-icon-play { display: none !important; } .home .main > section:nth-child(2) { padding-top: 50px; } @media (min-width: 1200px) { .home .main > section:nth-child(2) { padding-top: 75px; } } @media (min-width: 1400px) { .home .main > section:nth-child(2) { padding-top: 100px; } } .home .main > section:nth-child(2).home-core-values-section { padding-top: 0; } @media (min-width: 1400px) { .home .main > section.home-two-column-section + .home-two-column-section { padding-top: 100px; } } .flickity-button { border: none; background-color: #faf8f6; width: 40px; height: 40px; border-radius: 50%; will-change: background-color; -webkit-transition: background-color 0.15s ease-in-out; -o-transition: background-color 0.15s ease-in-out; transition: background-color 0.15s ease-in-out; } .flickity-button::after { content: ""; position: absolute; top: 50%; left: 50%; -webkit-transform: translate(-50%, -50%); -o-transform: translate(-50%, -50%); transform: translate(-50%, -50%); width: 15px; height: 10px; background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIxNS4zIiBoZWlnaHQ9IjEwLjQyMyIgdmlld0JveD0iMCAwIDE1LjMgMTAuNDIzIj4KICA8cGF0aCBpZD0iSWNvbl9pb25pYy1pb3MtYXJyb3ctcm91bmQtYmFjayIgZGF0YS1uYW1lPSJJY29uIGlvbmljLWlvcy1hcnJvdy1yb3VuZC1iYWNrIiBkPSJNMTcuMzIsMTEuNDQxYS42NzIuNjcyLDAsMCwwLS4wMDUuOTQ2bDMuMTIsMy4xMzFIOC41NDVhLjY2OC42NjgsMCwwLDAsMCwxLjMzN2gxMS44OUwxNy4zMSwxOS45ODRhLjY3Ny42NzcsMCwwLDAsLjAwNS45NDYuNjY2LjY2NiwwLDAsMCwuOTQxLS4wMDVsNC4yMzYtNC4yNjdoMGEuNzUuNzUsMCwwLDAsLjEzOS0uMjExLjYzOC42MzgsMCwwLDAsLjA1MS0uMjU3LjY3LjY3LDAsMCwwLS4xOS0uNDY4bC00LjIzNi00LjI2N0EuNjU1LjY1NSwwLDAsMCwxNy4zMiwxMS40NDFaIiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtNy42MzIgLTExLjAwMikiIHN0cm9rZT0iIzAyMzYwNSIgc3Ryb2tlLXdpZHRoPSIwLjUiLz4KPC9zdmc+Cg==); will-change: background-image; -webkit-transition: background-image 0.15s ease-in-out; -o-transition: background-image 0.15s ease-in-out; transition: background-image 0.15s ease-in-out; } .flickity-button:hover { background-color: #023605; } .flickity-button:hover::after { background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIxNS4zIiBoZWlnaHQ9IjEwLjQyMyIgdmlld0JveD0iMCAwIDE1LjMgMTAuNDIzIj4KICA8cGF0aCBpZD0iSWNvbl9pb25pYy1pb3MtYXJyb3ctcm91bmQtYmFjayIgZGF0YS1uYW1lPSJJY29uIGlvbmljLWlvcy1hcnJvdy1yb3VuZC1iYWNrIiBkPSJNMTcuMzIsMTEuNDQxYS42NzIuNjcyLDAsMCwwLS4wMDUuOTQ2bDMuMTIsMy4xMzFIOC41NDVhLjY2OC42NjgsMCwwLDAsMCwxLjMzN2gxMS44OUwxNy4zMSwxOS45ODRhLjY3Ny42NzcsMCwwLDAsLjAwNS45NDYuNjY2LjY2NiwwLDAsMCwuOTQxLS4wMDVsNC4yMzYtNC4yNjdoMGEuNzUuNzUsMCwwLDAsLjEzOS0uMjExLjYzOC42MzgsMCwwLDAsLjA1MS0uMjU3LjY3LjY3LDAsMCwwLS4xOS0uNDY4bC00LjIzNi00LjI2N0EuNjU1LjY1NSwwLDAsMCwxNy4zMiwxMS40NDFaIiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtNy42MzIgLTExLjAwMikiIHN0cm9rZT0iI2ZmZiIgc3Ryb2tlLXdpZHRoPSIwLjUiIGZpbGw9IiNmZmYiLz4KPC9zdmc+Cg==); } .flickity-button.previous { left: 0; } .flickity-button.previous::after { -webkit-transform: translate(-50%, -50%) rotate(180deg); -o-transform: translate(-50%, -50%) rotate(180deg); transform: translate(-50%, -50%) rotate(180deg); } .flickity-button.next { right: 0; } .flickity-button svg { display: none; } /* stylelint-disable */ .btn, .comment-form input[type=submit] { font-size: 14px; line-height: 24px; padding: 14px 35px; border: none; position: relative; min-width: 100%; font-weight: 700; border-radius: 24px; color: #fff; text-align: center; background-color: #023605; -webkit-box-shadow: 5px 5px 20px rgba(0, 0, 0, 0.2); box-shadow: 5px 5px 20px rgba(0, 0, 0, 0.2); will-change: all; -webkit-transition: all 0.15s ease-in-out; -o-transition: all 0.15s ease-in-out; transition: all 0.15s ease-in-out; } @media (min-width: 576px) { .btn, .comment-form input[type=submit] { min-width: 168px; padding: 12px 25px; } } @media (min-width: 1400px) { .btn, .comment-form input[type=submit] { min-width: 260px; font-size: 16px; padding: 13px 25px; } } .btn:hover, .comment-form input[type=submit]:hover { background-color: #000; color: #fff; } .btn:focus, .comment-form input[type=submit]:focus { background-color: #000; color: #fff; } .btn.btn-primary, .comment-form input.btn-primary[type=submit] { color: #fff; } .btn.btn-primary:focus, .comment-form input.btn-primary[type=submit]:focus, .btn.btn-primary:active, .comment-form input.btn-primary[type=submit]:active { background-color: #000 !important; color: #fff !important; } .btn.btn-primary:hover, .comment-form input.btn-primary[type=submit]:hover { background-color: #000; color: #fff; } .btn.btn-posts, .comment-form input.btn-posts[type=submit], .btn.read-more-btn, .comment-form input.read-more-btn[type=submit] { background-color: #efefef; color: #9ca0a2; padding: 5px 12px; border-radius: 14px; font-size: 12px; line-height: 17px; letter-spacing: 0; font-weight: 500; min-width: 85px; border: none; } @media (min-width: 1400px) { .btn.btn-posts, .comment-form input.btn-posts[type=submit], .btn.read-more-btn, .comment-form input.read-more-btn[type=submit] { font-size: 16px; min-width: 147px; padding: 12px; border-radius: 21px; } } .btn.btn-posts:hover, .comment-form input.btn-posts[type=submit]:hover, .btn.read-more-btn:hover, .comment-form input.read-more-btn[type=submit]:hover { border-color: none; background-color: #023605; color: #fff; } .btn.btn-posts:focus, .comment-form input.btn-posts[type=submit]:focus, .btn.btn-posts:active, .comment-form input.btn-posts[type=submit]:active, .btn.read-more-btn:focus, .comment-form input.read-more-btn[type=submit]:focus, .btn.read-more-btn:active, .comment-form input.read-more-btn[type=submit]:active { border: none; -webkit-box-shadow: none; box-shadow: none; background-color: #faf8f6; color: #fff; } .button-wrapper-form { display: inline-block; background-color: #023605; border: none; min-width: 100%; text-align: center; font-weight: normal; width: auto; position: relative; z-index: 0; margin-top: 20px; border-radius: 24px; line-height: normal; -webkit-box-shadow: 5px 5px 20px rgba(0, 0, 0, 0.2); box-shadow: 5px 5px 20px rgba(0, 0, 0, 0.2); will-change: background-color; -webkit-transition: background-color 0.15s ease-in-out; -o-transition: background-color 0.15s ease-in-out; transition: background-color 0.15s ease-in-out; } @media (min-width: 576px) { .button-wrapper-form { min-width: 168px; } } .button-wrapper-form input[type=submit] { background-color: transparent; border: none; font-size: 14px; font-weight: 600; width: 100%; height: 50px; padding: 12px 25px; text-align: center; color: #fff; will-change: color; -webkit-transition: color 0.15s ease-in-out; -o-transition: color 0.15s ease-in-out; transition: color 0.15s ease-in-out; } .button-wrapper-form:hover { background-color: #000; } .button-wrapper-form:hover input[type=submit] { color: #fff; } .error-msg { font-size: 12px; text-align: center; background-color: #eb0000; color: #fff; max-width: 302px; line-height: 24px; padding: 10px 39px; } @media (min-width: 768px) { .error-msg { max-width: 338px; padding: 13px 29px; } } .success-msg { font-size: 12px; text-align: center; background-color: #28b200; color: #fff; max-width: 302px; line-height: 24px; padding: 10px 39px; } @media (min-width: 768px) { .success-msg { max-width: 338px; padding: 13px 29px; } } h1 { font-size: 32px; line-height: 48px; font-weight: 800; } @media (min-width: 1200px) { h1 { font-size: 48px; line-height: 60px; } } @media (min-width: 1400px) { h1 { font-size: 68px; line-height: 76px; } } h2 { font-size: 28px; line-height: 40px; font-weight: 600px; } @media (min-width: 992px) { h2 { font-size: 40px; line-height: 52px; } } @media (min-width: 1400px) { h2 { font-size: 56px; line-height: 64px; } } h3 { font-size: 24px; line-height: 36px; font-weight: 700; color: #095d40; } @media (min-width: 992px) { h3 { font-size: 28px; line-height: 40px; } } @media (min-width: 1400px) { h3 { font-size: 36px; line-height: 48px; } } h4, .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item span, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_duration, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_now, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .shk-title { font-size: 16px; line-height: 28px; color: #000; font-weight: 600; } @media (min-width: 1400px) { h4, .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item span, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_duration, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_now, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .shk-title { font-size: 20px; line-height: 32px; } } h5 { font-size: 14px; line-height: 20px; color: #000; font-weight: 600; } @media (min-width: 992px) { h5 { font-size: 16px; } } h5.eyebrow-heading, .three-column-section .section-inner-wrp .three-column-wrp .three-column-item-wrp .content-wrapper h5 { font-size: 16px; line-height: 20px; font-weight: 600; } @media (min-width: 992px) { h5.eyebrow-heading, .three-column-section .section-inner-wrp .three-column-wrp .three-column-item-wrp .content-wrapper h5 { font-size: 22px; line-height: 28px; font-weight: 600; } } h1, h2 { color: #074530; } p { margin: 15px 0; } p strong, p b { font-weight: 600; } p:first-child { margin-top: 0; } p:last-child { margin-bottom: 0; } .eyebrow-heading, .three-column-section .section-inner-wrp .three-column-wrp .three-column-item-wrp .content-wrapper h5 { color: #023605; } ol { padding-left: 25px; text-align: left; } ol li { font-size: 16px; line-height: 32px; position: relative; } ol li::marker { font-weight: 600; } ul { padding-left: 25px; text-align: left; } ul li:not(.menu-item, .select2-results__option) { list-style: none; font-size: 16px; line-height: 32px; position: relative; left: -11px; } ul li:not(.menu-item, .select2-results__option)::after { content: ""; background-color: #023605; width: 6px; height: 6px; position: absolute; top: 12px; left: -14px; border-radius: 50%; } ul li:not(.menu-item, .select2-results__option)::marker { display: none; } .comment-list ol { list-style: none; } form .form-item input[type=text], form .form-item input[type=email], form .form-item input[type=tel] { width: 100%; height: 50px; padding: 9px 16px; font-size: 16px; color: #000; background-color: #faf8f6; border: none; border-radius: 10px; margin-top: 10px; outline: none; -webkit-appearance: none; -webkit-box-shadow: none; box-shadow: none; will-change: color, background-color; -webkit-transition: color, background-color 0.15s ease-in-out; -o-transition: color, background-color 0.15s ease-in-out; transition: color, background-color 0.15s ease-in-out; } @media (min-width: 1400px) { form .form-item input[type=text], form .form-item input[type=email], form .form-item input[type=tel] { height: 60px; } } form .form-item input[type=text]::-webkit-input-placeholder, form .form-item input[type=email]::-webkit-input-placeholder, form .form-item input[type=tel]::-webkit-input-placeholder { color: #adb5bd; -webkit-transition: 0.3s; transition: 0.3s; } form .form-item input[type=text]::-moz-placeholder, form .form-item input[type=email]::-moz-placeholder, form .form-item input[type=tel]::-moz-placeholder { color: #adb5bd; -moz-transition: 0.3s; transition: 0.3s; } form .form-item input[type=text]:-ms-input-placeholder, form .form-item input[type=email]:-ms-input-placeholder, form .form-item input[type=tel]:-ms-input-placeholder { color: #adb5bd; -ms-transition: 0.3s; transition: 0.3s; } form .form-item input[type=text]::-ms-input-placeholder, form .form-item input[type=email]::-ms-input-placeholder, form .form-item input[type=tel]::-ms-input-placeholder { color: #adb5bd; -ms-transition: 0.3s; transition: 0.3s; } form .form-item input[type=text]::placeholder, form .form-item input[type=email]::placeholder, form .form-item input[type=tel]::placeholder { color: #adb5bd; -webkit-transition: 0.3s; -o-transition: 0.3s; transition: 0.3s; } form .form-item input[type=text]:focus, form .form-item input[type=text]:focus-visible, form .form-item input[type=email]:focus, form .form-item input[type=email]:focus-visible, form .form-item input[type=tel]:focus, form .form-item input[type=tel]:focus-visible { border: none; outline: none; } form .form-item input[type=text]:focus::-webkit-input-placeholder, form .form-item input[type=text]:focus-visible::-webkit-input-placeholder, form .form-item input[type=email]:focus::-webkit-input-placeholder, form .form-item input[type=email]:focus-visible::-webkit-input-placeholder, form .form-item input[type=tel]:focus::-webkit-input-placeholder, form .form-item input[type=tel]:focus-visible::-webkit-input-placeholder { opacity: 0.6; } form .form-item input[type=text]:focus::-moz-placeholder, form .form-item input[type=text]:focus-visible::-moz-placeholder, form .form-item input[type=email]:focus::-moz-placeholder, form .form-item input[type=email]:focus-visible::-moz-placeholder, form .form-item input[type=tel]:focus::-moz-placeholder, form .form-item input[type=tel]:focus-visible::-moz-placeholder { opacity: 0.6; } form .form-item input[type=text]:focus:-ms-input-placeholder, form .form-item input[type=text]:focus-visible:-ms-input-placeholder, form .form-item input[type=email]:focus:-ms-input-placeholder, form .form-item input[type=email]:focus-visible:-ms-input-placeholder, form .form-item input[type=tel]:focus:-ms-input-placeholder, form .form-item input[type=tel]:focus-visible:-ms-input-placeholder { opacity: 0.6; } form .form-item input[type=text]:focus::-ms-input-placeholder, form .form-item input[type=text]:focus-visible::-ms-input-placeholder, form .form-item input[type=email]:focus::-ms-input-placeholder, form .form-item input[type=email]:focus-visible::-ms-input-placeholder, form .form-item input[type=tel]:focus::-ms-input-placeholder, form .form-item input[type=tel]:focus-visible::-ms-input-placeholder { opacity: 0.6; } form .form-item input[type=text]:focus::placeholder, form .form-item input[type=text]:focus-visible::placeholder, form .form-item input[type=email]:focus::placeholder, form .form-item input[type=email]:focus-visible::placeholder, form .form-item input[type=tel]:focus::placeholder, form .form-item input[type=tel]:focus-visible::placeholder { opacity: 0.6; } form .form-item textarea { width: 100%; height: 100px; padding: 9px 16px; font-size: 16px; color: #000; background: #faf8f6; border: none; border-radius: 10px; margin-top: 10px; outline: none; -webkit-appearance: none; -webkit-box-shadow: none; box-shadow: none; will-change: color, background-color; -webkit-transition: color, background-color 0.15s ease-in-out; -o-transition: color, background-color 0.15s ease-in-out; transition: color, background-color 0.15s ease-in-out; } @media (min-width: 768px) { form .form-item textarea { height: 121px; } } form .form-item textarea::-webkit-input-placeholder { color: #adb5bd; -webkit-transition: 0.3s; transition: 0.3s; } form .form-item textarea::-moz-placeholder { color: #adb5bd; -moz-transition: 0.3s; transition: 0.3s; } form .form-item textarea:-ms-input-placeholder { color: #adb5bd; -ms-transition: 0.3s; transition: 0.3s; } form .form-item textarea::-ms-input-placeholder { color: #adb5bd; -ms-transition: 0.3s; transition: 0.3s; } form .form-item textarea::placeholder { color: #adb5bd; -webkit-transition: 0.3s; -o-transition: 0.3s; transition: 0.3s; } form .form-item textarea:focus, form .form-item textarea:focus-visible { border: none; outline: none; } form .form-item textarea:focus::-webkit-input-placeholder, form .form-item textarea:focus-visible::-webkit-input-placeholder { opacity: 0.6; } form .form-item textarea:focus::-moz-placeholder, form .form-item textarea:focus-visible::-moz-placeholder { opacity: 0.6; } form .form-item textarea:focus:-ms-input-placeholder, form .form-item textarea:focus-visible:-ms-input-placeholder { opacity: 0.6; } form .form-item textarea:focus::-ms-input-placeholder, form .form-item textarea:focus-visible::-ms-input-placeholder { opacity: 0.6; } form .form-item textarea:focus::placeholder, form .form-item textarea:focus-visible::placeholder { opacity: 0.6; } form .form-item .select2-wrapper { position: relative; z-index: 1; } form .form-item .select2-wrapper label { margin-bottom: 5px; } form .form-item .select2-wrapper select { opacity: 0; position: absolute; top: 0; left: 0; width: 100%; height: 100%; margin-top: 0; pointer-events: none; } form .form-item .select2-wrapper .select2::after { content: ""; border: solid #dee2e6; border-width: 0 2px 2px 0; display: inline-block; padding: 4px; -o-transform: rotate(45deg); transform: rotate(45deg); -webkit-transform: rotate(45deg); position: absolute; bottom: 36px; right: 22px; will-change: border-color, transform; -webkit-transition: border-color, transform 0.15s ease-in-out; -o-transition: border-color, transform 0.15s ease-in-out; -webkit-transition: border-color, -webkit-transform 0.15s ease-in-out; transition: border-color, -webkit-transform 0.15s ease-in-out; -o-transition: border-color, -o-transform 0.15s ease-in-out; transition: border-color, transform 0.15s ease-in-out; transition: border-color, transform 0.15s ease-in-out, -webkit-transform 0.15s ease-in-out, -o-transform 0.15s ease-in-out; } form .form-item .select2-wrapper .select2.select2-container--default { min-height: 60px; -webkit-appearance: none; -moz-appearance: none; appearance: none; position: relative; display: block; z-index: 1; width: 100% !important; padding: 9px 16px; font-size: 16px; color: #dee2e6; background: #a49f9f; border: none; -webkit-box-shadow: none; box-shadow: none; outline: none; } form .form-item .select2-wrapper .select2.select2-container--default.select2-container--open::after { content: ""; border: solid #dee2e6; border-width: 0 2px 2px 0; display: inline-block; padding: 4px; position: absolute; bottom: 37px; right: 22px; -o-transform: rotate(225deg); transform: rotate(225deg); -webkit-transform: rotate(225deg); } form .form-item .select2-wrapper .select2 .selection { display: block; width: 100%; height: 60px; } form .form-item .select2-wrapper .select2 .selection .select2-selection.select2-selection--single { width: 100%; height: 100%; padding: 0 10px; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; } form .form-item .select2-wrapper .select2 .selection .select2-selection.select2-selection--single .select2-selection__arrow { display: none; } form .form-item .select2-wrapper .select2-container--open { width: 100%; color: #adb5bd; background: #a49f9f; z-index: 1; will-change: background-color, color; -webkit-transition: background-color, color 0.15s ease-in-out; -o-transition: background-color, color 0.15s ease-in-out; transition: background-color, color 0.15s ease-in-out; } form .form-item .select2-wrapper .select2-container--open::after { display: none; } form .form-item .select2-wrapper .select2-container--open .select2-dropdown .select2-search .select2-search__field { display: none; } form .form-item .select2-wrapper .select2-container--open .select2-dropdown .select2-results .select2-results__options { padding: 0 24px; } form .form-item .select2-wrapper .select2-container--open .select2-dropdown .select2-results .select2-results__options li { padding: 0; font-size: 16px; list-style: none; cursor: pointer; will-change: color; -webkit-transition: color 0.15s ease-in-out; -o-transition: color 0.15s ease-in-out; transition: color 0.15s ease-in-out; } form .form-item .select2-wrapper .select2-container--open .select2-dropdown .select2-results .select2-results__options li::before { display: none; } form .form-item .select2-wrapper .select2-container--open .select2-dropdown .select2-results .select2-results__options li:hover { color: #faf8f6; } form .form-item .wpcf7-checkbox .wpcf7-list-item:first-child { margin-left: 0; } form .form-item .wpcf7-checkbox .wpcf7-list-item label { position: relative; padding-left: 38px; } form .form-item .wpcf7-checkbox .wpcf7-list-item label input { position: absolute; top: 50%; left: 0; cursor: pointer; height: 20px; width: 20px; -webkit-transform: translateY(-50%); -o-transform: translateY(-50%); transform: translateY(-50%); } form .form-item .wpcf7-checkbox .wpcf7-list-item label input::after { content: ""; position: absolute; left: 7px; top: 3px; width: 6px; height: 11px; border: solid #faf8f6; border-width: 0 2px 2px 0; -webkit-transform: rotate(45deg); -o-transform: rotate(45deg); transform: rotate(45deg); display: none; z-index: 0; will-change: border-color; -webkit-transition: border-color 0.15s ease-in-out; -o-transition: border-color 0.15s ease-in-out; transition: border-color 0.15s ease-in-out; } form .form-item .wpcf7-checkbox .wpcf7-list-item label input:checked { color: #dee2e6; } form .form-item .wpcf7-checkbox .wpcf7-list-item label input:checked::after { display: block; } form .form-item .wpcf7-checkbox .wpcf7-list-item label input::before { content: ""; position: absolute; top: 0; left: 0; height: 20px; width: 20px; background-color: #fff; z-index: 0; border: 1px solid #faf8f6; display: block; will-change: border-color, background-color; -webkit-transition: border-color, background-color 0.15s ease-in-out; -o-transition: border-color, background-color 0.15s ease-in-out; transition: border-color, background-color 0.15s ease-in-out; } form .form-item .wpcf7-checkbox .wpcf7-list-item label span { font-size: 16px; color: #dee2e6; will-change: color; -webkit-transition: color 0.15s ease-in-out; -o-transition: color 0.15s ease-in-out; transition: color 0.15s ease-in-out; } form .form-item .wpcf7-radio .wpcf7-list-item:first-child { margin-left: 0; } form .form-item .wpcf7-radio .wpcf7-list-item label { position: relative; padding-left: 30px; } form .form-item .wpcf7-radio .wpcf7-list-item label input { position: absolute; top: 50%; left: 0; cursor: pointer; height: 20px; width: 20px; -webkit-transform: translateY(-50%); -o-transform: translateY(-50%); transform: translateY(-50%); } form .form-item .wpcf7-radio .wpcf7-list-item label input::after { content: ""; position: absolute; left: 4px; top: 4px; width: 12px; height: 12px; display: none; z-index: 0; border-radius: 50%; background: #faf8f6; will-change: border-color, background-color; -webkit-transition: border-color, background-color 0.15s ease-in-out; -o-transition: border-color, background-color 0.15s ease-in-out; transition: border-color, background-color 0.15s ease-in-out; } form .form-item .wpcf7-radio .wpcf7-list-item label input:checked { color: #dee2e6; } form .form-item .wpcf7-radio .wpcf7-list-item label input:checked::after { display: block; } form .form-item .wpcf7-radio .wpcf7-list-item label input::before { content: ""; position: absolute; top: 0; left: 0; height: 20px; width: 20px; background-color: #fff; z-index: 0; border: 1px solid #faf8f6; border-radius: 50%; display: block; will-change: border-color, background-color; -webkit-transition: border-color, background-color 0.15s ease-in-out; -o-transition: border-color, background-color 0.15s ease-in-out; transition: border-color, background-color 0.15s ease-in-out; } form .form-item .wpcf7-radio .wpcf7-list-item label span { font-size: 16px; color: #dee2e6; will-change: color; -webkit-transition: color 0.15s ease-in-out; -o-transition: color 0.15s ease-in-out; transition: color 0.15s ease-in-out; } /** Search form */ form { position: relative; text-align: center; } @media (min-width: 768px) { form { text-align: left; } } form .form-item { margin-bottom: 30px; text-align: left; } form .form-item label { font-size: 16px; line-height: 24px; display: block; margin-bottom: 0; } form .form-item label.checkbox, form .form-item label.radio { line-height: 24px; } form .form-item .wpcf7-form-control-wrap .wpcf7-form-control { margin-top: 15px; } form .wpcf7-not-valid-tip { position: absolute; font-size: 12px; right: 0; top: -70px; color: #eb0000; } form .wpcf7-spinner { display: none; } form .wpcf7-response-output { font-size: 12px; text-align: center; max-width: 302px; line-height: 24px; padding: 10px 39px !important; border: none !important; margin: 20px auto 0 auto !important; } @media (min-width: 768px) { form .wpcf7-response-output { max-width: 338px; padding: 13px 29px !important; position: absolute; bottom: 0; right: 0; margin-bottom: 0 !important; } } @media (min-width: 992px) { form .wpcf7-response-output { position: relative; } } @media (min-width: 1400px) { form .wpcf7-response-output { position: absolute; } } form.invalid .wpcf7-response-output, form.failed .wpcf7-response-output, form.aborted .wpcf7-response-output, form.spam .wpcf7-response-output, form.unaccepted .wpcf7-response-output, form.payment-required .wpcf7-response-output { background-color: #eb0000; color: #fff; } form.sent .wpcf7-response-output { background-color: #28b200; color: #fff; } @media (min-width: 992px) { .modal .modal-dialog { max-width: 930px; margin: 0 auto; } } .modal .modal-dialog .modal-content { background-color: #faf8f6; } .modal .modal-dialog .modal-content .modal-header { border: 0; } .modal .modal-dialog .modal-content .modal-header .close { color: #023605; opacity: 1; font-size: 1.5rem; font-weight: 500; } @media (min-width: 992px) { .modal .modal-dialog .modal-content .modal-header .close { font-size: 2rem; } } .modal .modal-dialog .modal-content .modal-title-wrp { padding-top: 20px; text-align: center; } @media (min-width: 576px) { .modal .modal-dialog .modal-content .modal-title-wrp { padding-top: 50px; } } .modal .modal-dialog .modal-content .modal-title-wrp .modal-title { color: #023605; font-size: 38px; } @media (min-width: 576px) { .modal .modal-dialog .modal-content .modal-title-wrp .modal-title { font-size: 40px; } } @media (min-width: 992px) { .modal .modal-dialog .modal-content .modal-title-wrp .modal-title { font-size: 48px; } } .modal .modal-dialog .modal-content .modal-body p { color: #fff; font-size: 16px; font-weight: normal; line-height: 32px; text-align: center; } @media (min-width: 576px) { .modal .modal-dialog .modal-content .modal-body p { max-width: 350px; margin: 0 auto; font-weight: 600; line-height: 36px; } } @media (min-width: 992px) { .modal .modal-dialog .modal-content .modal-body p { max-width: 700px; margin: 0 auto; } } .modal .modal-dialog .modal-content .modal-footer { border: 0; padding-bottom: 50px; } @media (min-width: 576px) { .modal .modal-dialog .modal-content .modal-footer { max-width: 250px; margin: 0 auto; padding-bottom: 100px; } } /** * WordPress Generated Classes * @see http://codex.wordpress.org/CSS#WordPress_Generated_Classes */ /** Media alignment */ .alignnone { margin-left: 0; margin-right: 0; max-width: 100%; height: auto; } .aligncenter { display: block; margin: 0.5rem auto; height: auto; } .alignleft, .alignright { margin-bottom: 0.5rem; height: auto; } @media (min-width: 576px) { .alignleft { float: left; margin-right: 0.5rem; } .alignright { float: right; margin-left: 0.5rem; } } /** Captions */ /** Text meant only for screen readers */ .search .search-inner-wrp { max-width: 812px; margin: 100px auto; } @media (min-width: 992px) { .search .search-inner-wrp { margin: 150px auto; } } .search .search-inner-wrp .search-form { background-color: #faf8f6; border-radius: 10px; position: relative; z-index: 1; } .search .search-inner-wrp .search-form .search-field { width: 100%; border: none; height: 75px; background-color: transparent; padding: 20px 72px 20px 20px; -webkit-box-shadow: none; box-shadow: none; outline: none; font-size: 20px; font-weight: 700; color: #000; border-radius: 10px; } @media (min-width: 1200px) { .search .search-inner-wrp .search-form .search-field { padding: 20px 224px 20px 92px; } } .search .search-inner-wrp .search-form .search-field::-webkit-input-placeholder { color: #000; } .search .search-inner-wrp .search-form .search-field::-moz-placeholder { color: #000; } .search .search-inner-wrp .search-form .search-field:-ms-input-placeholder { color: #000; } .search .search-inner-wrp .search-form .search-field::-ms-input-placeholder { color: #000; } .search .search-inner-wrp .search-form .search-field::placeholder { color: #000; } .search .search-inner-wrp .search-form .search-field::-webkit-search-decoration, .search .search-inner-wrp .search-form .search-field::-webkit-search-cancel-button, .search .search-inner-wrp .search-form .search-field::-webkit-search-results-button, .search .search-inner-wrp .search-form .search-field::-webkit-search-results-decoration { -webkit-appearance: none; } .search .search-inner-wrp .search-form .clear-icon { display: inline-block; width: 30px; height: 30px; position: absolute; top: 50%; right: 42px; z-index: -1; -webkit-transform: translateY(-50%); -o-transform: translateY(-50%); transform: translateY(-50%); background-color: #fff; border-radius: 50%; opacity: 0; cursor: pointer; will-change: opacity; -webkit-transition: opacity 0.15s ease-in-out; -o-transition: opacity 0.15s ease-in-out; transition: opacity 0.15s ease-in-out; } @media (min-width: 1200px) { .search .search-inner-wrp .search-form .clear-icon { right: 137px; } } .search .search-inner-wrp .search-form .clear-icon::after { content: ""; position: absolute; top: 50%; left: 50%; -webkit-transform: translate(-50%, -50%); -o-transform: translate(-50%, -50%); transform: translate(-50%, -50%); background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSI5LjM5MiIgaGVpZ2h0PSI5LjM5MiIgdmlld0JveD0iMCAwIDkuMzkyIDkuMzkyIj4KICA8ZyBpZD0iR3JvdXBfOTYyMSIgZGF0YS1uYW1lPSJHcm91cCA5NjIxIiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMzE4LjkwOCAtMjkuNDU0KSI+CiAgICA8ZyBpZD0iR3JvdXBfOTMzMiIgZGF0YS1uYW1lPSJHcm91cCA5MzMyIiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgzMTkuOTUxIDI5LjQ1NCkgcm90YXRlKDQ1KSI+CiAgICAgIDxnIGlkPSJNb2JpbGVfTWVudSIgZGF0YS1uYW1lPSJNb2JpbGUgTWVudSIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoMCAwKSI+CiAgICAgICAgPGcgaWQ9Ikdyb3VwXzkyNTkiIGRhdGEtbmFtZT0iR3JvdXAgOTI1OSI+CiAgICAgICAgICA8cmVjdCBpZD0iUmVjdGFuZ2xlXzE1MTQiIGRhdGEtbmFtZT0iUmVjdGFuZ2xlIDE1MTQiIHdpZHRoPSIxMS44MDYiIGhlaWdodD0iMS40NzYiIGZpbGw9IiMwMjM2MDUiLz4KICAgICAgICA8L2c+CiAgICAgIDwvZz4KICAgIDwvZz4KICAgIDxnIGlkPSJHcm91cF85NjE4IiBkYXRhLW5hbWU9Ikdyb3VwIDk2MTgiIHRyYW5zZm9ybT0idHJhbnNsYXRlKDMxOC45MDggMzcuODAyKSByb3RhdGUoLTQ1KSI+CiAgICAgIDxnIGlkPSJNb2JpbGVfTWVudS0yIiBkYXRhLW5hbWU9Ik1vYmlsZSBNZW51IiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgwKSI+CiAgICAgICAgPGcgaWQ9Ikdyb3VwXzkyNTktMiIgZGF0YS1uYW1lPSJHcm91cCA5MjU5Ij4KICAgICAgICAgIDxyZWN0IGlkPSJSZWN0YW5nbGVfMTUxNC0yIiBkYXRhLW5hbWU9IlJlY3RhbmdsZSAxNTE0IiB3aWR0aD0iMTEuODA2IiBoZWlnaHQ9IjEuNDc2IiBmaWxsPSIjMDIzNjA1Ii8+CiAgICAgICAgPC9nPgogICAgICA8L2c+CiAgICA8L2c+CiAgPC9nPgo8L3N2Zz4K); background-position: center center; background-repeat: no-repeat; background-size: contain; width: 9px; height: 9px; } .search .search-inner-wrp .search-form.show .clear-icon { opacity: 1; z-index: 1; } .search .search-inner-wrp .search-form::after { content: ""; position: absolute; top: 50%; right: 14px; z-index: -1; -webkit-transform: translateY(-50%); -o-transform: translateY(-50%); transform: translateY(-50%); background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIxNi41NjQiIGhlaWdodD0iMTYuNTY0IiB2aWV3Qm94PSIwIDAgMTYuNTY0IDE2LjU2NCI+CiAgPGcgaWQ9Ikljb25fZmVhdGhlci1zZWFyY2giIGRhdGEtbmFtZT0iSWNvbiBmZWF0aGVyLXNlYXJjaCIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoLTMuNSAtMy41KSI+CiAgICA8cGF0aCBpZD0iUGF0aF8xNzk4NCIgZGF0YS1uYW1lPSJQYXRoIDE3OTg0IiBkPSJNMTUuNDE2LDkuOTU4QTUuNDU4LDUuNDU4LDAsMSwxLDkuOTU4LDQuNSw1LjQ1OCw1LjQ1OCwwLDAsMSwxNS40MTYsOS45NThaIiBmaWxsPSJub25lIiBzdHJva2U9IiMwMjM2MDUiIHN0cm9rZS1saW5lY2FwPSJyb3VuZCIgc3Ryb2tlLWxpbmVqb2luPSJyb3VuZCIgc3Ryb2tlLXdpZHRoPSIyIi8+CiAgICA8cGF0aCBpZD0iUGF0aF8xNzk4NSIgZGF0YS1uYW1lPSJQYXRoIDE3OTg1IiBkPSJNMjkuODEzLDI5LjgxM2wtNC44MzgtNC44MzgiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0xMS4xNjIgLTExLjE2MikiIGZpbGw9Im5vbmUiIHN0cm9rZT0iIzAyMzYwNSIgc3Ryb2tlLWxpbmVjYXA9InJvdW5kIiBzdHJva2UtbGluZWpvaW49InJvdW5kIiBzdHJva2Utd2lkdGg9IjIiLz4KICA8L2c+Cjwvc3ZnPgo=); background-position: center center; background-repeat: no-repeat; background-size: contain; width: 18px; height: 18px; } @media (min-width: 1200px) { .search .search-inner-wrp .search-form::after { right: 92px; } } .search .search-inner-wrp .search-item-wrp { margin-top: 55px; } .search .search-inner-wrp .search-item-wrp .search-result-item-wrp { margin-bottom: 30px; } .search .search-inner-wrp .search-item-wrp .search-result-item-wrp:last-child { margin-bottom: 0; } .search .search-inner-wrp .search-item-wrp .search-result-item-wrp .search-result-item a { text-decoration: none; } .accordion-section { position: relative; } .accordion-section .section-inner-wrp { max-width: 904px; margin: 0 auto; } @media (min-width: 1400px) { .accordion-section .section-inner-wrp { max-width: 1364px; } } .accordion-section .section-inner-wrp .intro-content { max-width: 536px; margin: 0 auto 40px auto; text-align: center; } @media (min-width: 992px) { .accordion-section .section-inner-wrp .intro-content { margin: 0 auto 60px auto; } } @media (min-width: 1400px) { .accordion-section .section-inner-wrp .intro-content { margin: 0 auto 100px auto; max-width: 100%; } } .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp { margin: 20px 0; background-color: #faf8f6; border-radius: 10px; } @media (min-width: 992px) { .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp { margin: 30px 0; } } @media (min-width: 1400px) { .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp { margin: 46px 0; } } .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp:first-child { margin-top: 0; } .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp:last-child { margin-bottom: 0; } .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp .faq-title { position: relative; cursor: pointer; padding: 30px 30px 30px 20px; } @media (min-width: 992px) { .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp .faq-title { padding: 15px 50px 15px 30px; } } @media (min-width: 1400px) { .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp .faq-title { padding: 21px 70px 21px 40px; } } .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp .faq-title * { font-weight: 600; margin: 0; color: #000; } .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp .faq-title .accord-icon { position: absolute; top: 50%; right: 15px; width: 14px; height: 12px; -webkit-transform: translateY(-50%); -o-transform: translateY(-50%); transform: translateY(-50%); } @media (min-width: 992px) { .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp .faq-title .accord-icon { right: 30px; } } @media (min-width: 1400px) { .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp .faq-title .accord-icon { right: 45px; } } .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp .faq-title .accord-icon::after { content: ""; position: absolute; top: 0; left: 0; background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyMSIgaGVpZ2h0PSIxOCIgdmlld0JveD0iMCAwIDIxIDE4Ij4KICA8cGF0aCBpZD0iUG9seWdvbl8zMSIgZGF0YS1uYW1lPSJQb2x5Z29uIDMxIiBkPSJNOS42MzYsMS40ODFhMSwxLDAsMCwxLDEuNzI4LDBMMjAuMTIzLDE2LjVhMSwxLDAsMCwxLS44NjQsMS41SDEuNzQxYTEsMSwwLDAsMS0uODY0LTEuNVoiIHRyYW5zZm9ybT0idHJhbnNsYXRlKDIxIDE4KSByb3RhdGUoMTgwKSIgZmlsbD0iI0E0OUY5RiIvPgo8L3N2Zz4K); background-size: cover; background-repeat: no-repeat; width: 100%; height: 100%; -webkit-transform: rotate(180deg); -o-transform: rotate(180deg); transform: rotate(180deg); will-change: transform; -webkit-transition: transform 0.15s ease-in-out; -o-transition: transform 0.15s ease-in-out; -webkit-transition: -webkit-transform 0.15s ease-in-out; transition: -webkit-transform 0.15s ease-in-out; -o-transition: -o-transform 0.15s ease-in-out; transition: transform 0.15s ease-in-out; transition: transform 0.15s ease-in-out, -webkit-transform 0.15s ease-in-out, -o-transform 0.15s ease-in-out; } .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp .faq-title.collapsed .accord-icon::after { content: ""; -webkit-transform: rotate(0deg); -o-transform: rotate(0deg); transform: rotate(0deg); } .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp .faq-content .faq-content-inner-wrp { padding: 0 30px 30px 20px; } @media (min-width: 992px) { .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp .faq-content .faq-content-inner-wrp { padding: 0 50px 15px 30px; } } @media (min-width: 1400px) { .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp .faq-content .faq-content-inner-wrp { padding: 0 70px 21px 40px; } } .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp .faq-content .faq-content-inner-wrp .button-wrapper { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; -ms-flex-wrap: wrap; flex-wrap: wrap; -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; gap: 15px; margin-top: 25px; } @media (min-width: 768px) { .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp .faq-content .faq-content-inner-wrp .button-wrapper { margin-top: 35px; } } @media (min-width: 992px) { .accordion-section .section-inner-wrp .accordion-wrp .accordion-item-wrp .faq-content .faq-content-inner-wrp .button-wrapper { max-width: 571px; -webkit-box-pack: start; -ms-flex-pack: start; justify-content: flex-start; } } .accordion-section .animation-wrp { display: none; position: absolute; width: 100%; height: 100%; top: 0; left: 0; z-index: -1; overflow: hidden; } .accordion-section .animation-wrp .circle-object { top: 10%; left: 10%; } .accordion-section .animation-wrp .circle-object:first-child { bottom: 30%; right: 10%; top: auto; left: auto; } .accordion-section .animation-wrp .triangle-object { bottom: 20px; left: 0; } .accordion-section + .accordion-section .animation-wrp { display: none; } .accordion-section + .accordion-section .animation-wrp .circle-object { bottom: 10%; right: 10%; top: auto; left: auto; } .accordion-section + .accordion-section .animation-wrp .circle-object:first-child { top: 30%; left: 10%; bottom: auto; right: auto; } .accordion-section + .accordion-section .animation-wrp .triangle-object { top: 20px; right: 0; bottom: auto; left: auto; } .banner-section { min-height: 270px; padding: 68px 0 25px 0; position: relative; z-index: 4; background-color: #faf8f6; width: 100%; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; } @media (min-width: 992px) { .banner-section { min-height: 300px; padding: 133px 0 37px 0; } } @media (min-width: 1400px) { .banner-section { min-height: 470px; padding: 157px 0 50px 0; } } .banner-section header, .banner-section .sticky-overlay, .banner-section .mobile-menu { display: none; } .banner-section > header { position: relative; } .sticky-header .banner-section > header { background-color: #faf8f6; } .banner-section h2, .banner-section h1 { color: #023605; text-align: center; z-index: 1; } .banner-section .animation-wrp { display: none; } .banner-section .animation-wrp .circle-object:first-child { top: 40px; left: -30px; } @media (min-width: 992px) { .banner-section .animation-wrp .circle-object:first-child { top: 55px; left: 70px; } } @media (min-width: 1400px) { .banner-section .animation-wrp .circle-object:first-child { top: 120px; left: 50px; } } .banner-section .animation-wrp .circle-object:nth-child(2) { top: 170px; right: 40px; -webkit-animation-delay: 1s; -o-animation-delay: 1s; animation-delay: 1s; } @media (min-width: 992px) { .banner-section .animation-wrp .circle-object:nth-child(2) { top: 150px; right: 70px; } } @media (min-width: 1400px) { .banner-section .animation-wrp .circle-object:nth-child(2) { top: 250px; right: 50px; } } .banner-section .animation-wrp .triangle-object:nth-child(3) { top: 40px; left: auto; right: 25px; } @media (min-width: 992px) { .banner-section .animation-wrp .triangle-object:nth-child(3) { top: 130px; left: 250px; } } @media (min-width: 1400px) { .banner-section .animation-wrp .triangle-object:nth-child(3) { top: 240px; left: 300px; } } .banner-section .animation-wrp .triangle-object:nth-child(4) { -webkit-animation-delay: 1s; -o-animation-delay: 1s; animation-delay: 1s; display: none; } @media (min-width: 992px) { .banner-section .animation-wrp .triangle-object:nth-child(4) { top: 20px; right: 260px; display: block; } } @media (min-width: 1400px) { .banner-section .animation-wrp .triangle-object:nth-child(4) { top: 60px; right: 340px; } } .cards-section { overflow: hidden; } .cards-section .section-inner-wrp { max-width: 1286px; margin: 0 auto; } .cards-section .section-inner-wrp .intro-content { text-align: center; margin-bottom: 40px; } @media (min-width: 768px) { .cards-section .section-inner-wrp .intro-content { margin-bottom: 50px; } } .cards-section .section-inner-wrp .cards-wrp { display: block; margin: -10px -8px; outline: none; } @media (min-width: 992px) { .cards-section .section-inner-wrp .cards-wrp { display: -webkit-box; display: -ms-flexbox; display: flex; margin: -10px -35px; } } @media (min-width: 1400px) { .cards-section .section-inner-wrp .cards-wrp { margin: -20px -80px; } } .cards-section .section-inner-wrp .cards-wrp::after { content: "flickity"; display: none; } @media (min-width: 992px) { .cards-section .section-inner-wrp .cards-wrp::after { content: ""; } } .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp { text-align: center; padding: 10px 8px; } @media (min-width: 992px) { .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; -webkit-box-align: center; -ms-flex-align: center; align-items: center; padding: 10px 35px; } } @media (min-width: 1400px) { .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp { padding: 20px 80px; } } .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp .cards-item-inner-wrp { min-height: 100%; border: 1px solid #faf8f6; border-radius: 10px; padding: 40px; } @media (min-width: 992px) { .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp .cards-item-inner-wrp { padding: 0; border-radius: 0; border: none; } } .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp .cards-item-inner-wrp .image-wrapper { position: relative; width: 200px; height: 200px; margin: 0 auto 30px auto; } @media (min-width: 1400px) { .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp .cards-item-inner-wrp .image-wrapper { width: 328px; height: 328px; margin: 0 auto 55px auto; } } .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp .cards-item-inner-wrp .image-wrapper .img-wrp-inner { -webkit-filter: url(#round-corners); filter: url(#round-corners); width: 100%; height: 100%; } .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp .cards-item-inner-wrp .image-wrapper .img-wrp-inner img { clip-path: polygon(50% 0%, 100% 50%, 50% 100%, 0% 50%); height: 100%; -o-object-fit: cover; object-fit: cover; -o-object-position: top; object-position: top; } .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp .cards-item-inner-wrp .image-wrapper .img-bg { width: 100%; height: 100%; -webkit-filter: url(#round-corners); filter: url(#round-corners); position: absolute; top: 0; left: 0; z-index: -1; } .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp .cards-item-inner-wrp .image-wrapper .img-bg::after { display: none; content: ""; position: absolute; width: 100%; height: 100%; background: #faf8f6; top: 0; left: 0; clip-path: polygon(50% 0%, 100% 50%, 50% 100%, 0% 50%); -webkit-animation: threecardbg 8s infinite alternate; -o-animation: threecardbg 8s infinite alternate; animation: threecardbg 8s infinite alternate; } @-webkit-keyframes threecardbg { 0% { -webkit-transform: rotate(15deg); transform: rotate(15deg); } 100% { -webkit-transform: rotate(-15deg); transform: rotate(-15deg); } } @-o-keyframes threecardbg { 0% { -o-transform: rotate(15deg); transform: rotate(15deg); } 100% { -o-transform: rotate(-15deg); transform: rotate(-15deg); } } @keyframes threecardbg { 0% { -webkit-transform: rotate(15deg); -o-transform: rotate(15deg); transform: rotate(15deg); } 100% { -webkit-transform: rotate(-15deg); -o-transform: rotate(-15deg); transform: rotate(-15deg); } } .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp .cards-item-inner-wrp .content-wrapper { max-width: 320px; margin: 0 auto; } @media (min-width: 992px) { .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp .cards-item-inner-wrp .content-wrapper { max-width: 100%; } } .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp .cards-item-inner-wrp .content-wrapper p { margin-top: 0; line-height: 24px; } .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp .cards-item-inner-wrp .content-wrapper .button-wrapper { margin-top: 45px; } .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp:nth-child(2n) .cards-item-inner-wrp .image-wrapper .img-bg::after { -webkit-animation-delay: 2s; -o-animation-delay: 2s; animation-delay: 2s; } .cards-section .section-inner-wrp .cards-wrp .cards-item-wrp:nth-child(3n) .cards-item-inner-wrp .image-wrapper .img-bg::after { -webkit-animation-delay: 4s; -o-animation-delay: 4s; animation-delay: 4s; } .cards-section .section-inner-wrp .cards-wrp.flickity-resize .cards-item-wrp { min-height: 100%; } .cards-section .section-inner-wrp .cards-wrp .flickity-slider { position: absolute; width: 100%; height: 100%; } .cards-section .section-inner-wrp .cards-wrp .flickity-viewport { position: relative; height: 100%; } .cta-section { text-align: center; } .cta-section .section-inner-wrp { background-color: #faf8f6; padding: 100px 36px; margin: 0 -36px; position: relative; z-index: 0; } @media (min-width: 576px) { .cta-section .section-inner-wrp { margin: 0; border-radius: 20px; } } @media (min-width: 992px) { .cta-section .section-inner-wrp { padding: 120px 36px; } } @media (min-width: 1400px) { .cta-section .section-inner-wrp { padding: 180px 36px; } } .cta-section .section-inner-wrp .content-section .intro-content { max-width: 812px; margin: 0 auto; } .cta-section .section-inner-wrp .content-section .other-content { margin: 0 -36px; } @media (min-width: 576px) { .cta-section .section-inner-wrp .content-section .other-content { margin: 0; } } .cta-section .section-inner-wrp .content-section .other-content *:not(figure, img, figcaption, .image-wrapper, a, .btn, b, strong) { max-width: 812px; margin: 0 auto 40px auto; padding: 0 36px; } @media (min-width: 576px) { .cta-section .section-inner-wrp .content-section .other-content *:not(figure, img, figcaption, .image-wrapper, a, .btn, b, strong) { padding: 0; } } @media (min-width: 768px) { .cta-section .section-inner-wrp .content-section .other-content *:not(figure, img, figcaption, .image-wrapper, a, .btn, b, strong) { margin: 0 auto 50px auto; } } .cta-section .section-inner-wrp .content-section .other-content *:not(figure, img, figcaption, .image-wrapper, a, .btn, b, strong) > b, .cta-section .section-inner-wrp .content-section .other-content *:not(figure, img, figcaption, .image-wrapper, a, .btn, b, strong) > strong { color: #023605; font-weight: 500; } .cta-section .section-inner-wrp .content-section .other-content .button-wrapper { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; -ms-flex-wrap: wrap; flex-wrap: wrap; -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; gap: 15px; margin-bottom: 0; } .cta-section .section-inner-wrp .animation-wrp { display: none; position: absolute; width: 100%; height: 100%; top: 0; left: 0; z-index: -1; overflow: hidden; } .cta-section .section-inner-wrp .animation-wrp .circle-object { top: 10%; right: 10%; } .cta-section .section-inner-wrp .animation-wrp .circle-solid-object { bottom: 10%; left: 10%; } .form-section { position: relative; } .form-section .section-inner-wrp { max-width: 1088px; margin: 0 auto; } @media (min-width: 1400px) { .form-section .section-inner-wrp { max-width: 1364px; } } .form-section .section-inner-wrp .form-wrp { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; } .form-section .section-inner-wrp .form-wrp .item-wrapper-outer .image-wrapper { margin-bottom: 40px; margin-left: -36px; margin-right: -36px; } @media (min-width: 768px) { .form-section .section-inner-wrp .form-wrp .item-wrapper-outer .image-wrapper { margin-left: 0; margin-right: 0; } } @media (min-width: 768px) { .form-section .section-inner-wrp .form-wrp .item-wrapper-outer .image-wrapper { margin: 0 auto 80px auto; } } @media (min-width: 1200px) { .form-section .section-inner-wrp .form-wrp .item-wrapper-outer .image-wrapper { margin-bottom: 0; } } .form-section .section-inner-wrp .form-wrp .item-wrapper-outer .image-wrapper img { border-radius: 0; } @media (min-width: 576px) { .form-section .section-inner-wrp .form-wrp .item-wrapper-outer .image-wrapper img { border-radius: 10px; } } @media (min-width: 1200px) { .form-section .section-inner-wrp .form-wrp .item-wrapper-outer .section-content { max-width: 444px; margin-left: auto; } } @media (min-width: 1400px) { .form-section .section-inner-wrp .form-wrp .item-wrapper-outer .section-content { max-width: 536px; } } @media (min-width: 992px) { .form-section .section-inner-wrp .form-wrp .item-wrapper-outer .section-content h2 { margin-bottom: 30px; } } @media (min-width: 1400px) { .form-section .section-inner-wrp .form-wrp .item-wrapper-outer .section-content h2 { margin-bottom: 50px; } } @media (min-width: 1200px) { .form-section .section-inner-wrp .form-wrp .item-wrapper-outer .form-wrapper { max-width: 444px; margin-left: auto; } } @media (min-width: 1400px) { .form-section .section-inner-wrp .form-wrp .item-wrapper-outer .form-wrapper { max-width: 536px; } } .form-section .section-inner-wrp .form-wrp .item-wrapper-outer .form-wrapper .form-btn { margin: 0 -36px; } @media (min-width: 768px) { .form-section .section-inner-wrp .form-wrp .item-wrapper-outer .form-wrapper .form-btn { margin: 0; } } .form-section .animation-wrp { display: none; position: absolute; width: 100%; height: 100%; top: 0; left: 0; z-index: -1; overflow: hidden; } .form-section .animation-wrp .circle-solid-object { left: 0; bottom: 0; } .form-section .animation-wrp .triangle-object { top: 20px; right: 0; } .full-width-slider-section { overflow: hidden; } .full-width-slider-section .slider-wrp .row { margin: 0 -8px; outline: 0; position: relative; } .full-width-slider-section .slider-wrp .row a { text-decoration: none; } .full-width-slider-section .slider-wrp .row a .slider-item-wrp { margin: 0 8px; -webkit-box-shadow: 5px 5px 30px rgba(0, 0, 0, 0.0509803922); box-shadow: 5px 5px 30px rgba(0, 0, 0, 0.0509803922); height: 100%; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; will-change: border; -webkit-transition: border 0.15s ease-in-out; -o-transition: border 0.15s ease-in-out; transition: border 0.15s ease-in-out; } .full-width-slider-section .slider-wrp .row a .slider-item-wrp .img-wrp img { height: 300px; -o-object-fit: cover; object-fit: cover; } .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp { padding: 36px; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; height: 100%; } .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp * { text-decoration: none; } .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp *:first-child { -webkit-box-flex: 1; -ms-flex-positive: 1; flex-grow: 1; } .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp h1, .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp h2, .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp h3, .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp h4, .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item span, .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp span, .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_duration, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp .shk-time_duration, .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_now, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp .shk-time_now, .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .shk-title, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp .shk-title, .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp h5 { color: #faf8f6; will-change: color; -webkit-transition: color 0.15s ease-in-out; -o-transition: color 0.15s ease-in-out; transition: color 0.15s ease-in-out; } .full-width-slider-section .slider-wrp .row a .slider-item-wrp .content-wrp p { color: #adb5bd; will-change: color; -webkit-transition: color 0.15s ease-in-out; -o-transition: color 0.15s ease-in-out; transition: color 0.15s ease-in-out; } .full-width-slider-section .slider-wrp .row a:hover .slider-item-wrp .content-wrp .btn-posts { background-color: #faf8f6; color: #fff; } .full-width-slider-section .slider-wrp .row .flickity-button { width: 40px; height: 40px; border: none; background-color: #023605; margin-top: 40px; position: relative; display: none; will-change: background-color; -webkit-transition: background-color 0.15s ease-in-out; -o-transition: background-color 0.15s ease-in-out; transition: background-color 0.15s ease-in-out; } @media (min-width: 768px) { .full-width-slider-section .slider-wrp .row .flickity-button { position: absolute; top: -138px; right: 0; margin-top: 0; display: block; } } .full-width-slider-section .slider-wrp .row .flickity-button::after { content: ""; background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNS4wNyIgaGVpZ2h0PSIxMi43MjQiIHZpZXdCb3g9IjAgMCAyNS4wNyAxMi43MjQiPgogIDxnIGlkPSJHcm91cF8zNzc5IiBkYXRhLW5hbWU9Ikdyb3VwIDM3NzkiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC01MTAgLTQ1NDYuNjM3KSI+CiAgICA8bGluZSBpZD0iTGluZV81MyIgZGF0YS1uYW1lPSJMaW5lIDUzIiB4Mj0iMjMiIHRyYW5zZm9ybT0idHJhbnNsYXRlKDUxMCA0NTUzKSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSIjMDIzNjA1IiBzdHJva2Utd2lkdGg9IjIiLz4KICAgIDxwYXRoIGlkPSJQYXRoXzYyNDEiIGRhdGEtbmFtZT0iUGF0aCA2MjQxIiBkPSJNMCwwSDhWOCIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoNTI4LjAwMSA0NTQ3LjM0NCkgcm90YXRlKDQ1KSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSIjMDIzNjA1IiBzdHJva2Utd2lkdGg9IjIiLz4KICA8L2c+Cjwvc3ZnPgo=); background-repeat: no-repeat; background-size: cover; width: 15px; height: 8px; display: block; position: absolute; top: 50%; left: 50%; -webkit-transform: translate(-50%, -50%); -o-transform: translate(-50%, -50%); transform: translate(-50%, -50%); will-change: background-image; -webkit-transition: background-image 0.15s ease-in-out; -o-transition: background-image 0.15s ease-in-out; transition: background-image 0.15s ease-in-out; } .full-width-slider-section .slider-wrp .row .flickity-button:disabled { background-color: #fff; } .full-width-slider-section .slider-wrp .row .flickity-button:hover { background-color: #faf8f6; } .full-width-slider-section .slider-wrp .row .flickity-button:hover:disabled { background-color: #faf8f6; } .full-width-slider-section .slider-wrp .row .flickity-button:hover::after { background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNS4wNyIgaGVpZ2h0PSIxMi43MjQiIHZpZXdCb3g9IjAgMCAyNS4wNyAxMi43MjQiPgogIDxnIGlkPSJHcm91cF8zNzc5IiBkYXRhLW5hbWU9Ikdyb3VwIDM3NzkiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC01MTAgLTQ1NDYuNjM3KSI+CiAgICA8bGluZSBpZD0iTGluZV81MyIgZGF0YS1uYW1lPSJMaW5lIDUzIiB4Mj0iMjMiIHRyYW5zZm9ybT0idHJhbnNsYXRlKDUxMCA0NTUzKSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSIjZmZmIiBzdHJva2Utd2lkdGg9IjIiLz4KICAgIDxwYXRoIGlkPSJQYXRoXzYyNDEiIGRhdGEtbmFtZT0iUGF0aCA2MjQxIiBkPSJNMCwwSDhWOCIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoNTI4LjAwMSA0NTQ3LjM0NCkgcm90YXRlKDQ1KSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSIjZmZmIiBzdHJva2Utd2lkdGg9IjIiLz4KICA8L2c+Cjwvc3ZnPgo=); } @media (min-width: 768px) { .full-width-slider-section .slider-wrp .row .flickity-button.previous { right: 40px; } } .full-width-slider-section .slider-wrp .row .flickity-button.previous::after { -webkit-transform: translate(-50%, -50%) rotate(180deg); -o-transform: translate(-50%, -50%) rotate(180deg); transform: translate(-50%, -50%) rotate(180deg); } .full-width-slider-section .slider-wrp .row .flickity-button svg { display: none; } .full-width-slider-section .slider-wrp .row .flickity-page-dots { list-style: none; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; gap: 8px; margin-top: 50px; } @media (min-width: 768px) { .full-width-slider-section .slider-wrp .row .flickity-page-dots { display: none; } } .full-width-slider-section .slider-wrp .row .flickity-page-dots li { width: 10px; height: 10px; background-color: #faf8f6; border-radius: 50%; will-change: background-color; -webkit-transition: background-color 0.15s ease-in-out; -o-transition: background-color 0.15s ease-in-out; transition: background-color 0.15s ease-in-out; } .full-width-slider-section .slider-wrp .row .flickity-page-dots li.is-selected { background-color: #023605; } .gallery-section { overflow: hidden; position: relative; } .gallery-section .intro-content { margin-bottom: 40px; } @media (min-width: 768px) { .gallery-section .intro-content { margin-bottom: 50px; } } .gallery-section .gallery-wrapper { outline: 0; position: relative; } @media (min-width: 992px) { .gallery-section .gallery-wrapper { margin: -8px; display: -webkit-box; display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; } } .gallery-section .gallery-wrapper::after { content: "flickity"; display: none; } @media (min-width: 992px) { .gallery-section .gallery-wrapper::after { content: ""; } } .gallery-section .gallery-wrapper .gallery-item { margin: 8px; width: 100%; } @media (min-width: 768px) { .gallery-section .gallery-wrapper .gallery-item { width: 50%; } } @media (min-width: 992px) { .gallery-section .gallery-wrapper .gallery-item { -webkit-box-flex: 1; -ms-flex: 1 0 20%; flex: 1 0 20%; max-width: 164px; } } @media (min-width: 1400px) { .gallery-section .gallery-wrapper .gallery-item { -webkit-box-flex: 1; -ms-flex: 1 0 15%; flex: 1 0 15%; max-width: 260px; } } .gallery-section .gallery-wrapper .gallery-item img { -o-object-fit: cover; object-fit: cover; height: 67.2vw; border-radius: 10px; } @media (min-width: 768px) { .gallery-section .gallery-wrapper .gallery-item img { height: 324px; } } @media (min-width: 992px) { .gallery-section .gallery-wrapper .gallery-item img { height: 160px; } } @media (min-width: 1400px) { .gallery-section .gallery-wrapper .gallery-item img { height: 260px; } } .gallery-section .gallery-wrapper .flickity-button { width: 40px; height: 40px; border: none; border-radius: 50%; background-color: #faf8f6; margin-top: 40px; position: relative; will-change: background-color; -webkit-transition: background-color 0.15s ease-in-out; -o-transition: background-color 0.15s ease-in-out; transition: background-color 0.15s ease-in-out; } .gallery-section .gallery-wrapper .flickity-button::after { content: ""; background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNS4wNyIgaGVpZ2h0PSIxMi43MjQiIHZpZXdCb3g9IjAgMCAyNS4wNyAxMi43MjQiPgogIDxnIGlkPSJHcm91cF8zNzc5IiBkYXRhLW5hbWU9Ikdyb3VwIDM3NzkiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC01MTAgLTQ1NDYuNjM3KSI+CiAgICA8bGluZSBpZD0iTGluZV81MyIgZGF0YS1uYW1lPSJMaW5lIDUzIiB4Mj0iMjMiIHRyYW5zZm9ybT0idHJhbnNsYXRlKDUxMCA0NTUzKSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSIjMDIzNjA1IiBzdHJva2Utd2lkdGg9IjIiLz4KICAgIDxwYXRoIGlkPSJQYXRoXzYyNDEiIGRhdGEtbmFtZT0iUGF0aCA2MjQxIiBkPSJNMCwwSDhWOCIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoNTI4LjAwMSA0NTQ3LjM0NCkgcm90YXRlKDQ1KSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSIjMDIzNjA1IiBzdHJva2Utd2lkdGg9IjIiLz4KICA8L2c+Cjwvc3ZnPgo=); background-repeat: no-repeat; background-size: cover; width: 16px; height: 8px; display: block; position: absolute; top: 50%; left: 50%; -webkit-transform: translate(-50%, -50%); -o-transform: translate(-50%, -50%); transform: translate(-50%, -50%); will-change: background-image; -webkit-transition: background-image 0.15s ease-in-out; -o-transition: background-image 0.15s ease-in-out; transition: background-image 0.15s ease-in-out; } .gallery-section .gallery-wrapper .flickity-button:disabled { background-color: #fff; } .gallery-section .gallery-wrapper .flickity-button:hover { background-color: #023605; } .gallery-section .gallery-wrapper .flickity-button:hover:disabled { background-color: #023605; } .gallery-section .gallery-wrapper .flickity-button:hover::after { background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNS4wNyIgaGVpZ2h0PSIxMi43MjQiIHZpZXdCb3g9IjAgMCAyNS4wNyAxMi43MjQiPgogIDxnIGlkPSJHcm91cF8zNzc5IiBkYXRhLW5hbWU9Ikdyb3VwIDM3NzkiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC01MTAgLTQ1NDYuNjM3KSI+CiAgICA8bGluZSBpZD0iTGluZV81MyIgZGF0YS1uYW1lPSJMaW5lIDUzIiB4Mj0iMjMiIHRyYW5zZm9ybT0idHJhbnNsYXRlKDUxMCA0NTUzKSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSIjZmZmIiBzdHJva2Utd2lkdGg9IjIiLz4KICAgIDxwYXRoIGlkPSJQYXRoXzYyNDEiIGRhdGEtbmFtZT0iUGF0aCA2MjQxIiBkPSJNMCwwSDhWOCIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoNTI4LjAwMSA0NTQ3LjM0NCkgcm90YXRlKDQ1KSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSIjZmZmIiBzdHJva2Utd2lkdGg9IjIiLz4KICA8L2c+Cjwvc3ZnPgo=); } .gallery-section .gallery-wrapper .flickity-button.previous { margin-right: 10px; } .gallery-section .gallery-wrapper .flickity-button.previous::after { -webkit-transform: translate(-50%, -50%) rotate(180deg); -o-transform: translate(-50%, -50%) rotate(180deg); transform: translate(-50%, -50%) rotate(180deg); } .gallery-section .gallery-wrapper .flickity-button svg { display: none; } .gallery-section .button-wrapper { margin-top: 50px; } .gallery-section .animation-wrp { display: none; position: absolute; width: 100%; height: 100%; top: 0; left: 0; z-index: -1; overflow: hidden; } .gallery-section .animation-wrp .triangle-object { top: 10%; right: 0; } .gallery-section .animation-wrp .triangle-object:first-child { left: 0; bottom: 10%; top: auto; right: auto; } .one-column-section { text-align: center; position: relative; } .one-column-section img { border-radius: 10px; } .single-post .one-column-section, .single-events .one-column-section { padding: 25px 0 !important; } .single-post .one-column-section .wp-caption, .single-events .one-column-section .wp-caption { margin: 25px -36px 15px 0 !important; } .one-column-section .content-section { text-align: center; } .single-post .one-column-section .content-section, .single-events .one-column-section .content-section { max-width: 1164px; margin: 0 auto; } .one-column-section .content-section .intro-content { max-width: 720px; margin: 0 auto; } @media (min-width: 1400px) { .one-column-section .content-section .intro-content { max-width: 812px; } } .one-column-section .content-section .other-content { margin: 0 -36px; } .one-column-section .content-section .other-content ul { margin-left: -32px; } .one-column-section .content-section .other-content ul li { left: 15px; } .one-column-section .content-section .other-content ol { margin-left: -32px; } .one-column-section .content-section .other-content ol li { left: 18px; } @media (min-width: 576px) { .one-column-section .content-section .other-content { margin: 0; } } .one-column-section .content-section .other-content img { width: auto; } .single-post .one-column-section .content-section .other-content img, .single-events .one-column-section .content-section .other-content img { -o-object-fit: cover; object-fit: cover; } .one-column-section .content-section .other-content *:not(figure, img, figcaption, .image-wrapper, a, .button-wrapper) { max-width: 720px; margin: 0 auto; padding: 0 36px; } @media (min-width: 576px) { .one-column-section .content-section .other-content *:not(figure, img, figcaption, .image-wrapper, a, .button-wrapper) { padding: 0; } } @media (min-width: 1400px) { .one-column-section .content-section .other-content *:not(figure, img, figcaption, .image-wrapper, a, .button-wrapper) { max-width: 812px; } } .single-post .one-column-section .content-section .other-content *:not(figure, img, figcaption, .image-wrapper, a, .button-wrapper), .single-events .one-column-section .content-section .other-content *:not(figure, img, figcaption, .image-wrapper, a, .button-wrapper) { max-width: 1164px; } .one-column-section .content-section .other-content p { margin: 15px auto !important; } .one-column-section .content-section .other-content .wp-caption { max-width: 1088px; position: relative; margin: 25px -36px 15px -36px; width: 100% !important; } @media (min-width: 576px) { .one-column-section .content-section .other-content .wp-caption { border-radius: 10px; overflow: hidden; } } @media (min-width: 1400px) { .one-column-section .content-section .other-content .wp-caption { max-width: 1364px; margin: 35px auto 15px auto; } } .one-column-section .content-section .other-content .wp-caption img { height: 415px; -o-object-fit: cover; object-fit: cover; margin-bottom: 0; width: 100% !important; } @media (min-width: 992px) { .one-column-section .content-section .other-content .wp-caption img { height: 477px; } } @media (min-width: 1400px) { .one-column-section .content-section .other-content .wp-caption img { height: 600px; } } .one-column-section .content-section .other-content .wp-caption .wp-caption-text { position: absolute; bottom: 0; width: 100%; background-color: #faf8f6; color: #023605; text-align: center; padding: 6px 0; will-change: color, background-color; -webkit-transition: color, background-color 0.15s ease-in-out; -o-transition: color, background-color 0.15s ease-in-out; transition: color, background-color 0.15s ease-in-out; } .one-column-section .content-section .other-content .button-wrapper { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; -ms-flex-wrap: wrap; flex-wrap: wrap; -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; gap: 15px; margin-top: 40px; padding: 0 36px; } @media (min-width: 768px) { .one-column-section .content-section .other-content .button-wrapper { padding: 0; } } @media (min-width: 768px) { .one-column-section .content-section .other-content .button-wrapper { margin-top: 50px; } } .one-column-section .animation-wrp { display: none; position: absolute; height: 100%; width: 100%; top: 0; left: 0; z-index: -1; } .one-column-section .animation-wrp .circle-solid-object { right: 10%; top: 20%; } .one-column-section .animation-wrp .circle-object { left: 10%; bottom: 20%; } .one-column-section + .one-column-section .animation-wrp { display: none; } .one-column-section + .one-column-section .animation-wrp .circle-solid-object { left: 10%; right: auto; bottom: 20%; top: auto; } .one-column-section + .one-column-section .animation-wrp .circle-object { right: 10%; left: auto; top: 20%; bottom: auto; } .three-column-section { position: relative; } .three-column-section .section-inner-wrp { max-width: 935px; margin: 0 auto; } @media (min-width: 1400px) { .three-column-section .section-inner-wrp { max-width: 1364px; } } .three-column-section .section-inner-wrp .three-column-wrp .three-column-item-wrp { padding: 0 42px; } .three-column-section .section-inner-wrp .three-column-wrp .three-column-item-wrp .content-wrapper .image-wrapper { margin-top: 40px; } @media (min-width: 992px) { .three-column-section .section-inner-wrp .three-column-wrp .three-column-item-wrp .content-wrapper .image-wrapper { margin-top: 20px; } } .three-column-section .section-inner-wrp .three-column-wrp .three-column-item-wrp .content-wrapper .image-wrapper img { border-radius: 10px; } .three-column-section .section-inner-wrp .three-column-wrp .three-column-item-wrp .content-wrapper .button-wrapper { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; -ms-flex-wrap: wrap; flex-wrap: wrap; -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; gap: 15px; margin-top: 25px; } @media (min-width: 768px) { .three-column-section .section-inner-wrp .three-column-wrp .three-column-item-wrp .content-wrapper .button-wrapper { margin-top: 35px; } } @media (min-width: 992px) { .three-column-section .section-inner-wrp .three-column-wrp .three-column-item-wrp .content-wrapper .button-wrapper { max-width: 571px; -webkit-box-pack: start; -ms-flex-pack: start; justify-content: flex-start; } } .three-column-section .animation-wrp { display: none; position: absolute; width: 100%; height: 100%; top: 0; left: 0; z-index: -1; overflow: hidden; } .three-column-section .animation-wrp .circle-object { top: 50%; right: -25px; } .three-column-section + .three-column-section .animation-wrp { display: none; } .three-column-section + .three-column-section .animation-wrp .circle-object { top: 50%; left: -25px; } .two-col-cta-section { overflow: hidden; margin: 50px 0; padding: 0 !important; } @media (min-width: 768px) { .two-col-cta-section { margin: 75px 0; } } @media (min-width: 992px) { .two-col-cta-section { margin: 100px 0; } } .two-col-cta-section .intro-content h2 { margin-bottom: 30px; } @media (min-width: 1400px) { .two-col-cta-section .intro-content h2 { margin-bottom: 50px; } } .two-col-cta-section .image-wrapper .image-wrapper-inner { background-position: center; background-size: cover; padding: 34% 50%; } @media (min-width: 768px) { .two-col-cta-section .image-wrapper .image-wrapper-inner { padding: 28% 50%; } } @media (min-width: 992px) { .two-col-cta-section .image-wrapper .image-wrapper-inner { padding: 45% 50%; } } .two-col-cta-section .content-wrapper { background-color: #faf8f6; } @media (min-width: 992px) { .two-col-cta-section .content-wrapper { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; } } .two-col-cta-section .content-wrapper .content-wrapper-inner { text-align: center; padding: 100px 0; } @media (min-width: 768px) { .two-col-cta-section .content-wrapper .content-wrapper-inner { padding: 100px 36px; } } @media (min-width: 992px) { .two-col-cta-section .content-wrapper .content-wrapper-inner { padding: 0; text-align: left; max-width: 536px; margin-left: 20px; } } @media (min-width: 1400px) { .two-col-cta-section .content-wrapper .content-wrapper-inner { margin-left: 70px; } } .two-col-cta-section .content-wrapper .content-wrapper-inner p { margin-top: 0; } .two-col-cta-section .content-wrapper .content-wrapper-inner p strong, .two-col-cta-section .content-wrapper .content-wrapper-inner p b { color: #023605; } .two-col-cta-section .content-wrapper .content-wrapper-inner h2 { margin-bottom: 20px; } .two-col-cta-section .content-wrapper .content-wrapper-inner a { margin-top: 35px; } @media (min-width: 1200px) { .two-col-cta-section .content-wrapper .content-wrapper-inner a { margin-top: 85px; } } @media (min-width: 992px) { .two-col-cta-section .content-wrapper.inverted-text .content-wrapper-inner { margin-left: auto; margin-right: 20px; } } @media (min-width: 1400px) { .two-col-cta-section .content-wrapper.inverted-text .content-wrapper-inner { margin-right: 70px; } } .two-column-section { position: relative; } .two-column-section .section-inner-wrp { max-width: 935px; margin: 0 auto; } @media (min-width: 1400px) { .two-column-section .section-inner-wrp { max-width: 1364px; } } .two-column-section .section-inner-wrp .intro-section { margin-bottom: 30px; } @media (min-width: 1400px) { .two-column-section .section-inner-wrp .intro-section { margin-bottom: 50px; } } .two-column-section .section-inner-wrp .two-column-wrp { margin-bottom: -40px; padding-top: 0; } @media (min-width: 992px) { .two-column-section .section-inner-wrp .two-column-wrp { -webkit-box-align: center; -ms-flex-align: center; align-items: center; margin-bottom: 0; padding-top: 30px; } } @media (min-width: 1400px) { .two-column-section .section-inner-wrp .two-column-wrp { padding-top: 55px; } } .two-column-section .section-inner-wrp .two-column-wrp .columns { margin-bottom: 40px; } @media (min-width: 992px) { .two-column-section .section-inner-wrp .two-column-wrp .columns { margin-bottom: 0; } } @media (min-width: 992px) { .two-column-section .section-inner-wrp .two-column-wrp .columns .intro-content { max-width: 444px; } } @media (min-width: 1400px) { .two-column-section .section-inner-wrp .two-column-wrp .columns .intro-content { max-width: 536px; margin-top: 0; } } .two-column-section .section-inner-wrp .two-column-wrp .columns .content-wrapper { margin-top: 30px; } @media (min-width: 992px) { .two-column-section .section-inner-wrp .two-column-wrp .columns .content-wrapper { max-width: 444px; } } @media (min-width: 1400px) { .two-column-section .section-inner-wrp .two-column-wrp .columns .content-wrapper { max-width: 536px; margin-top: 0; } } .two-column-section .section-inner-wrp .two-column-wrp .columns .content-wrapper h5 { margin-bottom: 40px; } .two-column-section .section-inner-wrp .two-column-wrp .columns .button-wrapper { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; -ms-flex-wrap: wrap; flex-wrap: wrap; -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; gap: 15px; margin-top: 25px; } @media (min-width: 768px) { .two-column-section .section-inner-wrp .two-column-wrp .columns .button-wrapper { margin-top: 35px; } } @media (min-width: 992px) { .two-column-section .section-inner-wrp .two-column-wrp .columns .button-wrapper { max-width: 571px; -webkit-box-pack: start; -ms-flex-pack: start; justify-content: flex-start; } } .two-column-section .section-inner-wrp .two-column-wrp .columns .image-wrapper { position: relative; margin-left: -36px; margin-right: -36px; margin-top: 25px; } @media (min-width: 576px) { .two-column-section .section-inner-wrp .two-column-wrp .columns .image-wrapper { margin-left: 0; margin-right: 0; } } @media (min-width: 992px) { .two-column-section .section-inner-wrp .two-column-wrp .columns .image-wrapper { max-width: 352px; margin-top: 0; } } @media (min-width: 1400px) { .two-column-section .section-inner-wrp .two-column-wrp .columns .image-wrapper { max-width: 492px; } } .two-column-section .section-inner-wrp .two-column-wrp .columns .image-wrapper::after { content: ""; display: none; position: absolute; top: -12px; background: #faf8f6; width: 100%; height: 100%; z-index: -1; border-radius: 10px; -webkit-animation: twocolbg 2s infinite alternate; -o-animation: twocolbg 2s infinite alternate; animation: twocolbg 2s infinite alternate; } @media (min-width: 992px) { .two-column-section .section-inner-wrp .two-column-wrp .columns .image-wrapper::after { top: -15px; } } @media (min-width: 1400px) { .two-column-section .section-inner-wrp .two-column-wrp .columns .image-wrapper::after { top: -22px; } } .two-column-section .section-inner-wrp .two-column-wrp .columns .image-wrapper::before { content: ""; display: none; position: absolute; top: -25px; background: #faf8f6; width: 100%; height: 100%; z-index: -2; border-radius: 10px; -webkit-animation: twocolbg 2s infinite alternate; -o-animation: twocolbg 2s infinite alternate; animation: twocolbg 2s infinite alternate; -webkit-animation-delay: 1s; -o-animation-delay: 1s; animation-delay: 1s; } @media (min-width: 992px) { .two-column-section .section-inner-wrp .two-column-wrp .columns .image-wrapper::before { top: -30px; } } @media (min-width: 1400px) { .two-column-section .section-inner-wrp .two-column-wrp .columns .image-wrapper::before { top: -44px; } } .two-column-section .section-inner-wrp .two-column-wrp .columns .image-wrapper img { border-radius: 10px; } @-webkit-keyframes twocolbg { 0% { -webkit-transform: translateY(0); transform: translateY(0); } 100% { -webkit-transform: translateY(-10px); transform: translateY(-10px); } } @-o-keyframes twocolbg { 0% { -o-transform: translateY(0); transform: translateY(0); } 100% { -o-transform: translateY(-10px); transform: translateY(-10px); } } @keyframes twocolbg { 0% { -webkit-transform: translateY(0); -o-transform: translateY(0); transform: translateY(0); } 100% { -webkit-transform: translateY(-10px); -o-transform: translateY(-10px); transform: translateY(-10px); } } .two-column-section .section-inner-wrp .two-column-wrp .columns.column1-wrp .button-wrapper { margin-right: auto; } .two-column-section .section-inner-wrp .two-column-wrp .columns.column1-wrp .image-wrapper { margin-left: 30px; margin-right: auto; } @media (min-width: 1400px) { .two-column-section .section-inner-wrp .two-column-wrp .columns.column1-wrp .image-wrapper { margin-left: 44px; } } .two-column-section .section-inner-wrp .two-column-wrp .columns.column1-wrp .image-wrapper::after { left: -12px; } @media (min-width: 992px) { .two-column-section .section-inner-wrp .two-column-wrp .columns.column1-wrp .image-wrapper::after { left: -15px; } } @media (min-width: 1400px) { .two-column-section .section-inner-wrp .two-column-wrp .columns.column1-wrp .image-wrapper::after { left: -22px; } } .two-column-section .section-inner-wrp .two-column-wrp .columns.column1-wrp .image-wrapper::before { left: -25px; } @media (min-width: 992px) { .two-column-section .section-inner-wrp .two-column-wrp .columns.column1-wrp .image-wrapper::before { left: -30px; } } @media (min-width: 1400px) { .two-column-section .section-inner-wrp .two-column-wrp .columns.column1-wrp .image-wrapper::before { left: -44px; } } .two-column-section .section-inner-wrp .two-column-wrp .columns.column2-wrp .intro-content, .two-column-section .section-inner-wrp .two-column-wrp .columns.column2-wrp .content-wrapper, .two-column-section .section-inner-wrp .two-column-wrp .columns.column2-wrp .button-wrapper { margin-left: auto; } .two-column-section .section-inner-wrp .two-column-wrp .columns.column2-wrp .image-wrapper { margin-left: auto; margin-right: 25px; } @media (min-width: 992px) { .two-column-section .section-inner-wrp .two-column-wrp .columns.column2-wrp .image-wrapper { margin-right: 30px; } } @media (min-width: 1400px) { .two-column-section .section-inner-wrp .two-column-wrp .columns.column2-wrp .image-wrapper { margin-right: 44px; } } .two-column-section .section-inner-wrp .two-column-wrp .columns.column2-wrp .image-wrapper::after { right: -12px; } @media (min-width: 992px) { .two-column-section .section-inner-wrp .two-column-wrp .columns.column2-wrp .image-wrapper::after { right: -15px; } } @media (min-width: 1400px) { .two-column-section .section-inner-wrp .two-column-wrp .columns.column2-wrp .image-wrapper::after { right: -22px; } } .two-column-section .section-inner-wrp .two-column-wrp .columns.column2-wrp .image-wrapper::before { right: -25px; } @media (min-width: 992px) { .two-column-section .section-inner-wrp .two-column-wrp .columns.column2-wrp .image-wrapper::before { right: -30px; } } @media (min-width: 1400px) { .two-column-section .section-inner-wrp .two-column-wrp .columns.column2-wrp .image-wrapper::before { right: -44px; } } .two-column-section .section-inner-wrp .two-column-wrp + .two-column-wrp { padding-top: 150px; } .two-column-section .animation-wrp { display: none; position: absolute; width: 100%; height: 100%; top: 0; left: 0; z-index: -1; overflow: hidden; } .two-column-section .animation-wrp .circle-object { top: 25%; right: -20px; } @media (min-width: 992px) { .two-column-section .animation-wrp .circle-object { right: -50px; } } .two-column-section .animation-wrp .triangle-object { left: -20px; bottom: 10%; } .two-column-section + .two-column-section .animation-wrp { display: none; } .two-column-section + .two-column-section .animation-wrp .circle-object { bottom: 25%; left: -20px; top: auto; right: auto; } @media (min-width: 992px) { .two-column-section + .two-column-section .animation-wrp .circle-object { left: -50px; } } .two-column-section + .two-column-section .animation-wrp .triangle-object { right: -20px; top: 10%; bottom: auto; left: auto; } .video-section { position: relative; } .video-section .section-inner-wrp { max-width: 904px; margin: 0 auto; } @media (min-width: 1400px) { .video-section .section-inner-wrp { max-width: 1364px; } } .video-section .section-inner-wrp .intro-content { text-align: center; max-width: 536px; margin: 0 auto 40px; } @media (min-width: 768px) { .video-section .section-inner-wrp .intro-content { margin: 0 auto 50px; } } .video-section .section-inner-wrp .video-wrp { margin-bottom: 40px; margin-left: -36px; margin-right: -36px; } @media (min-width: 576px) { .video-section .section-inner-wrp .video-wrp { margin-left: 0; margin-right: 0; } } @media (min-width: 768px) { .video-section .section-inner-wrp .video-wrp { margin-bottom: 50px; } } .video-section .section-inner-wrp .video-wrp .vimeo-wrapper iframe { height: 360px; width: 100%; } @media (min-width: 576px) { .video-section .section-inner-wrp .video-wrp .vimeo-wrapper iframe { border-radius: 10px; } } @media (min-width: 992px) { .video-section .section-inner-wrp .video-wrp .vimeo-wrapper iframe { height: 375px; } } @media (min-width: 1400px) { .video-section .section-inner-wrp .video-wrp .vimeo-wrapper iframe { height: 565px; } } .video-section .section-inner-wrp .content-wrapper { max-width: 606px; margin: 0 auto; } .video-section .section-inner-wrp .content-wrapper .button-wrapper { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; -ms-flex-wrap: wrap; flex-wrap: wrap; -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; gap: 15px; margin-top: 40px; } @media (min-width: 768px) { .video-section .section-inner-wrp .content-wrapper .button-wrapper { margin-top: 50px; } } .video-section .animation-wrp { display: none; position: absolute; width: 100%; height: 100%; top: 0; left: 0; z-index: -1; overflow: hidden; } .video-section .animation-wrp .circle-object { top: 10%; left: 10%; } .video-section .animation-wrp .circle-object:first-child { bottom: 10%; right: 10%; top: auto; left: auto; } .home-cards-section { overflow: hidden; } .home-cards-section .intro-content { text-align: center; margin-bottom: 40px; } @media (min-width: 768px) { .home-cards-section .intro-content { margin-bottom: 50px; } } .home-cards-section .cards-wrp { display: block; margin: -8px; outline: none; } @media (min-width: 992px) { .home-cards-section .cards-wrp { display: -webkit-box; display: -ms-flexbox; display: flex; } } .home-cards-section .cards-wrp::after { content: "flickity"; display: none; } @media (min-width: 992px) { .home-cards-section .cards-wrp::after { content: ""; } } .home-cards-section .cards-wrp .cards-item-wrp { text-align: center; padding: 8px; } @media (min-width: 992px) { .home-cards-section .cards-wrp .cards-item-wrp { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; -webkit-box-align: center; -ms-flex-align: center; align-items: center; } } .home-cards-section .cards-wrp .cards-item-wrp .cards-item-inner-wrp { padding: 75px 45px; border: 1px solid #a49f9f; will-change: box-shadow; -webkit-transition: box-shadow 0.15s ease-in-out; -o-transition: box-shadow 0.15s ease-in-out; -webkit-transition: -webkit-box-shadow 0.15s ease-in-out; transition: -webkit-box-shadow 0.15s ease-in-out; transition: box-shadow 0.15s ease-in-out; transition: box-shadow 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out; } @media (min-width: 992px) { .home-cards-section .cards-wrp .cards-item-wrp .cards-item-inner-wrp { min-height: 100%; } } .home-cards-section .cards-wrp .cards-item-wrp .cards-item-inner-wrp .image-wrapper { margin-bottom: 35px; } .home-cards-section .cards-wrp .cards-item-wrp .cards-item-inner-wrp .image-wrapper img { width: 55px; height: 55px; } .home-cards-section .cards-wrp .cards-item-wrp .cards-item-inner-wrp .content-wrapper h5 { margin-bottom: 10px; } .home-cards-section .cards-wrp .cards-item-wrp .cards-item-inner-wrp .content-wrapper p { margin-top: 0; line-height: 24px; } .home-cards-section .cards-wrp .cards-item-wrp .cards-item-inner-wrp .content-wrapper .button-wrapper { margin-top: 45px; } .home-cards-section .cards-wrp .cards-item-wrp:hover .cards-item-inner-wrp, .home-cards-section .cards-wrp .cards-item-wrp.is-selected .cards-item-inner-wrp { -webkit-box-shadow: 0 20px 60px rgba(0, 0, 0, 0.1019607843); box-shadow: 0 20px 60px rgba(0, 0, 0, 0.1019607843); } .home-core-values-section .core-values-section-wrp { background-color: #faf8f6; padding: 50px 36px; text-align: center; margin-left: -20px; margin-right: -20px; margin-top: -100px; position: relative; z-index: 4; border-radius: 10px; } @media (min-width: 576px) { .home-core-values-section .core-values-section-wrp { margin-left: 0; margin-right: 0; } } @media (min-width: 992px) { .home-core-values-section .core-values-section-wrp { padding: 75px 184px; margin-top: -200px; border-radius: 20px; } } @media (min-width: 1400px) { .home-core-values-section .core-values-section-wrp { padding: 68px 184px; max-width: 1364px; margin-right: auto; margin-left: auto; margin-top: -300px; border-radius: 28px; } } .home-core-values-section .core-values-section-wrp .core-values-section-inner-wrp { max-width: 720px; margin: 0 auto; } .home-core-values-section .core-values-section-wrp .core-values-section-inner-wrp img { width: auto; } .home-core-values-section .core-values-section-wrp .core-values-section-inner-wrp p { color: #a49f9f; } .home-core-values-section .core-values-section-wrp .core-values-section-inner-wrp p strong { color: #a49f9f !important; font-weight: 500; } @media (min-width: 992px) { .home-core-values-section .core-values-section-wrp .core-values-section-inner-wrp p { color: black !important; } .home-core-values-section .core-values-section-wrp .core-values-section-inner-wrp p strong { color: #023605 !important; font-weight: 700 !important; } } @media (min-width: 1400px) { .home-core-values-section .core-values-section-wrp .core-values-section-inner-wrp { max-width: 812px; } } .home-core-values-section .core-values-section-wrp .animation-wrp { display: none; } .home-core-values-section .core-values-section-wrp .animation-wrp .circle-object { top: 14px; } @media (min-width: 768px) { .home-core-values-section .core-values-section-wrp .animation-wrp .circle-object { top: -30px; } } .home-core-values-section .core-values-section-wrp .animation-wrp .circle-solid-object { top: 100px; left: 80px; z-index: -1; } @media (min-width: 992px) { .home-core-values-section .core-values-section-wrp .animation-wrp .circle-solid-object { left: 380px; } } @media (min-width: 1400px) { .home-core-values-section .core-values-section-wrp .animation-wrp .circle-solid-object { top: 150px; left: 36%; } } .home-core-values-section .core-values-section-wrp .animation-wrp .circle-two .circle-object { top: auto; bottom: 14px; z-index: -1; } @media (min-width: 768px) { .home-core-values-section .core-values-section-wrp .animation-wrp .circle-two .circle-object { bottom: 55px; right: 190px; } } @media (min-width: 1400px) { .home-core-values-section .core-values-section-wrp .animation-wrp .circle-two .circle-object { bottom: 70px; right: 260px; } } /* stylelint-disable */ .home-banner-section { background-color: #faf8f6; position: relative; z-index: 4; } .home-banner-section > .mobile-menu { display: none; } .home-banner-section > header { position: relative; } .sticky-header .home-banner-section > header { background-color: #faf8f6; } .home-banner-section .banner-content-wrp { padding-top: 50px; overflow: hidden; position: relative; min-height: 70vh; -o-object-fit: cover; object-fit: cover; } @media (min-width: 992px) { .home-banner-section .banner-content-wrp { padding-top: 100px; min-height: 80vh; } } @media (min-width: 1400px) { .home-banner-section .banner-content-wrp { min-height: 95vh; } } .home-banner-section .banner-content-wrp .intro-container { position: absolute; z-index: 2; top: 0; width: 100%; height: 100%; left: 50%; -webkit-transform: translateX(-50%); -o-transform: translateX(-50%); transform: translateX(-50%); padding-bottom: 130px; padding-top: 30px; } @media (min-width: 992px) { .home-banner-section .banner-content-wrp .intro-container { padding-bottom: 230px; } } @media (min-width: 1400px) { .home-banner-section .banner-content-wrp .intro-container { padding-bottom: 330px; } } .home-banner-section .banner-content-wrp .intro-content { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; text-align: center; max-width: 1088px; margin-left: auto; margin-right: auto; height: 100%; } .home-banner-section .banner-content-wrp .intro-content .content-wrp h1 { color: #fff; } .home-banner-section .banner-content-wrp .banner-wrp { outline: 0; position: relative; } .home-banner-section .banner-content-wrp .banner-wrp::before { content: ""; position: absolute; top: 0; left: 0; width: 100%; height: 100%; background-color: #000; opacity: 0.5; z-index: 1; } .home-banner-section .banner-content-wrp .banner-wrp img { min-height: 70vh; -o-object-fit: cover; object-fit: cover; height: 100%; } @media (min-width: 992px) { .home-banner-section .banner-content-wrp .banner-wrp img { min-height: 80vh; } } @media (min-width: 1400px) { .home-banner-section .banner-content-wrp .banner-wrp img { min-height: 95vh; } } .home-banner-section .banner-content-wrp .banner-wrp .flickity-button { position: absolute; top: 50%; -webkit-transform: translateY(-50%); -o-transform: translateY(-50%); transform: translateY(-50%); width: 50px; height: 50px; display: none; } @media (min-width: 992px) { .home-banner-section .banner-content-wrp .banner-wrp .flickity-button { display: block; } } .home-banner-section .banner-content-wrp .banner-wrp .flickity-button::after { width: 18px; height: 12px; background-size: cover; } .home-banner-section .banner-content-wrp .banner-wrp .flickity-button.previous { left: 115px; } .home-banner-section .banner-content-wrp .banner-wrp .flickity-button.next { right: 115px; } .home-banner-section .message-section { max-width: 780px; position: absolute; bottom: 0; left: 50%; width: 100%; z-index: 2; padding: 0 20px; -webkit-transform: translate(-50%, 50%); -o-transform: translate(-50%, 50%); transform: translate(-50%, 50%); text-align: center; } @media (min-width: 992px) { .home-banner-section .message-section { text-align: left; } } @media (min-width: 1400px) { .home-banner-section .message-section { max-width: 1128px; } } .home-banner-section .message-section .flickity-page-dots { position: absolute; top: -132px; left: 50%; -webkit-transform: translateX(-50%); -o-transform: translateX(-50%); transform: translateX(-50%); display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; gap: 9px; padding: 0; } @media (min-width: 992px) { .home-banner-section .message-section .flickity-page-dots { top: -232px; } } @media (min-width: 1400px) { .home-banner-section .message-section .flickity-page-dots { top: -342px; } } .home-banner-section .message-section .flickity-page-dots .dot { display: block; width: 14px; height: 14px; border-radius: 50%; border: 2px solid #fff; background-color: #fff; } .home-banner-section .message-section .flickity-page-dots .dot.is-selected { background-color: transparent; } .home-banner-section .message-section .message-wrp { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; background-color: #fff; border-radius: 20px; -webkit-box-shadow: 5px 5px 30px rgba(0, 0, 0, 0.1019607843); box-shadow: 5px 5px 30px rgba(0, 0, 0, 0.1019607843); } @media (min-width: 992px) { .home-banner-section .message-section .message-wrp { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; padding: 16px; } } @media (min-width: 1400px) { .home-banner-section .message-section .message-wrp { padding: 16px; } } .home-banner-section .message-section .message-wrp .img-wrp { width: 180px; height: 200px; background-position: center; background-size: cover; background-repeat: no-repeat; border-radius: 20px; margin-top: 50px; margin-bottom: 20px; } @media (min-width: 992px) { .home-banner-section .message-section .message-wrp .img-wrp { width: 133px; height: 150px; margin-top: 0; margin-bottom: 0; } } @media (min-width: 1400px) { .home-banner-section .message-section .message-wrp .img-wrp { width: 180px; height: 200px; } } .home-banner-section .message-section .message-wrp .content-wrp { padding: 0 16px 50px 16px; } @media (min-width: 992px) { .home-banner-section .message-section .message-wrp .content-wrp { padding: 0; padding-left: 40px; width: 541px; } } @media (min-width: 1400px) { .home-banner-section .message-section .message-wrp .content-wrp { padding: 0; padding-left: 50px; width: 824px; } } .home-banner-section .message-section .message-wrp .content-wrp h3 { font-size: 22px; } .home-banner-section .message-section .message-wrp .content-wrp p { margin-top: 0; } /* stylelint-disable */ .home-previous-events-section { position: relative; } .home-previous-events-section .section-inner-wrp { max-width: 1088px; margin: 0 auto; } @media (min-width: 1400px) { .home-previous-events-section .section-inner-wrp { max-width: 1640px; } } .home-previous-events-section .section-inner-wrp .intro-section { margin-bottom: 50px; } .home-previous-events-section .section-inner-wrp .intro-section p { max-width: 100%; } @media (min-width: 768px) { .home-previous-events-section .section-inner-wrp .intro-section p { max-width: 550px; margin: auto; } } @media (min-width: 1200px) { .home-previous-events-section .section-inner-wrp .intro-section p { max-width: 650px; margin: auto; } } .home-previous-events-section .section-inner-wrp .post-wrp .row { margin: -8px; } .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp { padding: 8px; } @media (min-width: 768px) { .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp.featured-post .post-item a .image-wrp { padding-right: 8px; } } @media (min-width: 768px) { .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp.featured-post .post-item a .image-wrp img { height: 100%; } } .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp.featured-post .post-item a .featured-content { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; width: 100%; height: 100%; } .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp.featured-post .post-item a .featured-content .post-content .post-description { display: block; } .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-flex: 0; -ms-flex: 0 0 25%; flex: 0 0 25%; min-height: 100%; will-change: border; -webkit-transition: border 0.15s ease-in-out; -o-transition: border 0.15s ease-in-out; transition: border 0.15s ease-in-out; } .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item .button-wrapper .btn, .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item .button-wrapper .comment-form input[type=submit], .comment-form .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item .button-wrapper input[type=submit] { -webkit-box-shadow: none !important; box-shadow: none !important; } .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item:hover { cursor: pointer; } .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item:hover .button-wrapper .btn, .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item:hover .button-wrapper .comment-form input[type=submit], .comment-form .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item:hover .button-wrapper input[type=submit] { background-color: #023605; color: #fff; -webkit-box-shadow: none !important; box-shadow: none !important; } .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a { text-decoration: none; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; -webkit-box-shadow: 5px 5px 30px rgba(0, 0, 0, 0.102); box-shadow: 5px 5px 30px rgba(0, 0, 0, 0.102); width: 100%; border-radius: 10px; overflow: hidden; } .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a:hover { text-decoration: none; } .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .image-wrp img { height: 265px; -o-object-fit: cover; object-fit: cover; } .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; -ms-flex-wrap: wrap; flex-wrap: wrap; -ms-flex-line-pack: start; align-content: flex-start; height: 100%; padding: 50px 15px 0; } @media (min-width: 992px) { .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content { padding: 40px 22px 0; } } @media (min-width: 1400px) { .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content { padding: 50px 40px 0; } } .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content .post-date { margin-bottom: 10px; } @media (min-width: 992px) { .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content .post-date { margin-bottom: 30px; } } @media (min-width: 1400px) { .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content .post-date { margin-bottom: 50px; } } .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content .post-date p { font-size: 14px; line-height: 22px; color: #a49f9f; } .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content .post-description { overflow: hidden; display: -webkit-box; -webkit-box-orient: vertical; -webkit-line-clamp: 4; } .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content .post-description > * { color: #a49f9f; } .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .button-wrapper { margin-top: 30px; padding: 0 15px 50px 15px; } @media (min-width: 992px) { .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .button-wrapper { margin-top: 50px; padding: 0 22px 40px 22px; } } @media (min-width: 1400px) { .home-previous-events-section .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .button-wrapper { margin-top: 50px; padding: 0 40px 64px 40px; } } .home-previous-events-section .section-inner-wrp .post-wrp .alm-btn-wrap { text-align: center; margin-top: 100px; } .home-previous-events-section .section-inner-wrp .post-wrp .alm-btn-wrap .done { display: none; } .home-previous-events-section .section-inner-wrp .pagination-wrapper { margin-top: 100px; } .home-previous-events-section .section-inner-wrp .pagination-wrapper .pagination .page-numbers { color: #9ca0a2; margin-right: 16px; text-decoration: none; cursor: pointer; will-change: color; -webkit-transition: color 0.15s ease-in-out; -o-transition: color 0.15s ease-in-out; transition: color 0.15s ease-in-out; } .home-previous-events-section .section-inner-wrp .pagination-wrapper .pagination .page-numbers:hover { color: #023605; } .home-previous-events-section .section-inner-wrp .pagination-wrapper .pagination .page-numbers:hover.next::after, .home-previous-events-section .section-inner-wrp .pagination-wrapper .pagination .page-numbers:hover.prev::after { background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNS4wNyIgaGVpZ2h0PSIxMi43MjQiIHZpZXdCb3g9IjAgMCAyNS4wNyAxMi43MjQiPgogIDxnIGlkPSJHcm91cF8zNzc5IiBkYXRhLW5hbWU9Ikdyb3VwIDM3NzkiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC01MTAgLTQ1NDYuNjM3KSI+CiAgICA8bGluZSBpZD0iTGluZV81MyIgZGF0YS1uYW1lPSJMaW5lIDUzIiB4Mj0iMjMiIHRyYW5zZm9ybT0idHJhbnNsYXRlKDUxMCA0NTUzKSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSIjMDIzNjA1IiBzdHJva2Utd2lkdGg9IjIiLz4KICAgIDxwYXRoIGlkPSJQYXRoXzYyNDEiIGRhdGEtbmFtZT0iUGF0aCA2MjQxIiBkPSJNMCwwSDhWOCIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoNTI4LjAwMSA0NTQ3LjM0NCkgcm90YXRlKDQ1KSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSIjMDIzNjA1IiBzdHJva2Utd2lkdGg9IjIiLz4KICA8L2c+Cjwvc3ZnPgo=); will-change: background-image; -webkit-transition: background-image 0.15s ease-in-out; -o-transition: background-image 0.15s ease-in-out; transition: background-image 0.15s ease-in-out; } .home-previous-events-section .section-inner-wrp .pagination-wrapper .pagination .page-numbers:last-child { margin-right: 0; } .home-previous-events-section .section-inner-wrp .pagination-wrapper .pagination .page-numbers.current { color: #023605; cursor: default; } .home-previous-events-section .section-inner-wrp .pagination-wrapper .pagination .page-numbers.next, .home-previous-events-section .section-inner-wrp .pagination-wrapper .pagination .page-numbers.prev { position: relative; width: 18px; } .home-previous-events-section .section-inner-wrp .pagination-wrapper .pagination .page-numbers.next::after, .home-previous-events-section .section-inner-wrp .pagination-wrapper .pagination .page-numbers.prev::after { content: ""; position: absolute; top: 50%; left: 50%; -webkit-transform: translate(-50%, -50%); -o-transform: translate(-50%, -50%); transform: translate(-50%, -50%); background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNS4wNyIgaGVpZ2h0PSIxMi43MjQiIHZpZXdCb3g9IjAgMCAyNS4wNyAxMi43MjQiPgogIDxnIGlkPSJHcm91cF8zNzc5IiBkYXRhLW5hbWU9Ikdyb3VwIDM3NzkiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC01MTAgLTQ1NDYuNjM3KSI+CiAgICA8bGluZSBpZD0iTGluZV81MyIgZGF0YS1uYW1lPSJMaW5lIDUzIiB4Mj0iMjMiIHRyYW5zZm9ybT0idHJhbnNsYXRlKDUxMCA0NTUzKSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSIjOWNhMGEyIiBzdHJva2Utd2lkdGg9IjIiLz4KICAgIDxwYXRoIGlkPSJQYXRoXzYyNDEiIGRhdGEtbmFtZT0iUGF0aCA2MjQxIiBkPSJNMCwwSDhWOCIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoNTI4LjAwMSA0NTQ3LjM0NCkgcm90YXRlKDQ1KSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSIjOWNhMGEyIiBzdHJva2Utd2lkdGg9IjIiLz4KICA8L2c+Cjwvc3ZnPgo=); background-repeat: no-repeat; background-size: cover; background-position: right; width: 18px; height: 12px; will-change: background-image; -webkit-transition: background-image 0.15s ease-in-out; -o-transition: background-image 0.15s ease-in-out; transition: background-image 0.15s ease-in-out; } .home-previous-events-section .section-inner-wrp .pagination-wrapper .pagination .page-numbers.prev::after { -webkit-transform: translate(-50%, -50%) rotate(180deg); -o-transform: translate(-50%, -50%) rotate(180deg); transform: translate(-50%, -50%) rotate(180deg); } .home-previous-events-section .animation-wrp { display: none; position: absolute; width: 100%; height: 100%; top: 0; left: 0; z-index: -1; overflow: hidden; } .home-previous-events-section .animation-wrp .circle-object:first-child { display: none; bottom: 40%; left: -30px; } @media (min-width: 992px) { .home-previous-events-section .animation-wrp .circle-object:first-child { display: block; bottom: 40%; left: -75px; } } .home-previous-events-section .animation-wrp .circle-object:nth-child(2) { top: 20px; right: 93%; -webkit-animation-delay: 1s; -o-animation-delay: 1s; animation-delay: 1s; } @media (min-width: 992px) { .home-previous-events-section .animation-wrp .circle-object:nth-child(2) { top: 150px; right: 69%; } } .home-previous-events-section .animation-wrp .circle-solid-object:nth-child(3) { bottom: 0; left: 50px; } @media (min-width: 1400px) { .home-previous-events-section .animation-wrp .circle-solid-object:nth-child(3) { bottom: 0; left: 50px; } } .home-previous-events-section .animation-wrp .circle-solid-object:nth-child(4) { display: none; top: 50px; right: 42%; -webkit-animation-delay: 1s; -o-animation-delay: 1s; animation-delay: 1s; } @media (min-width: 992px) { .home-previous-events-section .animation-wrp .circle-solid-object:nth-child(4) { display: block; top: 50px; right: 42%; } } /* stylelint-disable */ .home-two-column-section .two-column-wrp { margin-bottom: -40px; } @media (min-width: 992px) { .home-two-column-section .two-column-wrp { -webkit-box-align: center; -ms-flex-align: center; align-items: center; margin-bottom: 0; } } @media (min-width: 1400px) { .home-two-column-section .two-column-wrp { max-width: 1436px; margin: 0 auto; } } .home-two-column-section .two-column-wrp .columns { margin-bottom: 40px; } @media (min-width: 992px) { .home-two-column-section .two-column-wrp .columns { margin-bottom: 0; } } @media (min-width: 992px) { .home-two-column-section .two-column-wrp .columns .intro-content { max-width: 571px; margin-top: 0; } } .home-two-column-section .two-column-wrp .columns .content-wrapper { margin-top: 30px; } @media (min-width: 992px) { .home-two-column-section .two-column-wrp .columns .content-wrapper { max-width: 536px; margin-top: 0; } } .home-two-column-section .two-column-wrp .columns .content-wrapper h5 { margin-bottom: 40px; } .home-two-column-section .two-column-wrp .columns .content-wrapper h2, .home-two-column-section .two-column-wrp .columns .content-wrapper p { text-align: center; } @media (min-width: 992px) { .home-two-column-section .two-column-wrp .columns .content-wrapper h2, .home-two-column-section .two-column-wrp .columns .content-wrapper p { text-align: left; } } .home-two-column-section .two-column-wrp .columns .content-tagline { margin-top: 40px; } @media (min-width: 992px) { .home-two-column-section .two-column-wrp .columns .content-tagline { max-width: 571px; margin-top: 50px; } } @media (min-width: 1400px) { .home-two-column-section .two-column-wrp .columns .content-tagline { margin-top: 70px; } } .home-two-column-section .two-column-wrp .columns .button-wrapper { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; -ms-flex-wrap: wrap; flex-wrap: wrap; -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; gap: 15px; margin-top: 25px; } @media (min-width: 768px) { .home-two-column-section .two-column-wrp .columns .button-wrapper { margin-top: 35px; } } @media (min-width: 992px) { .home-two-column-section .two-column-wrp .columns .button-wrapper { max-width: 571px; -webkit-box-pack: start; -ms-flex-pack: start; justify-content: flex-start; } } .home-two-column-section .two-column-wrp .columns .image-wrapper { position: relative; max-width: 302px; margin: 0 auto; } @media (min-width: 992px) { .home-two-column-section .two-column-wrp .columns .image-wrapper { max-width: 352px; margin-right: auto; } } @media (min-width: 1400px) { .home-two-column-section .two-column-wrp .columns .image-wrapper { max-width: 561px; } } .home-two-column-section .two-column-wrp .columns .image-wrapper.image-right .image-inner-wrp .animation-wrp { display: none; } .home-two-column-section .two-column-wrp .columns .image-wrapper.image-right .image-inner-wrp .animation-wrp .circle-solid-object { right: -30px; left: auto; } @media (min-width: 1200px) { .home-two-column-section .two-column-wrp .columns .image-wrapper.image-right .image-inner-wrp .animation-wrp .circle-solid-object { right: -20px; } } @media (min-width: 1400px) { .home-two-column-section .two-column-wrp .columns .image-wrapper.image-right .image-inner-wrp .animation-wrp .circle-solid-object { right: -31px; } } .home-two-column-section .two-column-wrp .columns .image-wrapper.image-right .image-inner-wrp .animation-wrp .circle-object { right: 11%; left: auto; } .home-two-column-section .two-column-wrp .columns .image-wrapper.image-right .image-inner-wrp::after { -webkit-transform: scaleX(-1); -o-transform: scaleX(-1); transform: scaleX(-1); } .home-two-column-section .two-column-wrp .columns .image-wrapper .image-inner-wrp { overflow: hidden; } .home-two-column-section .two-column-wrp .columns .image-wrapper .image-inner-wrp img { width: auto; max-width: 100%; border-radius: 10px; } .home-two-column-section .two-column-wrp .columns .image-wrapper .image-inner-wrp .animation-wrp { display: none; } .home-two-column-section .two-column-wrp .columns .image-wrapper .image-inner-wrp .animation-wrp .circle-solid-object { top: 50%; left: -30px; background-color: #023605; opacity: 0.85; } @media (min-width: 1200px) { .home-two-column-section .two-column-wrp .columns .image-wrapper .image-inner-wrp .animation-wrp .circle-solid-object { width: 40px; height: 40px; left: -20px; } } @media (min-width: 1400px) { .home-two-column-section .two-column-wrp .columns .image-wrapper .image-inner-wrp .animation-wrp .circle-solid-object { width: 62px; height: 62px; left: -31px; } } .home-two-column-section .two-column-wrp .columns .image-wrapper .image-inner-wrp .animation-wrp .circle-object { border-color: #faf8f6; top: -52px; left: 11%; width: 105px; height: 105px; border-width: 22px; } @media (min-width: 1200px) { .home-two-column-section .two-column-wrp .columns .image-wrapper .image-inner-wrp .animation-wrp .circle-object { width: 122px; height: 122px; top: -61px; } } @media (min-width: 1400px) { .home-two-column-section .two-column-wrp .columns .image-wrapper .image-inner-wrp .animation-wrp .circle-object { width: 184px; height: 184px; top: -92px; } } .home-two-column-section .two-column-wrp .columns .content-tagline { font-size: 16px; font-weight: 700; line-height: 24px; color: #000; } @media (min-width: 1400px) { .home-two-column-section .two-column-wrp .columns .content-tagline { font-size: 20px; line-height: 32px; } } .home-two-column-section .two-column-wrp .columns.column1-wrp .button-wrapper { margin-right: auto; } .home-two-column-section .two-column-wrp .columns.column2-wrp .intro-content, .home-two-column-section .two-column-wrp .columns.column2-wrp .content-wrapper, .home-two-column-section .two-column-wrp .columns.column2-wrp .button-wrapper, .home-two-column-section .two-column-wrp .columns.column2-wrp .content-tagline { margin-left: auto; } @media (min-width: 992px) { .home-two-column-section .two-column-wrp .columns.column2-wrp .image-wrapper { margin-left: auto; } } /* stylelint-disable */ .tribe-events.tribe-common--breakpoint-medium .tribe-events-c-events-bar--border { border-color: #d9d9d9; background-color: #fff; } .tribe-common--breakpoint-medium.tribe-events .tribe-events-c-top-bar__nav { display: none !important; } .tribe-events .tribe-events-c-search__input-control--keyword-focus .tribe-events-c-search__input ~ .tribe-events-c-search__input-control-icon-svg path, .tribe-events .tribe-events-c-search__input-control--keyword .tribe-events-c-search__input:focus ~ .tribe-events-c-search__input-control-icon-svg path, .tribe-events .tribe-events-c-search__input-control--location-focus .tribe-events-c-search__input ~ .tribe-events-c-search__input-control-icon-svg path, .tribe-events .tribe-events-c-search__input-control--location .tribe-events-c-search__input:focus ~ .tribe-events-c-search__input-control-icon-svg path, .tribe-events .tribe-events-c-search__input-control-icon-svg path { color: #023605; } .tribe-common--breakpoint-medium.tribe-common .tribe-common-form-control-text__input { padding: 25px 40px 25px 58px; -webkit-box-sizing: border-box; box-sizing: border-box; min-height: 80px; font-weight: 700; } .tribe-common--breakpoint-medium.tribe-events .tribe-events-c-search__input-control-icon-svg { left: 30px; } .tribe-events .tribe-events-c-search__button { background-color: #023605; border-radius: 24px; padding: 13px 50px; } .tribe-events .tribe-events-c-search__button:hover { background-color: #000; } .tribe-common--breakpoint-medium.tribe-events .tribe-events-c-view-selector--tabs .tribe-events-c-view-selector__list-item::after { content: none; } .tribe-common--breakpoint-medium.tribe-common .tribe-common-c-btn-border-small, .tribe-common--breakpoint-medium.tribe-common a.tribe-common-c-btn-border-small { padding: 13px 67px; font-size: 16px; font-weight: 700; border: none; background: #faf8f6; } .tribe-common--breakpoint-full.tribe-events .tribe-events-c-top-bar__datepicker-desktop { font-size: 22px; font-weight: 900; color: #023605; } .tribe-events .datepicker .day.active, .tribe-events .datepicker .day.active.focused, .tribe-events .datepicker .day.active:focus, .tribe-events .datepicker .day.active:hover, .tribe-events .datepicker .month.active, .tribe-events .datepicker .month.active.focused, .tribe-events .datepicker .month.active:focus, .tribe-events .datepicker .month.active:hover, .tribe-events .datepicker .year.active, .tribe-events .datepicker .year.active.focused, .tribe-events .datepicker .year.active:focus, .tribe-events .datepicker .year.active:hover { background-color: #023605; } .tribe-common--breakpoint-medium.tribe-common .tribe-common-h4--min-medium, .tribe-common--breakpoint-full.tribe-events .tribe-events-c-top-bar__datepicker-desktop { font-size: 22px; font-weight: 900; color: #023605; } .tribe-events .tribe-events-calendar-list__event-datetime { font-size: 12px; color: #a49f9f; } .tribe-common .tribe-common-b2 { color: #a49f9f; } .tribe-common .tribe-common-h--alt { font-weight: 700; } .single-tribe_events .tribe-events-c-subscribe-dropdown__container, .tribe-events .tribe-events-c-subscribe-dropdown__container { display: none; } .tribe-events .tribe-events-calendar-list__event-date-tag-weekday { font-size: 16px; font-weight: 700; color: #023605; } .tribe-events .tribe-events-c-view-selector__list-item--active .tribe-events-c-view-selector__list-item-text { font-size: 16px; font-weight: 700; color: #023605; } .tribe-events .tribe-events-c-view-selector__list-item-text { font-size: 16px; font-weight: 700; color: #a49f9f; } .tribe-common--breakpoint-medium.tribe-common .tribe-common-form-control-text__input::-webkit-input-placeholder { color: #a49f9f; font-weight: 700; } .tribe-common--breakpoint-medium.tribe-common .tribe-common-form-control-text__input::-moz-placeholder { color: #a49f9f; font-weight: 700; } .tribe-common--breakpoint-medium.tribe-common .tribe-common-form-control-text__input:-ms-input-placeholder { color: #a49f9f; font-weight: 700; } .tribe-common--breakpoint-medium.tribe-common .tribe-common-form-control-text__input::-ms-input-placeholder { color: #a49f9f; font-weight: 700; } .tribe-common--breakpoint-medium.tribe-common .tribe-common-form-control-text__input::placeholder { color: #a49f9f; font-weight: 700; } .tribe-events .tribe-events-calendar-list__event-title-link { color: #023605; } .tribe-common--breakpoint-medium.tribe-events .tribe-events-c-nav__list-item::after { content: none; } .tribe-common--breakpoint-medium.tribe-events .tribe-events-c-view-selector--tabs .tribe-events-c-view-selector__list-item { padding: 0 25px; } .tribe-common--breakpoint-medium.tribe-common .tribe-common-b1--min-medium { font-size: 14px; font-weight: 700; } /* stylelint-disable */ .upcoming-events-section .title-wrp { text-align: center; } .upcoming-events-section .upcoming-events-wrp { margin-top: 46px; } .upcoming-events-section .upcoming-events-wrp .filteration-wrp { border-top: 0.5px solid #d9d9d9; border-bottom: 0.5px solid #d9d9d9; padding: 28px 0; } @media (min-width: 768px) { .upcoming-events-section .upcoming-events-wrp .filteration-wrp { display: -webkit-box; display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; } } @media (min-width: 992px) { .upcoming-events-section .upcoming-events-wrp .filteration-wrp { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; padding: 16px 0; } } .upcoming-events-section .upcoming-events-wrp .filteration-wrp .selected-year-month-wrp { font-size: 22px; font-weight: 900; text-align: center; color: #023605; margin-bottom: 35px; } @media (min-width: 768px) { .upcoming-events-section .upcoming-events-wrp .filteration-wrp .selected-year-month-wrp { -webkit-box-flex: 1; -ms-flex: 1 0 100%; flex: 1 0 100%; } } @media (min-width: 992px) { .upcoming-events-section .upcoming-events-wrp .filteration-wrp .selected-year-month-wrp { margin: 0; margin-right: 80px; -webkit-box-flex: 0; -ms-flex: 0 0 auto; flex: 0 0 auto; } } .upcoming-events-section .upcoming-events-wrp .filteration-wrp .current-month-button-wrp { margin-bottom: 12px; } @media (min-width: 768px) { .upcoming-events-section .upcoming-events-wrp .filteration-wrp .current-month-button-wrp { max-width: 300px; -webkit-box-flex: 0; -ms-flex: 0 0 auto; flex: 0 0 auto; margin: 0; } } @media (min-width: 992px) { .upcoming-events-section .upcoming-events-wrp .filteration-wrp .current-month-button-wrp { margin: 0; } } .upcoming-events-section .upcoming-events-wrp .filteration-wrp .current-month-button-wrp .current-month { text-align: center; display: inline-block; width: 100%; padding: 18px 44px; background-color: #faf8f6; border-radius: 35px; text-decoration: none; color: #023605; font-weight: 700; will-change: background-color; -webkit-transition: background-color 0.15s ease-in-out; -o-transition: background-color 0.15s ease-in-out; transition: background-color 0.15s ease-in-out; } .upcoming-events-section .upcoming-events-wrp .filteration-wrp .current-month-button-wrp .current-month:hover { background-color: #faf8f6; } .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp { display: -webkit-box; display: -ms-flexbox; display: flex; margin-left: -5px; margin-right: -5px; } @media (min-width: 768px) { .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp { max-width: 330px; -webkit-box-flex: 1; -ms-flex: 1; flex: 1; -webkit-box-align: center; -ms-flex-align: center; align-items: center; margin-left: auto; } } @media (min-width: 992px) { .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp { -webkit-box-flex: 0; -ms-flex: 0 0 360px; flex: 0 0 360px; max-width: none; } } .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp .btn, .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp .comment-form input[type=submit], .comment-form .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp input[type=submit] { -webkit-box-flex: 1; -ms-flex: 1 1 50%; flex: 1 1 50%; min-width: auto; padding: 15px 15px; border-radius: 35px; margin: 0 5px; position: relative; z-index: 1; } @media (min-width: 768px) { .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp .btn, .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp .comment-form input[type=submit], .comment-form .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp input[type=submit] { -webkit-box-shadow: 5px 5px 20px rgba(0, 0, 0, 0.2); box-shadow: 5px 5px 20px rgba(0, 0, 0, 0.2); } } .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp .btn::after, .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp .comment-form input[type=submit]::after, .comment-form .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp input[type=submit]::after { content: ""; position: absolute; z-index: 1; width: 6px; height: 10px; top: 50%; -webkit-transform: translateY(-50%); -o-transform: translateY(-50%); transform: translateY(-50%); } .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp .btn.previous::after, .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp .comment-form input.previous[type=submit]::after, .comment-form .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp input.previous[type=submit]::after { left: 15px; background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSI2LjI4IiBoZWlnaHQ9IjEwLjM0OCIgdmlld0JveD0iMCAwIDYuMjggMTAuMzQ4Ij4KICA8cGF0aCBpZD0iSWNvbl9hd2Vzb21lLWNoZXZyb24tZG93biIgZGF0YS1uYW1lPSJJY29uIGF3ZXNvbWUtY2hldnJvbi1kb3duIiBkPSJNNS4xNjksMTQuOC41NjQsMTAuMTkxYS41NjkuNTY5LDAsMCwxLDAtLjhMMS4xLDguODVhLjU2OS41NjksMCwwLDEsLjgsMEw1LjU3MiwxMi41bDMuNjY3LTMuNjVhLjU2OS41NjksMCwwLDEsLjgsMGwuNTM3LjUzN2EuNTY5LjU2OSwwLDAsMSwwLC44TDUuOTc0LDE0LjhBLjU2OS41NjksMCwwLDEsNS4xNjksMTQuOFoiIHRyYW5zZm9ybT0idHJhbnNsYXRlKDE0Ljk2MyAtMC4zOTgpIHJvdGF0ZSg5MCkiIGZpbGw9IiNmZmYiLz4KPC9zdmc+Cg==); } .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp .btn.next::after, .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp .comment-form input.next[type=submit]::after, .comment-form .upcoming-events-section .upcoming-events-wrp .filteration-wrp .previous-next-button-wrp input.next[type=submit]::after { right: 15px; background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSI2LjI4IiBoZWlnaHQ9IjEwLjM0OCIgdmlld0JveD0iMCAwIDYuMjggMTAuMzQ4Ij4KICA8cGF0aCBpZD0iSWNvbl9hd2Vzb21lLWNoZXZyb24tZG93biIgZGF0YS1uYW1lPSJJY29uIGF3ZXNvbWUtY2hldnJvbi1kb3duIiBkPSJNNC43NzIuMTY3LjE2Nyw0Ljc3MmEuNTY5LjU2OSwwLDAsMCwwLC44TC43LDYuMTEzYS41NjkuNTY5LDAsMCwwLC44LDBsMy42NjctMy42NSwzLjY2NywzLjY1YS41NjkuNTY5LDAsMCwwLC44LDBsLjUzNy0uNTM3YS41NjkuNTY5LDAsMCwwLDAtLjhMNS41NzYuMTY3QS41NjkuNTY5LDAsMCwwLDQuNzcyLjE2N1oiIHRyYW5zZm9ybT0idHJhbnNsYXRlKDYuMjgpIHJvdGF0ZSg5MCkiIGZpbGw9IiNmZmYiLz4KPC9zdmc+Cg==); } .upcoming-events-section .upcoming-events-wrp .event-items-wrp { margin-top: 28px; } .upcoming-events-section .upcoming-events-wrp .event-items-wrp:first-child { padding-top: 28px; border-top: 0.5px solid #d9d9d9; } .upcoming-events-section .upcoming-events-wrp .event-items-wrp:last-child { margin-bottom: 48px; } @media (min-width: 768px) { .upcoming-events-section .upcoming-events-wrp .event-items-wrp { margin-top: 40px; } } .upcoming-events-section .upcoming-events-wrp .event-items-wrp .event-item { text-align: center; border-bottom: 0.5px solid #d9d9d9; margin-bottom: 28px; padding-bottom: 28px; } @media (min-width: 768px) { .upcoming-events-section .upcoming-events-wrp .event-items-wrp .event-item { display: -webkit-box; display: -ms-flexbox; display: flex; text-align: left; -webkit-box-align: center; -ms-flex-align: center; align-items: center; } } .upcoming-events-section .upcoming-events-wrp .event-items-wrp .event-item a { text-decoration: none; } @media (min-width: 768px) { .upcoming-events-section .upcoming-events-wrp .event-items-wrp .event-item a { display: -webkit-box; display: -ms-flexbox; display: flex; text-align: left; -webkit-box-align: center; -ms-flex-align: center; align-items: center; width: 100%; } } .upcoming-events-section .upcoming-events-wrp .event-items-wrp .event-item a .content-wrp .date-time, .upcoming-events-section .upcoming-events-wrp .event-items-wrp .event-item a .content-wrp p { color: #a49f9f; } .upcoming-events-section .upcoming-events-wrp .event-items-wrp .event-item .image-wrp { width: 214px; height: 214px; overflow: hidden; margin: 0 auto; border-radius: 10px; margin-bottom: 30px; } @media (min-width: 768px) { .upcoming-events-section .upcoming-events-wrp .event-items-wrp .event-item .image-wrp { -webkit-box-flex: 0; -ms-flex: 0 0 auto; flex: 0 0 auto; width: 168px; height: 168px; margin: 0; } } .upcoming-events-section .upcoming-events-wrp .event-items-wrp .event-item .image-wrp img { -o-object-fit: cover; object-fit: cover; width: 100%; height: 100%; } .upcoming-events-section .upcoming-events-wrp .event-items-wrp .event-item .date-wrp { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; margin-bottom: 30px; } @media (min-width: 768px) { .upcoming-events-section .upcoming-events-wrp .event-items-wrp .event-item .date-wrp { -webkit-box-flex: 0; -ms-flex: 0 0 20%; flex: 0 0 20%; } } .upcoming-events-section .upcoming-events-wrp .event-items-wrp .event-item .date-wrp span { display: inline-block; line-height: normal; color: #023605; } .upcoming-events-section .upcoming-events-wrp .event-items-wrp .event-item .date-wrp span.day { font-size: 16px; font-weight: 700; } .upcoming-events-section .upcoming-events-wrp .event-items-wrp .event-item .date-wrp span.date { font-size: 22px; font-weight: 900; } .upcoming-events-section .upcoming-events-wrp .event-items-wrp .event-item .content-wrp .date-time { font-size: 12px; font-weight: 500; } .upcoming-events-section .upcoming-events-wrp .event-items-wrp .event-item .content-wrp p { margin-top: 0; } .school-song-section .section-inner-wrp { max-width: 904px; margin: 0 auto; } @media (min-width: 1400px) { .school-song-section .section-inner-wrp { max-width: 1364px; } } @media (min-width: 992px) { .school-song-section .section-inner-wrp .content-wrp { margin-right: auto; max-width: 352px; } } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .content-wrp { max-width: 525px; } } .school-song-section .section-inner-wrp .content-wrp h2 { margin-bottom: 20px; } @media (min-width: 992px) { .school-song-section .section-inner-wrp .content-wrp h2 { margin-bottom: 30px; } } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .content-wrp h2 { margin-bottom: 40px; } } .school-song-section .section-inner-wrp .content-wrp p { margin-bottom: 20px; } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .content-wrp p { margin-bottom: 50px; } } .school-song-section .section-inner-wrp .player-wrp { margin: 50px -16px 0 -16px; background-color: #faf8f6; position: relative; border-radius: 10px; overflow: hidden; height: 458px; padding: 0 30px; z-index: 0; } @media (min-width: 576px) { .school-song-section .section-inner-wrp .player-wrp { margin: 50px auto 0 auto; } } @media (min-width: 992px) { .school-song-section .section-inner-wrp .player-wrp { margin: 0 0 0 auto; margin-top: 0; max-width: 352px; } } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .player-wrp { height: 656px; padding: 0 60px; max-width: 536px; } } .school-song-section .section-inner-wrp .player-wrp::after { content: ""; position: absolute; top: 13px; left: 50%; -webkit-transform: translateX(-50%); -o-transform: translateX(-50%); transform: translateX(-50%); background-color: #023605; width: 150px; height: 3px; } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .player-wrp::after { top: 20px; } } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp { height: 100%; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk { height: 100%; position: relative; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk[data-play=paused] .shk-btn_toggle::after { opacity: 1 !important; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk[data-play=playing] .shk-btn_toggle::before { opacity: 1 !important; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player { background: transparent; -webkit-box-shadow: none; box-shadow: none; margin: 0; height: 100%; padding: 0; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-bar_wrap { position: absolute; bottom: 75px; top: auto; padding: 0; left: 0; margin: 0; right: 0; } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-bar_wrap { bottom: 115px; } } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-bar_wrap .shk-bar { height: 2px; background: #023605; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-bar_wrap .shk-bar .shk-bar_played { background: #023605; height: 3px; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-bar_wrap .shk-bar .shk-bar_played .shk-bar-handle { border: none; -webkit-transform: none; -o-transform: none; transform: none; width: 8px; height: 8px; -webkit-box-shadow: none; box-shadow: none; background: #023605; top: -2.7px; right: -6px; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-cover { position: absolute; top: 60px; left: 50%; -webkit-transform: translateX(-50%); -o-transform: translateX(-50%); transform: translateX(-50%); width: 168px; height: 168px; display: block; } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-cover { top: 90px; width: 260px; height: 260px; } } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-cover::after { content: ""; display: none; position: absolute; top: 50%; left: 50%; -webkit-transform: translate(-50%, -50%); -o-transform: translate(-50%, -50%); transform: translate(-50%, -50%); background-color: #023605; width: 35px; height: 35px; } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-cover::after { width: 54px; height: 54px; } } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-cover img { width: 100%; height: 100%; -o-object-fit: cover; object-fit: cover; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main { max-width: 100%; padding: 0; height: 458px; } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main { height: 656px; } } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text { position: absolute; bottom: 168px; left: 50%; -webkit-transform: translateX(-50%); -o-transform: translateX(-50%); transform: translateX(-50%); } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text { bottom: 230px; } } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-artist_wrap { display: none; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .shk-title { color: #023605; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls { position: absolute; bottom: 95px; left: 50%; -webkit-transform: translateX(-50%); -o-transform: translateX(-50%); transform: translateX(-50%); width: 200px; } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls { bottom: 130px; width: 300px; } } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_speed, .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_more { display: none; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_toggle { position: relative; width: 35px; height: 35px; border-radius: 50%; background-color: #023605; padding: 0; } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_toggle { width: 53px; height: 53px; } } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_toggle svg { display: none; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_toggle::after { content: ""; position: absolute; top: 50%; left: 54%; -webkit-transform: translate(-50%, -50%); -o-transform: translate(-50%, -50%); transform: translate(-50%, -50%); width: 11px; height: 13px; background: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIxNyIgaGVpZ2h0PSIyMCIgdmlld0JveD0iMCAwIDE3IDIwIj4KICA8cGF0aCBpZD0iUG9seWdvbl8yOCIgZGF0YS1uYW1lPSJQb2x5Z29uIDI4IiBkPSJNOS4xMzgsMS40NjVhMSwxLDAsMCwxLDEuNzI0LDBsOC4yNTIsMTQuMDI4QTEsMSwwLDAsMSwxOC4yNTIsMTdIMS43NDhhMSwxLDAsMCwxLS44NjItMS41MDdaIiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgxNykgcm90YXRlKDkwKSIgZmlsbD0iI2Y5ZTdkOSIvPgo8L3N2Zz4K); background-repeat: no-repeat; background-size: cover; border-radius: 0; opacity: 0; visibility: visible; z-index: 1; will-change: opacity; -webkit-transition: opacity 0.15s ease-in-out; -o-transition: opacity 0.15s ease-in-out; transition: opacity 0.15s ease-in-out; } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_toggle::after { width: 17px; height: 20px; } } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_toggle::before { content: ""; position: absolute; top: 50%; left: 50%; -webkit-transform: translate(-50%, -50%); -o-transform: translate(-50%, -50%); transform: translate(-50%, -50%); width: 11px; height: 13px; background: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSI5IiBoZWlnaHQ9IjEzIiB2aWV3Qm94PSIwIDAgOSAxMyI+CiAgPGcgaWQ9Ikdyb3VwXzk2NTgiIGRhdGEtbmFtZT0iR3JvdXAgOTY1OCIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoLTk1NiAtMTk0MikiPgogICAgPHJlY3QgaWQ9IlJlY3RhbmdsZV8yODQzIiBkYXRhLW5hbWU9IlJlY3RhbmdsZSAyODQzIiB3aWR0aD0iMyIgaGVpZ2h0PSIxMyIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoOTU2IDE5NDIpIiBmaWxsPSIjZjZkYmM1Ii8+CiAgICA8cmVjdCBpZD0iUmVjdGFuZ2xlXzI4NDQiIGRhdGEtbmFtZT0iUmVjdGFuZ2xlIDI4NDQiIHdpZHRoPSIzIiBoZWlnaHQ9IjEzIiB0cmFuc2Zvcm09InRyYW5zbGF0ZSg5NjIgMTk0MikiIGZpbGw9IiNmNmRiYzUiLz4KICA8L2c+Cjwvc3ZnPgo=); background-repeat: no-repeat; background-size: cover; border-radius: 0; opacity: 0; visibility: visible; z-index: 1; will-change: opacity; -webkit-transition: opacity 0.15s ease-in-out; -o-transition: opacity 0.15s ease-in-out; transition: opacity 0.15s ease-in-out; } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_toggle::before { width: 17px; height: 20px; } } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_backward { width: 18px; height: 14px; padding: 0; } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_backward { width: 24px; height: 20px; } } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_backward svg { display: none; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_backward::after { content: ""; position: absolute; top: 50%; left: 50%; -webkit-transform: translate(-50%, -50%); -o-transform: translate(-50%, -50%); transform: translate(-50%, -50%); width: 100%; height: 100%; background: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNCIgaGVpZ2h0PSIyMCIgdmlld0JveD0iMCAwIDI0IDIwIj4KICA8ZyBpZD0iR3JvdXBfOTY1NyIgZGF0YS1uYW1lPSJHcm91cCA5NjU3IiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMTM2MiAtMjkxNykiPgogICAgPHBhdGggaWQ9IlBvbHlnb25fMjkiIGRhdGEtbmFtZT0iUG9seWdvbiAyOSIgZD0iTTkuMTM4LDEuNDY1YTEsMSwwLDAsMSwxLjcyNCwwbDguMjUyLDE0LjAyOEExLDEsMCwwLDEsMTguMjUyLDE3SDEuNzQ4YTEsMSwwLDAsMS0uODYyLTEuNTA3WiIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoMTM2OSAyOTM3KSByb3RhdGUoLTkwKSIgZmlsbD0iIzAyMzYwNSIvPgogICAgPHBhdGggaWQ9IlBvbHlnb25fMzAiIGRhdGEtbmFtZT0iUG9seWdvbiAzMCIgZD0iTTkuMTUyLDEuMzU3YTEsMSwwLDAsMSwxLjcsMGw4LjIsMTMuMTEzQTEsMSwwLDAsMSwxOC4yLDE2SDEuOGExLDEsMCwwLDEtLjg0OC0xLjUzWiIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoMTM2MiAyOTM3KSByb3RhdGUoLTkwKSIgZmlsbD0iIzAyMzYwNSIvPgogIDwvZz4KPC9zdmc+Cg==); background-repeat: no-repeat; background-size: cover; border-radius: 0; opacity: 1; visibility: visible; z-index: 1; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_forward { width: 18px; height: 14px; padding: 0; } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_forward { width: 24px; height: 20px; } } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_forward svg { display: none; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_basic .shk-btn_forward::after { content: ""; position: absolute; top: 50%; left: 50%; -webkit-transform: translate(-50%, -50%); -o-transform: translate(-50%, -50%); transform: translate(-50%, -50%); width: 100%; height: 100%; background: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNCIgaGVpZ2h0PSIyMCIgdmlld0JveD0iMCAwIDI0IDIwIj4KICA8ZyBpZD0iR3JvdXBfOTY1NiIgZGF0YS1uYW1lPSJHcm91cCA5NjU2IiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMTY0MCAtMjkxNykiPgogICAgPHBhdGggaWQ9IlBvbHlnb25fMjYiIGRhdGEtbmFtZT0iUG9seWdvbiAyNiIgZD0iTTkuMTM4LDEuNDY1YTEsMSwwLDAsMSwxLjcyNCwwbDguMjUyLDE0LjAyOEExLDEsMCwwLDEsMTguMjUyLDE3SDEuNzQ4YTEsMSwwLDAsMS0uODYyLTEuNTA3WiIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoMTY1NyAyOTE3KSByb3RhdGUoOTApIiBmaWxsPSIjMDIzNjA1Ii8+CiAgICA8cGF0aCBpZD0iUG9seWdvbl8yNyIgZGF0YS1uYW1lPSJQb2x5Z29uIDI3IiBkPSJNOS4xMzgsMS40NjVhMSwxLDAsMCwxLDEuNzI0LDBsOC4yNTIsMTQuMDI4QTEsMSwwLDAsMSwxOC4yNTIsMTdIMS43NDhhMSwxLDAsMCwxLS44NjItMS41MDdaIiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgxNjY0IDI5MTcpIHJvdGF0ZSg5MCkiIGZpbGw9IiMwMjM2MDUiLz4KICA8L2c+Cjwvc3ZnPgo=); background-repeat: no-repeat; background-size: cover; border-radius: 0; opacity: 1; visibility: visible; z-index: 1; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-controls .shk-controls_extra { display: none; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display { width: 100%; top: auto; left: 0; right: auto; bottom: 50px; } @media (min-width: 1400px) { .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display { bottom: 85px; } } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time { display: inline-block; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_now { position: absolute; top: 0; left: 0; color: #023605; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_duration { position: absolute; top: 0; right: 0; color: #023605; } .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_duration::before { display: none; } @media (min-width: 992px) { .school-song-section.college-hymn-section .section-inner-wrp .content-wrp { margin-left: auto; } } @media (min-width: 992px) { .school-song-section.college-hymn-section .section-inner-wrp .player-wrp { margin: 0 auto 0 0; } } @media (min-width: 992px) { .our-history-section .section-inner-wrp .content-img-wrp { position: sticky; top: 160px; bottom: auto; } } @media (min-width: 992px) { .sticky-header .our-history-section .section-inner-wrp .content-img-wrp { top: 105px; } } .our-history-section .section-inner-wrp .content-img-wrp .content-wrp { margin-bottom: 50px; } @media (min-width: 992px) { .our-history-section .section-inner-wrp .content-img-wrp .content-wrp { margin-bottom: 100px; } } @media (min-width: 1400px) { .our-history-section .section-inner-wrp .content-img-wrp .content-wrp { margin-bottom: 60px; } } .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper { position: relative; max-width: 302px; margin: 0 auto; } @media (min-width: 992px) { .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper { max-width: 352px; margin-left: 0; margin-right: 0; } } @media (min-width: 1400px) { .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper { max-width: 534px; } } .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp { overflow: hidden; } .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp img { width: auto; max-width: 225px; -webkit-filter: grayscale(1); filter: grayscale(1); } @media (min-width: 1200px) { .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp img { max-width: 263px; } } @media (min-width: 1400px) { .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp img { max-width: 400px; } } .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp .animation-wrp { display: none; } .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp .animation-wrp .circle-solid-object { top: 25%; right: 25px; background-color: #023605; width: 35px; height: 35px; } @media (min-width: 992px) { .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp .animation-wrp .circle-solid-object { width: 40px; height: 40px; top: 30%; right: 30px; } } @media (min-width: 1400px) { .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp .animation-wrp .circle-solid-object { width: 62px; height: 62px; top: 25%; right: 50px; } } .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp::before { content: ""; width: 100%; height: 153px; position: absolute; bottom: -1px; left: 0; z-index: 1; background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHhtbG5zOnhsaW5rPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5L3hsaW5rIiB3aWR0aD0iNTM0IiBoZWlnaHQ9IjI2OCIgdmlld0JveD0iMCAwIDUzNCAyNjgiPgogIDxkZWZzPgogICAgPGNsaXBQYXRoIGlkPSJjbGlwLXBhdGgiPgogICAgICA8cmVjdCBpZD0iUmVjdGFuZ2xlXzI4NDAiIGRhdGEtbmFtZT0iUmVjdGFuZ2xlIDI4NDAiIHdpZHRoPSI1MzQiIGhlaWdodD0iMjY4IiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtNjQxOSAtNzkzMykiIGZpbGw9IiNmZmYiLz4KICAgIDwvY2xpcFBhdGg+CiAgPC9kZWZzPgogIDxnIGlkPSJNYXNrX0dyb3VwXzE5OCIgZGF0YS1uYW1lPSJNYXNrIEdyb3VwIDE5OCIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoNjQxOSA3OTMzKSIgY2xpcC1wYXRoPSJ1cmwoI2NsaXAtcGF0aCkiPgogICAgPHBhdGggaWQ9IkV4Y2x1c2lvbl8xIiBkYXRhLW5hbWU9IkV4Y2x1c2lvbiAxIiBkPSJNMjY3LDQxNC44MWMtNC4zMTEsMC04LjY3NS0uMS0xMi45NzEtLjMxaDI1Ljk0MkMyNzUuNjYxLDQxNC43MDcsMjcxLjMsNDE0LjgxLDI2Nyw0MTQuODFabTI2Ny0uMzFIMjc5Ljk3MUM0MjIuMDIzLDQwNy43MDgsNTMzLjYwNiwyOTAuOSw1MzQsMTQ4LjU2NFptLTI4MC4wMTMsMEgwVjE0OC40NzhjLjM1MiwxNDIuMzUsMTExLjkxNiwyNTkuMiwyNTMuOTg3LDI2Ni4wMlpNMCwxNDcuNDQ3SDBWMTM2LjVIMy40NTJBMTkuMjUsMTkuMjUsMCwwLDAsMCwxNDcuNDQ3Wm01MzQtLjMwOGgwYy0uMDExLTMuNDg5LS4xMDUtNy4wNjgtLjI4MS0xMC42MzlIMy40NTJhMjcuMzgzLDI3LjM4MywwLDAsMSwxMC4wODYtOC4zLDY2LjAxNiw2Ni4wMTYsMCwwLDEsMTUuOC01LjRjMTEuNDkzLTIuNTY1LDI2LjIyOC0zLjgxMSw0NS4wNDUtMy44MTEsMzQuNjU2LDAsNzYuODQ5LDQuMjY2LDExNy42NTIsOC4zOTJsLjAwNSwwaDBjMzcuMjU4LDMuNzY3LDcyLjQ1LDcuMzI2LDk4Ljg2LDcuMzI2LDE5Ljc2NywwLDM5LjM0OS04LjY0Miw1OS44NjUtMjYuNDIxYTI2My4wNiwyNjMuMDYsMCwwLDAsMjUuNjUyLTI2LjA3OWM4LjE1Mi05LjM1MSwxNS45MS0xOS4wNzYsMjMuNDEyLTI4LjQ4MSw5LjY0OS0xMi4xLDE4Ljc2Mi0yMy41MiwyNy41NzItMzIuNzE1QTExNS41LDExNS41LDAsMCwxLDQ0MC4zODksOS4xMjIsNDguMSw0OC4xLDAsMCwxLDQ1My4wMSwxLjg1MywyOS43OTEsMjkuNzkxLDAsMCwxLDQ2My4yMjcsMGM4LjgsMCwxNy41MzksNC4wNjYsMjUuOTg1LDEyLjA4NGE4Ni41MjUsODYuNTI1LDAsMCwxLDExLjUzNCwxMy43NzNBMTM5LjgzNywxMzkuODM3LDAsMCwxLDUxMC45NzEsNDMuNmExOTguMTM5LDE5OC4xMzksMCwwLDEsOC42NjIsMjAuODI0YzIuNTkzLDcuMzM5LDQuOSwxNS4wODMsNi44NDcsMjMuMDE3LDEuOTU5LDcuOTcsMy41NjcsMTYuMTUzLDQuNzc5LDI0LjMyMiwxLjIzMiw4LjMsMi4wNTksMTYuNjI3LDIuNDU5LDI0LjczOEg1MzRaIiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtNjQxOS4wMDEgLTgwNzkuNSkiIGZpbGw9IiNmZmYiLz4KICA8L2c+Cjwvc3ZnPgo=); background-position: center center; background-repeat: no-repeat; background-size: contain; } @media (min-width: 1200px) { .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp::before { height: 177px; } } @media (min-width: 1400px) { .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp::before { height: 270px; } } @media (max-width: 374px) { .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp::before { height: 127px; } } .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp::after { content: ""; width: 100%; height: 180px; display: block; background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSI1MzQuMDAxIiBoZWlnaHQ9IjQxNC44MTEiIHZpZXdCb3g9IjAgMCA1MzQuMDAxIDQxNC44MTEiPgogIDxwYXRoIGlkPSJQYXRoXzIiIGRhdGEtbmFtZT0iUGF0aCAyIiBkPSJNMjQzLjEsMjEzLjI3N2MtNzIuODQ1LDAtMTE5LjYwOS0xMTcuMzY4LTE2Mi4xMDktMTMyLjg1NkMzNy45MjMsNjQuNzI1LDAsMTUxLjc2MywwLDIyNi4zNzdjMCwxNDcuNDYsMTE5LjU0LDI2NywyNjcsMjY3czI2Ny0xMTkuNTQsMjY3LTI2N0M1MzQsMTcwLjM0MywzMzQuNTI2LDIxMy4yNzcsMjQzLjEsMjEzLjI3N1oiIHRyYW5zZm9ybT0idHJhbnNsYXRlKDAgLTc4LjU2NykiIGZpbGw9IiMwMjM2MDUiLz4KPC9zdmc+Cg==); background-position: center center; background-repeat: no-repeat; background-size: contain; position: absolute; bottom: 0; left: 0; z-index: -1; } @media (min-width: 992px) { .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp::after { height: 180px; } } @media (min-width: 1200px) { .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp::after { height: 210px; } } @media (min-width: 1400px) { .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp::after { height: 310px; } } @media (max-width: 374px) { .our-history-section .section-inner-wrp .content-img-wrp .image-wrapper .image-inner-wrp::after { height: 190px; } } .our-history-section .section-inner-wrp .animation-content-wrp { display: none; z-index: -1; position: relative; } .our-history-section .section-inner-wrp .animation-content-wrp .circle-object { top: 310px; left: 50px; display: none; } @media (min-width: 992px) { .our-history-section .section-inner-wrp .animation-content-wrp .circle-object { display: block; } } .our-history-section .section-inner-wrp .history-items-wrp .item-wrp { padding: 40px 50px; margin-bottom: 30px; -webkit-box-shadow: 5px 5px 30px rgba(0, 0, 0, 0.102); box-shadow: 5px 5px 30px rgba(0, 0, 0, 0.102); border-radius: 10px; background-color: #fff; } @media (min-width: 992px) { .our-history-section .section-inner-wrp .history-items-wrp .item-wrp { max-width: 536px; padding: 50px 40px; margin-bottom: 50px; } } @media (min-width: 1400px) { .our-history-section .section-inner-wrp .history-items-wrp .item-wrp { max-width: 812px; padding: 50px; margin-bottom: 100px; } } .our-history-section .section-inner-wrp .history-items-wrp .item-wrp:nth-child(even) { margin-left: auto; } .our-history-section .section-inner-wrp .history-items-wrp .item-wrp:first-child { margin-top: 50px; } @media (min-width: 992px) { .our-history-section .section-inner-wrp .history-items-wrp .item-wrp:first-child { margin-top: 0; } } .our-history-section .section-inner-wrp .history-items-wrp .item-wrp:last-child { margin-bottom: 0; } .principals-section { overflow: hidden; margin-top: 105px; } .principals-section .section-inner-wrp .intro-content h1 { margin-bottom: 50px; } .principals-section .section-inner-wrp .date-wrp-outter { position: relative; margin-bottom: 40px; padding: 0; margin-left: -36px; margin-right: -36px; } @media (min-width: 576px) { .principals-section .section-inner-wrp .date-wrp-outter { margin-left: 0; margin-right: 0; } } @media (min-width: 992px) { .principals-section .section-inner-wrp .date-wrp-outter { margin-bottom: 70px; } } @media (min-width: 1400px) { .principals-section .section-inner-wrp .date-wrp-outter { margin-bottom: 100px; } } .principals-section .section-inner-wrp .date-wrp-outter::after { content: ""; position: absolute; top: 50px; left: 0; background-color: #d9d9d9; width: 100%; height: 0.5px; z-index: -1; } .principals-section .section-inner-wrp .date-wrp-outter .date-wrp { max-width: 730px; margin: 0 auto; overflow: hidden; outline: 0; } @media (min-width: 1200px) { .principals-section .section-inner-wrp .date-wrp-outter .date-wrp { max-width: 904px; } } @media (min-width: 1400px) { .principals-section .section-inner-wrp .date-wrp-outter .date-wrp { max-width: 1364px; } } .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item { width: 50%; text-align: center; position: relative; margin: 0 9px; cursor: pointer; } @media (min-width: 992px) { .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item { width: 100%; max-width: 170px; } } @media (min-width: 1400px) { .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item { max-width: 260px; margin: 0 8px; } } .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item::after { content: ""; position: absolute; top: 46px; left: 50%; -webkit-transform: translateX(-50%); -o-transform: translateX(-50%); transform: translateX(-50%); width: 8px; height: 8px; border-radius: 50%; background-color: #a49f9f; } .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item h4, .principals-section .sports-incharge-contacts-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item .sports-contacts-wrp .sports-contacts-item span, .sports-incharge-contacts-section .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item .sports-contacts-wrp .sports-contacts-item span, .principals-section .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item .date-wrp-outter .date-wrp .date-item span, .sports-incharge-contacts-section .principals-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item .date-wrp-outter .date-wrp .date-item span, .principals-section .school-song-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .shk-title, .school-song-section .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .shk-title, .principals-section .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .date-wrp-outter .date-wrp .date-item .shk-title, .school-song-section .principals-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .date-wrp-outter .date-wrp .date-item .shk-title, .principals-section .school-song-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_now, .school-song-section .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_now, .principals-section .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .date-wrp-outter .date-wrp .date-item .shk-time_now, .school-song-section .principals-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .date-wrp-outter .date-wrp .date-item .shk-time_now, .principals-section .school-song-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_duration, .school-song-section .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_duration, .principals-section .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .date-wrp-outter .date-wrp .date-item .shk-time_duration, .school-song-section .principals-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .date-wrp-outter .date-wrp .date-item .shk-time_duration { color: #a49f9f; margin-bottom: 35px; } .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item h4:last-child, .principals-section .sports-incharge-contacts-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item .sports-contacts-wrp .sports-contacts-item span:last-child, .sports-incharge-contacts-section .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item .sports-contacts-wrp .sports-contacts-item span:last-child, .principals-section .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item .date-wrp-outter .date-wrp .date-item span:last-child, .sports-incharge-contacts-section .principals-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item .date-wrp-outter .date-wrp .date-item span:last-child, .principals-section .school-song-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .shk-title:last-child, .school-song-section .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .shk-title:last-child, .principals-section .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .date-wrp-outter .date-wrp .date-item .shk-title:last-child, .school-song-section .principals-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .date-wrp-outter .date-wrp .date-item .shk-title:last-child, .principals-section .school-song-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_now:last-child, .school-song-section .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_now:last-child, .principals-section .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .date-wrp-outter .date-wrp .date-item .shk-time_now:last-child, .school-song-section .principals-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .date-wrp-outter .date-wrp .date-item .shk-time_now:last-child, .principals-section .school-song-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_duration:last-child, .school-song-section .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_duration:last-child, .principals-section .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .date-wrp-outter .date-wrp .date-item .shk-time_duration:last-child, .school-song-section .principals-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .date-wrp-outter .date-wrp .date-item .shk-time_duration:last-child { margin-bottom: 0; } .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item.is-selected h4, .principals-section .sports-incharge-contacts-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item.is-selected .sports-contacts-wrp .sports-contacts-item span, .sports-incharge-contacts-section .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item.is-selected .sports-contacts-wrp .sports-contacts-item span, .principals-section .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item .date-wrp-outter .date-wrp .date-item.is-selected span, .sports-incharge-contacts-section .principals-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item .date-wrp-outter .date-wrp .date-item.is-selected span, .principals-section .school-song-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item.is-selected .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .shk-title, .school-song-section .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item.is-selected .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .shk-title, .principals-section .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .date-wrp-outter .date-wrp .date-item.is-selected .shk-title, .school-song-section .principals-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .date-wrp-outter .date-wrp .date-item.is-selected .shk-title, .principals-section .school-song-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item.is-selected .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_now, .school-song-section .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item.is-selected .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_now, .principals-section .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .date-wrp-outter .date-wrp .date-item.is-selected .shk-time_now, .school-song-section .principals-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .date-wrp-outter .date-wrp .date-item.is-selected .shk-time_now, .principals-section .school-song-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item.is-selected .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_duration, .school-song-section .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item.is-selected .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_duration, .principals-section .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .date-wrp-outter .date-wrp .date-item.is-selected .shk-time_duration, .school-song-section .principals-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .date-wrp-outter .date-wrp .date-item.is-selected .shk-time_duration { color: #000; } .principals-section .section-inner-wrp .date-wrp-outter .date-wrp .date-item.is-selected::after { background-color: #000; } .principals-section .section-inner-wrp .date-wrp-outter .flickity-button { position: absolute; top: 30px; display: none; will-change: background-color; -webkit-transition: background-color 0.15s ease-in-out; -o-transition: background-color 0.15s ease-in-out; transition: background-color 0.15s ease-in-out; } @media (min-width: 992px) { .principals-section .section-inner-wrp .date-wrp-outter .flickity-button { display: block; } } .principals-section .section-inner-wrp .slider-content { max-width: 904px; margin: 0 auto; overflow: hidden; outline: 0; } @media (min-width: 992px) { .principals-section .section-inner-wrp .slider-content { padding-top: 40px; } } @media (min-width: 1400px) { .principals-section .section-inner-wrp .slider-content { max-width: 1364px; padding-top: 54px; } } .principals-section .section-inner-wrp .slider-content .slider-item { width: 100%; margin: 0 8px; } .principals-section .section-inner-wrp .slider-content .slider-item .image-wrapper { position: relative; margin-top: 35px; margin-right: 25px; } @media (min-width: 992px) { .principals-section .section-inner-wrp .slider-content .slider-item .image-wrapper { max-width: 352px; margin-top: 0; margin-right: 30px; margin-left: auto; } } @media (min-width: 1400px) { .principals-section .section-inner-wrp .slider-content .slider-item .image-wrapper { max-width: 536px; margin-right: 44px; } } .principals-section .section-inner-wrp .slider-content .slider-item .image-wrapper::after { content: ""; display: none; position: absolute; top: -12px; background: #faf8f6; width: 100%; height: 100%; z-index: -1; border-radius: 10px; -webkit-animation: twocolbg 2s infinite alternate; -o-animation: twocolbg 2s infinite alternate; animation: twocolbg 2s infinite alternate; right: -12px; } @media (min-width: 992px) { .principals-section .section-inner-wrp .slider-content .slider-item .image-wrapper::after { top: -15px; right: -15px; } } @media (min-width: 1400px) { .principals-section .section-inner-wrp .slider-content .slider-item .image-wrapper::after { top: -22px; right: -22px; } } .principals-section .section-inner-wrp .slider-content .slider-item .image-wrapper::before { content: ""; display: none; position: absolute; top: -25px; right: -25px; background: #faf8f6; width: 100%; height: 100%; z-index: -2; border-radius: 10px; -webkit-animation: twocolbg 2s infinite alternate; -o-animation: twocolbg 2s infinite alternate; animation: twocolbg 2s infinite alternate; -webkit-animation-delay: 1s; -o-animation-delay: 1s; animation-delay: 1s; } @media (min-width: 992px) { .principals-section .section-inner-wrp .slider-content .slider-item .image-wrapper::before { top: -30px; right: -30px; } } @media (min-width: 1400px) { .principals-section .section-inner-wrp .slider-content .slider-item .image-wrapper::before { top: -44px; right: -44px; } } .principals-section .section-inner-wrp .slider-content .slider-item .image-wrapper img { border-radius: 10px; } @keyframes twocolbg { 0% { -webkit-transform: translateY(0); -o-transform: translateY(0); transform: translateY(0); } 100% { -webkit-transform: translateY(-10px); -o-transform: translateY(-10px); transform: translateY(-10px); } } .principals-section .section-inner-wrp .slider-content .slider-item .content-wrp { margin-top: 50px; text-align: center; } @media (min-width: 992px) { .principals-section .section-inner-wrp .slider-content .slider-item .content-wrp { max-width: 444px; margin-left: auto; margin-top: 0; text-align: left; } } @media (min-width: 1400px) { .principals-section .section-inner-wrp .slider-content .slider-item .content-wrp { max-width: 674px; } } .principals-section .section-inner-wrp .slider-content .slider-item .content-wrp h3 { color: #000; } .principals-section.vice-principals-section { margin-top: 75px !important; } @media (min-width: 992px) { .principals-section.vice-principals-section .section-inner-wrp .slider-content .slider-item .content-wrp { margin-left: 0; margin-right: auto; } } .principals-section.headmistress-section { background-color: #faf8f6; } .principals-section.headmistress-section .section-inner-wrp .intro-content span { font-size: 18px; line-height: 24px; font-weight: 900; color: #023605; } @media (min-width: 1400px) { .principals-section.headmistress-section .section-inner-wrp .intro-content span { font-size: 22px; line-height: 32px; } } .principals-section.headmistress-section .section-inner-wrp .date-wrp-outter { margin-bottom: 0; z-index: 1; } @media (min-width: 1400px) { .our-school-committee .section-inner-wrp .content-wrapper { max-width: 674px !important; } } .our-school-committee .animation-wrp { display: none; position: absolute; width: 100%; height: 100%; top: 0; left: 0; z-index: -1; overflow: hidden; } .our-school-committee .animation-wrp .triangle-object { top: 35%; left: -30px; } @media (min-width: 1400px) { .our-school-committee .animation-wrp .triangle-object { top: 33%; left: -50px; } } .our-school-committee .animation-wrp .circle-object { top: 68%; right: -35px; } @media (min-width: 1400px) { .our-school-committee .animation-wrp .circle-object { top: 60%; right: -70px; } } @media (min-width: 992px) { .school-staff-section .section-inner-wrp .cards-wrp .cards-item-wrp { display: none; } } .school-staff-section .button-wrapper { display: none; } @media (min-width: 992px) { .school-staff-section .button-wrapper { display: block; } } .school-staff-section .animation-wrp { display: none; position: absolute; width: 100%; height: 100%; top: 0; left: 0; z-index: -1; overflow: hidden; } .school-staff-section .animation-wrp .triangle-object:first-child { top: 57%; left: -40px; right: -35px; } @media (min-width: 992px) { .school-staff-section .animation-wrp .triangle-object:first-child { top: 57%; left: -60px; } } .school-staff-section .animation-wrp .triangle-object:nth-child(2) { top: 68%; right: -40px; -webkit-animation-delay: 1s; -o-animation-delay: 1s; animation-delay: 1s; } @media (min-width: 992px) { .school-staff-section .animation-wrp .triangle-object:nth-child(2) { top: 68%; right: -63px; } } .school-staff-section .animation-wrp .circle-object { top: 54%; right: -50px; } @media (min-width: 1400px) { .school-staff-section .animation-wrp .circle-object { top: 54%; right: -70px; } } .sectional-heads-section { overflow: hidden; margin-top: 75px; } .sectional-heads-section .title-description-wrp { text-align: center; padding: 0 36px; margin: 0 auto; margin-bottom: 50px; max-width: 720px; } @media (min-width: 1200px) { .sectional-heads-section .title-description-wrp { margin-bottom: 80px; } } @media (min-width: 1400px) { .sectional-heads-section .title-description-wrp { max-width: 1364px; margin-bottom: 75px; } } .sectional-heads-section .title-description-wrp .title-description-content-wrp { max-width: 536px; margin: 0 auto; max-width: 626px; } .sectional-heads-section .sectional-heads-slider-wrp { outline: none; text-align: center; } .sectional-heads-section .sectional-heads-slider-wrp .section-head-item { max-width: 300px; text-align: center; width: 100%; padding: 20px 18px; cursor: pointer; border: 0.5px solid #faf8f6; border-radius: 10px; margin: 0 8px; } @media (min-width: 1200px) { .sectional-heads-section .sectional-heads-slider-wrp .section-head-item { max-width: 370px; padding: 0 36px; margin: 0; border: none; } } @media (min-width: 1400px) { .sectional-heads-section .sectional-heads-slider-wrp .section-head-item { max-width: 490px; padding: 0 60px; } } .sectional-heads-section .sectional-heads-slider-wrp .section-head-item .image-content-wrp { margin-bottom: 24px; } .sectional-heads-section .sectional-heads-slider-wrp .section-head-item .image-content-wrp .img-wrp { width: 144px; height: 144px; border-radius: 50%; overflow: hidden; margin: 0 auto; margin-bottom: 32px; } @media (min-width: 1400px) { .sectional-heads-section .sectional-heads-slider-wrp .section-head-item .image-content-wrp .img-wrp { width: 266px; height: 266px; } } .sectional-heads-section .sectional-heads-slider-wrp .section-head-item .image-content-wrp .img-wrp img { -o-object-fit: cover; object-fit: cover; width: 100%; height: 100%; } .sectional-heads-section .sectional-heads-slider-wrp .section-head-item .image-content-wrp .head-description { line-height: normal; } .sectional-heads-section .sectional-heads-slider-wrp .section-head-item .image-content-wrp .head-description .name { font-size: 16px; font-weight: 700; display: block; color: #000; line-height: normal; } @media (min-width: 1400px) { .sectional-heads-section .sectional-heads-slider-wrp .section-head-item .image-content-wrp .head-description .name { font-size: 20px; margin-bottom: 7px; } } .sectional-heads-section .sectional-heads-slider-wrp .flickity-button { display: none; } @media (min-width: 992px) { .sectional-heads-section .sectional-heads-slider-wrp .flickity-button { display: inline-block; position: relative; z-index: 1; margin: 0 8px; } } @media (min-width: 992px) { .sectional-heads-section .sectional-heads-slider-wrp .flickity-page-dots { display: none; } } .sectional-heads-section .sectional-heads-slider-wrp .flickity-viewport { margin-bottom: 50px; } .our-sports-section .section-inner-wrp .intro-content h1 { margin-bottom: 30px; } @media (min-width: 1400px) { .our-sports-section .section-inner-wrp .intro-content h1 { margin-bottom: 50px; } } .our-sports-section .section-inner-wrp .sports-items-wrp { outline: 0; overflow: hidden; } .our-sports-section .section-inner-wrp .sports-items-wrp .sports-item { width: 100%; max-width: 100%; height: 330px; border-radius: 10px; overflow: hidden; margin: 0 10px; background-position: center; background-repeat: no-repeat; background-size: cover; } @media (min-width: 768px) { .our-sports-section .section-inner-wrp .sports-items-wrp .sports-item { max-width: 260px; height: 285px; margin: 0 8px; } } @media (min-width: 1400px) { .our-sports-section .section-inner-wrp .sports-items-wrp .sports-item { max-width: 398px; height: 435px; } } .our-sports-section .section-inner-wrp .sports-items-wrp .sports-item .content-wrp { height: 100%; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: end; -ms-flex-align: end; align-items: flex-end; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; padding: 28px 23px; position: relative; z-index: 1; } @media (min-width: 768px) { .our-sports-section .section-inner-wrp .sports-items-wrp .sports-item .content-wrp { padding: 20px; } } @media (min-width: 1400px) { .our-sports-section .section-inner-wrp .sports-items-wrp .sports-item .content-wrp { padding: 55px 23px; } } .our-sports-section .section-inner-wrp .sports-items-wrp .sports-item .content-wrp::after { content: ""; position: absolute; bottom: 0; left: 0; width: 100%; height: 100%; background: transparent -webkit-gradient(linear, left top, left bottom, from(rgba(255, 255, 255, 0)), color-stop(51%, rgba(125, 152, 126, 0)), to(rgb(2, 54, 5))) 0% 0% no-repeat padding-box; background: transparent -webkit-linear-gradient(top, rgba(255, 255, 255, 0) 0%, rgba(125, 152, 126, 0) 51%, rgb(2, 54, 5) 100%) 0% 0% no-repeat padding-box; background: transparent -o-linear-gradient(top, rgba(255, 255, 255, 0) 0%, rgba(125, 152, 126, 0) 51%, rgb(2, 54, 5) 100%) 0% 0% no-repeat padding-box; background: transparent linear-gradient(180deg, rgba(255, 255, 255, 0) 0%, rgba(125, 152, 126, 0) 51%, rgb(2, 54, 5) 100%) 0% 0% no-repeat padding-box; z-index: -1; } .our-sports-section .section-inner-wrp .sports-items-wrp .sports-item .content-wrp h3 { margin-bottom: 0; color: #fff; } .our-sports-section .section-inner-wrp .sports-items-wrp .flickity-button { margin-top: 50px; display: none; position: relative; } @media (min-width: 768px) { .our-sports-section .section-inner-wrp .sports-items-wrp .flickity-button { display: inline-block; } } .our-sports-section .section-inner-wrp .sports-items-wrp .flickity-button.next { margin-left: 10px; } .our-sports-section .section-inner-wrp .sports-items-wrp .flickity-page-dots { list-style: none; padding-right: 25px; text-align: center; } .our-sports-section .section-inner-wrp .sports-items-wrp .flickity-page-dots .dot { display: inline-block; width: 12px; height: 12px; opacity: 1; background: #faf8f6; margin: 4px; margin-top: 10px; border-radius: 6px; } .our-sports-section .section-inner-wrp .sports-items-wrp .flickity-page-dots .dot.is-selected { background: #023605; } @media (min-width: 768px) { .our-sports-section .section-inner-wrp .sports-items-wrp .flickity-page-dots { display: none; } } @media (min-width: 1400px) { .map-section .section-inner-wrp { max-width: 1364px; margin: 0 auto; } } .map-section .contact-form-outer-wrp .contact-detail-wrp { text-align: center; margin-bottom: 50px; font-weight: 700; } .map-section .contact-form-outer-wrp .contact-detail-wrp strong, .map-section .contact-form-outer-wrp .contact-detail-wrp b { color: #000; } @media (min-width: 992px) { .map-section .contact-form-outer-wrp .contact-detail-wrp { text-align: left; } } .map-section .acf-map { height: 402px; border-radius: 10px; margin-left: -16px; margin-right: -16px; } @media (min-width: 768px) { .map-section .acf-map { margin-left: 0; margin-right: 0; } } @media (min-width: 1400px) { .map-section .acf-map { height: 600px; } } .sports-incharge-contacts-section { overflow: hidden; } .sports-incharge-contacts-section .section-inner-wrp .intro-content h3 { margin-bottom: 30px; } @media (min-width: 1400px) { .sports-incharge-contacts-section .section-inner-wrp .intro-content h3 { margin-bottom: 50px; } } .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp { display: -webkit-box; display: -ms-flexbox; display: flex; gap: 80px 20px; -ms-flex-wrap: wrap; flex-wrap: wrap; padding: 15px 5px; } @media (min-width: 1400px) { .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp { gap: 80px 40px; } } .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item { padding: 30px; background-color: #faf8f6; border-radius: 10px; position: relative; width: 100%; } @media (min-width: 992px) { .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item { padding: 20px; width: calc(50% - 15px); } } @media (min-width: 1400px) { .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item { padding: 30px; width: calc(33% - 30px); } } .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item::after { content: ""; width: 100%; height: 100%; border: 1px solid #faf8f6; position: absolute; top: 0; left: 0; z-index: -1; border-radius: 10px; -webkit-transform: rotate(2.5deg); -o-transform: rotate(2.5deg); transform: rotate(2.5deg); } .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item::before { content: ""; width: 100%; height: 100%; border: 1px solid #faf8f6; position: absolute; top: 0; left: 0; z-index: -1; border-radius: 10px; -webkit-transform: rotate(5deg); -o-transform: rotate(5deg); transform: rotate(5deg); } @media (min-width: 1400px) { .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item h4, .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item span, .sports-incharge-contacts-section .school-song-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .shk-title, .school-song-section .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .shk-title, .sports-incharge-contacts-section .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .sports-contacts-wrp .sports-contacts-item .shk-title, .school-song-section .sports-incharge-contacts-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-text .shk-title_wrap .shk-title_inner .sports-contacts-wrp .sports-contacts-item .shk-title, .sports-incharge-contacts-section .school-song-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_now, .school-song-section .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_now, .sports-incharge-contacts-section .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .sports-contacts-wrp .sports-contacts-item .shk-time_now, .school-song-section .sports-incharge-contacts-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .sports-contacts-wrp .sports-contacts-item .shk-time_now, .sports-incharge-contacts-section .school-song-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_duration, .school-song-section .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .shk-time_duration, .sports-incharge-contacts-section .school-song-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .sports-contacts-wrp .sports-contacts-item .shk-time_duration, .school-song-section .sports-incharge-contacts-section .section-inner-wrp .player-wrp .audio-player-inner-wrp .shk .shk-player .shk-body .shk-main .shk-display .shk-time .sports-contacts-wrp .sports-contacts-item .shk-time_duration { font-size: 18px; } } .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item span { color: #a49f9f; word-break: break-all; } @media (min-width: 576px) { .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item span { font-size: 16px; word-break: keep-all; } } @media (min-width: 1400px) { .sports-incharge-contacts-section .section-inner-wrp .sports-contacts-wrp .sports-contacts-item span { font-size: 16px; } } /* stylelint-disable */ .single-post img, .single-events img { border-radius: 10px; } .single-post .post, .single-post .events, .single-events .post, .single-events .events { padding: 150px 0 0; } @media (min-width: 992px) { .single-post .post, .single-post .events, .single-events .post, .single-events .events { padding: 200px 0 0; } } .single-post .post .intro-wrp .intro-wrp-inner, .single-post .events .intro-wrp .intro-wrp-inner, .single-events .post .intro-wrp .intro-wrp-inner, .single-events .events .intro-wrp .intro-wrp-inner { max-width: 1164px; margin: 0 auto 50px; } .single-post .post .intro-wrp .intro-wrp-inner .title-date-wrp p, .single-post .events .intro-wrp .intro-wrp-inner .title-date-wrp p, .single-events .post .intro-wrp .intro-wrp-inner .title-date-wrp p, .single-events .events .intro-wrp .intro-wrp-inner .title-date-wrp p { font-size: 24px; line-height: 32px; font-weight: 700; color: #dee2e6; margin-bottom: 10px; } .single-post .post .intro-wrp .intro-wrp-inner .title-date-wrp h2, .single-post .events .intro-wrp .intro-wrp-inner .title-date-wrp h2, .single-events .post .intro-wrp .intro-wrp-inner .title-date-wrp h2, .single-events .events .intro-wrp .intro-wrp-inner .title-date-wrp h2 { margin-bottom: 50px; } .single-post .post .intro-wrp .intro-wrp-inner .banner-wrp img, .single-post .events .intro-wrp .intro-wrp-inner .banner-wrp img, .single-events .post .intro-wrp .intro-wrp-inner .banner-wrp img, .single-events .events .intro-wrp .intro-wrp-inner .banner-wrp img { height: 390px; -o-object-fit: cover; object-fit: cover; } @media (min-width: 992px) { .single-post .post .intro-wrp .intro-wrp-inner .banner-wrp img, .single-post .events .intro-wrp .intro-wrp-inner .banner-wrp img, .single-events .post .intro-wrp .intro-wrp-inner .banner-wrp img, .single-events .events .intro-wrp .intro-wrp-inner .banner-wrp img { height: 590px; } } @media (min-width: 1400px) { .single-post .post .intro-wrp .intro-wrp-inner .banner-wrp img, .single-post .events .intro-wrp .intro-wrp-inner .banner-wrp img, .single-events .post .intro-wrp .intro-wrp-inner .banner-wrp img, .single-events .events .intro-wrp .intro-wrp-inner .banner-wrp img { height: 690px; } } .single-post .post .content-wrp *:not(.btn), .single-post .events .content-wrp *:not(.btn), .single-events .post .content-wrp *:not(.btn), .single-events .events .content-wrp *:not(.btn) { text-align: left; } .single-post .post .content-wrp .content-section .intro-content h2, .single-post .events .content-wrp .content-section .intro-content h2, .single-events .post .content-wrp .content-section .intro-content h2, .single-events .events .content-wrp .content-section .intro-content h2 { text-align: center; } .single-post .post .content-wrp .content-section .other-content li, .single-post .events .content-wrp .content-section .other-content li, .single-events .post .content-wrp .content-section .other-content li, .single-events .events .content-wrp .content-section .other-content li { padding-left: 0; } .single-post .post .content-wrp .content-section .other-content .button-wrapper .btn, .single-post .post .content-wrp .content-section .other-content .button-wrapper .comment-form input[type=submit], .comment-form .single-post .post .content-wrp .content-section .other-content .button-wrapper input[type=submit], .single-post .events .content-wrp .content-section .other-content .button-wrapper .btn, .single-post .events .content-wrp .content-section .other-content .button-wrapper .comment-form input[type=submit], .comment-form .single-post .events .content-wrp .content-section .other-content .button-wrapper input[type=submit], .single-events .post .content-wrp .content-section .other-content .button-wrapper .btn, .single-events .post .content-wrp .content-section .other-content .button-wrapper .comment-form input[type=submit], .comment-form .single-events .post .content-wrp .content-section .other-content .button-wrapper input[type=submit], .single-events .events .content-wrp .content-section .other-content .button-wrapper .btn, .single-events .events .content-wrp .content-section .other-content .button-wrapper .comment-form input[type=submit], .comment-form .single-events .events .content-wrp .content-section .other-content .button-wrapper input[type=submit] { text-align: center; } .single-post .related-stories .intro-section p, .single-events .related-stories .intro-section p { font-size: 24px; font-weight: 800; color: #faf8f6; margin-bottom: 40px; } /* stylelint-disable */ .post-listing-wrp { position: relative; } .post-listing-wrp .section-inner-wrp { max-width: 1088px; margin: 0 auto; } @media (min-width: 1400px) { .post-listing-wrp .section-inner-wrp { max-width: 1640px; } } .post-listing-wrp .section-inner-wrp .intro-section { margin-bottom: 50px; } .post-listing-wrp .section-inner-wrp .intro-section p { max-width: 100%; } @media (min-width: 768px) { .post-listing-wrp .section-inner-wrp .intro-section p { max-width: 550px; margin: auto; } } @media (min-width: 1200px) { .post-listing-wrp .section-inner-wrp .intro-section p { max-width: 650px; margin: auto; } } .post-listing-wrp .section-inner-wrp .post-wrp .row { margin: -8px; } .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp { padding: 8px; } @media (min-width: 768px) { .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp.featured-post .post-item a .image-wrp { padding-right: 8px; } } @media (min-width: 768px) { .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp.featured-post .post-item a .image-wrp img { height: 100%; } } .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp.featured-post .post-item a .featured-content { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; width: 100%; height: 100%; } .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp.featured-post .post-item a .featured-content .post-content .post-description { display: block; } .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-flex: 0; -ms-flex: 0 0 25%; flex: 0 0 25%; min-height: 100%; will-change: border; -webkit-transition: border 0.15s ease-in-out; -o-transition: border 0.15s ease-in-out; transition: border 0.15s ease-in-out; } .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item .button-wrapper .btn, .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item .button-wrapper .comment-form input[type=submit], .comment-form .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item .button-wrapper input[type=submit] { -webkit-box-shadow: none !important; box-shadow: none !important; } .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item:hover { cursor: pointer; } .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item:hover .button-wrapper .btn, .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item:hover .button-wrapper .comment-form input[type=submit], .comment-form .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item:hover .button-wrapper input[type=submit] { background-color: #023605; color: #fff; -webkit-box-shadow: none !important; box-shadow: none !important; } .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a { text-decoration: none; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; -webkit-box-shadow: 5px 5px 30px rgba(0, 0, 0, 0.102); box-shadow: 5px 5px 30px rgba(0, 0, 0, 0.102); width: 100%; border-radius: 10px; overflow: hidden; } .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a:hover { text-decoration: none; } .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .image-wrp img { height: 265px; -o-object-fit: cover; object-fit: cover; } .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; -ms-flex-wrap: wrap; flex-wrap: wrap; -ms-flex-line-pack: start; align-content: flex-start; height: 100%; padding: 50px 15px 0; } @media (min-width: 992px) { .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content { padding: 40px 22px 0; } } @media (min-width: 1400px) { .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content { padding: 50px 40px 0; } } .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content .post-date { margin-bottom: 10px; } @media (min-width: 992px) { .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content .post-date { margin-bottom: 30px; } } @media (min-width: 1400px) { .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content .post-date { margin-bottom: 50px; } } .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content .post-date p { font-size: 14px; line-height: 22px; color: #a49f9f; } .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content .post-description { overflow: hidden; display: -webkit-box; -webkit-box-orient: vertical; -webkit-line-clamp: 4; } .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .post-content .post-description > * { color: #a49f9f; } .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .button-wrapper { margin-top: 30px; padding: 0 15px 50px 15px; } @media (min-width: 992px) { .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .button-wrapper { margin-top: 50px; padding: 0 22px 40px 22px; } } @media (min-width: 1400px) { .post-listing-wrp .section-inner-wrp .post-wrp .row .post-item-wrp .post-item a .button-wrapper { margin-top: 50px; padding: 0 40px 64px 40px; } } .post-listing-wrp .section-inner-wrp .post-wrp .alm-btn-wrap { text-align: center; margin-top: 100px; } .post-listing-wrp .section-inner-wrp .post-wrp .alm-btn-wrap .done { display: none; } .post-listing-wrp .section-inner-wrp .pagination-wrapper { margin-top: 100px; } .post-listing-wrp .section-inner-wrp .pagination-wrapper .pagination .page-numbers { color: #9ca0a2; margin-right: 16px; text-decoration: none; cursor: pointer; will-change: color; -webkit-transition: color 0.15s ease-in-out; -o-transition: color 0.15s ease-in-out; transition: color 0.15s ease-in-out; } .post-listing-wrp .section-inner-wrp .pagination-wrapper .pagination .page-numbers:hover { color: #023605; } .post-listing-wrp .section-inner-wrp .pagination-wrapper .pagination .page-numbers:hover.next::after, .post-listing-wrp .section-inner-wrp .pagination-wrapper .pagination .page-numbers:hover.prev::after { background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNS4wNyIgaGVpZ2h0PSIxMi43MjQiIHZpZXdCb3g9IjAgMCAyNS4wNyAxMi43MjQiPgogIDxnIGlkPSJHcm91cF8zNzc5IiBkYXRhLW5hbWU9Ikdyb3VwIDM3NzkiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC01MTAgLTQ1NDYuNjM3KSI+CiAgICA8bGluZSBpZD0iTGluZV81MyIgZGF0YS1uYW1lPSJMaW5lIDUzIiB4Mj0iMjMiIHRyYW5zZm9ybT0idHJhbnNsYXRlKDUxMCA0NTUzKSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSIjMDIzNjA1IiBzdHJva2Utd2lkdGg9IjIiLz4KICAgIDxwYXRoIGlkPSJQYXRoXzYyNDEiIGRhdGEtbmFtZT0iUGF0aCA2MjQxIiBkPSJNMCwwSDhWOCIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoNTI4LjAwMSA0NTQ3LjM0NCkgcm90YXRlKDQ1KSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSIjMDIzNjA1IiBzdHJva2Utd2lkdGg9IjIiLz4KICA8L2c+Cjwvc3ZnPgo=); will-change: background-image; -webkit-transition: background-image 0.15s ease-in-out; -o-transition: background-image 0.15s ease-in-out; transition: background-image 0.15s ease-in-out; } .post-listing-wrp .section-inner-wrp .pagination-wrapper .pagination .page-numbers:last-child { margin-right: 0; } .post-listing-wrp .section-inner-wrp .pagination-wrapper .pagination .page-numbers.current { color: #023605; cursor: default; } .post-listing-wrp .section-inner-wrp .pagination-wrapper .pagination .page-numbers.next, .post-listing-wrp .section-inner-wrp .pagination-wrapper .pagination .page-numbers.prev { position: relative; width: 18px; } .post-listing-wrp .section-inner-wrp .pagination-wrapper .pagination .page-numbers.next::after, .post-listing-wrp .section-inner-wrp .pagination-wrapper .pagination .page-numbers.prev::after { content: ""; position: absolute; top: 50%; left: 50%; -webkit-transform: translate(-50%, -50%); -o-transform: translate(-50%, -50%); transform: translate(-50%, -50%); background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNS4wNyIgaGVpZ2h0PSIxMi43MjQiIHZpZXdCb3g9IjAgMCAyNS4wNyAxMi43MjQiPgogIDxnIGlkPSJHcm91cF8zNzc5IiBkYXRhLW5hbWU9Ikdyb3VwIDM3NzkiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC01MTAgLTQ1NDYuNjM3KSI+CiAgICA8bGluZSBpZD0iTGluZV81MyIgZGF0YS1uYW1lPSJMaW5lIDUzIiB4Mj0iMjMiIHRyYW5zZm9ybT0idHJhbnNsYXRlKDUxMCA0NTUzKSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSIjOWNhMGEyIiBzdHJva2Utd2lkdGg9IjIiLz4KICAgIDxwYXRoIGlkPSJQYXRoXzYyNDEiIGRhdGEtbmFtZT0iUGF0aCA2MjQxIiBkPSJNMCwwSDhWOCIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoNTI4LjAwMSA0NTQ3LjM0NCkgcm90YXRlKDQ1KSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSIjOWNhMGEyIiBzdHJva2Utd2lkdGg9IjIiLz4KICA8L2c+Cjwvc3ZnPgo=); background-repeat: no-repeat; background-size: cover; background-position: right; width: 18px; height: 12px; will-change: background-image; -webkit-transition: background-image 0.15s ease-in-out; -o-transition: background-image 0.15s ease-in-out; transition: background-image 0.15s ease-in-out; } .post-listing-wrp .section-inner-wrp .pagination-wrapper .pagination .page-numbers.prev::after { -webkit-transform: translate(-50%, -50%) rotate(180deg); -o-transform: translate(-50%, -50%) rotate(180deg); transform: translate(-50%, -50%) rotate(180deg); } .post-listing-wrp .animation-wrp { display: none; position: absolute; width: 100%; height: 100%; top: 0; left: 0; z-index: -1; overflow: hidden; } .post-listing-wrp .animation-wrp .triangle-object { top: 2%; right: -30px; } @media (min-width: 1400px) { .post-listing-wrp .animation-wrp .triangle-object { top: 10%; right: -55px; } } .post-listing-wrp .animation-wrp .circle-solid-object { display: none; } @media (min-width: 992px) { .post-listing-wrp .animation-wrp .circle-solid-object { display: block; top: 4%; right: 41%; } } @media (min-width: 1400px) { .post-listing-wrp .animation-wrp .circle-solid-object { top: 8%; right: 41%; } } .post-listing-wrp .animation-wrp .circle-object:first-child { bottom: 3%; left: -30px; } @media (min-width: 1400px) { .post-listing-wrp .animation-wrp .circle-object:first-child { bottom: 3%; left: -75px; } } .post-listing-wrp .animation-wrp .circle-object:nth-child(2) { top: 120px; right: 82%; -webkit-animation-delay: 1s; -o-animation-delay: 1s; animation-delay: 1s; } @media (min-width: 1400px) { .post-listing-wrp .animation-wrp .circle-object:nth-child(2) { top: 150px; right: 69%; } } .circle-solid-object { width: 30px; height: 30px; background-color: #fff; border-radius: 50%; position: absolute; -webkit-animation: bounceside 0.5s infinite alternate; -o-animation: bounceside 0.5s infinite alternate; animation: bounceside 0.5s infinite alternate; } @media (min-width: 992px) { .circle-solid-object { width: 60px; height: 60px; } } @media (min-width: 1400px) { .circle-solid-object { width: 85px; height: 85px; } } .single-post .circle-solid-object, .single-events .circle-solid-object { display: none; } @media (min-width: 992px) { .fcp-section:not(.banner-section) .circle-solid-object { width: 60px; height: 60px; } } .circle-solid-object.color-primary { background-color: #023605; } .circle-solid-object.color-secondary { background-color: #faf8f6; } @-webkit-keyframes bounceside { 0% { -webkit-transform: translateY(0); transform: translateY(0); } 100% { -webkit-transform: translateX(-10px); transform: translateX(-10px); } } @-o-keyframes bounceside { 0% { -o-transform: translateY(0); transform: translateY(0); } 100% { -o-transform: translateX(-10px); transform: translateX(-10px); } } @keyframes bounceside { 0% { -webkit-transform: translateY(0); -o-transform: translateY(0); transform: translateY(0); } 100% { -webkit-transform: translateX(-10px); -o-transform: translateX(-10px); transform: translateX(-10px); } } .circle-object { width: 75px; height: 75px; border: 15px solid #fff; border-radius: 50%; position: absolute; -webkit-animation: bounce 2s infinite alternate; -o-animation: bounce 2s infinite alternate; animation: bounce 2s infinite alternate; } @media (min-width: 992px) { .circle-object { width: 100px; height: 100px; } } @media (min-width: 1400px) { .circle-object { width: 150px; height: 150px; border: 25px solid #fff; } } .single-post .circle-object, .single-events .circle-object { display: none; } @media (min-width: 992px) { .fcp-section:not(.banner-section) .circle-object { width: 100px; height: 100px; border-width: 15px; } } .circle-object.color-primary { border-color: #023605; } .circle-object.color-secondary { border-color: #faf8f6; } @-webkit-keyframes bounce { 0% { -webkit-transform: translateY(0); transform: translateY(0); } 100% { -webkit-transform: translateY(-20px); transform: translateY(-20px); } } @-o-keyframes bounce { 0% { -o-transform: translateY(0); transform: translateY(0); } 100% { -o-transform: translateY(-20px); transform: translateY(-20px); } } @keyframes bounce { 0% { -webkit-transform: translateY(0); -o-transform: translateY(0); transform: translateY(0); } 100% { -webkit-transform: translateY(-20px); -o-transform: translateY(-20px); transform: translateY(-20px); } } .triangle-object { width: 60px; height: 55px; position: absolute; border-left: 30px solid transparent; border-right: 30px solid transparent; border-bottom: 55px solid #fff; -webkit-animation: rotate 50s infinite linear; -o-animation: rotate 50s infinite linear; animation: rotate 50s infinite linear; } @media (min-width: 992px) { .triangle-object { width: 80px; height: 65px; border-left: 40px solid transparent; border-right: 40px solid transparent; border-bottom: 65px solid #fff; } } @media (min-width: 1400px) { .triangle-object { width: 140px; height: 110px; border-left: 70px solid transparent; border-right: 70px solid transparent; border-bottom: 110px solid #fff; } } .single-post .triangle-object, .single-events .triangle-object { display: none; } @media (min-width: 992px) { .fcp-section:not(.banner-section) .triangle-object { width: 80px; height: 65px; border-left: 40px solid transparent; border-right: 40px solid transparent; border-bottom-width: 65px; } } .triangle-object.color-primary { border-bottom-color: #023605; } .triangle-object.color-secondary { border-bottom-color: #faf8f6; } @-webkit-keyframes rotate { 0% { -webkit-transform: rotate(0); transform: rotate(0); } 100% { -webkit-transform: rotate(360deg); transform: rotate(360deg); } } @-o-keyframes rotate { 0% { -o-transform: rotate(0); transform: rotate(0); } 100% { -o-transform: rotate(360deg); transform: rotate(360deg); } } @keyframes rotate { 0% { -webkit-transform: rotate(0); -o-transform: rotate(0); transform: rotate(0); } 100% { -webkit-transform: rotate(360deg); -o-transform: rotate(360deg); transform: rotate(360deg); } } /* stylelint-disable */ .header { position: fixed; width: 100%; top: 0; z-index: 6; background-color: #faf8f6; will-change: background-color; -webkit-transition: background-color 0.15s ease-in-out; -o-transition: background-color 0.15s ease-in-out; transition: background-color 0.15s ease-in-out; } .header.enable-scroll-up { -webkit-transition: top 0.3s ease-in-out; -o-transition: top 0.3s ease-in-out; transition: top 0.3s ease-in-out; } .sticky-header .header { background-color: #faf8f6; } .show-menu .header { z-index: 6; } .header .header-container { margin: 0 auto; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-pack: justify; -ms-flex-pack: justify; justify-content: space-between; -webkit-box-align: center; -ms-flex-align: center; align-items: center; } @media (min-width: 1200px) { .header .header-container { -webkit-box-align: baseline; -ms-flex-align: baseline; align-items: baseline; } } .header .header-container .logo-wrp { position: relative; max-width: 170px; padding: 5px 0; will-change: all; -webkit-transition: all 0.15s ease-in-out; -o-transition: all 0.15s ease-in-out; transition: all 0.15s ease-in-out; } @media (min-width: 1200px) { .header .header-container .logo-wrp { max-width: 230px; } } .header .header-container .logo-wrp img { width: 56px; will-change: width; -webkit-transition: width 0.15s ease-in-out; -o-transition: width 0.15s ease-in-out; transition: width 0.15s ease-in-out; } @media (min-width: 1200px) { .header .header-container .logo-wrp img { width: 120px; } } @media (min-width: 1400px) { .header .header-container .logo-wrp img { width: 140px; } } .header .header-container .nav-with-button { display: none; } @media (min-width: 1200px) { .header .header-container .nav-with-button { display: block; will-change: all; -webkit-transition: all 0.15s ease-in-out; -o-transition: all 0.15s ease-in-out; transition: all 0.15s ease-in-out; } } .sticky-header .header .header-container .nav-with-button { background: #faf8f6; } @media (min-width: 1200px) { .sticky-header .header .header-container .nav-with-button { background-color: transparent; } } .header .header-container .nav-with-button .nav-primary > div > ul > li { margin-left: 20px; position: relative; z-index: 1; } @media (min-width: 1400px) { .header .header-container .nav-with-button .nav-primary > div > ul > li { margin-left: 30px; } } .header .header-container .nav-with-button .nav-primary > div > ul > li:first-child { margin-left: 0; } .header .header-container .nav-with-button .nav-primary > div > ul > li.menu-item-has-children > a { padding-right: 16px; } .header .header-container .nav-with-button .nav-primary > div > ul > li.menu-item-has-children > a:before { content: ""; -webkit-transform: translateY(-50%) rotate(180deg); -o-transform: translateY(-50%) rotate(180deg); transform: translateY(-50%) rotate(180deg); background-color: #023605; -webkit-mask: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZpZXdCb3g9IjAgMCA0NDggNTEyIj48cGF0aCBmaWxsPSIjMDUyNTNjIiBkPSJNMjAxLjQgMTA1LjRjMTIuNS0xMi41IDMyLjgtMTIuNSA0NS4zIDBsMTkyIDE5MmMxMi41IDEyLjUgMTIuNSAzMi44IDAgNDUuM3MtMzIuOCAxMi41LTQ1LjMgMEwyMjQgMTczLjMgNTQuNiAzNDIuNmMtMTIuNSAxMi41LTMyLjggMTIuNS00NS4zIDBzLTEyLjUtMzIuOCAwLTQ1LjNsMTkyLTE5MnoiLz48L3N2Zz4=) no-repeat center; mask: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZpZXdCb3g9IjAgMCA0NDggNTEyIj48cGF0aCBmaWxsPSIjMDUyNTNjIiBkPSJNMjAxLjQgMTA1LjRjMTIuNS0xMi41IDMyLjgtMTIuNSA0NS4zIDBsMTkyIDE5MmMxMi41IDEyLjUgMTIuNSAzMi44IDAgNDUuM3MtMzIuOCAxMi41LTQ1LjMgMEwyMjQgMTczLjMgNTQuNiAzNDIuNmMtMTIuNSAxMi41LTMyLjggMTIuNS00NS4zIDBzLTEyLjUtMzIuOCAwLTQ1LjNsMTkyLTE5MnoiLz48L3N2Zz4=) no-repeat center; -webkit-mask-size: contain; mask-size: contain; position: absolute; width: 10px; height: 7px; z-index: 1; top: 50%; right: 0; bottom: auto; left: auto; will-change: default, transform; -webkit-transition: default, transform 0.15s ease-in-out; -o-transition: default, transform 0.15s ease-in-out; -webkit-transition: default, -webkit-transform 0.15s ease-in-out; transition: default, -webkit-transform 0.15s ease-in-out; -o-transition: default, -o-transform 0.15s ease-in-out; transition: default, transform 0.15s ease-in-out; transition: default, transform 0.15s ease-in-out, -webkit-transform 0.15s ease-in-out, -o-transform 0.15s ease-in-out; } .header .header-container .nav-with-button .nav-primary > div > ul > li.menu-item-has-children > a::after { content: none; } .header .header-container .nav-with-button .nav-primary > div > ul > li.menu-item-has-children:hover > ul.sub-menu { opacity: 1; pointer-events: visible; } .header .header-container .nav-with-button .nav-primary > div > ul > li.menu-item-has-children > .sub-menu li.menu-item-has-children:hover > ul.sub-menu { opacity: 1; pointer-events: visible; } .header .header-container .nav-with-button .nav-primary > div > ul > li.menu-item-has-children:nth-last-child(2) .sub-menu { right: 0; left: auto; } .header .header-container .nav-with-button .nav-primary > div > ul > li.menu-item-has-children:nth-last-child(2) .sub-menu li .sub-menu { right: 100%; left: auto; } .header .header-container .nav-with-button .nav-primary > div > ul > li.menu-item-has-children.btn.nav-btn > a::before { display: none; } .header .header-container .nav-with-button .nav-primary > div > ul > li.menu-item-has-children.btn.nav-btn .sub-menu { display: none; } .header .header-container .nav-with-button .nav-primary > div > ul > li:hover a:after { opacity: 1; } .header .header-container .nav-with-button .nav-primary > div > ul > li:hover a:before { -webkit-transform: translateY(-50%) rotate(180deg); -o-transform: translateY(-50%) rotate(180deg); transform: translateY(-50%) rotate(180deg); } .header .header-container .nav-with-button .nav-primary > div > ul > li.current-menu-item a:after { opacity: 1; } .header .header-container .nav-with-button .nav-primary > div > ul > li a { color: #023605; text-decoration: none; display: inline-block; } .header .header-container .nav-with-button .nav-primary > div > ul > li > a { padding: 0; position: relative; z-index: 1; padding-top: 10px; padding-bottom: 10px; } .header .header-container .nav-with-button .nav-primary > div > ul > li > a:after { content: ""; display: block; background-color: #023605; opacity: 0; position: absolute; width: 100%; height: 2px; z-index: 1; bottom: 0; left: 0; top: auto; right: auto; will-change: opacity; -webkit-transition: opacity 0.15s ease-in-out; -o-transition: opacity 0.15s ease-in-out; transition: opacity 0.15s ease-in-out; } .header .header-container .nav-with-button .nav-primary > div > ul > li .sub-menu { list-style: none; padding: 0; margin: 0; min-width: 227px; max-width: 326px; opacity: 0; pointer-events: none; background-color: #faf8f6; border: 1px solid #e4e1de; position: absolute; width: auto; height: auto; z-index: 1; top: 100%; left: 0; bottom: auto; right: auto; will-change: opacity; -webkit-transition: opacity 0.15s ease-in-out; -o-transition: opacity 0.15s ease-in-out; transition: opacity 0.15s ease-in-out; } .sticky-header .header .header-container .nav-with-button .nav-primary > div > ul > li .sub-menu { background-color: #faf8f6; } .header .header-container .nav-with-button .nav-primary > div > ul > li .sub-menu li { position: relative; z-index: 1; } .header .header-container .nav-with-button .nav-primary > div > ul > li .sub-menu li.menu-item-has-children > a { padding-right: 30px; } .header .header-container .nav-with-button .nav-primary > div > ul > li .sub-menu li.menu-item-has-children > a:before { content: ""; -webkit-transform: translateY(-50%) rotate(90deg); -o-transform: translateY(-50%) rotate(90deg); transform: translateY(-50%) rotate(90deg); background-color: #023605; -webkit-mask: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZpZXdCb3g9IjAgMCA0NDggNTEyIj48cGF0aCBmaWxsPSIjMDUyNTNjIiBkPSJNMjAxLjQgMTA1LjRjMTIuNS0xMi41IDMyLjgtMTIuNSA0NS4zIDBsMTkyIDE5MmMxMi41IDEyLjUgMTIuNSAzMi44IDAgNDUuM3MtMzIuOCAxMi41LTQ1LjMgMEwyMjQgMTczLjMgNTQuNiAzNDIuNmMtMTIuNSAxMi41LTMyLjggMTIuNS00NS4zIDBzLTEyLjUtMzIuOCAwLTQ1LjNsMTkyLTE5MnoiLz48L3N2Zz4=) no-repeat center; mask: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZpZXdCb3g9IjAgMCA0NDggNTEyIj48cGF0aCBmaWxsPSIjMDUyNTNjIiBkPSJNMjAxLjQgMTA1LjRjMTIuNS0xMi41IDMyLjgtMTIuNSA0NS4zIDBsMTkyIDE5MmMxMi41IDEyLjUgMTIuNSAzMi44IDAgNDUuM3MtMzIuOCAxMi41LTQ1LjMgMEwyMjQgMTczLjMgNTQuNiAzNDIuNmMtMTIuNSAxMi41LTMyLjggMTIuNS00NS4zIDBzLTEyLjUtMzIuOCAwLTQ1LjNsMTkyLTE5MnoiLz48L3N2Zz4=) no-repeat center; -webkit-mask-size: contain; mask-size: contain; position: absolute; width: 10px; height: 7px; z-index: 1; top: 50%; right: 20px; bottom: auto; left: auto; will-change: transform; -webkit-transition: transform 0.15s ease-in-out; -o-transition: transform 0.15s ease-in-out; -webkit-transition: -webkit-transform 0.15s ease-in-out; transition: -webkit-transform 0.15s ease-in-out; -o-transition: -o-transform 0.15s ease-in-out; transition: transform 0.15s ease-in-out; transition: transform 0.15s ease-in-out, -webkit-transform 0.15s ease-in-out, -o-transform 0.15s ease-in-out; } .header .header-container .nav-with-button .nav-primary > div > ul > li .sub-menu li a { display: block; padding: 6px 16px; } .header .header-container .nav-with-button .nav-primary > div > ul > li .sub-menu li a:hover { background-color: #f0e7e0; color: #023605; } .header .header-container .nav-with-button .nav-primary > div > ul > li .sub-menu li .sub-menu { left: 100%; top: 0; } .header .header-container .nav-with-button .nav-primary > div > ul > li:nth-last-child(-n+3) .sub-menu { left: auto; right: 0; } .header .header-container .nav-with-button .nav-primary > div > ul > li:nth-last-child(-n+3) .sub-menu li.menu-item-has-children .sub-menu { left: auto; right: 100%; } .header .header-container .nav-with-button .nav-primary > div.sub-menu > li a { font-size: 14px; line-height: 24px; font-weight: 600; } .header .header-container .search-wrp-mobile { position: sticky; bottom: 0; z-index: 2; background-color: #faf8f6; padding: 30px 0 60px 0; } .sticky-header .header .header-container .search-wrp-mobile { background-color: #faf8f6; } .header .header-container .search-wrp { padding-left: 28px; border-bottom: 1px solid #f0e7e0; max-width: 150px; margin: 0 auto; position: relative; will-change: margin; -webkit-transition: margin 0.15s ease-in-out; -o-transition: margin 0.15s ease-in-out; transition: margin 0.15s ease-in-out; } @media (min-width: 576px) { .header .header-container .search-wrp { max-width: 320px; } } @media (min-width: 1200px) { .header .header-container .search-wrp { z-index: 0; width: 170px; max-width: 100%; bottom: unset; margin: 0; } } @media (min-width: 1400px) { .header .header-container .search-wrp { margin-top: 30px; width: 230px; } } @media (min-width: 1200px) { .sticky-header .header .header-container .search-wrp { margin-top: 34px; } } @media (min-width: 1400px) { .sticky-header .header .header-container .search-wrp { margin-top: 30px; } } .header .header-container .search-wrp::after { content: ""; background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIxNi41NjQiIGhlaWdodD0iMTYuNTY0IiB2aWV3Qm94PSIwIDAgMTYuNTY0IDE2LjU2NCI+CiAgPGcgaWQ9Ikljb25fZmVhdGhlci1zZWFyY2giIGRhdGEtbmFtZT0iSWNvbiBmZWF0aGVyLXNlYXJjaCIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoLTMuNSAtMy41KSI+CiAgICA8cGF0aCBpZD0iUGF0aF8xNzk4NCIgZGF0YS1uYW1lPSJQYXRoIDE3OTg0IiBkPSJNMTUuNDE2LDkuOTU4QTUuNDU4LDUuNDU4LDAsMSwxLDkuOTU4LDQuNSw1LjQ1OCw1LjQ1OCwwLDAsMSwxNS40MTYsOS45NThaIiBmaWxsPSJub25lIiBzdHJva2U9IiMwMjM2MDUiIHN0cm9rZS1saW5lY2FwPSJyb3VuZCIgc3Ryb2tlLWxpbmVqb2luPSJyb3VuZCIgc3Ryb2tlLXdpZHRoPSIyIi8+CiAgICA8cGF0aCBpZD0iUGF0aF8xNzk4NSIgZGF0YS1uYW1lPSJQYXRoIDE3OTg1IiBkPSJNMjkuODEzLDI5LjgxM2wtNC44MzgtNC44MzgiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0xMS4xNjIgLTExLjE2MikiIGZpbGw9Im5vbmUiIHN0cm9rZT0iIzAyMzYwNSIgc3Ryb2tlLWxpbmVjYXA9InJvdW5kIiBzdHJva2UtbGluZWpvaW49InJvdW5kIiBzdHJva2Utd2lkdGg9IjIiLz4KICA8L2c+Cjwvc3ZnPgo=); background-size: cover; background-repeat: no-repeat; width: 14px; height: 14px; position: absolute; top: 50%; left: 7px; -webkit-transform: translateY(-50%); -o-transform: translateY(-50%); transform: translateY(-50%); } @media (min-width: 1200px) { .header .header-container .search-wrp::after { left: 0; } } .header .header-container .search-wrp input { background: transparent; border: none; outline: 0; width: 100%; color: #023605; font-weight: 600; } .header .header-container .search-wrp input::-webkit-input-placeholder { color: #a49f9f; font-weight: 600; } .header .header-container .search-wrp input::-moz-placeholder { color: #a49f9f; font-weight: 600; } .header .header-container .search-wrp input:-ms-input-placeholder { color: #a49f9f; font-weight: 600; } .header .header-container .search-wrp input::-ms-input-placeholder { color: #a49f9f; font-weight: 600; } .header .header-container .search-wrp input::placeholder { color: #a49f9f; font-weight: 600; } .header .header-container .mobile-menu { width: 24px; height: 10px; cursor: pointer; position: relative; } @media (min-width: 1200px) { .header .header-container .mobile-menu { display: none; } } .show-menu .header .header-container .mobile-menu { height: 9px; } .header .header-container .mobile-menu span { width: 100%; height: 3px; background-color: #023605; display: block; position: absolute; will-change: all 300ms; -webkit-transition: all 300ms 0.15s ease-in-out; -o-transition: all 300ms 0.15s ease-in-out; transition: all 300ms 0.15s ease-in-out; } .show-menu .header .header-container .mobile-menu span { top: 0; left: 0; } .header .header-container .mobile-menu span:first-child { top: 0; } .show-menu .header .header-container .mobile-menu span:first-child { -webkit-transform: rotateZ(45deg); -o-transform: rotateZ(45deg); transform: rotateZ(45deg); top: 8px; } .header .header-container .mobile-menu span:last-child { top: 6px; width: 70%; right: 0; } .show-menu .header .header-container .mobile-menu span:last-child { -webkit-transform: rotateZ(-45deg); -o-transform: rotateZ(-45deg); transform: rotateZ(-45deg); top: 8px; width: 100%; right: 0; left: auto; } .mobile-menu { display: block; } @media (min-width: 1200px) { .mobile-menu { display: none; } } .mobile-menu .menu-wrp { position: fixed; top: 0; left: 0; z-index: 5; background-color: #faf8f6; width: 100%; padding: 60px 0; height: 100%; -webkit-transform: translate3d(100%, 0, 0); transform: translate3d(100%, 0, 0); will-change: 0.5s, transform; -webkit-transition: 0.5s, transform 0.15s ease-in-out; -o-transition: 0.5s, transform 0.15s ease-in-out; -webkit-transition: 0.5s, -webkit-transform 0.15s ease-in-out; transition: 0.5s, -webkit-transform 0.15s ease-in-out; -o-transition: 0.5s, -o-transform 0.15s ease-in-out; transition: 0.5s, transform 0.15s ease-in-out; transition: 0.5s, transform 0.15s ease-in-out, -webkit-transform 0.15s ease-in-out, -o-transform 0.15s ease-in-out; -webkit-transition-timing-function: cubic-bezier(0.7, 0, 0.3, 1); -o-transition-timing-function: cubic-bezier(0.7, 0, 0.3, 1); transition-timing-function: cubic-bezier(0.7, 0, 0.3, 1); } .sticky-header .mobile-menu .menu-wrp { background-color: #faf8f6; } .home-header-variation .mobile-menu .menu-wrp, .sub-page-header-variation .mobile-menu .menu-wrp { z-index: 4; } .home-header-variation.no-banner .mobile-menu .menu-wrp, .sub-page-header-variation.no-banner .mobile-menu .menu-wrp { z-index: 5; } .show-menu .mobile-menu .menu-wrp { -webkit-transform: translate3d(0, 0, 0); transform: translate3d(0, 0, 0); } .mobile-menu .menu-wrp .nav-primary { overflow: auto; height: 100%; } .mobile-menu .menu-wrp .nav-primary > div .nav { position: relative; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; } .mobile-menu .menu-wrp .nav-primary > div .nav li { list-style: none; margin: 0; } .mobile-menu .menu-wrp .nav-primary > div .nav li a { color: #023605; display: block; padding: 16px 32px; border-top: 1px solid #878787; text-decoration: none; will-change: background-color; -webkit-transition: background-color 0.15s ease-in-out; -o-transition: background-color 0.15s ease-in-out; transition: background-color 0.15s ease-in-out; } .mobile-menu .menu-wrp .nav-primary > div .nav li a:hover { background-color: transparent; } .mobile-menu .menu-wrp .nav-primary > div .nav li.menu-item-has-children > a { position: relative; z-index: 1; } .mobile-menu .menu-wrp .nav-primary > div .nav li.menu-item-has-children > a .sub-menu-arrow { -webkit-transform: translateY(-50%) rotate(90deg); -o-transform: translateY(-50%) rotate(90deg); transform: translateY(-50%) rotate(90deg); position: absolute; width: 50px; height: 100%; z-index: 1; top: 50%; right: 20px; bottom: auto; left: auto; } .mobile-menu .menu-wrp .nav-primary > div .nav li.menu-item-has-children > a .sub-menu-arrow::after { content: ""; background-color: #023605; -webkit-mask: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZpZXdCb3g9IjAgMCA0NDggNTEyIj48cGF0aCBmaWxsPSIjMDUyNTNjIiBkPSJNMjAxLjQgMTA1LjRjMTIuNS0xMi41IDMyLjgtMTIuNSA0NS4zIDBsMTkyIDE5MmMxMi41IDEyLjUgMTIuNSAzMi44IDAgNDUuM3MtMzIuOCAxMi41LTQ1LjMgMEwyMjQgMTczLjMgNTQuNiAzNDIuNmMtMTIuNSAxMi41LTMyLjggMTIuNS00NS4zIDBzLTEyLjUtMzIuOCAwLTQ1LjNsMTkyLTE5MnoiLz48L3N2Zz4=) no-repeat center; mask: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZpZXdCb3g9IjAgMCA0NDggNTEyIj48cGF0aCBmaWxsPSIjMDUyNTNjIiBkPSJNMjAxLjQgMTA1LjRjMTIuNS0xMi41IDMyLjgtMTIuNSA0NS4zIDBsMTkyIDE5MmMxMi41IDEyLjUgMTIuNSAzMi44IDAgNDUuM3MtMzIuOCAxMi41LTQ1LjMgMEwyMjQgMTczLjMgNTQuNiAzNDIuNmMtMTIuNSAxMi41LTMyLjggMTIuNS00NS4zIDBzLTEyLjUtMzIuOCAwLTQ1LjNsMTkyLTE5MnoiLz48L3N2Zz4=) no-repeat center; -webkit-mask-size: contain; mask-size: contain; position: absolute; width: 9px; height: 13px; z-index: 1; top: 50%; left: 50%; bottom: auto; right: auto; -webkit-transform: translate(-50%, -50%); -o-transform: translate(-50%, -50%); transform: translate(-50%, -50%); } .mobile-menu .menu-wrp .nav-primary > div .nav li.menu-item-has-children.btn.nav-btn > a::after { display: none; } .mobile-menu .menu-wrp .nav-primary > div .nav li.menu-item-has-children.btn.nav-btn .sub-menu { display: none; } .mobile-menu .menu-wrp .nav-primary > div .nav li:last-child { border-bottom: 1px solid #878787; } .mobile-menu .menu-wrp .nav-primary > div .nav > .menu-item-has-children > .sub-menu-wrap { position: fixed; top: 0; left: 0; width: 100%; height: 100%; z-index: 6; background-color: #faf8f6; -webkit-transform: translate3d(100%, 0, 0); transform: translate3d(100%, 0, 0); will-change: transform; -webkit-transition: transform 0.15s ease-in-out; -o-transition: transform 0.15s ease-in-out; -webkit-transition: -webkit-transform 0.15s ease-in-out; transition: -webkit-transform 0.15s ease-in-out; -o-transition: -o-transform 0.15s ease-in-out; transition: transform 0.15s ease-in-out; transition: transform 0.15s ease-in-out, -webkit-transform 0.15s ease-in-out, -o-transform 0.15s ease-in-out; -webkit-transition-timing-function: cubic-bezier(0.7, 0, 0.3, 1); -o-transition-timing-function: cubic-bezier(0.7, 0, 0.3, 1); transition-timing-function: cubic-bezier(0.7, 0, 0.3, 1); padding: 65px 0; } .sticky-header .mobile-menu .menu-wrp .nav-primary > div .nav > .menu-item-has-children > .sub-menu-wrap { background-color: #faf8f6; } .mobile-menu .menu-wrp .nav-primary > div .nav > .menu-item-has-children > .sub-menu-wrap.show-menu { -webkit-transform: translate3d(0, 0, 0); transform: translate3d(0, 0, 0); } .mobile-menu .menu-wrp .nav-primary > div .nav > .menu-item-has-children > .sub-menu-wrap > .sub-menu { overflow: auto; height: 100%; padding: 0; } .mobile-menu .menu-wrp .nav-primary > div .nav > .menu-item-has-children > .sub-menu-wrap > .sub-menu li a { padding-left: 76px; color: #023605; } .mobile-menu .menu-wrp .nav-primary > div .nav > .menu-item-has-children > .sub-menu-wrap > .sub-menu > .menu-item-has-children > .sub-menu-wrap { position: fixed; top: 0; left: 0; z-index: 7; -webkit-transform: translate3d(100%, 0, 0); transform: translate3d(100%, 0, 0); background-color: #faf8f6; width: 100%; height: 100%; will-change: transform; -webkit-transition: transform 0.15s ease-in-out; -o-transition: transform 0.15s ease-in-out; -webkit-transition: -webkit-transform 0.15s ease-in-out; transition: -webkit-transform 0.15s ease-in-out; -o-transition: -o-transform 0.15s ease-in-out; transition: transform 0.15s ease-in-out; transition: transform 0.15s ease-in-out, -webkit-transform 0.15s ease-in-out, -o-transform 0.15s ease-in-out; -webkit-transition-timing-function: cubic-bezier(0.7, 0, 0.3, 1); -o-transition-timing-function: cubic-bezier(0.7, 0, 0.3, 1); transition-timing-function: cubic-bezier(0.7, 0, 0.3, 1); padding: 65px 0; } .sticky-header .mobile-menu .menu-wrp .nav-primary > div .nav > .menu-item-has-children > .sub-menu-wrap > .sub-menu > .menu-item-has-children > .sub-menu-wrap { background-color: #faf8f6; } .mobile-menu .menu-wrp .nav-primary > div .nav > .menu-item-has-children > .sub-menu-wrap > .sub-menu > .menu-item-has-children > .sub-menu-wrap.show-menu { -webkit-transform: translate3d(0, 0, 0); transform: translate3d(0, 0, 0); } .mobile-menu .menu-wrp .nav-primary > div .nav > .menu-item-has-children > .sub-menu-wrap > .sub-menu > .menu-item-has-children > .sub-menu-wrap > .sub-menu { overflow: auto; height: 100%; padding: 0; } .mobile-menu .menu-wrp .nav-primary > div .nav > .menu-item-has-children > .sub-menu-wrap .return-link { color: #023605; display: block; padding: 16px 32px; padding-left: 76px; position: relative; z-index: 1; background-color: #faf8f6; cursor: pointer; } .sticky-header .mobile-menu .menu-wrp .nav-primary > div .nav > .menu-item-has-children > .sub-menu-wrap .return-link { background-color: #faf8f6; } .mobile-menu .menu-wrp .nav-primary > div .nav > .menu-item-has-children > .sub-menu-wrap .return-link::after { content: ""; -webkit-transform: translateY(-50%) rotate(-90deg); -o-transform: translateY(-50%) rotate(-90deg); transform: translateY(-50%) rotate(-90deg); background-color: #023605; -webkit-mask: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZpZXdCb3g9IjAgMCA0NDggNTEyIj48cGF0aCBmaWxsPSIjMDUyNTNjIiBkPSJNMjAxLjQgMTA1LjRjMTIuNS0xMi41IDMyLjgtMTIuNSA0NS4zIDBsMTkyIDE5MmMxMi41IDEyLjUgMTIuNSAzMi44IDAgNDUuM3MtMzIuOCAxMi41LTQ1LjMgMEwyMjQgMTczLjMgNTQuNiAzNDIuNmMtMTIuNSAxMi41LTMyLjggMTIuNS00NS4zIDBzLTEyLjUtMzIuOCAwLTQ1LjNsMTkyLTE5MnoiLz48L3N2Zz4=) no-repeat center; mask: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZpZXdCb3g9IjAgMCA0NDggNTEyIj48cGF0aCBmaWxsPSIjMDUyNTNjIiBkPSJNMjAxLjQgMTA1LjRjMTIuNS0xMi41IDMyLjgtMTIuNSA0NS4zIDBsMTkyIDE5MmMxMi41IDEyLjUgMTIuNSAzMi44IDAgNDUuM3MtMzIuOCAxMi41LTQ1LjMgMEwyMjQgMTczLjMgNTQuNiAzNDIuNmMtMTIuNSAxMi41LTMyLjggMTIuNS00NS4zIDBzLTEyLjUtMzIuOCAwLTQ1LjNsMTkyLTE5MnoiLz48L3N2Zz4=) no-repeat center; -webkit-mask-size: contain; mask-size: contain; position: absolute; width: 9px; height: 13px; z-index: 1; top: 50%; left: 36px; bottom: auto; right: auto; } .pre-footer { margin-bottom: -118px; margin-top: 75px; position: relative; z-index: 2; } @media (min-width: 576px) { .pre-footer { margin-bottom: -90px; } } @media (min-width: 1400px) { .pre-footer { margin-bottom: -127px; } } .error404 .pre-footer { margin-top: 0; } .pre-footer .pre-footer-wrp { background-color: #fff; -webkit-box-shadow: 5px 5px 30px rgba(0, 0, 0, 0.1019607843); box-shadow: 5px 5px 30px rgba(0, 0, 0, 0.1019607843); border-radius: 20px; max-width: 720px; padding: 50px 32px; margin-left: 20px; margin-right: 20px; } @media (min-width: 576px) { .pre-footer .pre-footer-wrp { padding: 40px 32px; } } @media (min-width: 768px) { .pre-footer .pre-footer-wrp { margin: 0 auto; } } @media (min-width: 1400px) { .pre-footer .pre-footer-wrp { padding: 72px 138px; max-width: 1088px; } } .pre-footer .pre-footer-wrp .content-wrapper-inner { color: #023605; text-align: center; font-size: 22px; line-height: 32px; font-weight: 900; } @media (min-width: 1400px) { .pre-footer .pre-footer-wrp .content-wrapper-inner { font-size: 34px; line-height: 32px; } } .pre-footer .pre-footer-wrp .content-wrapper-inner p { margin-top: 0; } .pre-footer .pre-footer-wrp .content-wrapper-inner a { margin-top: 5px; } @media (min-width: 1400px) { .pre-footer .pre-footer-wrp .content-wrapper-inner a { margin-top: 15px; } } /* stylelint-disable */ .footer { position: relative; z-index: 1; background-color: #faf8f6; color: #023605; text-align: center; } .footer .footer-top-container { padding-top: 182px; } @media (min-width: 1400px) { .footer .footer-top-container { padding-top: 230px; } } .footer .footer-top-container .container .footer-logo { padding-bottom: 40px; } @media (min-width: 992px) { .footer .footer-top-container .container .footer-logo { text-align: left; } } @media (min-width: 1200px) { .footer .footer-top-container .container .footer-logo { padding-bottom: 30px; } } .footer .footer-top-container .container .footer-logo .footer-logo-wrp { display: -webkit-box !important; display: -ms-flexbox !important; display: flex !important; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; } .footer .footer-top-container .container .footer-logo .footer-logo-wrp a { width: 146px; height: 146px; display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-align: center; -ms-flex-align: center; align-items: center; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; border-radius: 8px; background-color: #fff; } @media (min-width: 1400px) { .footer .footer-top-container .container .footer-logo .footer-logo-wrp a { width: 126px; height: 126px; } } .footer .footer-top-container .container .footer-logo .footer-logo-wrp a img { width: auto; } .footer .footer-top-container .container .footer-logo .footer-logo-wrp a img.default { opacity: 1; will-change: opacity; -webkit-transition: opacity 0.15s ease-in-out; -o-transition: opacity 0.15s ease-in-out; transition: opacity 0.15s ease-in-out; } .footer .footer-top-container .container .footer-top-content .social-media-wrp { margin-bottom: 50px; } @media (min-width: 1200px) { .footer .footer-top-container .container .footer-top-content .social-media-wrp { margin-bottom: 40px; } } .footer .footer-top-container .container .footer-top-content .footer-menu { margin-bottom: 50px; } @media (min-width: 1200px) { .footer .footer-top-container .container .footer-top-content .footer-menu { margin-bottom: 40px; } } .footer .footer-top-container .container .footer-top-content .footer-menu .footer-menu-wrp .nav { -webkit-box-orient: vertical; -webkit-box-direction: normal; -ms-flex-direction: column; flex-direction: column; -webkit-box-align: center; -ms-flex-align: center; align-items: center; } @media (min-width: 992px) { .footer .footer-top-container .container .footer-top-content .footer-menu .footer-menu-wrp .nav { -webkit-box-orient: horizontal; -webkit-box-direction: normal; -ms-flex-direction: row; flex-direction: row; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; } } .footer .footer-top-container .container .footer-top-content .footer-menu .footer-menu-wrp .nav .menu-item { padding-bottom: 28px; list-style: none; line-height: normal; } @media (min-width: 992px) { .footer .footer-top-container .container .footer-top-content .footer-menu .footer-menu-wrp .nav .menu-item { padding: 0; margin-right: 30px; } } @media (min-width: 1200px) { .footer .footer-top-container .container .footer-top-content .footer-menu .footer-menu-wrp .nav .menu-item { margin-right: 40px; } } .footer .footer-top-container .container .footer-top-content .footer-menu .footer-menu-wrp .nav .menu-item:last-child { padding-bottom: 0; margin-right: 0; } .footer .footer-top-container .container .footer-top-content .footer-menu .footer-menu-wrp .nav .menu-item a { color: #023605; font-weight: 700; font-size: 16px; position: relative; z-index: 1; will-change: color; -webkit-transition: color 0.15s ease-in-out; -o-transition: color 0.15s ease-in-out; transition: color 0.15s ease-in-out; } .footer .footer-top-container .container .footer-top-content .footer-menu .footer-menu-wrp .nav .menu-item a::after { content: ""; position: absolute; top: 100%; left: 0; z-index: 1; width: 0; height: 2px; background: #023605; will-change: width; -webkit-transition: width 0.15s ease-in-out; -o-transition: width 0.15s ease-in-out; transition: width 0.15s ease-in-out; } .footer .footer-top-container .container .footer-top-content .footer-menu .footer-menu-wrp .nav .menu-item a:hover { color: #023605; text-decoration: none; } .footer .footer-top-container .container .footer-top-content .footer-menu .footer-menu-wrp .nav .menu-item a:hover:after { width: 100%; } .footer .footer-top-container .container .footer-top-content .footer-location { margin-bottom: 50px; } @media (min-width: 1200px) { .footer .footer-top-container .container .footer-top-content .footer-location { margin-bottom: 40px; } } .footer .footer-top-container .container .footer-top-content .footer-location .location-item { margin-bottom: 25px; } @media (min-width: 992px) { .footer .footer-top-container .container .footer-top-content .footer-location .location-item { margin-bottom: 20px; } } @media (min-width: 1200px) { .footer .footer-top-container .container .footer-top-content .footer-location .location-item { margin-bottom: 30px; } } .footer .footer-top-container .container .footer-top-content .footer-location .location-item:last-child { margin-bottom: 0; } .footer .footer-top-container .container .footer-top-content .footer-location .location-item p { font-size: 16px; line-height: 32px; font-weight: 700; } .footer .footer-top-container .container .footer-top-content .footer-contact { margin-bottom: 50px; } @media (min-width: 1200px) { .footer .footer-top-container .container .footer-top-content .footer-contact { margin-bottom: 40px; } } .footer .footer-top-container .container .footer-top-content .footer-contact .contact-details .contact-detail-item { line-height: normal; margin-bottom: 25px; } @media (min-width: 1400px) { .footer .footer-top-container .container .footer-top-content .footer-contact .contact-details .contact-detail-item { margin-bottom: 20px; } } .footer .footer-top-container .container .footer-top-content .footer-contact .contact-details .contact-detail-item:last-child { margin-bottom: 0; } .footer .footer-top-container .container .footer-top-content .footer-contact .contact-details .contact-detail-item a { color: #023605; font-size: 16px; font-weight: 700; will-change: color; -webkit-transition: color 0.15s ease-in-out; -o-transition: color 0.15s ease-in-out; transition: color 0.15s ease-in-out; } .footer .footer-top-container .container .footer-top-content .footer-contact .contact-details .contact-detail-item a:hover { color: #023605; text-decoration: none; } @media (min-width: 992px) { .footer .footer-top-container .container .footer-top-content .footer-social-media { text-align: right; } } .footer .footer-top-container .container .footer-top-content .footer-social-media .footer-social-media-wrp { display: -webkit-box; display: -ms-flexbox; display: flex; -webkit-box-pack: center; -ms-flex-pack: center; justify-content: center; -ms-flex-wrap: wrap; flex-wrap: wrap; gap: 10px; } .footer .footer-top-container .container .footer-top-content .footer-social-media .footer-social-media-wrp .footer-social-media-item a { width: 40px; height: 40px; display: block; border-radius: 50%; background-color: #023605; position: relative; z-index: 1; will-change: background-color; -webkit-transition: background-color 0.15s ease-in-out; -o-transition: background-color 0.15s ease-in-out; transition: background-color 0.15s ease-in-out; } .footer .footer-top-container .container .footer-top-content .footer-social-media .footer-social-media-wrp .footer-social-media-item a::before { position: absolute; top: 50%; left: 50%; -webkit-transform: translate(-50%, -50%); -o-transform: translate(-50%, -50%); transform: translate(-50%, -50%); color: #faf8f6; font-size: 20px; will-change: color; -webkit-transition: color 0.15s ease-in-out; -o-transition: color 0.15s ease-in-out; transition: color 0.15s ease-in-out; } .footer .footer-top-container .container .footer-top-content .footer-social-media .footer-social-media-wrp .footer-social-media-item a:hover { background-color: #001401; } .footer .footer-top-container .container .footer-top-content .footer-social-media .footer-social-media-wrp .footer-social-media-item img { width: 100%; height: 100%; padding: 8px; -o-object-fit: contain; object-fit: contain; } .footer .footer-bottom-container { padding: 40px 0; border-top: 1px solid #faf8f6; } @media (min-width: 992px) { .footer .footer-bottom-container { padding: 20px 0; } } .footer .footer-bottom-container .enterprise-logo-wrp { display: -webkit-box; display: -ms-flexbox; display: flex; width: 100%; -ms-flex-pack: distribute; justify-content: space-around; -webkit-box-align: center; -ms-flex-align: center; align-items: center; margin-bottom: 40px; } @media (min-width: 992px) { .footer .footer-bottom-container .enterprise-logo-wrp { max-width: 235px; -webkit-box-pack: justify; -ms-flex-pack: justify; justify-content: space-between; margin-bottom: 0; } } .footer .footer-bottom-container .enterprise-logo-wrp .enterprise-logo-item { -webkit-box-flex: 0; -ms-flex: 0 0 auto; flex: 0 0 auto; } .footer .footer-bottom-container .footer-site-details { font-size: 12px; color: #a49f9f; } .footer .footer-bottom-container .footer-site-details a { text-decoration: underline; color: #a49f9f; will-change: color; -webkit-transition: color 0.15s ease-in-out; -o-transition: color 0.15s ease-in-out; transition: color 0.15s ease-in-out; } .footer .footer-bottom-container .footer-site-details a:hover { text-decoration: none; } .footer .footer-bottom-container .footer-copyright { text-align: center; margin-bottom: 40px; } @media (min-width: 992px) { .footer .footer-bottom-container .footer-copyright { text-align: left; margin-bottom: 0; } } .footer .footer-bottom-container .footer-copyright a { position: relative; z-index: 1; display: inline-block; margin-left: 10px; padding-left: 10px; } .footer .footer-bottom-container .footer-copyright a::after { content: ""; position: absolute; top: 7px; left: 0; z-index: 1; width: 2px; height: 50%; background-color: #faf8f6; will-change: color; -webkit-transition: color 0.15s ease-in-out; -o-transition: color 0.15s ease-in-out; transition: color 0.15s ease-in-out; } .footer .footer-bottom-container .footer-site-details { text-align: center; } @media (min-width: 992px) { .footer .footer-bottom-container .footer-site-details { text-align: right; } } .footer .footer-bottom-container .footer-site-details:first-child { position: relative; margin-right: 10px; } .footer .footer-bottom-container .footer-site-details:first-child::after { content: ""; position: absolute; top: 50%; right: -5px; -webkit-transform: translateY(-50%); -o-transform: translateY(-50%); transform: translateY(-50%); height: 12px; width: 1px; background-color: #a49f9f; } .footer .animation-wrp { display: none; position: absolute; top: 0; left: 0; width: 100%; height: 100%; z-index: -1; overflow: hidden; } .footer .animation-wrp .circle-object:nth-child(1) { right: -20px; top: 300px; } @media (min-width: 992px) { .footer .animation-wrp .circle-object:nth-child(1) { right: -25px; top: 128px; } } @media (min-width: 1400px) { .footer .animation-wrp .circle-object:nth-child(1) { right: -50px; top: 180px; } } .footer .animation-wrp .circle-solid-object:nth-child(2) { -webkit-transition-delay: 1s; -o-transition-delay: 1s; transition-delay: 1s; top: 400px; left: 85px; } @media (min-width: 992px) { .footer .animation-wrp .circle-solid-object:nth-child(2) { top: 200px; left: 280px; } } @media (min-width: 1400px) { .footer .animation-wrp .circle-solid-object:nth-child(2) { top: 280px; left: 380px; } } .footer .animation-wrp .circle-solid-object:nth-child(3) { right: 50px; bottom: 200px; } @media (min-width: 992px) { .footer .animation-wrp .circle-solid-object:nth-child(3) { right: 140px; bottom: 70px; } } @media (min-width: 1400px) { .footer .animation-wrp .circle-solid-object:nth-child(3) { bottom: 20px; right: 200px; } } .footer .animation-wrp .circle-object:nth-child(4) { top: 600px; left: -20px; } @media (min-width: 992px) { .footer .animation-wrp .circle-object:nth-child(4) { top: 400px; left: 10px; } } @media (min-width: 1400px) { .footer .animation-wrp .circle-object:nth-child(4) { left: -30px; top: 350px; } } .not-found-wrapper { padding: 50px 0 !important; } @media (min-width: 768px) { .not-found-wrapper { padding: 75px 0 !important; } } @media (min-width: 992px) { .not-found-wrapper { padding: 100px 0 !important; } } .not-found-wrapper .img-wrp { margin: 185px auto; margin-bottom: 50px; width: 210px; height: 92px; background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyMTEuMTMxIiBoZWlnaHQ9IjkyLjkzNSIgdmlld0JveD0iMCAwIDIxMS4xMzEgOTIuOTM1Ij4KICA8cGF0aCBpZD0iUGF0aF8xODAzNyIgZGF0YS1uYW1lPSJQYXRoIDE4MDM3IiBkPSJNNTguNTU2LDc0LjAzNWg5djE1LjhoLTl2MTguNzgzSDM4LjA3MVY4OS44MzlIMy44NDlMMi42MzMsNzcuMzE3LDM4LjA3MSwyMC4zdi0uMTgySDU4LjU1NlptLTM2LjQxMSwwSDM4LjA3MVY0Ni44TDM2Ljc5NCw0OC44N1pNMTM4LDcyLjQ1NHEwLDE3LjkzMi04LjA1NCwyNy42NTd0LTIyLjcsOS43MjZxLTE0Ljc3MSwwLTIyLjg1NS05Ljc4NnQtOC4wODQtMjcuNlY1Ni4yODZxMC0xNy45MzIsOC4wNTQtMjcuNjU3VDEwNy4xMjMsMTguOXExNC43MSwwLDIyLjc5NSw5Ljc4NlQxMzgsNTYuMzQ2Wk0xMTcuNTE4LDUzLjY3MnEwLTkuNTQzLTIuNDkyLTE0LjI1NGE4LjMzLDguMzMsMCwwLDAtNy45LTQuNzExLDguMTMzLDguMTMzLDAsMCwwLTcuNjg5LDQuMzc3cS0yLjQsNC4zNzctMi41ODMsMTMuMjUxVjc0Ljk0N3EwLDkuOTA4LDIuNDkyLDE0LjVhOC4zNjIsOC4zNjIsMCwwLDAsNy45LDQuNTg5LDguMjUsOC4yNSwwLDAsMCw3LjcyLTQuNDY4cTIuNDkyLTQuNDY4LDIuNTUzLTE0LjAxMVptODUuMjIxLDIwLjM2M2g5djE1LjhoLTl2MTguNzgzSDE4Mi4yNTRWODkuODM5SDE0OC4wMzJsLTEuMjE2LTEyLjUyMkwxODIuMjU0LDIwLjN2LS4xODJoMjAuNDg1Wm0tMzYuNDExLDBoMTUuOTI2VjQ2LjhsLTEuMjc2LDIuMDY3WiIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoLTEuNjA1IC0xNy45MDIpIiBmaWxsPSJub25lIiBzdHJva2U9IiMwMjM2MDUiIHN0cm9rZS13aWR0aD0iMiIvPgo8L3N2Zz4K); background-size: contain; background-repeat: no-repeat; } .not-found-wrapper .content-wrp p { font-size: 16px; line-height: 28px; } .not-found-wrapper .content-wrp a { margin-top: 35px; margin-bottom: 185px; } .not-found-wrapper .not-found-animation-wrp1 { display: none; position: absolute; margin-left: 12%; top: 135px; } .not-found-wrapper .not-found-animation-wrp1 .circle-object.color-secondary { border-color: #fef4ec; } .not-found-wrapper .not-found-animation-wrp1 .triangle-object { width: 80px; height: 65px; border-left: 40px solid transparent; border-right: 40px solid transparent; border-bottom: 65px solid #fff; } .not-found-wrapper .not-found-animation-wrp1 .triangle-object.color-secondary { border-bottom-color: #fef4ec; right: -56vw; top: -75px; } .not-found-wrapper .not-found-animation-wrp2 { display: none; position: absolute; margin-left: 20%; top: 700px; } .not-found-wrapper .not-found-animation-wrp2 .triangle-object { width: 80px; height: 65px; border-left: 40px solid transparent; border-right: 40px solid transparent; border-bottom: 65px solid #f9e7d9; } .not-found-wrapper .not-found-animation-wrp2 .circle-object.color-secondary { right: -65vw; top: -75px; } @media (min-width: 768px) { .not-found-wrapper .not-found-animation-wrp2 { display: none; top: 550px; } } body#tinymce { margin: 12px !important; } /*# sourceMappingURL=main.css.map*/